diff --git a/.circleci/config.yml b/.circleci/config.yml index abbf617c2dd2..079a93429da7 100644 --- a/.circleci/config.yml +++ b/.circleci/config.yml @@ -37,11 +37,11 @@ jobs: docker: - image: node:10-buster shell: /usr/bin/env bash -euo pipefail -c - working_directory: /src + working_directory: /go/src/github.com/hashicorp/vault steps: - checkout - restore_cache: - key: yarn-lock-v1-{{ checksum "ui/yarn.lock" }} + key: yarn-lock-v6-{{ checksum "ui/yarn.lock" }} - run: command: | cd ui @@ -49,40 +49,32 @@ jobs: npm rebuild node-sass name: Install UI dependencies - save_cache: - key: yarn-lock-v1-{{ checksum "ui/yarn.lock" }} + key: yarn-lock-v6-{{ checksum "ui/yarn.lock" }} paths: - ui/node_modules - go-mod-download: - docker: - - image: golang:1.12.12-buster - shell: /usr/bin/env bash -euo pipefail -c - working_directory: /src - steps: - - add_ssh_keys: - fingerprints: - - c6:96:98:82:dc:04:6c:39:dd:ac:83:05:e3:15:1c:98 - - checkout - - restore_cache: - key: go-sum-v1-{{ checksum "go.sum" }} - - run: - command: go mod download - name: Download Go modules - - run: - command: go mod verify - name: Verify checksums of Go modules - - save_cache: - key: go-sum-v1-{{ checksum "go.sum" }} - paths: - - /go/pkg/mod build-go-dev: - docker: - - image: golang:1.12.12-buster + machine: true shell: /usr/bin/env bash -euo pipefail -c - working_directory: /src + working_directory: /go/src/github.com/hashicorp/vault steps: + - run: + command: | + [ -n "$GO_VERSION" ] || { echo "You must set GO_VERSION"; exit 1; } + # Install Go + curl -sSLO "https://dl.google.com/go/go${GO_VERSION}.linux-amd64.tar.gz" + sudo rm -rf /usr/local/go + sudo tar -C /usr/local -xzf "go${GO_VERSION}.linux-amd64.tar.gz" + rm -f "go${GO_VERSION}.linux-amd64.tar.gz" + GOPATH="/go" + mkdir $GOPATH 2>/dev/null || { sudo mkdir $GOPATH && sudo chmod 777 $GOPATH; } + echo "export GOPATH='$GOPATH'" >> "$BASH_ENV" + echo "export PATH='$PATH:$GOPATH/bin:/usr/local/go/bin'" >> "$BASH_ENV" + + echo "$ go version" + go version + name: Setup Go + working_directory: ~/ - checkout - - restore_cache: - key: go-sum-v1-{{ checksum "go.sum" }} - attach_workspace: at: . - run: @@ -98,16 +90,22 @@ jobs: paths: - bin root: . + environment: + - CIRCLECI_CLI_VERSION: 0.1.5546 + - GO_TAGS: '' + - GO_VERSION: 1.12.12 + - GO111MODULE: 'off' + - GOTESTSUM_VERSION: 0.3.3 test-ui: docker: - image: node:10-buster shell: /usr/bin/env bash -euo pipefail -c - working_directory: /src + working_directory: /go/src/github.com/hashicorp/vault resource_class: medium+ steps: - checkout - restore_cache: - key: yarn-lock-v1-{{ checksum "ui/yarn.lock" }} + key: yarn-lock-v6-{{ checksum "ui/yarn.lock" }} - attach_workspace: at: . - run: @@ -140,12 +138,12 @@ jobs: docker: - image: node:10-buster shell: /usr/bin/env bash -euo pipefail -c - working_directory: /src + working_directory: /go/src/github.com/hashicorp/vault resource_class: medium+ steps: - checkout - restore_cache: - key: yarn-lock-v1-{{ checksum "ui/yarn.lock" }} + key: yarn-lock-v6-{{ checksum "ui/yarn.lock" }} - attach_workspace: at: . - run: @@ -157,28 +155,30 @@ jobs: test-go: machine: true shell: /usr/bin/env bash -euo pipefail -c - working_directory: ~/src + working_directory: /go/src/github.com/hashicorp/vault parallelism: 2 steps: - - checkout - run: command: | - sudo mkdir /go - sudo chown -R circleci:circleci /go - name: Allow circleci user to restore Go modules cache - - restore_cache: - key: go-sum-v1-{{ checksum "go.sum" }} - - run: - command: | - set -x - + [ -n "$GO_VERSION" ] || { echo "You must set GO_VERSION"; exit 1; } # Install Go curl -sSLO "https://dl.google.com/go/go${GO_VERSION}.linux-amd64.tar.gz" sudo rm -rf /usr/local/go sudo tar -C /usr/local -xzf "go${GO_VERSION}.linux-amd64.tar.gz" rm -f "go${GO_VERSION}.linux-amd64.tar.gz" - export GOPATH=/go - export PATH="${PATH}:${GOPATH}/bin:/usr/local/go/bin" + GOPATH="/go" + mkdir $GOPATH 2>/dev/null || { sudo mkdir $GOPATH && sudo chmod 777 $GOPATH; } + echo "export GOPATH='$GOPATH'" >> "$BASH_ENV" + echo "export PATH='$PATH:$GOPATH/bin:/usr/local/go/bin'" >> "$BASH_ENV" + + echo "$ go version" + go version + name: Setup Go + working_directory: ~/ + - checkout + - run: + command: | + set -x # Install CircleCI CLI curl -sSL \ @@ -222,33 +222,36 @@ jobs: path: test-results environment: - CIRCLECI_CLI_VERSION: 0.1.5546 - - GO_TAGS: null + - GO_TAGS: '' - GO_VERSION: 1.12.12 + - GO111MODULE: 'off' - GOTESTSUM_VERSION: 0.3.3 test-go-race: machine: true shell: /usr/bin/env bash -euo pipefail -c - working_directory: ~/src + working_directory: /go/src/github.com/hashicorp/vault steps: - - checkout - - run: - command: | - sudo mkdir /go - sudo chown -R circleci:circleci /go - name: Allow circleci user to restore Go modules cache - - restore_cache: - key: go-sum-v1-{{ checksum "go.sum" }} - run: command: | - set -x - + [ -n "$GO_VERSION" ] || { echo "You must set GO_VERSION"; exit 1; } # Install Go curl -sSLO "https://dl.google.com/go/go${GO_VERSION}.linux-amd64.tar.gz" sudo rm -rf /usr/local/go sudo tar -C /usr/local -xzf "go${GO_VERSION}.linux-amd64.tar.gz" rm -f "go${GO_VERSION}.linux-amd64.tar.gz" - export GOPATH=/go - export PATH="${PATH}:${GOPATH}/bin:/usr/local/go/bin" + GOPATH="/go" + mkdir $GOPATH 2>/dev/null || { sudo mkdir $GOPATH && sudo chmod 777 $GOPATH; } + echo "export GOPATH='$GOPATH'" >> "$BASH_ENV" + echo "export PATH='$PATH:$GOPATH/bin:/usr/local/go/bin'" >> "$BASH_ENV" + + echo "$ go version" + go version + name: Setup Go + working_directory: ~/ + - checkout + - run: + command: | + set -x # Install CircleCI CLI curl -sSL \ @@ -292,8 +295,9 @@ jobs: path: test-results environment: - CIRCLECI_CLI_VERSION: 0.1.5546 - - GO_TAGS: null + - GO_TAGS: '' - GO_VERSION: 1.12.12 + - GO111MODULE: 'off' - GOTESTSUM_VERSION: 0.3.3 workflows: ci: @@ -302,12 +306,9 @@ workflows: - install-ui-dependencies: requires: - pre-flight-checks - - go-mod-download: - requires: - - pre-flight-checks - build-go-dev: requires: - - go-mod-download + - pre-flight-checks - test-ui: requires: - install-ui-dependencies @@ -340,14 +341,6 @@ workflows: # command: | # set -x # -# # Install Go -# curl -sSLO \"https://dl.google.com/go/go${GO_VERSION}.linux-amd64.tar.gz\" -# sudo rm -rf /usr/local/go -# sudo tar -C /usr/local -xzf \"go${GO_VERSION}.linux-amd64.tar.gz\" -# rm -f \"go${GO_VERSION}.linux-amd64.tar.gz\" -# export GOPATH=/go -# export PATH=\"${PATH}:${GOPATH}/bin:/usr/local/go/bin\" -# # # Install CircleCI CLI # curl -sSL \\ # \"https://github.com/CircleCI-Public/circleci-cli/releases/download/v${CIRCLECI_CLI_VERSION}/circleci-cli_${CIRCLECI_CLI_VERSION}_linux_amd64.tar.gz\" \\ @@ -384,52 +377,69 @@ workflows: # ${package_names} # name: Run Go tests # no_output_timeout: 20m -# restore_go_cache: -# steps: -# - restore_cache: -# key: go-sum-v1-{{ checksum \"go.sum\" }} # restore_yarn_cache: # steps: # - restore_cache: -# key: yarn-lock-v1-{{ checksum \"ui/yarn.lock\" }} -# save_go_cache: -# steps: -# - save_cache: -# key: go-sum-v1-{{ checksum \"go.sum\" }} -# paths: -# - /go/pkg/mod +# key: yarn-lock-v6-{{ checksum \"ui/yarn.lock\" }} # save_yarn_cache: # steps: # - save_cache: -# key: yarn-lock-v1-{{ checksum \"ui/yarn.lock\" }} +# key: yarn-lock-v6-{{ checksum \"ui/yarn.lock\" }} # paths: # - ui/node_modules +# setup-go: +# description: | +# Ensure the right version of Go is installed and set GOPATH to $HOME/go. +# steps: +# - run: +# command: | +# [ -n \"$GO_VERSION\" ] || { echo \"You must set GO_VERSION\"; exit 1; } +# # Install Go +# curl -sSLO \"https://dl.google.com/go/go${GO_VERSION}.linux-amd64.tar.gz\" +# sudo rm -rf /usr/local/go +# sudo tar -C /usr/local -xzf \"go${GO_VERSION}.linux-amd64.tar.gz\" +# rm -f \"go${GO_VERSION}.linux-amd64.tar.gz\" +# GOPATH=\"/go\" +# mkdir $GOPATH 2>/dev/null || { sudo mkdir $GOPATH && sudo chmod 777 $GOPATH; } +# echo \"export GOPATH='$GOPATH'\" >> \"$BASH_ENV\" +# echo \"export PATH='$PATH:$GOPATH/bin:/usr/local/go/bin'\" >> \"$BASH_ENV\" +# +# echo \"$ go version\" +# go version +# name: Setup Go +# working_directory: ~/ # executors: -# go: +# alpine: # docker: -# - image: golang:1.12.12-buster -# shell: /usr/bin/env bash -euo pipefail -c -# working_directory: /src +# - image: alpine:3.10.2 +# shell: /bin/sh +# working_directory: /go/src/github.com/hashicorp/vault # go-machine: # environment: # CIRCLECI_CLI_VERSION: 0.1.5546 -# GO_TAGS: null +# GO_TAGS: \"\" # GO_VERSION: 1.12.12 +# GO111MODULE: \"off\" # GOTESTSUM_VERSION: 0.3.3 # machine: true # shell: /usr/bin/env bash -euo pipefail -c -# working_directory: ~/src +# working_directory: /go/src/github.com/hashicorp/vault # node: # docker: # - image: node:10-buster # shell: /usr/bin/env bash -euo pipefail -c -# working_directory: /src +# working_directory: /go/src/github.com/hashicorp/vault +# python: +# docker: +# - image: python:3-alpine +# shell: /usr/bin/env bash -euo pipefail -c +# working_directory: /go/src/github.com/hashicorp/vault # jobs: # build-go-dev: -# executor: go +# executor: go-machine # steps: +# - setup-go # - checkout -# - restore_go_cache # - attach_workspace: # at: . # - run: @@ -445,21 +455,6 @@ workflows: # paths: # - bin # root: . -# go-mod-download: -# executor: go -# steps: -# - add_ssh_keys: -# fingerprints: -# - c6:96:98:82:dc:04:6c:39:dd:ac:83:05:e3:15:1c:98 -# - checkout -# - restore_go_cache -# - run: -# command: go mod download -# name: Download Go modules -# - run: -# command: go mod verify -# name: Verify checksums of Go modules -# - save_go_cache # install-ui-dependencies: # executor: node # steps: @@ -505,13 +500,8 @@ workflows: # executor: go-machine # parallelism: 2 # steps: +# - setup-go # - checkout -# - run: -# command: | -# sudo mkdir /go -# sudo chown -R circleci:circleci /go -# name: Allow circleci user to restore Go modules cache -# - restore_go_cache # - go_test # - store_artifacts: # path: test-results @@ -520,13 +510,8 @@ workflows: # test-go-race: # executor: go-machine # steps: +# - setup-go # - checkout -# - run: -# command: | -# sudo mkdir /go -# sudo chown -R circleci:circleci /go -# name: Allow circleci user to restore Go modules cache -# - restore_go_cache # - go_test: # extra_flags: -race # - store_artifacts: @@ -584,9 +569,8 @@ workflows: # references: # cache: # go-sum: go-sum-v1-{{ checksum \"go.sum\" }} -# yarn-lock: yarn-lock-v1-{{ checksum \"ui/yarn.lock\" }} +# yarn-lock: yarn-lock-v6-{{ checksum \"ui/yarn.lock\" }} # images: -# go: golang:1.12.12-buster # node: node:10-buster # version: 2.1 # workflows: @@ -596,12 +580,9 @@ workflows: # - install-ui-dependencies: # requires: # - pre-flight-checks -# - go-mod-download: -# requires: -# - pre-flight-checks # - build-go-dev: # requires: -# - go-mod-download +# - pre-flight-checks # - test-ui: # requires: # - install-ui-dependencies diff --git a/.circleci/config/@config.yml b/.circleci/config/@config.yml index 9b0bedfba187..4975bfa4993a 100644 --- a/.circleci/config/@config.yml +++ b/.circleci/config/@config.yml @@ -3,12 +3,11 @@ version: 2.1 references: images: - go: &GOLANG_IMAGE golang:1.12.12-buster # Pin Go to patch version (ex: 1.2.3) node: &NODE_IMAGE node:10-buster # Pin Node.js to major version (ex: 10) cache: go-sum: &GO_SUM_CACHE_KEY go-sum-v1-{{ checksum "go.sum" }} - yarn-lock: &YARN_LOCK_CACHE_KEY yarn-lock-v1-{{ checksum "ui/yarn.lock" }} + yarn-lock: &YARN_LOCK_CACHE_KEY yarn-lock-v6-{{ checksum "ui/yarn.lock" }} # more commands defined in commands/ commands: @@ -22,35 +21,30 @@ commands: key: *YARN_LOCK_CACHE_KEY paths: - ui/node_modules - restore_go_cache: - steps: - - restore_cache: - key: *GO_SUM_CACHE_KEY - save_go_cache: - steps: - - save_cache: - key: *GO_SUM_CACHE_KEY - paths: - - /go/pkg/mod executors: - go: - docker: - - image: *GOLANG_IMAGE - shell: /usr/bin/env bash -euo pipefail -c - working_directory: /src go-machine: machine: true + shell: /usr/bin/env bash -euo pipefail -c environment: + GO111MODULE: "off" CIRCLECI_CLI_VERSION: 0.1.5546 # Pin CircleCI CLI to patch version (ex: 1.2.3) GO_VERSION: 1.12.12 # Pin Go to patch version (ex: 1.2.3) GOTESTSUM_VERSION: 0.3.3 # Pin gotestsum to patch version (ex: 1.2.3) - GO_TAGS: - shell: /usr/bin/env bash -euo pipefail -c - working_directory: ~/src + GO_TAGS: "" + working_directory: /go/src/github.com/hashicorp/vault node: docker: - image: *NODE_IMAGE shell: /usr/bin/env bash -euo pipefail -c - working_directory: /src - + working_directory: /go/src/github.com/hashicorp/vault + python: + docker: + - image: python:3-alpine + shell: /usr/bin/env bash -euo pipefail -c + working_directory: /go/src/github.com/hashicorp/vault + alpine: + docker: + - image: alpine:3.10.2 + shell: /bin/sh + working_directory: /go/src/github.com/hashicorp/vault diff --git a/.circleci/config/commands/go_test.yml b/.circleci/config/commands/go_test.yml index d756e13525d0..d6f76266278f 100644 --- a/.circleci/config/commands/go_test.yml +++ b/.circleci/config/commands/go_test.yml @@ -10,14 +10,6 @@ steps: command: | set -x - # Install Go - curl -sSLO "https://dl.google.com/go/go${GO_VERSION}.linux-amd64.tar.gz" - sudo rm -rf /usr/local/go - sudo tar -C /usr/local -xzf "go${GO_VERSION}.linux-amd64.tar.gz" - rm -f "go${GO_VERSION}.linux-amd64.tar.gz" - export GOPATH=/go - export PATH="${PATH}:${GOPATH}/bin:/usr/local/go/bin" - # Install CircleCI CLI curl -sSL \ "https://github.com/CircleCI-Public/circleci-cli/releases/download/v${CIRCLECI_CLI_VERSION}/circleci-cli_${CIRCLECI_CLI_VERSION}_linux_amd64.tar.gz" \ diff --git a/.circleci/config/commands/setup-go.yml b/.circleci/config/commands/setup-go.yml new file mode 100644 index 000000000000..fcfe4e88e988 --- /dev/null +++ b/.circleci/config/commands/setup-go.yml @@ -0,0 +1,21 @@ +--- +description: > + Ensure the right version of Go is installed and set GOPATH to $HOME/go. +steps: + - run: + working_directory: ~/ + name: Setup Go + command: | + [ -n "$GO_VERSION" ] || { echo "You must set GO_VERSION"; exit 1; } + # Install Go + curl -sSLO "https://dl.google.com/go/go${GO_VERSION}.linux-amd64.tar.gz" + sudo rm -rf /usr/local/go + sudo tar -C /usr/local -xzf "go${GO_VERSION}.linux-amd64.tar.gz" + rm -f "go${GO_VERSION}.linux-amd64.tar.gz" + GOPATH="/go" + mkdir $GOPATH 2>/dev/null || { sudo mkdir $GOPATH && sudo chmod 777 $GOPATH; } + echo "export GOPATH='$GOPATH'" >> "$BASH_ENV" + echo "export PATH='$PATH:$GOPATH/bin:/usr/local/go/bin'" >> "$BASH_ENV" + + echo "$ go version" + go version diff --git a/.circleci/config/jobs/build-go-dev.yml b/.circleci/config/jobs/build-go-dev.yml index 34057ced5ee8..3193d0be6d30 100644 --- a/.circleci/config/jobs/build-go-dev.yml +++ b/.circleci/config/jobs/build-go-dev.yml @@ -1,7 +1,7 @@ -executor: go +executor: go-machine steps: + - setup-go - checkout - - restore_go_cache - attach_workspace: at: . - run: diff --git a/.circleci/config/jobs/go-mod-download.yml b/.circleci/config/jobs/go-mod-download.yml deleted file mode 100644 index adfaf0ad8043..000000000000 --- a/.circleci/config/jobs/go-mod-download.yml +++ /dev/null @@ -1,15 +0,0 @@ -executor: go -steps: - - add_ssh_keys: - fingerprints: - # "CircleCI SSH Checkout" SSH key associated with hashicorp-ci GitHub user - - "c6:96:98:82:dc:04:6c:39:dd:ac:83:05:e3:15:1c:98" - - checkout - - restore_go_cache - - run: - name: Download Go modules - command: go mod download - - run: - name: Verify checksums of Go modules - command: go mod verify - - save_go_cache diff --git a/.circleci/config/jobs/test-go-race.yml b/.circleci/config/jobs/test-go-race.yml index 87dcc0ce272c..86cb97a66994 100644 --- a/.circleci/config/jobs/test-go-race.yml +++ b/.circleci/config/jobs/test-go-race.yml @@ -1,12 +1,7 @@ executor: go-machine steps: + - setup-go - checkout - - run: - name: Allow circleci user to restore Go modules cache - command: | - sudo mkdir /go - sudo chown -R circleci:circleci /go - - restore_go_cache - go_test: extra_flags: "-race" - store_artifacts: diff --git a/.circleci/config/jobs/test-go.yml b/.circleci/config/jobs/test-go.yml index 188176449253..84f9c4844013 100644 --- a/.circleci/config/jobs/test-go.yml +++ b/.circleci/config/jobs/test-go.yml @@ -1,13 +1,8 @@ executor: go-machine parallelism: 2 steps: + - setup-go - checkout - - run: - name: Allow circleci user to restore Go modules cache - command: | - sudo mkdir /go - sudo chown -R circleci:circleci /go - - restore_go_cache - go_test - store_artifacts: path: test-results diff --git a/.circleci/config/workflows/ci.yml b/.circleci/config/workflows/ci.yml index f33cbdac47ae..8716556ccaab 100644 --- a/.circleci/config/workflows/ci.yml +++ b/.circleci/config/workflows/ci.yml @@ -3,12 +3,9 @@ jobs: - install-ui-dependencies: requires: - pre-flight-checks - - go-mod-download: - requires: - - pre-flight-checks - build-go-dev: requires: - - go-mod-download + - pre-flight-checks - test-ui: requires: - install-ui-dependencies diff --git a/CHANGELOG.md b/CHANGELOG.md index 1b5066c8fbaf..bce37e330ec6 100644 --- a/CHANGELOG.md +++ b/CHANGELOG.md @@ -1,49 +1,81 @@ -## 1.3 (Unreleased) +## 1.3 (unreleased) + +CHANGES: + +* Secondary cluster activation: There has been a change to the way that activating + performance and DR secondary clusters works when using public keys for + encryption of the parameters rather than a wrapping token. This flow was + experimental and never documented. It is now officially supported and + documented but is not backwards compatible with older Vault releases. + +IMPROVEMENTS: + +* metrics: Upgrade DataDog library to improve performance [GH-7794] + +BUG FIXES: + +* api: Fix Go API using lease revocation via URL instead of body [GH-7777] +* core: Don't allow registering a non-root zero TTL token lease. This is purely + defense in depth as the lease would be revoked immediately anyways, but + there's no real reason to allow registration. [GH-7524] +* ui: Ensure that items in the top navigation link to pages that users have access to. [GH-7590] + +## 1.3-beta1 (October 30th, 2019) + +CHANGES: + + * Cluster cipher suites: On its cluster port, Vault will no longer advertise + the full TLS 1.2 cipher suite list by default. Although this port is only + used for Vault-to-Vault communication and would always pick a strong cipher, + it could cause false flags on port scanners and other security utilities + that assumed insecure ciphers were being used. The previous behavior can be + achieved by setting the value of the (undocumented) `cluster_cipher_suites` + config flag to `tls12`. FEATURES: - * **Recovery Mode**: Vault server can be brought up in recovery mode to resolve - outages caused due to data store being in bad state. This is a privileged mode - that allows `sys/raw` API calls to perform surgical corrections to the data - store. Bad storage state can be caused by bugs. However, this is usually - observed when known (and fixed) bugs are hit by older versions of Vault. - * **Stackdriver Metrics Sink**: Vault can now send metrics to - [Stackdriver](https://cloud.google.com/stackdriver/). See the [configuration - documentation](https://www.vaultproject.io/docs/config/index.html) for - details. [GH-6957] - * **Transit**: Signing and verification is now supported with the P-384 - (secp384r1) and P-521 (secp521r1) ECDSA curves [GH-7551] - * **Transit**: Encryption and decryption is now supported via AES128-GCM96 - [GH-7555] * **Vault Debug**: A new top-level subcommand, `debug`, is added that allows operators to retrieve debugging information related to a particular Vault node. Operators can use this simple workflow to capture triaging information, which can then be consumed programmatically or by support and engineering teams. It has the abilitity to probe for config, host, metrics, pprof, server status, and replication status. + * **Recovery Mode**: Vault server can be brought up in recovery mode to resolve + outages caused due to data store being in bad state. This is a privileged mode + that allows `sys/raw` API calls to perform surgical corrections to the data + store. Bad storage state can be caused by bugs. However, this is usually + observed when known (and fixed) bugs are hit by older versions of Vault. + * **Entropy Augmentation (Enterprise)**: Vault now supports sourcing entropy from + external source for critical security parameters. Currently an HSM that + supports PKCS#11 is the only supported source. * **Active Directory Secret Check-In/Check-Out**: In the Active Directory secrets engine, users or applications can check out a service account for use, and its password will be rotated when it's checked back in. - * **New UI Features** The UI now supports managing users and groups for the Userpass, Cert, Okta, and Radius auth methods. - * **Vault Agent Template** Vault Agent now supports rendering templates containing Vault secrets to disk, similar to Consul Template [GH-7652] + * **Vault Agent Template** Vault Agent now supports rendering templates containing + Vault secrets to disk, similar to Consul Template [GH-7652] + * **Transit Key Type Support**: Signing and verification is now supported with the P-384 + (secp384r1) and P-521 (secp521r1) ECDSA curves [GH-7551] and encryption and + decryption is now supported via AES128-GCM96 [GH-7555] + * **SSRF Protection for Vault Agent**: Vault Agent has a configuration option to + require a specific header beffore allowing requests [GH-7627] + * **AWS Auth Method Root Rotation**: The credential used by the AWS auth method can + now be rotated, to ensure that only Vault knows the credentials it is using [GH-7131] + * **New UI Features** The UI now supports managing users and groups for the + Userpass, Cert, Okta, and Radius auth methods. * **Shamir with Stored Master Key** The on disk format for Shamir seals has changed, allowing for a secondary cluster using Shamir downstream from a primary cluster - using AutoUnseal. [GH-7694] - -CHANGES: - - * auth/aws: If a custom `sts_endpoint` is configured, Vault Agent and the CLI - should provide the corresponding region via the `region` parameter (which - already existed as a CLI parameter, and has now been added to Agent). The - automatic region detection added to the CLI and Agent in 1.2 has been removed. - * sys/seal-status now has a `storage_type` field denoting what type of storage - the cluster is configured to use - * Vault Agent now has a new optional `require_request_header` option per - listener. If the option is set, each incoming request must have a - `X-Vault-Request: true` header entry. [GH-7627] + using Auto Unseal. [GH-7694] + * **Stackdriver Metrics Sink**: Vault can now send metrics to + [Stackdriver](https://cloud.google.com/stackdriver/). See the [configuration + documentation](https://www.vaultproject.io/docs/config/index.html) for + details. [GH-6957] + * **Filtered Paths Replication** Based on the predecessor Filtered Mount Replication, + Filtered Paths Replication allows now filtering of namespaces in addition to mounts. IMPROVEMENTS: + * agent: Add ability to set the TLS SNI name used by Agent [GH-7519] + * api: Allow setting a function to control retry behavior [GH-7331] * auth/jwt: The redirect callback host may now be specified for CLI logins [JWT-71] * auth/jwt: Bound claims may now contain boolean values [JWT-73] @@ -51,21 +83,35 @@ IMPROVEMENTS: * core: Exit ScanView if context has been cancelled [GH-7419] * core: re-encrypt barrier and recovery keys if the unseal key is updated [GH-7493] + * core: Don't advertise the full set of TLS 1.2 cipher suites on the cluster + port, even though only strong ciphers were used [GH-7487] * core (enterprise): Add background seal re-wrap * core/metrics: Add config parameter to allow unauthenticated sys/metrics - access. [GH-7550] + access. [GH-7550] * replication (enterprise): Write-Ahead-Log entries will not duplicate the data belonging to the encompassing physical entries of the transaction, thereby improving the performance and storage capacity. + * replication (enterprise): Added more replication metrics + * replication (enterprise): Reindex process now compares subpages for a more + accurate indexing process. + * replication (enterprise): Reindex API now accepts a new `skip_flush` parameter + indicating all the changes should not be flushed while the tree is locked. * secrets/aws: The root config can now be read [GH-7245] + * secrets/aws: Role paths may now contain the '@' character [GH-7553] + * secrets/database/cassandra: Add ability to skip verfication of connection [GH-7614] * storage/azure: Add config parameter to Azure storage backend to allow specifying the ARM endpoint [GH-7567] * storage/cassandra: Improve storage efficiency by eliminating unnecessary copies of value data [GH-7199] + * storage/raft: Improve raft write performance by utilizing FSM Batching [GH-7527] + * storage/raft: Add support for non-voter nodes [GH-7634] * sys: Add a new `sys/host-info` endpoint for querying information about the host [GH-7330] * sys: Add a new set of endpoints under `sys/pprof/` that allows profiling information to be extracted [GH-7473] + * sys: Add endpoint that counts the total number of active identity entities [GH-7541] + * sys: `sys/seal-status` now has a `storage_type` field denoting what type of storage + the cluster is configured to use * sys/config: Add a new endpoint under `sys/config/state/sanitized` that returns the configuration state of the server. It excludes config values from `storage`, `ha_storage`, and `seal` stanzas and some values @@ -76,8 +122,6 @@ IMPROVEMENTS: * sys: Add a new `sys/internal/counters/tokens` endpoint, that counts the total number of active service token accessors in the shared token storage. [GH-7541] - * sys: Add a new `sys/internal/counters/entities` endpoint, that counts the - total number of active identity entities. [GH-7541] BUG FIXES: @@ -91,6 +135,10 @@ BUG FIXES: * identity (enterprise): Fixed identity case sensitive loading in secondary cluster [GH-7327] * raft: Fixed VAULT_CLUSTER_ADDR env being ignored at startup [GH-7619] + * secret/pki: Don't allow duplicate SAN names in issued certs [GH-7605] + * sys/health: Pay attention to the values provided for `standbyok` and + `perfstandbyok` rather than simply using their presence as a key to flip on + that behavior [GH-7323] * ui: using the `wrapped_token` query param will work with `redirect_to` and will automatically log in as intended [GH-7398] * ui: fix an error when initializing from the UI using PGP keys [GH-7542] @@ -108,6 +156,7 @@ CHANGES: automatic region detection added to the CLI and Agent in 1.2 has been removed. IMPROVEMENTS: + * cli: Ignore existing token during CLI login [GH-7508] * core: Log proxy settings from environment on startup [GH-7528] * core: Cache whether we've been initialized to reduce load on storage [GH-7549] @@ -122,6 +171,7 @@ BUG FIXES: * identity: Add required field `response_types_supported` to identity token `.well-known/openid-configuration` response [GH-7533] * identity: Fixed nil pointer panic when merging entities [GH-7712] + * secrets/azure: Fix panic that could occur if client retries timeout [GH-7793] * secrets/database: Fix bug in combined DB secrets engine that can result in writes to static-roles endpoints timing out [GH-7518] * secrets/pki: Improve tidy to continue when value is nil [GH-7589] @@ -129,13 +179,13 @@ BUG FIXES: viewed in the UI [GH-7504] * cli: Command timeouts are now always specified solely by the `VAULT_CLIENT_TIMEOUT` value. [GH-7469] - + ## 1.2.3 (September 12, 2019) FEATURES: * **Oracle Cloud (OCI) Integration**: Vault now support using Oracle Cloud for - storage, auto unseal, and authentication. + storage, auto unseal, and authentication. IMPROVEMENTS: @@ -155,6 +205,7 @@ BUG FIXES: * auth/jwt: Fix an error where newer (v1.2) token_* configuration parameters were not being applied to tokens generated using the OIDC login flow [JWT-67] + * raft: Fix an incorrect JSON tag on `leader_ca_cert` in the join request [GH-7393] * seal/transit: Allow using Vault Agent for transit seal operations [GH-7441] * storage/couchdb: Fix a file descriptor leak [GH-7345] * ui: Fix a bug where the status menu would disappear when trying to revoke a @@ -2932,1553 +2983,4 @@ DEPRECATIONS/CHANGES: to hundreds of thousands, or millions), this will significantly improve Vault startup time since leases associated with these certificates will not have to be loaded; however note that it also means that revocation of a - token used to issue certificates will no longer add these certificates to a - CRL. If this behavior is desired or needed, consider keeping leases enabled - and ensuring lifetimes are reasonable, and issue long-lived certificates via - a different role with leases disabled. - -FEATURES: - - * **Replication (Enterprise)**: Vault Enterprise now has support for creating - a multi-datacenter replication set between clusters. The current replication - offering is based on an asynchronous primary/secondary (1:N) model that - replicates static data while keeping dynamic data (leases, tokens) - cluster-local, focusing on horizontal scaling for high-throughput and - high-fanout deployments. - * **Response Wrapping & Replication in the Vault Enterprise UI**: Vault - Enterprise UI now supports looking up and rotating response wrapping tokens, - as well as creating tokens with arbitrary values inside. It also now - supports replication functionality, enabling the configuration of a - replication set in the UI. - * **Expanded Access Control Policies**: Access control policies can now - specify allowed and denied parameters -- and, optionally, their values -- to - control what a client can and cannot submit during an API call. Policies can - also specify minimum/maximum response wrapping TTLs to both enforce the use - of response wrapping and control the duration of resultant wrapping tokens. - See the [policies concepts - page](https://www.vaultproject.io/docs/concepts/policies.html) for more - information. - * **SSH Backend As Certificate Authority**: The SSH backend can now be - configured to sign host and user certificates. Each mount of the backend - acts as an independent signing authority. The CA key pair can be configured - for each mount and the public key is accessible via an unauthenticated API - call; additionally, the backend can generate a public/private key pair for - you. We recommend using separate mounts for signing host and user - certificates. - -IMPROVEMENTS: - - * api/request: Passing username and password information in API request - [GH-2469] - * audit: Logging the token's use count with authentication response and - logging the remaining uses of the client token with request [GH-2437] - * auth/approle: Support for restricting the number of uses on the tokens - issued [GH-2435] - * auth/aws-ec2: AWS EC2 auth backend now supports constraints for VPC ID, - Subnet ID and Region [GH-2407] - * auth/ldap: Use the value of the `LOGNAME` or `USER` env vars for the - username if not explicitly set on the command line when authenticating - [GH-2154] - * audit: Support adding a configurable prefix (such as `@cee`) before each - line [GH-2359] - * core: Canonicalize list operations to use a trailing slash [GH-2390] - * core: Add option to disable caching on a per-mount level [GH-2455] - * core: Add ability to require valid client certs in listener config [GH-2457] - * physical/dynamodb: Implement a session timeout to avoid having to use - recovery mode in the case of an unclean shutdown, which makes HA much safer - [GH-2141] - * secret/pki: O (Organization) values can now be set to role-defined values - for issued/signed certificates [GH-2369] - * secret/pki: Certificates issued/signed from PKI backend do not generate - leases by default [GH-2403] - * secret/pki: When using DER format, still return the private key type - [GH-2405] - * secret/pki: Add an intermediate to the CA chain even if it lacks an - authority key ID [GH-2465] - * secret/pki: Add role option to use CSR SANs [GH-2489] - * secret/ssh: SSH backend as CA to sign user and host certificates [GH-2208] - * secret/ssh: Support reading of SSH CA public key from `config/ca` endpoint - and also return it when CA key pair is generated [GH-2483] - -BUG FIXES: - - * audit: When auditing headers use case-insensitive comparisons [GH-2362] - * auth/aws-ec2: Return role period in seconds and not nanoseconds [GH-2374] - * auth/okta: Fix panic if user had no local groups and/or policies set - [GH-2367] - * command/server: Fix parsing of redirect address when port is not mentioned - [GH-2354] - * physical/postgresql: Fix listing returning incorrect results if there were - multiple levels of children [GH-2393] - -## 0.6.5 (February 7th, 2017) - -FEATURES: - - * **Okta Authentication**: A new Okta authentication backend allows you to use - Okta usernames and passwords to authenticate to Vault. If provided with an - appropriate Okta API token, group membership can be queried to assign - policies; users and groups can be defined locally as well. - * **RADIUS Authentication**: A new RADIUS authentication backend allows using - a RADIUS server to authenticate to Vault. Policies can be configured for - specific users or for any authenticated user. - * **Exportable Transit Keys**: Keys in `transit` can now be marked as - `exportable` at creation time. This allows a properly ACL'd user to retrieve - the associated signing key, encryption key, or HMAC key. The `exportable` - value is returned on a key policy read and cannot be changed, so if a key is - marked `exportable` it will always be exportable, and if it is not it will - never be exportable. - * **Batch Transit Operations**: `encrypt`, `decrypt` and `rewrap` operations - in the transit backend now support processing multiple input items in one - call, returning the output of each item in the response. - * **Configurable Audited HTTP Headers**: You can now specify headers that you - want to have included in each audit entry, along with whether each header - should be HMAC'd or kept plaintext. This can be useful for adding additional - client or network metadata to the audit logs. - * **Transit Backend UI (Enterprise)**: Vault Enterprise UI now supports the transit - backend, allowing creation, viewing and editing of named keys as well as using - those keys to perform supported transit operations directly in the UI. - * **Socket Audit Backend** A new socket audit backend allows audit logs to be sent - through TCP, UDP, or UNIX Sockets. - -IMPROVEMENTS: - - * auth/aws-ec2: Add support for cross-account auth using STS [GH-2148] - * auth/aws-ec2: Support issuing periodic tokens [GH-2324] - * auth/github: Support listing teams and users [GH-2261] - * auth/ldap: Support adding policies to local users directly, in addition to - local groups [GH-2152] - * command/server: Add ability to select and prefer server cipher suites - [GH-2293] - * core: Add a nonce to unseal operations as a check (useful mostly for - support, not as a security principle) [GH-2276] - * duo: Added ability to supply extra context to Duo pushes [GH-2118] - * physical/consul: Add option for setting consistency mode on Consul gets - [GH-2282] - * physical/etcd: Full v3 API support; code will autodetect which API version - to use. The v3 code path is significantly less complicated and may be much - more stable. [GH-2168] - * secret/pki: Allow specifying OU entries in generated certificate subjects - [GH-2251] - * secret mount ui (Enterprise): the secret mount list now shows all mounted - backends even if the UI cannot browse them. Additional backends can now be - mounted from the UI as well. - -BUG FIXES: - - * auth/token: Fix regression in 0.6.4 where using token store roles as a - blacklist (with only `disallowed_policies` set) would not work in most - circumstances [GH-2286] - * physical/s3: Page responses in client so list doesn't truncate [GH-2224] - * secret/cassandra: Stop a connection leak that could occur on active node - failover [GH-2313] - * secret/pki: When using `sign-verbatim`, don't require a role and use the - CSR's common name [GH-2243] - -## 0.6.4 (December 16, 2016) - -SECURITY: - -Further details about these security issues can be found in the 0.6.4 upgrade -guide. - - * `default` Policy Privilege Escalation: If a parent token did not have the - `default` policy attached to its token, it could still create children with - the `default` policy. This is no longer allowed (unless the parent has - `sudo` capability for the creation path). In most cases this is low severity - since the access grants in the `default` policy are meant to be access - grants that are acceptable for all tokens to have. - * Leases Not Expired When Limited Use Token Runs Out of Uses: When using - limited-use tokens to create leased secrets, if the limited-use token was - revoked due to running out of uses (rather than due to TTL expiration or - explicit revocation) it would fail to revoke the leased secrets. These - secrets would still be revoked when their TTL expired, limiting the severity - of this issue. An endpoint has been added (`auth/token/tidy`) that can - perform housekeeping tasks on the token store; one of its tasks can detect - this situation and revoke the associated leases. - -FEATURES: - - * **Policy UI (Enterprise)**: Vault Enterprise UI now supports viewing, - creating, and editing policies. - -IMPROVEMENTS: - - * http: Vault now sets a `no-store` cache control header to make it more - secure in setups that are not end-to-end encrypted [GH-2183] - -BUG FIXES: - - * auth/ldap: Don't panic if dialing returns an error and starttls is enabled; - instead, return the error [GH-2188] - * ui (Enterprise): Submitting an unseal key now properly resets the - form so a browser refresh isn't required to continue. - -## 0.6.3 (December 6, 2016) - -DEPRECATIONS/CHANGES: - - * Request size limitation: A maximum request size of 32MB is imposed to - prevent a denial of service attack with arbitrarily large requests [GH-2108] - * LDAP denies passwordless binds by default: In new LDAP mounts, or when - existing LDAP mounts are rewritten, passwordless binds will be denied by - default. The new `deny_null_bind` parameter can be set to `false` to allow - these. [GH-2103] - * Any audit backend activated satisfies conditions: Previously, when a new - Vault node was taking over service in an HA cluster, all audit backends were - required to be loaded successfully to take over active duty. This behavior - now matches the behavior of the audit logging system itself: at least one - audit backend must successfully be loaded. The server log contains an error - when this occurs. This helps keep a Vault HA cluster working when there is a - misconfiguration on a standby node. [GH-2083] - -FEATURES: - - * **Web UI (Enterprise)**: Vault Enterprise now contains a built-in web UI - that offers access to a number of features, including init/unsealing/sealing, - authentication via userpass or LDAP, and K/V reading/writing. The capability - set of the UI will be expanding rapidly in further releases. To enable it, - set `ui = true` in the top level of Vault's configuration file and point a - web browser at your Vault address. - * **Google Cloud Storage Physical Backend**: You can now use GCS for storing - Vault data [GH-2099] - -IMPROVEMENTS: - - * auth/github: Policies can now be assigned to users as well as to teams - [GH-2079] - * cli: Set the number of retries on 500 down to 0 by default (no retrying). It - can be very confusing to users when there is a pause while the retries - happen if they haven't explicitly set it. With request forwarding the need - for this is lessened anyways. [GH-2093] - * core: Response wrapping is now allowed to be specified by backend responses - (requires backends gaining support) [GH-2088] - * physical/consul: When announcing service, use the scheme of the Vault server - rather than the Consul client [GH-2146] - * secret/consul: Added listing functionality to roles [GH-2065] - * secret/postgresql: Added `revocation_sql` parameter on the role endpoint to - enable customization of user revocation SQL statements [GH-2033] - * secret/transit: Add listing of keys [GH-1987] - -BUG FIXES: - - * api/unwrap, command/unwrap: Increase compatibility of `unwrap` command with - Vault 0.6.1 and older [GH-2014] - * api/unwrap, command/unwrap: Fix error when no client token exists [GH-2077] - * auth/approle: Creating the index for the role_id properly [GH-2004] - * auth/aws-ec2: Handle the case of multiple upgrade attempts when setting the - instance-profile ARN [GH-2035] - * auth/ldap: Avoid leaking connections on login [GH-2130] - * command/path-help: Use the actual error generated by Vault rather than - always using 500 when there is a path help error [GH-2153] - * command/ssh: Use temporary file for identity and ensure its deletion before - the command returns [GH-2016] - * cli: Fix error printing values with `-field` if the values contained - formatting directives [GH-2109] - * command/server: Don't say mlock is supported on OSX when it isn't. [GH-2120] - * core: Fix bug where a failure to come up as active node (e.g. if an audit - backend failed) could lead to deadlock [GH-2083] - * physical/mysql: Fix potential crash during setup due to a query failure - [GH-2105] - * secret/consul: Fix panic on user error [GH-2145] - -## 0.6.2 (October 5, 2016) - -DEPRECATIONS/CHANGES: - - * Convergent Encryption v2: New keys in `transit` using convergent mode will - use a new nonce derivation mechanism rather than require the user to supply - a nonce. While not explicitly increasing security, it minimizes the - likelihood that a user will use the mode improperly and impact the security - of their keys. Keys in convergent mode that were created in v0.6.1 will - continue to work with the same mechanism (user-supplied nonce). - * `etcd` HA off by default: Following in the footsteps of `dynamodb`, the - `etcd` storage backend now requires that `ha_enabled` be explicitly - specified in the configuration file. The backend currently has known broken - HA behavior, so this flag discourages use by default without explicitly - enabling it. If you are using this functionality, when upgrading, you should - set `ha_enabled` to `"true"` *before* starting the new versions of Vault. - * Default/Max lease/token TTLs are now 32 days: In previous versions of Vault - the default was 30 days, but moving it to 32 days allows some operations - (e.g. reauthenticating, renewing, etc.) to be performed via a monthly cron - job. - * AppRole Secret ID endpoints changed: Secret ID and Secret ID accessors are - no longer part of request URLs. The GET and DELETE operations are now moved - to new endpoints (`/lookup` and `/destroy`) which consumes the input from - the body and not the URL. - * AppRole requires at least one constraint: previously it was sufficient to - turn off all AppRole authentication constraints (secret ID, CIDR block) and - use the role ID only. It is now required that at least one additional - constraint is enabled. Existing roles are unaffected, but any new roles or - updated roles will require this. - * Reading wrapped responses from `cubbyhole/response` is deprecated. The - `sys/wrapping/unwrap` endpoint should be used instead as it provides - additional security, auditing, and other benefits. The ability to read - directly will be removed in a future release. - * Request Forwarding is now on by default: in 0.6.1 this required toggling on, - but is now enabled by default. This can be disabled via the - `"disable_clustering"` parameter in Vault's - [config](https://www.vaultproject.io/docs/config/index.html), or per-request - with the `X-Vault-No-Request-Forwarding` header. - * In prior versions a bug caused the `bound_iam_role_arn` value in the - `aws-ec2` authentication backend to actually use the instance profile ARN. - This has been corrected, but as a result there is a behavior change. To - match using the instance profile ARN, a new parameter - `bound_iam_instance_profile_arn` has been added. Existing roles will - automatically transfer the value over to the correct parameter, but the next - time the role is updated, the new meanings will take effect. - -FEATURES: - - * **Secret ID CIDR Restrictions in `AppRole`**: Secret IDs generated under an - approle can now specify a list of CIDR blocks from where the requests to - generate secret IDs should originate from. If an approle already has CIDR - restrictions specified, the CIDR restrictions on the secret ID should be a - subset of those specified on the role [GH-1910] - * **Initial Root Token PGP Encryption**: Similar to `generate-root`, the root - token created at initialization time can now be PGP encrypted [GH-1883] - * **Support Chained Intermediate CAs in `pki`**: The `pki` backend now allows, - when a CA cert is being supplied as a signed root or intermediate, a trust - chain of arbitrary length. The chain is returned as a parameter at - certificate issue/sign time and is retrievable independently as well. - [GH-1694] - * **Response Wrapping Enhancements**: There are new endpoints to look up - response wrapped token parameters; wrap arbitrary values; rotate wrapping - tokens; and unwrap with enhanced validation. In addition, list operations - can now be response-wrapped. [GH-1927] - * **Transit Features**: The `transit` backend now supports generating random - bytes and SHA sums; HMACs; and signing and verification functionality using - EC keys (P-256 curve) - -IMPROVEMENTS: - - * api: Return error when an invalid (as opposed to incorrect) unseal key is - submitted, rather than ignoring it [GH-1782] - * api: Add method to call `auth/token/create-orphan` endpoint [GH-1834] - * api: Rekey operation now redirects from standbys to master [GH-1862] - * audit/file: Sending a `SIGHUP` to Vault now causes Vault to close and - re-open the log file, making it easier to rotate audit logs [GH-1953] - * auth/aws-ec2: EC2 instances can get authenticated by presenting the identity - document and its SHA256 RSA digest [GH-1961] - * auth/aws-ec2: IAM bound parameters on the aws-ec2 backend will perform a - prefix match instead of exact match [GH-1943] - * auth/aws-ec2: Added a new constraint `bound_iam_instance_profile_arn` to - refer to IAM instance profile ARN and fixed the earlier `bound_iam_role_arn` - to refer to IAM role ARN instead of the instance profile ARN [GH-1913] - * auth/aws-ec2: Backend generates the nonce by default and clients can - explicitly disable reauthentication by setting empty nonce [GH-1889] - * auth/token: Added warnings if tokens and accessors are used in URLs [GH-1806] - * command/format: The `format` flag on select CLI commands takes `yml` as an - alias for `yaml` [GH-1899] - * core: Allow the size of the read cache to be set via the config file, and - change the default value to 1MB (from 32KB) [GH-1784] - * core: Allow single and two-character path parameters for most places - [GH-1811] - * core: Allow list operations to be response-wrapped [GH-1814] - * core: Provide better protection against timing attacks in Shamir code - [GH-1877] - * core: Unmounting/disabling backends no longer returns an error if the mount - didn't exist. This is line with elsewhere in Vault's API where `DELETE` is - an idempotent operation. [GH-1903] - * credential/approle: At least one constraint is required to be enabled while - creating and updating a role [GH-1882] - * secret/cassandra: Added consistency level for use with roles [GH-1931] - * secret/mysql: SQL for revoking user can be configured on the role [GH-1914] - * secret/transit: Use HKDF (RFC 5869) as the key derivation function for new - keys [GH-1812] - * secret/transit: Empty plaintext values are now allowed [GH-1874] - -BUG FIXES: - - * audit: Fix panic being caused by some values logging as underlying Go types - instead of formatted strings [GH-1912] - * auth/approle: Fixed panic on deleting approle that doesn't exist [GH-1920] - * auth/approle: Not letting secret IDs and secret ID accessors to get logged - in plaintext in audit logs [GH-1947] - * auth/aws-ec2: Allow authentication if the underlying host is in a bad state - but the instance is running [GH-1884] - * auth/token: Fixed metadata getting missed out from token lookup response by - gracefully handling token entry upgrade [GH-1924] - * cli: Don't error on newline in token file [GH-1774] - * core: Pass back content-type header for forwarded requests [GH-1791] - * core: Fix panic if the same key was given twice to `generate-root` [GH-1827] - * core: Fix potential deadlock on unmount/remount [GH-1793] - * physical/file: Remove empty directories from the `file` storage backend [GH-1821] - * physical/zookeeper: Remove empty directories from the `zookeeper` storage - backend and add a fix to the `file` storage backend's logic [GH-1964] - * secret/aws: Added update operation to `aws/sts` path to consider `ttl` - parameter [39b75c6] - * secret/aws: Mark STS secrets as non-renewable [GH-1804] - * secret/cassandra: Properly store session for re-use [GH-1802] - * secret/ssh: Fix panic when revoking SSH dynamic keys [GH-1781] - -## 0.6.1 (August 22, 2016) - -DEPRECATIONS/CHANGES: - - * Once the active node is 0.6.1, standby nodes must also be 0.6.1 in order to - connect to the HA cluster. We recommend following our [general upgrade - instructions](https://www.vaultproject.io/docs/install/upgrade.html) in - addition to 0.6.1-specific upgrade instructions to ensure that this is not - an issue. - * Status codes for sealed/uninitialized Vaults have changed to `503`/`501` - respectively. See the [version-specific upgrade - guide](https://www.vaultproject.io/docs/install/upgrade-to-0.6.1.html) for - more details. - * Root tokens (tokens with the `root` policy) can no longer be created except - by another root token or the `generate-root` endpoint. - * Issued certificates from the `pki` backend against new roles created or - modified after upgrading will contain a set of default key usages. - * The `dynamodb` physical data store no longer supports HA by default. It has - some non-ideal behavior around failover that was causing confusion. See the - [documentation](https://www.vaultproject.io/docs/config/index.html#ha_enabled) - for information on enabling HA mode. It is very important that this - configuration is added _before upgrading_. - * The `ldap` backend no longer searches for `memberOf` groups as part of its - normal flow. Instead, the desired group filter must be specified. This fixes - some errors and increases speed for directories with different structures, - but if this behavior has been relied upon, ensure that you see the upgrade - notes _before upgrading_. - * `app-id` is now deprecated with the addition of the new AppRole backend. - There are no plans to remove it, but we encourage using AppRole whenever - possible, as it offers enhanced functionality and can accommodate many more - types of authentication paradigms. - -FEATURES: - - * **AppRole Authentication Backend**: The `approle` backend is a - machine-oriented authentication backend that provides a similar concept to - App-ID while adding many missing features, including a pull model that - allows for the backend to generate authentication credentials rather than - requiring operators or other systems to push credentials in. It should be - useful in many more situations than App-ID. The inclusion of this backend - deprecates App-ID. [GH-1426] - * **Request Forwarding**: Vault servers can now forward requests to each other - rather than redirecting clients. This feature is off by default in 0.6.1 but - will be on by default in the next release. See the [HA concepts - page](https://www.vaultproject.io/docs/concepts/ha.html) for information on - enabling and configuring it. [GH-443] - * **Convergent Encryption in `Transit`**: The `transit` backend now supports a - convergent encryption mode where the same plaintext will produce the same - ciphertext. Although very useful in some situations, this has potential - security implications, which are mostly mitigated by requiring the use of - key derivation when convergent encryption is enabled. See [the `transit` - backend - documentation](https://www.vaultproject.io/docs/secrets/transit/index.html) - for more details. [GH-1537] - * **Improved LDAP Group Filters**: The `ldap` auth backend now uses templates - to define group filters, providing the capability to support some - directories that could not easily be supported before (especially specific - Active Directory setups with nested groups). [GH-1388] - * **Key Usage Control in `PKI`**: Issued certificates from roles created or - modified after upgrading contain a set of default key usages for increased - compatibility with OpenVPN and some other software. This set can be changed - when writing a role definition. Existing roles are unaffected. [GH-1552] - * **Request Retrying in the CLI and Go API**: Requests that fail with a `5xx` - error code will now retry after a backoff. The maximum total number of - retries (including disabling this functionality) can be set with an - environment variable. See the [environment variable - documentation](https://www.vaultproject.io/docs/commands/environment.html) - for more details. [GH-1594] - * **Service Discovery in `vault init`**: The new `-auto` option on `vault init` - will perform service discovery using Consul. When only one node is discovered, - it will be initialized and when more than one node is discovered, they will - be output for easy selection. See `vault init --help` for more details. [GH-1642] - * **MongoDB Secret Backend**: Generate dynamic unique MongoDB database - credentials based on configured roles. Sponsored by - [CommerceHub](http://www.commercehub.com/). [GH-1414] - * **Circonus Metrics Integration**: Vault can now send metrics to - [Circonus](http://www.circonus.com/). See the [configuration - documentation](https://www.vaultproject.io/docs/config/index.html) for - details. [GH-1646] - -IMPROVEMENTS: - - * audit: Added a unique identifier to each request which will also be found in - the request portion of the response. [GH-1650] - * auth/aws-ec2: Added a new constraint `bound_account_id` to the role - [GH-1523] - * auth/aws-ec2: Added a new constraint `bound_iam_role_arn` to the role - [GH-1522] - * auth/aws-ec2: Added `ttl` field for the role [GH-1703] - * auth/ldap, secret/cassandra, physical/consul: Clients with `tls.Config` - have the minimum TLS version set to 1.2 by default. This is configurable. - * auth/token: Added endpoint to list accessors [GH-1676] - * auth/token: Added `disallowed_policies` option to token store roles [GH-1681] - * auth/token: `root` or `sudo` tokens can now create periodic tokens via - `auth/token/create`; additionally, the same token can now be periodic and - have an explicit max TTL [GH-1725] - * build: Add support for building on Solaris/Illumos [GH-1726] - * cli: Output formatting in the presence of warnings in the response object - [GH-1533] - * cli: `vault auth` command supports a `-path` option to take in the path at - which the auth backend is enabled, thereby allowing authenticating against - different paths using the command options [GH-1532] - * cli: `vault auth -methods` will now display the config settings of the mount - [GH-1531] - * cli: `vault read/write/unwrap -field` now allows selecting token response - fields [GH-1567] - * cli: `vault write -field` now allows selecting wrapped response fields - [GH-1567] - * command/status: Version information and cluster details added to the output - of `vault status` command [GH-1671] - * core: Response wrapping is now enabled for login endpoints [GH-1588] - * core: The duration of leadership is now exported via events through - telemetry [GH-1625] - * core: `sys/capabilities-self` is now accessible as part of the `default` - policy [GH-1695] - * core: `sys/renew` is now accessible as part of the `default` policy [GH-1701] - * core: Unseal keys will now be returned in both hex and base64 forms, and - either can be used [GH-1734] - * core: Responses from most `/sys` endpoints now return normal `api.Secret` - structs in addition to the values they carried before. This means that - response wrapping can now be used with most authenticated `/sys` operations - [GH-1699] - * physical/etcd: Support `ETCD_ADDR` env var for specifying addresses [GH-1576] - * physical/consul: Allowing additional tags to be added to Consul service - registration via `service_tags` option [GH-1643] - * secret/aws: Listing of roles is supported now [GH-1546] - * secret/cassandra: Add `connect_timeout` value for Cassandra connection - configuration [GH-1581] - * secret/mssql,mysql,postgresql: Reading of connection settings is supported - in all the sql backends [GH-1515] - * secret/mysql: Added optional maximum idle connections value to MySQL - connection configuration [GH-1635] - * secret/mysql: Use a combination of the role name and token display name in - generated user names and allow the length to be controlled [GH-1604] - * secret/{cassandra,mssql,mysql,postgresql}: SQL statements can now be passed - in via one of four ways: a semicolon-delimited string, a base64-delimited - string, a serialized JSON string array, or a base64-encoded serialized JSON - string array [GH-1686] - * secret/ssh: Added `allowed_roles` to vault-ssh-helper's config and returning - role name as part of response of `verify` API - * secret/ssh: Added passthrough of command line arguments to `ssh` [GH-1680] - * sys/health: Added version information to the response of health status - endpoint [GH-1647] - * sys/health: Cluster information isbe returned as part of health status when - Vault is unsealed [GH-1671] - * sys/mounts: MountTable data is compressed before serializing to accommodate - thousands of mounts [GH-1693] - * website: The [token - concepts](https://www.vaultproject.io/docs/concepts/tokens.html) page has - been completely rewritten [GH-1725] - -BUG FIXES: - - * auth/aws-ec2: Added a nil check for stored whitelist identity object - during renewal [GH-1542] - * auth/cert: Fix panic if no client certificate is supplied [GH-1637] - * auth/token: Don't report that a non-expiring root token is renewable, as - attempting to renew it results in an error [GH-1692] - * cli: Don't retry a command when a redirection is received [GH-1724] - * core: Fix regression causing status codes to be `400` in most non-5xx error - cases [GH-1553] - * core: Fix panic that could occur during a leadership transition [GH-1627] - * physical/postgres: Remove use of prepared statements as this causes - connection multiplexing software to break [GH-1548] - * physical/consul: Multiple Vault nodes on the same machine leading to check ID - collisions were resulting in incorrect health check responses [GH-1628] - * physical/consul: Fix deregistration of health checks on exit [GH-1678] - * secret/postgresql: Check for existence of role before attempting deletion - [GH-1575] - * secret/postgresql: Handle revoking roles that have privileges on sequences - [GH-1573] - * secret/postgresql(,mysql,mssql): Fix incorrect use of database over - transaction object which could lead to connection exhaustion [GH-1572] - * secret/pki: Fix parsing CA bundle containing trailing whitespace [GH-1634] - * secret/pki: Fix adding email addresses as SANs [GH-1688] - * secret/pki: Ensure that CRL values are always UTC, per RFC [GH-1727] - * sys/seal-status: Fixed nil Cluster object while checking seal status [GH-1715] - -## 0.6.0 (June 14th, 2016) - -SECURITY: - - * Although `sys/revoke-prefix` was intended to revoke prefixes of secrets (via - lease IDs, which incorporate path information) and - `auth/token/revoke-prefix` was intended to revoke prefixes of tokens (using - the tokens' paths and, since 0.5.2, role information), in implementation - they both behaved exactly the same way since a single component in Vault is - responsible for managing lifetimes of both, and the type of the tracked - lifetime was not being checked. The end result was that either endpoint - could revoke both secret leases and tokens. We consider this a very minor - security issue as there are a number of mitigating factors: both endpoints - require `sudo` capability in addition to write capability, preventing - blanket ACL path globs from providing access; both work by using the prefix - to revoke as a part of the endpoint path, allowing them to be properly - ACL'd; and both are intended for emergency scenarios and users should - already not generally have access to either one. In order to prevent - confusion, we have simply removed `auth/token/revoke-prefix` in 0.6, and - `sys/revoke-prefix` will be meant for both leases and tokens instead. - -DEPRECATIONS/CHANGES: - - * `auth/token/revoke-prefix` has been removed. See the security notice for - details. [GH-1280] - * Vault will now automatically register itself as the `vault` service when - using the `consul` backend and will perform its own health checks. See - the Consul backend documentation for information on how to disable - auto-registration and service checks. - * List operations that do not find any keys now return a `404` status code - rather than an empty response object [GH-1365] - * CA certificates issued from the `pki` backend no longer have associated - leases, and any CA certs already issued will ignore revocation requests from - the lease manager. This is to prevent CA certificates from being revoked - when the token used to issue the certificate expires; it was not be obvious - to users that they need to ensure that the token lifetime needed to be at - least as long as a potentially very long-lived CA cert. - -FEATURES: - - * **AWS EC2 Auth Backend**: Provides a secure introduction mechanism for AWS - EC2 instances allowing automated retrieval of Vault tokens. Unlike most - Vault authentication backends, this backend does not require first deploying - or provisioning security-sensitive credentials (tokens, username/password, - client certificates, etc). Instead, it treats AWS as a Trusted Third Party - and uses the cryptographically signed dynamic metadata information that - uniquely represents each EC2 instance. [Vault - Enterprise](https://www.hashicorp.com/vault.html) customers have access to a - turnkey client that speaks the backend API and makes access to a Vault token - easy. - * **Response Wrapping**: Nearly any response within Vault can now be wrapped - inside a single-use, time-limited token's cubbyhole, taking the [Cubbyhole - Authentication - Principles](https://www.hashicorp.com/blog/vault-cubbyhole-principles.html) - mechanism to its logical conclusion. Retrieving the original response is as - simple as a single API command or the new `vault unwrap` command. This makes - secret distribution easier and more secure, including secure introduction. - * **Azure Physical Backend**: You can now use Azure blob object storage as - your Vault physical data store [GH-1266] - * **Swift Physical Backend**: You can now use Swift blob object storage as - your Vault physical data store [GH-1425] - * **Consul Backend Health Checks**: The Consul backend will automatically - register a `vault` service and perform its own health checking. By default - the active node can be found at `active.vault.service.consul` and all with - standby nodes are `standby.vault.service.consul`. Sealed vaults are marked - critical and are not listed by default in Consul's service discovery. See - the documentation for details. [GH-1349] - * **Explicit Maximum Token TTLs**: You can now set explicit maximum TTLs on - tokens that do not honor changes in the system- or mount-set values. This is - useful, for instance, when the max TTL of the system or the `auth/token` - mount must be set high to accommodate certain needs but you want more - granular restrictions on tokens being issued directly from the Token - authentication backend at `auth/token`. [GH-1399] - * **Non-Renewable Tokens**: When creating tokens directly through the token - authentication backend, you can now specify in both token store roles and - the API whether or not a token should be renewable, defaulting to `true`. - * **RabbitMQ Secret Backend**: Vault can now generate credentials for - RabbitMQ. Vhosts and tags can be defined within roles. [GH-788] - -IMPROVEMENTS: - - * audit: Add the DisplayName value to the copy of the Request object embedded - in the associated Response, to match the original Request object [GH-1387] - * audit: Enable auditing of the `seal` and `step-down` commands [GH-1435] - * backends: Remove most `root`/`sudo` paths in favor of normal ACL mechanisms. - A particular exception are any current MFA paths. A few paths in `token` and - `sys` also require `root` or `sudo`. [GH-1478] - * command/auth: Restore the previous authenticated token if the `auth` command - fails to authenticate the provided token [GH-1233] - * command/write: `-format` and `-field` can now be used with the `write` - command [GH-1228] - * core: Add `mlock` support for FreeBSD, OpenBSD, and Darwin [GH-1297] - * core: Don't keep lease timers around when tokens are revoked [GH-1277] - * core: If using the `disable_cache` option, caches for the policy store and - the `transit` backend are now disabled as well [GH-1346] - * credential/cert: Renewal requests are rejected if the set of policies has - changed since the token was issued [GH-477] - * credential/cert: Check CRLs for specific non-CA certs configured in the - backend [GH-1404] - * credential/ldap: If `groupdn` is not configured, skip searching LDAP and - only return policies for local groups, plus a warning [GH-1283] - * credential/ldap: `vault list` support for users and groups [GH-1270] - * credential/ldap: Support for the `memberOf` attribute for group membership - searching [GH-1245] - * credential/userpass: Add list support for users [GH-911] - * credential/userpass: Remove user configuration paths from requiring sudo, in - favor of normal ACL mechanisms [GH-1312] - * credential/token: Sanitize policies and add `default` policies in appropriate - places [GH-1235] - * credential/token: Setting the renewable status of a token is now possible - via `vault token-create` and the API. The default is true, but tokens can be - specified as non-renewable. [GH-1499] - * secret/aws: Use chain credentials to allow environment/EC2 instance/shared - providers [GH-307] - * secret/aws: Support for STS AssumeRole functionality [GH-1318] - * secret/consul: Reading consul access configuration supported. The response - will contain non-sensitive information only [GH-1445] - * secret/pki: Added `exclude_cn_from_sans` field to prevent adding the CN to - DNS or Email Subject Alternate Names [GH-1220] - * secret/pki: Added list support for certificates [GH-1466] - * sys/capabilities: Enforce ACL checks for requests that query the capabilities - of a token on a given path [GH-1221] - * sys/health: Status information can now be retrieved with `HEAD` [GH-1509] - -BUG FIXES: - - * command/read: Fix panic when using `-field` with a non-string value [GH-1308] - * command/token-lookup: Fix TTL showing as 0 depending on how a token was - created. This only affected the value shown at lookup, not the token - behavior itself. [GH-1306] - * command/various: Tell the JSON decoder to not convert all numbers to floats; - fixes some various places where numbers were showing up in scientific - notation - * command/server: Prioritized `devRootTokenID` and `devListenAddress` flags - over their respective env vars [GH-1480] - * command/ssh: Provided option to disable host key checking. The automated - variant of `vault ssh` command uses `sshpass` which was failing to handle - host key checking presented by the `ssh` binary. [GH-1473] - * core: Properly persist mount-tuned TTLs for auth backends [GH-1371] - * core: Don't accidentally crosswire SIGINT to the reload handler [GH-1372] - * credential/github: Make organization comparison case-insensitive during - login [GH-1359] - * credential/github: Fix panic when renewing a token created with some earlier - versions of Vault [GH-1510] - * credential/github: The token used to log in via `vault auth` can now be - specified in the `VAULT_AUTH_GITHUB_TOKEN` environment variable [GH-1511] - * credential/ldap: Fix problem where certain error conditions when configuring - or opening LDAP connections would cause a panic instead of return a useful - error message [GH-1262] - * credential/token: Fall back to normal parent-token semantics if - `allowed_policies` is empty for a role. Using `allowed_policies` of - `default` resulted in the same behavior anyways. [GH-1276] - * credential/token: Fix issues renewing tokens when using the "suffix" - capability of token roles [GH-1331] - * credential/token: Fix lookup via POST showing the request token instead of - the desired token [GH-1354] - * credential/various: Fix renewal conditions when `default` policy is not - contained in the backend config [GH-1256] - * physical/s3: Don't panic in certain error cases from bad S3 responses [GH-1353] - * secret/consul: Use non-pooled Consul API client to avoid leaving files open - [GH-1428] - * secret/pki: Don't check whether a certificate is destined to be a CA - certificate if sign-verbatim endpoint is used [GH-1250] - -## 0.5.3 (May 27th, 2016) - -SECURITY: - - * Consul ACL Token Revocation: An issue was reported to us indicating that - generated Consul ACL tokens were not being properly revoked. Upon - investigation, we found that this behavior was reproducible in a specific - scenario: when a generated lease for a Consul ACL token had been renewed - prior to revocation. In this case, the generated token was not being - properly persisted internally through the renewal function, leading to an - error during revocation due to the missing token. Unfortunately, this was - coded as a user error rather than an internal error, and the revocation - logic was expecting internal errors if revocation failed. As a result, the - revocation logic believed the revocation to have succeeded when it in fact - failed, causing the lease to be dropped while the token was still valid - within Consul. In this release, the Consul backend properly persists the - token through renewals, and the revocation logic has been changed to - consider any error type to have been a failure to revoke, causing the lease - to persist and attempt to be revoked later. - -We have written an example shell script that searches through Consul's ACL -tokens and looks for those generated by Vault, which can be used as a template -for a revocation script as deemed necessary for any particular security -response. The script is available at -https://gist.github.com/jefferai/6233c2963f9407a858d84f9c27d725c0 - -Please note that any outstanding leases for Consul tokens produced prior to -0.5.3 that have been renewed will continue to exhibit this behavior. As a -result, we recommend either revoking all tokens produced by the backend and -issuing new ones, or if needed, a more advanced variant of the provided example -could use the timestamp embedded in each generated token's name to decide which -tokens are too old and should be deleted. This could then be run periodically -up until the maximum lease time for any outstanding pre-0.5.3 tokens has -expired. - -This is a security-only release. There are no other code changes since 0.5.2. -The binaries have one additional change: they are built against Go 1.6.1 rather -than Go 1.6, as Go 1.6.1 contains two security fixes to the Go programming -language itself. - -## 0.5.2 (March 16th, 2016) - -FEATURES: - - * **MSSQL Backend**: Generate dynamic unique MSSQL database credentials based - on configured roles [GH-998] - * **Token Accessors**: Vault now provides an accessor with each issued token. - This accessor is an identifier that can be used for a limited set of - actions, notably for token revocation. This value can be logged in - plaintext to audit logs, and in combination with the plaintext metadata - logged to audit logs, provides a searchable and straightforward way to - revoke particular users' or services' tokens in many cases. To enable - plaintext audit logging of these accessors, set `hmac_accessor=false` when - enabling an audit backend. - * **Token Credential Backend Roles**: Roles can now be created in the `token` - credential backend that allow modifying token behavior in ways that are not - otherwise exposed or easily delegated. This allows creating tokens with a - fixed set (or subset) of policies (rather than a subset of the calling - token's), periodic tokens with a fixed TTL but no expiration, specified - prefixes, and orphans. - * **Listener Certificate Reloading**: Vault's configured listeners now reload - their TLS certificate and private key when the Vault process receives a - SIGHUP. - -IMPROVEMENTS: - - * auth/token: Endpoints optionally accept tokens from the HTTP body rather - than just from the URLs [GH-1211] - * auth/token,sys/capabilities: Added new endpoints - `auth/token/lookup-accessor`, `auth/token/revoke-accessor` and - `sys/capabilities-accessor`, which enables performing the respective actions - with just the accessor of the tokens, without having access to the actual - token [GH-1188] - * core: Ignore leading `/` in policy paths [GH-1170] - * core: Ignore leading `/` in mount paths [GH-1172] - * command/policy-write: Provided HCL is now validated for format violations - and provides helpful information around where the violation occurred - [GH-1200] - * command/server: The initial root token ID when running in `-dev` mode can - now be specified via `-dev-root-token-id` or the environment variable - `VAULT_DEV_ROOT_TOKEN_ID` [GH-1162] - * command/server: The listen address when running in `-dev` mode can now be - specified via `-dev-listen-address` or the environment variable - `VAULT_DEV_LISTEN_ADDRESS` [GH-1169] - * command/server: The configured listeners now reload their TLS - certificates/keys when Vault is SIGHUP'd [GH-1196] - * command/step-down: New `vault step-down` command and API endpoint to force - the targeted node to give up active status, but without sealing. The node - will wait ten seconds before attempting to grab the lock again. [GH-1146] - * command/token-renew: Allow no token to be passed in; use `renew-self` in - this case. Change the behavior for any token being passed in to use `renew`. - [GH-1150] - * credential/app-id: Allow `app-id` parameter to be given in the login path; - this causes the `app-id` to be part of the token path, making it easier to - use with `revoke-prefix` [GH-424] - * credential/cert: Non-CA certificates can be used for authentication. They - must be matched exactly (issuer and serial number) for authentication, and - the certificate must carry the client authentication or 'any' extended usage - attributes. [GH-1153] - * credential/cert: Subject and Authority key IDs are output in metadata; this - allows more flexible searching/revocation in the audit logs [GH-1183] - * credential/cert: Support listing configured certs [GH-1212] - * credential/userpass: Add support for `create`/`update` capability - distinction in user path, and add user-specific endpoints to allow changing - the password and policies [GH-1216] - * credential/token: Add roles [GH-1155] - * secret/mssql: Add MSSQL backend [GH-998] - * secret/pki: Add revocation time (zero or Unix epoch) to `pki/cert/SERIAL` - endpoint [GH-1180] - * secret/pki: Sanitize serial number in `pki/revoke` endpoint to allow some - other formats [GH-1187] - * secret/ssh: Added documentation for `ssh/config/zeroaddress` endpoint. - [GH-1154] - * sys: Added new endpoints `sys/capabilities` and `sys/capabilities-self` to - fetch the capabilities of a token on a given path [GH-1171] - * sys: Added `sys/revoke-force`, which enables a user to ignore backend errors - when revoking a lease, necessary in some emergency/failure scenarios - [GH-1168] - * sys: The return codes from `sys/health` can now be user-specified via query - parameters [GH-1199] - -BUG FIXES: - - * logical/cassandra: Apply hyphen/underscore replacement to the entire - generated username, not just the UUID, in order to handle token display name - hyphens [GH-1140] - * physical/etcd: Output actual error when cluster sync fails [GH-1141] - * vault/expiration: Not letting the error responses from the backends to skip - during renewals [GH-1176] - -## 0.5.1 (February 25th, 2016) - -DEPRECATIONS/CHANGES: - - * RSA keys less than 2048 bits are no longer supported in the PKI backend. - 1024-bit keys are considered unsafe and are disallowed in the Internet PKI. - The `pki` backend has enforced SHA256 hashes in signatures from the - beginning, and software that can handle these hashes should be able to - handle larger key sizes. [GH-1095] - * The PKI backend now does not automatically delete expired certificates, - including from the CRL. Doing so could lead to a situation where a time - mismatch between the Vault server and clients could result in a certificate - that would not be considered expired by a client being removed from the CRL. - The new `pki/tidy` endpoint can be used to trigger expirations. [GH-1129] - * The `cert` backend now performs a variant of channel binding at renewal time - for increased security. In order to not overly burden clients, a notion of - identity is used. This functionality can be disabled. See the 0.5.1 upgrade - guide for more specific information [GH-1127] - -FEATURES: - - * **Codebase Audit**: Vault's 0.5 codebase was audited by iSEC. (The terms of - the audit contract do not allow us to make the results public.) [GH-220] - -IMPROVEMENTS: - - * api: The `VAULT_TLS_SERVER_NAME` environment variable can be used to control - the SNI header during TLS connections [GH-1131] - * api/health: Add the server's time in UTC to health responses [GH-1117] - * command/rekey and command/generate-root: These now return the status at - attempt initialization time, rather than requiring a separate fetch for the - nonce [GH-1054] - * credential/cert: Don't require root/sudo tokens for the `certs/` and `crls/` - paths; use normal ACL behavior instead [GH-468] - * credential/github: The validity of the token used for login will be checked - at renewal time [GH-1047] - * credential/github: The `config` endpoint no longer requires a root token; - normal ACL path matching applies - * deps: Use the standardized Go 1.6 vendoring system - * secret/aws: Inform users of AWS-imposed policy restrictions around STS - tokens if they attempt to use an invalid policy [GH-1113] - * secret/mysql: The MySQL backend now allows disabling verification of the - `connection_url` [GH-1096] - * secret/pki: Submitted CSRs are now verified to have the correct key type and - minimum number of bits according to the role. The exception is intermediate - CA signing and the `sign-verbatim` path [GH-1104] - * secret/pki: New `tidy` endpoint to allow expunging expired certificates. - [GH-1129] - * secret/postgresql: The PostgreSQL backend now allows disabling verification - of the `connection_url` [GH-1096] - * secret/ssh: When verifying an OTP, return 400 if it is not valid instead of - 204 [GH-1086] - * credential/app-id: App ID backend will check the validity of app-id and user-id - during renewal time [GH-1039] - * credential/cert: TLS Certificates backend, during renewal, will now match the - client identity with the client identity used during login [GH-1127] - -BUG FIXES: - - * credential/ldap: Properly escape values being provided to search filters - [GH-1100] - * secret/aws: Capping on length of usernames for both IAM and STS types - [GH-1102] - * secret/pki: If a cert is not found during lookup of a serial number, - respond with a 400 rather than a 500 [GH-1085] - * secret/postgresql: Add extra revocation statements to better handle more - permission scenarios [GH-1053] - * secret/postgresql: Make connection_url work properly [GH-1112] - -## 0.5.0 (February 10, 2016) - -SECURITY: - - * Previous versions of Vault could allow a malicious user to hijack the rekey - operation by canceling an operation in progress and starting a new one. The - practical application of this is very small. If the user was an unseal key - owner, they could attempt to do this in order to either receive unencrypted - reseal keys or to replace the PGP keys used for encryption with ones under - their control. However, since this would invalidate any rekey progress, they - would need other unseal key holders to resubmit, which would be rather - suspicious during this manual operation if they were not also the original - initiator of the rekey attempt. If the user was not an unseal key holder, - there is no benefit to be gained; the only outcome that could be attempted - would be a denial of service against a legitimate rekey operation by sending - cancel requests over and over. Thanks to Josh Snyder for the report! - -DEPRECATIONS/CHANGES: - - * `s3` physical backend: Environment variables are now preferred over - configuration values. This makes it behave similar to the rest of Vault, - which, in increasing order of preference, uses values from the configuration - file, environment variables, and CLI flags. [GH-871] - * `etcd` physical backend: `sync` functionality is now supported and turned on - by default. This can be disabled. [GH-921] - * `transit`: If a client attempts to encrypt a value with a key that does not - yet exist, what happens now depends on the capabilities set in the client's - ACL policies. If the client has `create` (or `create` and `update`) - capability, the key will upsert as in the past. If the client has `update` - capability, they will receive an error. [GH-1012] - * `token-renew` CLI command: If the token given for renewal is the same as the - client token, the `renew-self` endpoint will be used in the API. Given that - the `default` policy (by default) allows all clients access to the - `renew-self` endpoint, this makes it much more likely that the intended - operation will be successful. [GH-894] - * Token `lookup`: the `ttl` value in the response now reflects the actual - remaining TTL rather than the original TTL specified when the token was - created; this value is now located in `creation_ttl` [GH-986] - * Vault no longer uses grace periods on leases or token TTLs. Uncertainty - about the length grace period for any given backend could cause confusion - and uncertainty. [GH-1002] - * `rekey`: Rekey now requires a nonce to be supplied with key shares. This - nonce is generated at the start of a rekey attempt and is unique for that - attempt. - * `status`: The exit code for the `status` CLI command is now `2` for an - uninitialized Vault instead of `1`. `1` is returned for errors. This better - matches the rest of the CLI. - -FEATURES: - - * **Split Data/High Availability Physical Backends**: You can now configure - two separate physical backends: one to be used for High Availability - coordination and another to be used for encrypted data storage. See the - [configuration - documentation](https://vaultproject.io/docs/config/index.html) for details. - [GH-395] - * **Fine-Grained Access Control**: Policies can now use the `capabilities` set - to specify fine-grained control over operations allowed on a path, including - separation of `sudo` privileges from other privileges. These can be mixed - and matched in any way desired. The `policy` value is kept for backwards - compatibility. See the [updated policy - documentation](https://vaultproject.io/docs/concepts/policies.html) for - details. [GH-914] - * **List Support**: Listing is now supported via the API and the new `vault - list` command. This currently supports listing keys in the `generic` and - `cubbyhole` backends and a few other places (noted in the IMPROVEMENTS - section below). Different parts of the API and backends will need to - implement list capabilities in ways that make sense to particular endpoints, - so further support will appear over time. [GH-617] - * **Root Token Generation via Unseal Keys**: You can now use the - `generate-root` CLI command to generate new orphaned, non-expiring root - tokens in case the original is lost or revoked (accidentally or - purposefully). This requires a quorum of unseal key holders. The output - value is protected via any PGP key of the initiator's choosing or a one-time - pad known only to the initiator (a suitable pad can be generated via the - `-genotp` flag to the command. [GH-915] - * **Unseal Key Archiving**: You can now optionally have Vault store your - unseal keys in your chosen physical store for disaster recovery purposes. - This option is only available when the keys are encrypted with PGP. [GH-907] - * **Keybase Support for PGP Encryption Keys**: You can now specify Keybase - users when passing in PGP keys to the `init`, `rekey`, and `generate-root` - CLI commands. Public keys for these users will be fetched automatically. - [GH-901] - * **DynamoDB HA Physical Backend**: There is now a new, community-supported - HA-enabled physical backend using Amazon DynamoDB. See the [configuration - documentation](https://vaultproject.io/docs/config/index.html) for details. - [GH-878] - * **PostgreSQL Physical Backend**: There is now a new, community-supported - physical backend using PostgreSQL. See the [configuration - documentation](https://vaultproject.io/docs/config/index.html) for details. - [GH-945] - * **STS Support in AWS Secret Backend**: You can now use the AWS secret - backend to fetch STS tokens rather than IAM users. [GH-927] - * **Speedups in the transit backend**: The `transit` backend has gained a - cache, and now loads only the working set of keys (e.g. from the - `min_decryption_version` to the current key version) into its working set. - This provides large speedups and potential memory savings when the `rotate` - feature of the backend is used heavily. - -IMPROVEMENTS: - - * cli: Output secrets sorted by key name [GH-830] - * cli: Support YAML as an output format [GH-832] - * cli: Show an error if the output format is incorrect, rather than falling - back to an empty table [GH-849] - * cli: Allow setting the `advertise_addr` for HA via the - `VAULT_ADVERTISE_ADDR` environment variable [GH-581] - * cli/generate-root: Add generate-root and associated functionality [GH-915] - * cli/init: Add `-check` flag that returns whether Vault is initialized - [GH-949] - * cli/server: Use internal functions for the token-helper rather than shelling - out, which fixes some problems with using a static binary in Docker or paths - with multiple spaces when launching in `-dev` mode [GH-850] - * cli/token-lookup: Add token-lookup command [GH-892] - * command/{init,rekey}: Allow ASCII-armored keychain files to be arguments for - `-pgp-keys` [GH-940] - * conf: Use normal bool values rather than empty/non-empty for the - `tls_disable` option [GH-802] - * credential/ldap: Add support for binding, both anonymously (to discover a - user DN) and via a username and password [GH-975] - * credential/token: Add `last_renewal_time` to token lookup calls [GH-896] - * credential/token: Change `ttl` to reflect the current remaining TTL; the - original value is in `creation_ttl` [GH-1007] - * helper/certutil: Add ability to parse PKCS#8 bundles [GH-829] - * logical/aws: You can now get STS tokens instead of IAM users [GH-927] - * logical/cassandra: Add `protocol_version` parameter to set the CQL proto - version [GH-1005] - * logical/cubbyhole: Add cubbyhole access to default policy [GH-936] - * logical/mysql: Add list support for roles path [GH-984] - * logical/pki: Fix up key usages being specified for CAs [GH-989] - * logical/pki: Add list support for roles path [GH-985] - * logical/pki: Allow `pem_bundle` to be specified as the format, which - provides a concatenated PEM bundle of returned values [GH-1008] - * logical/pki: Add 30 seconds of slack to the validity start period to - accommodate some clock skew in machines [GH-1036] - * logical/postgres: Add `max_idle_connections` parameter [GH-950] - * logical/postgres: Add list support for roles path - * logical/ssh: Add list support for roles path [GH-983] - * logical/transit: Keys are archived and only keys between the latest version - and `min_decryption_version` are loaded into the working set. This can - provide a very large speed increase when rotating keys very often. [GH-977] - * logical/transit: Keys are now cached, which should provide a large speedup - in most cases [GH-979] - * physical/cache: Use 2Q cache instead of straight LRU [GH-908] - * physical/etcd: Support basic auth [GH-859] - * physical/etcd: Support sync functionality and enable by default [GH-921] - -BUG FIXES: - - * api: Correct the HTTP verb used in the LookupSelf method [GH-887] - * api: Fix the output of `Sys().MountConfig(...)` to return proper values - [GH-1017] - * command/read: Fix panic when an empty argument was given [GH-923] - * command/ssh: Fix panic when username lookup fails [GH-886] - * core: When running in standalone mode, don't advertise that we are active - until post-unseal setup completes [GH-872] - * core: Update go-cleanhttp dependency to ensure idle connections aren't - leaked [GH-867] - * core: Don't allow tokens to have duplicate policies [GH-897] - * core: Fix regression in `sys/renew` that caused information stored in the - Secret part of the response to be lost [GH-912] - * physical: Use square brackets when setting an IPv6-based advertise address - as the auto-detected advertise address [GH-883] - * physical/s3: Use an initialized client when using IAM roles to fix a - regression introduced against newer versions of the AWS Go SDK [GH-836] - * secret/pki: Fix a condition where unmounting could fail if the CA - certificate was not properly loaded [GH-946] - * secret/ssh: Fix a problem where SSH connections were not always closed - properly [GH-942] - -MISC: - - * Clarified our stance on support for community-derived physical backends. - See the [configuration - documentation](https://vaultproject.io/docs/config/index.html) for details. - * Add `vault-java` to libraries [GH-851] - * Various minor documentation fixes and improvements [GH-839] [GH-854] - [GH-861] [GH-876] [GH-899] [GH-900] [GH-904] [GH-923] [GH-924] [GH-958] - [GH-959] [GH-981] [GH-990] [GH-1024] [GH-1025] - -BUILD NOTE: - - * The HashiCorp-provided binary release of Vault 0.5.0 is built against a - patched version of Go 1.5.3 containing two specific bug fixes affecting TLS - certificate handling. These fixes are in the Go 1.6 tree and were - cherry-picked on top of stock Go 1.5.3. If you want to examine the way in - which the releases were built, please look at our [cross-compilation - Dockerfile](https://github.com/hashicorp/vault/blob/v0.5.0/scripts/cross/Dockerfile-patched-1.5.3). - -## 0.4.1 (January 13, 2016) - -SECURITY: - - * Build against Go 1.5.3 to mitigate a security vulnerability introduced in - Go 1.5. For more information, please see - https://groups.google.com/forum/#!topic/golang-dev/MEATuOi_ei4 - -This is a security-only release; other than the version number and building -against Go 1.5.3, there are no changes from 0.4.0. - -## 0.4.0 (December 10, 2015) - -DEPRECATIONS/CHANGES: - - * Policy Name Casing: Policy names are now normalized to lower-case on write, - helping prevent accidental case mismatches. For backwards compatibility, - policy names are not currently normalized when reading or deleting. [GH-676] - * Default etcd port number: the default connection string for the `etcd` - physical store uses port 2379 instead of port 4001, which is the port used - by the supported version 2.x of etcd. [GH-753] - * As noted below in the FEATURES section, if your Vault installation contains - a policy called `default`, new tokens created will inherit this policy - automatically. - * In the PKI backend there have been a few minor breaking changes: - * The token display name is no longer a valid option for providing a base - domain for issuance. Since this name is prepended with the name of the - authentication backend that issued it, it provided a faulty use-case at best - and a confusing experience at worst. We hope to figure out a better - per-token value in a future release. - * The `allowed_base_domain` parameter has been changed to `allowed_domains`, - which accepts a comma-separated list of domains. This allows issuing - certificates with DNS subjects across multiple domains. If you had a - configured `allowed_base_domain` parameter, it will be migrated - automatically when the role is read (either via a normal read, or via - issuing a certificate). - -FEATURES: - - * **Significantly Enhanced PKI Backend**: The `pki` backend can now generate - and sign root CA certificates and intermediate CA CSRs. It can also now sign - submitted client CSRs, as well as a significant number of other - enhancements. See the updated documentation for the full API. [GH-666] - * **CRL Checking for Certificate Authentication**: The `cert` backend now - supports pushing CRLs into the mount and using the contained serial numbers - for revocation checking. See the documentation for the `cert` backend for - more info. [GH-330] - * **Default Policy**: Vault now ensures that a policy named `default` is added - to every token. This policy cannot be deleted, but it can be modified - (including to an empty policy). There are three endpoints allowed in the - default `default` policy, related to token self-management: `lookup-self`, - which allows a token to retrieve its own information, and `revoke-self` and - `renew-self`, which are self-explanatory. If your existing Vault - installation contains a policy called `default`, it will not be overridden, - but it will be added to each new token created. You can override this - behavior when using manual token creation (i.e. not via an authentication - backend) by setting the "no_default_policy" flag to true. [GH-732] - -IMPROVEMENTS: - - * api: API client now uses a 60 second timeout instead of indefinite [GH-681] - * api: Implement LookupSelf, RenewSelf, and RevokeSelf functions for auth - tokens [GH-739] - * api: Standardize environment variable reading logic inside the API; the CLI - now uses this but can still override via command-line parameters [GH-618] - * audit: HMAC-SHA256'd client tokens are now stored with each request entry. - Previously they were only displayed at creation time; this allows much - better traceability of client actions. [GH-713] - * audit: There is now a `sys/audit-hash` endpoint that can be used to generate - an HMAC-SHA256'd value from provided data using the given audit backend's - salt [GH-784] - * core: The physical storage read cache can now be disabled via - "disable_cache" [GH-674] - * core: The unsealing process can now be reset midway through (this feature - was documented before, but not enabled) [GH-695] - * core: Tokens can now renew themselves [GH-455] - * core: Base64-encoded PGP keys can be used with the CLI for `init` and - `rekey` operations [GH-653] - * core: Print version on startup [GH-765] - * core: Access to `sys/policy` and `sys/mounts` now uses the normal ACL system - instead of requiring a root token [GH-769] - * credential/token: Display whether or not a token is an orphan in the output - of a lookup call [GH-766] - * logical: Allow `.` in path-based variables in many more locations [GH-244] - * logical: Responses now contain a "warnings" key containing a list of - warnings returned from the server. These are conditions that did not require - failing an operation, but of which the client should be aware. [GH-676] - * physical/(consul,etcd): Consul and etcd now use a connection pool to limit - the number of outstanding operations, improving behavior when a lot of - operations must happen at once [GH-677] [GH-780] - * physical/consul: The `datacenter` parameter was removed; It could not be - effective unless the Vault node (or the Consul node it was connecting to) - was in the datacenter specified, in which case it wasn't needed [GH-816] - * physical/etcd: Support TLS-encrypted connections and use a connection pool - to limit the number of outstanding operations [GH-780] - * physical/s3: The S3 endpoint can now be configured, allowing using - S3-API-compatible storage solutions [GH-750] - * physical/s3: The S3 bucket can now be configured with the `AWS_S3_BUCKET` - environment variable [GH-758] - * secret/consul: Management tokens can now be created [GH-714] - -BUG FIXES: - - * api: API client now checks for a 301 response for redirects. Vault doesn't - generate these, but in certain conditions Go's internal HTTP handler can - generate them, leading to client errors. - * cli: `token-create` now supports the `ttl` parameter in addition to the - deprecated `lease` parameter. [GH-688] - * core: Return data from `generic` backends on the last use of a limited-use - token [GH-615] - * core: Fix upgrade path for leases created in `generic` prior to 0.3 [GH-673] - * core: Stale leader entries will now be reaped [GH-679] - * core: Using `mount-tune` on the auth/token path did not take effect. - [GH-688] - * core: Fix a potential race condition when (un)sealing the vault with metrics - enabled [GH-694] - * core: Fix an error that could happen in some failure scenarios where Vault - could fail to revert to a clean state [GH-733] - * core: Ensure secondary indexes are removed when a lease is expired [GH-749] - * core: Ensure rollback manager uses an up-to-date mounts table [GH-771] - * everywhere: Don't use http.DefaultClient, as it shares state implicitly and - is a source of hard-to-track-down bugs [GH-700] - * credential/token: Allow creating orphan tokens via an API path [GH-748] - * secret/generic: Validate given duration at write time, not just read time; - if stored durations are not parseable, return a warning and the default - duration rather than an error [GH-718] - * secret/generic: Return 400 instead of 500 when `generic` backend is written - to with no data fields [GH-825] - * secret/postgresql: Revoke permissions before dropping a user or revocation - may fail [GH-699] - -MISC: - - * Various documentation fixes and improvements [GH-685] [GH-688] [GH-697] - [GH-710] [GH-715] [GH-831] - -## 0.3.1 (October 6, 2015) - -SECURITY: - - * core: In certain failure scenarios, the full values of requests and - responses would be logged [GH-665] - -FEATURES: - - * **Settable Maximum Open Connections**: The `mysql` and `postgresql` backends - now allow setting the number of maximum open connections to the database, - which was previously capped to 2. [GH-661] - * **Renewable Tokens for GitHub**: The `github` backend now supports - specifying a TTL, enabling renewable tokens. [GH-664] - -BUG FIXES: - - * dist: linux-amd64 distribution was dynamically linked [GH-656] - * credential/github: Fix acceptance tests [GH-651] - -MISC: - - * Various minor documentation fixes and improvements [GH-649] [GH-650] - [GH-654] [GH-663] - -## 0.3.0 (September 28, 2015) - -DEPRECATIONS/CHANGES: - -Note: deprecations and breaking changes in upcoming releases are announced -ahead of time on the "vault-tool" mailing list. - - * **Cookie Authentication Removed**: As of 0.3 the only way to authenticate is - via the X-Vault-Token header. Cookie authentication was hard to properly - test, could result in browsers/tools/applications saving tokens in plaintext - on disk, and other issues. [GH-564] - * **Terminology/Field Names**: Vault is transitioning from overloading the - term "lease" to mean both "a set of metadata" and "the amount of time the - metadata is valid". The latter is now being referred to as TTL (or - "lease_duration" for backwards-compatibility); some parts of Vault have - already switched to using "ttl" and others will follow in upcoming releases. - In particular, the "token", "generic", and "pki" backends accept both "ttl" - and "lease" but in 0.4 only "ttl" will be accepted. [GH-528] - * **Downgrade Not Supported**: Due to enhancements in the storage subsystem, - values written by Vault 0.3+ will not be able to be read by prior versions - of Vault. There are no expected upgrade issues, however, as with all - critical infrastructure it is recommended to back up Vault's physical - storage before upgrading. - -FEATURES: - - * **SSH Backend**: Vault can now be used to delegate SSH access to machines, - via a (recommended) One-Time Password approach or by issuing dynamic keys. - [GH-385] - * **Cubbyhole Backend**: This backend works similarly to the "generic" backend - but provides a per-token workspace. This enables some additional - authentication workflows (especially for containers) and can be useful to - applications to e.g. store local credentials while being restarted or - upgraded, rather than persisting to disk. [GH-612] - * **Transit Backend Improvements**: The transit backend now allows key - rotation and datakey generation. For rotation, data encrypted with previous - versions of the keys can still be decrypted, down to a (configurable) - minimum previous version; there is a rewrap function for manual upgrades of - ciphertext to newer versions. Additionally, the backend now allows - generating and returning high-entropy keys of a configurable bitsize - suitable for AES and other functions; this is returned wrapped by a named - key, or optionally both wrapped and plaintext for immediate use. [GH-626] - * **Global and Per-Mount Default/Max TTL Support**: You can now set the - default and maximum Time To Live for leases both globally and per-mount. - Per-mount settings override global settings. Not all backends honor these - settings yet, but the maximum is a hard limit enforced outside the backend. - See the documentation for "/sys/mounts/" for details on configuring - per-mount TTLs. [GH-469] - * **PGP Encryption for Unseal Keys**: When initializing or rotating Vault's - master key, PGP/GPG public keys can now be provided. The output keys will be - encrypted with the given keys, in order. [GH-570] - * **Duo Multifactor Authentication Support**: Backends that support MFA can - now use Duo as the mechanism. [GH-464] - * **Performance Improvements**: Users of the "generic" backend will see a - significant performance improvement as the backend no longer creates leases, - although it does return TTLs (global/mount default, or set per-item) as - before. [GH-631] - * **Codebase Audit**: Vault's codebase was audited by iSEC. (The terms of the - audit contract do not allow us to make the results public.) [GH-220] - -IMPROVEMENTS: - - * audit: Log entries now contain a time field [GH-495] - * audit: Obfuscated audit entries now use hmac-sha256 instead of sha1 [GH-627] - * backends: Add ability for a cleanup function to be called on backend unmount - [GH-608] - * config: Allow specifying minimum acceptable TLS version [GH-447] - * core: If trying to mount in a location that is already mounted, be more - helpful about the error [GH-510] - * core: Be more explicit on failure if the issue is invalid JSON [GH-553] - * core: Tokens can now revoke themselves [GH-620] - * credential/app-id: Give a more specific error when sending a duplicate POST - to sys/auth/app-id [GH-392] - * credential/github: Support custom API endpoints (e.g. for Github Enterprise) - [GH-572] - * credential/ldap: Add per-user policies and option to login with - userPrincipalName [GH-420] - * credential/token: Allow root tokens to specify the ID of a token being - created from CLI [GH-502] - * credential/userpass: Enable renewals for login tokens [GH-623] - * scripts: Use /usr/bin/env to find Bash instead of hardcoding [GH-446] - * scripts: Use godep for build scripts to use same environment as tests - [GH-404] - * secret/mysql: Allow reading configuration data [GH-529] - * secret/pki: Split "allow_any_name" logic to that and "enforce_hostnames", to - allow for non-hostname values (e.g. for client certificates) [GH-555] - * storage/consul: Allow specifying certificates used to talk to Consul - [GH-384] - * storage/mysql: Allow SSL encrypted connections [GH-439] - * storage/s3: Allow using temporary security credentials [GH-433] - * telemetry: Put telemetry object in configuration to allow more flexibility - [GH-419] - * testing: Disable mlock for testing of logical backends so as not to require - root [GH-479] - -BUG FIXES: - - * audit/file: Do not enable auditing if file permissions are invalid [GH-550] - * backends: Allow hyphens in endpoint patterns (fixes AWS and others) [GH-559] - * cli: Fixed missing setup of client TLS certificates if no custom CA was - provided - * cli/read: Do not include a carriage return when using raw field output - [GH-624] - * core: Bad input data could lead to a panic for that session, rather than - returning an error [GH-503] - * core: Allow SHA2-384/SHA2-512 hashed certificates [GH-448] - * core: Do not return a Secret if there are no uses left on a token (since it - will be unable to be used) [GH-615] - * core: Code paths that called lookup-self would decrement num_uses and - potentially immediately revoke a token [GH-552] - * core: Some /sys/ paths would not properly redirect from a standby to the - leader [GH-499] [GH-551] - * credential/aws: Translate spaces in a token's display name to avoid making - IAM unhappy [GH-567] - * credential/github: Integration failed if more than ten organizations or - teams [GH-489] - * credential/token: Tokens with sudo access to "auth/token/create" can now use - root-only options [GH-629] - * secret/cassandra: Work around backwards-incompatible change made in - Cassandra 2.2 preventing Vault from properly setting/revoking leases - [GH-549] - * secret/mysql: Use varbinary instead of varchar to avoid InnoDB/UTF-8 issues - [GH-522] - * secret/postgres: Explicitly set timezone in connections [GH-597] - * storage/etcd: Renew semaphore periodically to prevent leadership flapping - [GH-606] - * storage/zk: Fix collisions in storage that could lead to data unavailability - [GH-411] - -MISC: - - * Various documentation fixes and improvements [GH-412] [GH-474] [GH-476] - [GH-482] [GH-483] [GH-486] [GH-508] [GH-568] [GH-574] [GH-586] [GH-590] - [GH-591] [GH-592] [GH-595] [GH-613] [GH-637] - * Less "armon" in stack traces [GH-453] - * Sourcegraph integration [GH-456] - -## 0.2.0 (July 13, 2015) - -FEATURES: - - * **Key Rotation Support**: The `rotate` command can be used to rotate the - master encryption key used to write data to the storage (physical) backend. - [GH-277] - * **Rekey Support**: Rekey can be used to rotate the master key and change the - configuration of the unseal keys (number of shares, threshold required). - [GH-277] - * **New secret backend: `pki`**: Enable Vault to be a certificate authority - and generate signed TLS certificates. [GH-310] - * **New secret backend: `cassandra`**: Generate dynamic credentials for - Cassandra [GH-363] - * **New storage backend: `etcd`**: store physical data in etcd [GH-259] - [GH-297] - * **New storage backend: `s3`**: store physical data in S3. Does not support - HA. [GH-242] - * **New storage backend: `MySQL`**: store physical data in MySQL. Does not - support HA. [GH-324] - * `transit` secret backend supports derived keys for per-transaction unique - keys [GH-399] - -IMPROVEMENTS: - - * cli/auth: Enable `cert` method [GH-380] - * cli/auth: read input from stdin [GH-250] - * cli/read: Ability to read a single field from a secret [GH-257] - * cli/write: Adding a force flag when no input required - * core: allow time duration format in place of seconds for some inputs - * core: audit log provides more useful information [GH-360] - * core: graceful shutdown for faster HA failover - * core: **change policy format** to use explicit globbing [GH-400] Any - existing policy in Vault is automatically upgraded to avoid issues. All - policy files must be updated for future writes. Adding the explicit glob - character `*` to the path specification is all that is required. - * core: policy merging to give deny highest precedence [GH-400] - * credential/app-id: Protect against timing attack on app-id - * credential/cert: Record the common name in the metadata [GH-342] - * credential/ldap: Allow TLS verification to be disabled [GH-372] - * credential/ldap: More flexible names allowed [GH-245] [GH-379] [GH-367] - * credential/userpass: Protect against timing attack on password - * credential/userpass: Use bcrypt for password matching - * http: response codes improved to reflect error [GH-366] - * http: the `sys/health` endpoint supports `?standbyok` to return 200 on - standby [GH-389] - * secret/app-id: Support deleting AppID and UserIDs [GH-200] - * secret/consul: Fine grained lease control [GH-261] - * secret/transit: Decouple raw key from key management endpoint [GH-355] - * secret/transit: Upsert named key when encrypt is used [GH-355] - * storage/zk: Support for HA configuration [GH-252] - * storage/zk: Changing node representation. **Backwards incompatible**. - [GH-416] - -BUG FIXES: - - * audit/file: file removing TLS connection state - * audit/syslog: fix removing TLS connection state - * command/*: commands accepting `k=v` allow blank values - * core: Allow building on FreeBSD [GH-365] - * core: Fixed various panics when audit logging enabled - * core: Lease renewal does not create redundant lease - * core: fixed leases with negative duration [GH-354] - * core: token renewal does not create child token - * core: fixing panic when lease increment is null [GH-408] - * credential/app-id: Salt the paths in storage backend to avoid information - leak - * credential/cert: Fixing client certificate not being requested - * credential/cert: Fixing panic when no certificate match found [GH-361] - * http: Accept PUT as POST for sys/auth - * http: Accept PUT as POST for sys/mounts [GH-349] - * http: Return 503 when sealed [GH-225] - * secret/postgres: Username length is capped to exceeding limit - * server: Do not panic if backend not configured [GH-222] - * server: Explicitly check value of tls_diable [GH-201] - * storage/zk: Fixed issues with version conflicts [GH-190] - -MISC: - - * cli/path-help: renamed from `help` to avoid confusion - -## 0.1.2 (May 11, 2015) - -FEATURES: - - * **New physical backend: `zookeeper`**: store physical data in Zookeeper. - HA not supported yet. - * **New credential backend: `ldap`**: authenticate using LDAP credentials. - -IMPROVEMENTS: - - * core: Auth backends can store internal data about auth creds - * audit: display name for auth is shown in logs [GH-176] - * command/*: `-insecure` has been renamed to `-tls-skip-verify` [GH-130] - * command/*: `VAULT_TOKEN` overrides local stored auth [GH-162] - * command/server: environment variables are copy-pastable - * credential/app-id: hash of app and user ID are in metadata [GH-176] - * http: HTTP API accepts `X-Vault-Token` as auth header [GH-124] - * logical/*: Generate help output even if no synopsis specified - -BUG FIXES: - - * core: login endpoints should never return secrets - * core: Internal data should never be returned from core endpoints - * core: defer barrier initialization to as late as possible to avoid error - cases during init that corrupt data (no data loss) - * core: guard against invalid init config earlier - * audit/file: create file if it doesn't exist [GH-148] - * command/*: ignore directories when traversing CA paths [GH-181] - * credential/*: all policy mapping keys are case insensitive [GH-163] - * physical/consul: Fixing path for locking so HA works in every case - -## 0.1.1 (May 2, 2015) - -SECURITY CHANGES: - - * physical/file: create the storge with 0600 permissions [GH-102] - * token/disk: write the token to disk with 0600 perms - -IMPROVEMENTS: - - * core: Very verbose error if mlock fails [GH-59] - * command/*: On error with TLS oversized record, show more human-friendly - error message. [GH-123] - * command/read: `lease_renewable` is now outputted along with the secret to - show whether it is renewable or not - * command/server: Add configuration option to disable mlock - * command/server: Disable mlock for dev mode so it works on more systems - -BUG FIXES: - - * core: if token helper isn't absolute, prepend with path to Vault - executable, not "vault" (which requires PATH) [GH-60] - * core: Any "mapping" routes allow hyphens in keys [GH-119] - * core: Validate `advertise_addr` is a valid URL with scheme [GH-106] - * command/auth: Using an invalid token won't crash [GH-75] - * credential/app-id: app and user IDs can have hyphens in keys [GH-119] - * helper/password: import proper DLL for Windows to ask password [GH-83] - -## 0.1.0 (April 28, 2015) - - * Initial release + token used to issue diff --git a/README.md b/README.md index bfce4ee17fce..fca29bd29b28 100644 --- a/README.md +++ b/README.md @@ -84,16 +84,6 @@ $ bin/vault ... ``` -To compile a development version of Vault Enterprise, run `make premdev`. Keep in mind this binary will contain a perpetual built-in license and should thus be protected from unauthorized use. Running `make premdev` will -put the Vault binary in the `bin` and `$GOPATH/bin` folders: - -```sh -$ make premdev -... -$ bin/vault -... -``` - To compile a development version of Vault with the UI, run `make static-dist dev-ui`. This will put the Vault binary in the `bin` and `$GOPATH/bin` folders: diff --git a/api/client.go b/api/client.go index ff27eff6575c..38cfbd6d62bc 100644 --- a/api/client.go +++ b/api/client.go @@ -88,6 +88,9 @@ type Config struct { // The Backoff function to use; a default is used if not provided Backoff retryablehttp.Backoff + // The CheckRetry function to use; a default is used if not provided + CheckRetry retryablehttp.CheckRetry + // Limiter is the rate limiter used by the client. // If this pointer is nil, then there will be no limit set. // In contrast, if this pointer is set, even to an empty struct, @@ -492,6 +495,16 @@ func (c *Client) SetMaxRetries(retries int) { c.config.MaxRetries = retries } +// SetCheckRetry sets the CheckRetry function to be used for future requests. +func (c *Client) SetCheckRetry(checkRetry retryablehttp.CheckRetry) { + c.modifyLock.RLock() + c.config.modifyLock.Lock() + defer c.config.modifyLock.Unlock() + c.modifyLock.RUnlock() + + c.config.CheckRetry = checkRetry +} + // SetClientTimeout sets the client request timeout func (c *Client) SetClientTimeout(timeout time.Duration) { c.modifyLock.RLock() @@ -647,6 +660,7 @@ func (c *Client) Clone() (*Client, error) { MaxRetries: config.MaxRetries, Timeout: config.Timeout, Backoff: config.Backoff, + CheckRetry: config.CheckRetry, Limiter: config.Limiter, } config.modifyLock.RUnlock() @@ -740,6 +754,7 @@ func (c *Client) RawRequestWithContext(ctx context.Context, r *Request) (*Respon c.config.modifyLock.RLock() limiter := c.config.Limiter maxRetries := c.config.MaxRetries + checkRetry := c.config.CheckRetry backoff := c.config.Backoff httpClient := c.config.HttpClient timeout := c.config.Timeout @@ -776,6 +791,13 @@ START: } if timeout != 0 { + // NOTE: this leaks a timer. But when we defer a cancel call here for + // the returned function we see errors in tests with contxt canceled. + // Although the request is done by the time we exit this function it is + // still causing something else to go wrong. Maybe it ends up being + // tied to the response somehow and reading the response body ends up + // checking it, or something. I don't know, but until we can chase this + // down, keep it not-canceled even though vet complains. ctx, _ = context.WithTimeout(ctx, timeout) } req.Request = req.Request.WithContext(ctx) @@ -784,13 +806,17 @@ START: backoff = retryablehttp.LinearJitterBackoff } + if checkRetry == nil { + checkRetry = retryablehttp.DefaultRetryPolicy + } + client := &retryablehttp.Client{ HTTPClient: httpClient, RetryWaitMin: 1000 * time.Millisecond, RetryWaitMax: 1500 * time.Millisecond, RetryMax: maxRetries, - CheckRetry: retryablehttp.DefaultRetryPolicy, Backoff: backoff, + CheckRetry: checkRetry, ErrorHandler: retryablehttp.PassthroughErrorHandler, } diff --git a/api/go.mod b/api/go.mod index 8f92a43bc295..0e6ae050e745 100644 --- a/api/go.mod +++ b/api/go.mod @@ -5,6 +5,7 @@ go 1.12 replace github.com/hashicorp/vault/sdk => ../sdk require ( + github.com/go-test/deep v1.0.2-0.20181118220953-042da051cf31 github.com/hashicorp/errwrap v1.0.0 github.com/hashicorp/go-cleanhttp v0.5.1 github.com/hashicorp/go-multierror v1.0.0 diff --git a/api/go.sum b/api/go.sum index e552682ba7df..d74daa2c9c80 100644 --- a/api/go.sum +++ b/api/go.sum @@ -10,6 +10,7 @@ github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSs github.com/fatih/color v1.7.0/go.mod h1:Zm6kSWBoL9eyXnKyktHP6abPY2pDugNf5KwzbycvMj4= github.com/fatih/structs v1.1.0/go.mod h1:9NiDSp5zOcgEDl+j00MP/WkGVPOlPRLejGD8Ga6PJ7M= github.com/go-ldap/ldap v3.0.2+incompatible/go.mod h1:qfd9rJvER9Q0/D/Sqn1DfHRoBp40uXYvFoEVrNEPqRc= +github.com/go-test/deep v1.0.2-0.20181118220953-042da051cf31 h1:28FVBuwkwowZMjbA7M0wXsI6t3PYulRTMio3SO+eKCM= github.com/go-test/deep v1.0.2-0.20181118220953-042da051cf31/go.mod h1:wGDj63lr65AM2AQyKZd/NYHGb0R+1RLqB8NKt3aSFNA= github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q= github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A= @@ -37,7 +38,6 @@ github.com/hashicorp/go-rootcerts v1.0.1/go.mod h1:pqUvnprVnM5bf7AOirdbb01K4ccR3 github.com/hashicorp/go-sockaddr v1.0.2 h1:ztczhD1jLxIRjVejw8gFomI1BQZOe2WoVOu0SyteCQc= github.com/hashicorp/go-sockaddr v1.0.2/go.mod h1:rB4wwRAUzs07qva3c5SdrY/NEtAUjGlgmH/UkBUC97A= github.com/hashicorp/go-uuid v1.0.0/go.mod h1:6SBZvOh/SIDV7/2o3Jml5SYk/TvGqwFJ/bN7x4byOro= -github.com/hashicorp/go-uuid v1.0.1/go.mod h1:6SBZvOh/SIDV7/2o3Jml5SYk/TvGqwFJ/bN7x4byOro= github.com/hashicorp/go-uuid v1.0.2-0.20191001231223-f32f5fe8d6a8/go.mod h1:6SBZvOh/SIDV7/2o3Jml5SYk/TvGqwFJ/bN7x4byOro= github.com/hashicorp/go-version v1.1.0/go.mod h1:fltr4n8CU8Ke44wwGCBoEymUuxUHl09ZGVZPK5anwXA= github.com/hashicorp/golang-lru v0.5.0/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= diff --git a/api/lifetime_watcher.go b/api/lifetime_watcher.go new file mode 100644 index 000000000000..841c51c0942f --- /dev/null +++ b/api/lifetime_watcher.go @@ -0,0 +1,384 @@ +package api + +import ( + "errors" + "math/rand" + "sync" + "time" +) + +var ( + ErrLifetimeWatcherMissingInput = errors.New("missing input") + ErrLifetimeWatcherMissingSecret = errors.New("missing secret") + ErrLifetimeWatcherNotRenewable = errors.New("secret is not renewable") + ErrLifetimeWatcherNoSecretData = errors.New("returned empty secret data") + + // Deprecated; kept for compatibility + ErrRenewerMissingInput = errors.New("missing input to renewer") + ErrRenewerMissingSecret = errors.New("missing secret to renew") + ErrRenewerNotRenewable = errors.New("secret is not renewable") + ErrRenewerNoSecretData = errors.New("returned empty secret data") + + // DefaultLifetimeWatcherRenewBuffer is the default size of the buffer for renew + // messages on the channel. + DefaultLifetimeWatcherRenewBuffer = 5 + // Deprecated: kept for backwards compatibility + DefaultRenewerRenewBuffer = 5 +) + +type RenewBehavior uint + +const ( + // RenewBehaviorIgnoreErrors means we will attempt to keep renewing until + // we hit the lifetime threshold. It also ignores errors stemming from + // passing a non-renewable lease in. In practice, this means you simply + // reauthenticate/refetch credentials when the watcher exits. This is the + // default. + RenewBehaviorIgnoreErrors RenewBehavior = iota + + // RenewBehaviorRenewDisabled turns off renewal attempts entirely. This + // allows you to simply watch lifetime and have the watcher return at a + // reasonable threshold without actually making Vault calls. + RenewBehaviorRenewDisabled + + // RenewBehaviorErrorOnErrors is the "legacy" behavior which always exits + // on some kind of error + RenewBehaviorErrorOnErrors +) + +// LifetimeWatcher is a process for watching lifetime of a secret. +// +// watcher, err := client.NewLifetimeWatcher(&LifetimeWatcherInput{ +// Secret: mySecret, +// }) +// go watcher.Start() +// defer watcher.Stop() +// +// for { +// select { +// case err := <-watcher.DoneCh(): +// if err != nil { +// log.Fatal(err) +// } +// +// // Renewal is now over +// case renewal := <-watcher.RenewCh(): +// log.Printf("Successfully renewed: %#v", renewal) +// } +// } +// +// +// `DoneCh` will return if renewal fails, or if the remaining lease duration is +// under a built-in threshold and either renewing is not extending it or +// renewing is disabled. In both cases, the caller should attempt a re-read of +// the secret. Clients should check the return value of the channel to see if +// renewal was successful. +type LifetimeWatcher struct { + l sync.Mutex + + client *Client + secret *Secret + grace time.Duration + random *rand.Rand + increment int + doneCh chan error + renewCh chan *RenewOutput + renewBehavior RenewBehavior + + stopped bool + stopCh chan struct{} + + errLifetimeWatcherNotRenewable error + errLifetimeWatcherNoSecretData error +} + +// LifetimeWatcherInput is used as input to the renew function. +type LifetimeWatcherInput struct { + // Secret is the secret to renew + Secret *Secret + + // DEPRECATED: this does not do anything. + Grace time.Duration + + // Rand is the randomizer to use for underlying randomization. If not + // provided, one will be generated and seeded automatically. If provided, it + // is assumed to have already been seeded. + Rand *rand.Rand + + // RenewBuffer is the size of the buffered channel where renew messages are + // dispatched. + RenewBuffer int + + // The new TTL, in seconds, that should be set on the lease. The TTL set + // here may or may not be honored by the vault server, based on Vault + // configuration or any associated max TTL values. + Increment int + + // RenewBehavior controls what happens when a renewal errors or the + // passed-in secret is not renewable. + RenewBehavior RenewBehavior +} + +// RenewOutput is the metadata returned to the client (if it's listening) to +// renew messages. +type RenewOutput struct { + // RenewedAt is the timestamp when the renewal took place (UTC). + RenewedAt time.Time + + // Secret is the underlying renewal data. It's the same struct as all data + // that is returned from Vault, but since this is renewal data, it will not + // usually include the secret itself. + Secret *Secret +} + +// NewLifetimeWatcher creates a new renewer from the given input. +func (c *Client) NewLifetimeWatcher(i *LifetimeWatcherInput) (*LifetimeWatcher, error) { + if i == nil { + return nil, ErrLifetimeWatcherMissingInput + } + + secret := i.Secret + if secret == nil { + return nil, ErrLifetimeWatcherMissingSecret + } + + random := i.Rand + if random == nil { + random = rand.New(rand.NewSource(int64(time.Now().Nanosecond()))) + } + + renewBuffer := i.RenewBuffer + if renewBuffer == 0 { + renewBuffer = DefaultLifetimeWatcherRenewBuffer + } + + return &LifetimeWatcher{ + client: c, + secret: secret, + increment: i.Increment, + random: random, + doneCh: make(chan error, 1), + renewCh: make(chan *RenewOutput, renewBuffer), + renewBehavior: i.RenewBehavior, + + stopped: false, + stopCh: make(chan struct{}), + + errLifetimeWatcherNotRenewable: ErrLifetimeWatcherNotRenewable, + errLifetimeWatcherNoSecretData: ErrLifetimeWatcherNoSecretData, + }, nil +} + +// Deprecated: exists only for backwards compatibility. Calls +// NewLifetimeWatcher, and sets compatibility flags. +func (c *Client) NewRenewer(i *LifetimeWatcherInput) (*LifetimeWatcher, error) { + if i == nil { + return nil, ErrRenewerMissingInput + } + + secret := i.Secret + if secret == nil { + return nil, ErrRenewerMissingSecret + } + + renewer, err := c.NewLifetimeWatcher(i) + if err != nil { + return nil, err + } + + renewer.renewBehavior = RenewBehaviorErrorOnErrors + renewer.errLifetimeWatcherNotRenewable = ErrRenewerNotRenewable + renewer.errLifetimeWatcherNoSecretData = ErrRenewerNoSecretData + return renewer, err +} + +// DoneCh returns the channel where the renewer will publish when renewal stops. +// If there is an error, this will be an error. +func (r *LifetimeWatcher) DoneCh() <-chan error { + return r.doneCh +} + +// RenewCh is a channel that receives a message when a successful renewal takes +// place and includes metadata about the renewal. +func (r *LifetimeWatcher) RenewCh() <-chan *RenewOutput { + return r.renewCh +} + +// Stop stops the renewer. +func (r *LifetimeWatcher) Stop() { + r.l.Lock() + defer r.l.Unlock() + + if !r.stopped { + close(r.stopCh) + r.stopped = true + } +} + +// Start starts a background process for watching the lifetime of this secret. +// If renewal is enabled, when the secret has auth data, this attempts to renew +// the auth (token); When the secret has a lease, this attempts to renew the +// lease. +func (r *LifetimeWatcher) Start() { + r.doneCh <- r.doRenew() +} + +// Renew is for comnpatibility with the legacy api.Renewer. Calling Renew +// simply chains to Start. +func (r *LifetimeWatcher) Renew() { + r.Start() +} + +// renewAuth is a helper for renewing authentication. +func (r *LifetimeWatcher) doRenew() error { + var nonRenewable bool + var tokenMode bool + var initLeaseDuration int + var credString string + var renewFunc func(string, int) (*Secret, error) + + switch { + case r.secret.Auth != nil: + tokenMode = true + nonRenewable = !r.secret.Auth.Renewable + initLeaseDuration = r.secret.Auth.LeaseDuration + credString = r.secret.Auth.ClientToken + renewFunc = r.client.Auth().Token().RenewTokenAsSelf + default: + nonRenewable = !r.secret.Renewable + initLeaseDuration = r.secret.LeaseDuration + credString = r.secret.LeaseID + renewFunc = r.client.Sys().Renew + } + + if credString == "" || + (nonRenewable && r.renewBehavior == RenewBehaviorErrorOnErrors) { + return r.errLifetimeWatcherNotRenewable + } + + initialTime := time.Now() + priorDuration := time.Duration(initLeaseDuration) * time.Second + r.calculateGrace(priorDuration) + + for { + // Check if we are stopped. + select { + case <-r.stopCh: + return nil + default: + } + + var leaseDuration time.Duration + fallbackLeaseDuration := initialTime.Add(priorDuration).Sub(time.Now()) + + switch { + case nonRenewable || r.renewBehavior == RenewBehaviorRenewDisabled: + // Can't or won't renew, just keep the same expiration so we exit + // when it's reauthentication time + leaseDuration = fallbackLeaseDuration + + default: + // Renew the token + renewal, err := renewFunc(credString, r.increment) + if err != nil || renewal == nil || (tokenMode && renewal.Auth == nil) { + if r.renewBehavior == RenewBehaviorErrorOnErrors { + if err != nil { + return err + } + if renewal == nil || (tokenMode && renewal.Auth == nil) { + return r.errLifetimeWatcherNoSecretData + } + } + + leaseDuration = fallbackLeaseDuration + break + } + + // Push a message that a renewal took place. + select { + case r.renewCh <- &RenewOutput{time.Now().UTC(), renewal}: + default: + } + + // Possibly error if we are not renewable + if ((tokenMode && !renewal.Auth.Renewable) || (!tokenMode && !renewal.Renewable)) && + r.renewBehavior == RenewBehaviorErrorOnErrors { + return r.errLifetimeWatcherNotRenewable + } + + // Grab the lease duration + newDuration := renewal.LeaseDuration + if tokenMode { + newDuration = renewal.Auth.LeaseDuration + } + + leaseDuration = time.Duration(newDuration) * time.Second + } + + // We keep evaluating a new grace period so long as the lease is + // extending. Once it stops extending, we've hit the max and need to + // rely on the grace duration. + if leaseDuration > priorDuration { + r.calculateGrace(leaseDuration) + } + priorDuration = leaseDuration + + // The sleep duration is set to 2/3 of the current lease duration plus + // 1/3 of the current grace period, which adds jitter. + sleepDuration := time.Duration(float64(leaseDuration.Nanoseconds())*2/3 + float64(r.grace.Nanoseconds())/3) + + // If we are within grace, return now; or, if the amount of time we + // would sleep would land us in the grace period. This helps with short + // tokens; for example, you don't want a current lease duration of 4 + // seconds, a grace period of 3 seconds, and end up sleeping for more + // than three of those seconds and having a very small budget of time + // to renew. + if leaseDuration <= r.grace || leaseDuration-sleepDuration <= r.grace { + return nil + } + + select { + case <-r.stopCh: + return nil + case <-time.After(sleepDuration): + continue + } + } +} + +// sleepDuration calculates the time to sleep given the base lease duration. The +// base is the resulting lease duration. It will be reduced to 1/3 and +// multiplied by a random float between 0.0 and 1.0. This extra randomness +// prevents multiple clients from all trying to renew simultaneously. +func (r *LifetimeWatcher) sleepDuration(base time.Duration) time.Duration { + sleep := float64(base) + + // Renew at 1/3 the remaining lease. This will give us an opportunity to retry + // at least one more time should the first renewal fail. + sleep = sleep / 3.0 + + // Use a randomness so many clients do not hit Vault simultaneously. + sleep = sleep * (r.random.Float64() + 1) / 2.0 + + return time.Duration(sleep) +} + +// calculateGrace calculates the grace period based on a reasonable set of +// assumptions given the total lease time; it also adds some jitter to not have +// clients be in sync. +func (r *LifetimeWatcher) calculateGrace(leaseDuration time.Duration) { + if leaseDuration == 0 { + r.grace = 0 + return + } + + leaseNanos := float64(leaseDuration.Nanoseconds()) + jitterMax := 0.1 * leaseNanos + + // For a given lease duration, we want to allow 80-90% of that to elapse, + // so the remaining amount is the grace period + r.grace = time.Duration(jitterMax) + time.Duration(uint64(r.random.Int63())%uint64(jitterMax)) +} + +type Renewer = LifetimeWatcher +type RenewerInput = LifetimeWatcherInput diff --git a/api/renewer.go b/api/renewer.go deleted file mode 100644 index 1d37a1938212..000000000000 --- a/api/renewer.go +++ /dev/null @@ -1,349 +0,0 @@ -package api - -import ( - "errors" - "math/rand" - "sync" - "time" -) - -var ( - ErrRenewerMissingInput = errors.New("missing input to renewer") - ErrRenewerMissingSecret = errors.New("missing secret to renew") - ErrRenewerNotRenewable = errors.New("secret is not renewable") - ErrRenewerNoSecretData = errors.New("returned empty secret data") - - // DefaultRenewerRenewBuffer is the default size of the buffer for renew - // messages on the channel. - DefaultRenewerRenewBuffer = 5 -) - -// Renewer is a process for renewing a secret. -// -// renewer, err := client.NewRenewer(&RenewerInput{ -// Secret: mySecret, -// }) -// go renewer.Renew() -// defer renewer.Stop() -// -// for { -// select { -// case err := <-renewer.DoneCh(): -// if err != nil { -// log.Fatal(err) -// } -// -// // Renewal is now over -// case renewal := <-renewer.RenewCh(): -// log.Printf("Successfully renewed: %#v", renewal) -// } -// } -// -// -// The `DoneCh` will return if renewal fails or if the remaining lease duration -// after a renewal is less than or equal to the grace (in number of seconds). In -// both cases, the caller should attempt a re-read of the secret. Clients should -// check the return value of the channel to see if renewal was successful. -type Renewer struct { - l sync.Mutex - - client *Client - secret *Secret - grace time.Duration - random *rand.Rand - increment int - doneCh chan error - renewCh chan *RenewOutput - - stopped bool - stopCh chan struct{} -} - -// RenewerInput is used as input to the renew function. -type RenewerInput struct { - // Secret is the secret to renew - Secret *Secret - - // DEPRECATED: this does not do anything. - Grace time.Duration - - // Rand is the randomizer to use for underlying randomization. If not - // provided, one will be generated and seeded automatically. If provided, it - // is assumed to have already been seeded. - Rand *rand.Rand - - // RenewBuffer is the size of the buffered channel where renew messages are - // dispatched. - RenewBuffer int - - // The new TTL, in seconds, that should be set on the lease. The TTL set - // here may or may not be honored by the vault server, based on Vault - // configuration or any associated max TTL values. - Increment int -} - -// RenewOutput is the metadata returned to the client (if it's listening) to -// renew messages. -type RenewOutput struct { - // RenewedAt is the timestamp when the renewal took place (UTC). - RenewedAt time.Time - - // Secret is the underlying renewal data. It's the same struct as all data - // that is returned from Vault, but since this is renewal data, it will not - // usually include the secret itself. - Secret *Secret -} - -// NewRenewer creates a new renewer from the given input. -func (c *Client) NewRenewer(i *RenewerInput) (*Renewer, error) { - if i == nil { - return nil, ErrRenewerMissingInput - } - - secret := i.Secret - if secret == nil { - return nil, ErrRenewerMissingSecret - } - - random := i.Rand - if random == nil { - random = rand.New(rand.NewSource(int64(time.Now().Nanosecond()))) - } - - renewBuffer := i.RenewBuffer - if renewBuffer == 0 { - renewBuffer = DefaultRenewerRenewBuffer - } - - return &Renewer{ - client: c, - secret: secret, - increment: i.Increment, - random: random, - doneCh: make(chan error, 1), - renewCh: make(chan *RenewOutput, renewBuffer), - - stopped: false, - stopCh: make(chan struct{}), - }, nil -} - -// DoneCh returns the channel where the renewer will publish when renewal stops. -// If there is an error, this will be an error. -func (r *Renewer) DoneCh() <-chan error { - return r.doneCh -} - -// RenewCh is a channel that receives a message when a successful renewal takes -// place and includes metadata about the renewal. -func (r *Renewer) RenewCh() <-chan *RenewOutput { - return r.renewCh -} - -// Stop stops the renewer. -func (r *Renewer) Stop() { - r.l.Lock() - if !r.stopped { - close(r.stopCh) - r.stopped = true - } - r.l.Unlock() -} - -// Renew starts a background process for renewing this secret. When the secret -// has auth data, this attempts to renew the auth (token). When the secret has -// a lease, this attempts to renew the lease. -func (r *Renewer) Renew() { - var result error - if r.secret.Auth != nil { - result = r.renewAuth() - } else { - result = r.renewLease() - } - - r.doneCh <- result -} - -// renewAuth is a helper for renewing authentication. -func (r *Renewer) renewAuth() error { - if !r.secret.Auth.Renewable || r.secret.Auth.ClientToken == "" { - return ErrRenewerNotRenewable - } - - priorDuration := time.Duration(r.secret.Auth.LeaseDuration) * time.Second - r.calculateGrace(priorDuration) - - client, token := r.client, r.secret.Auth.ClientToken - - for { - // Check if we are stopped. - select { - case <-r.stopCh: - return nil - default: - } - - // Renew the auth. - renewal, err := client.Auth().Token().RenewTokenAsSelf(token, r.increment) - if err != nil { - return err - } - - // Push a message that a renewal took place. - select { - case r.renewCh <- &RenewOutput{time.Now().UTC(), renewal}: - default: - } - - // Somehow, sometimes, this happens. - if renewal == nil || renewal.Auth == nil { - return ErrRenewerNoSecretData - } - - // Do nothing if we are not renewable - if !renewal.Auth.Renewable { - return ErrRenewerNotRenewable - } - - // Grab the lease duration - leaseDuration := time.Duration(renewal.Auth.LeaseDuration) * time.Second - - // We keep evaluating a new grace period so long as the lease is - // extending. Once it stops extending, we've hit the max and need to - // rely on the grace duration. - if leaseDuration > priorDuration { - r.calculateGrace(leaseDuration) - } - priorDuration = leaseDuration - - // The sleep duration is set to 2/3 of the current lease duration plus - // 1/3 of the current grace period, which adds jitter. - sleepDuration := time.Duration(float64(leaseDuration.Nanoseconds())*2/3 + float64(r.grace.Nanoseconds())/3) - - // If we are within grace, return now; or, if the amount of time we - // would sleep would land us in the grace period. This helps with short - // tokens; for example, you don't want a current lease duration of 4 - // seconds, a grace period of 3 seconds, and end up sleeping for more - // than three of those seconds and having a very small budget of time - // to renew. - if leaseDuration <= r.grace || leaseDuration-sleepDuration <= r.grace { - return nil - } - - select { - case <-r.stopCh: - return nil - case <-time.After(sleepDuration): - continue - } - } -} - -// renewLease is a helper for renewing a lease. -func (r *Renewer) renewLease() error { - if !r.secret.Renewable || r.secret.LeaseID == "" { - return ErrRenewerNotRenewable - } - - priorDuration := time.Duration(r.secret.LeaseDuration) * time.Second - r.calculateGrace(priorDuration) - - client, leaseID := r.client, r.secret.LeaseID - - for { - // Check if we are stopped. - select { - case <-r.stopCh: - return nil - default: - } - - // Renew the lease. - renewal, err := client.Sys().Renew(leaseID, r.increment) - if err != nil { - return err - } - - // Push a message that a renewal took place. - select { - case r.renewCh <- &RenewOutput{time.Now().UTC(), renewal}: - default: - } - - // Somehow, sometimes, this happens. - if renewal == nil { - return ErrRenewerNoSecretData - } - - // Do nothing if we are not renewable - if !renewal.Renewable { - return ErrRenewerNotRenewable - } - - // Grab the lease duration - leaseDuration := time.Duration(renewal.LeaseDuration) * time.Second - - // We keep evaluating a new grace period so long as the lease is - // extending. Once it stops extending, we've hit the max and need to - // rely on the grace duration. - if leaseDuration > priorDuration { - r.calculateGrace(leaseDuration) - } - priorDuration = leaseDuration - - // The sleep duration is set to 2/3 of the current lease duration plus - // 1/3 of the current grace period, which adds jitter. - sleepDuration := time.Duration(float64(leaseDuration.Nanoseconds())*2/3 + float64(r.grace.Nanoseconds())/3) - - // If we are within grace, return now; or, if the amount of time we - // would sleep would land us in the grace period. This helps with short - // tokens; for example, you don't want a current lease duration of 4 - // seconds, a grace period of 3 seconds, and end up sleeping for more - // than three of those seconds and having a very small budget of time - // to renew. - if leaseDuration <= r.grace || leaseDuration-sleepDuration <= r.grace { - return nil - } - - select { - case <-r.stopCh: - return nil - case <-time.After(sleepDuration): - continue - } - } -} - -// sleepDuration calculates the time to sleep given the base lease duration. The -// base is the resulting lease duration. It will be reduced to 1/3 and -// multiplied by a random float between 0.0 and 1.0. This extra randomness -// prevents multiple clients from all trying to renew simultaneously. -func (r *Renewer) sleepDuration(base time.Duration) time.Duration { - sleep := float64(base) - - // Renew at 1/3 the remaining lease. This will give us an opportunity to retry - // at least one more time should the first renewal fail. - sleep = sleep / 3.0 - - // Use a randomness so many clients do not hit Vault simultaneously. - sleep = sleep * (r.random.Float64() + 1) / 2.0 - - return time.Duration(sleep) -} - -// calculateGrace calculates the grace period based on a reasonable set of -// assumptions given the total lease time; it also adds some jitter to not have -// clients be in sync. -func (r *Renewer) calculateGrace(leaseDuration time.Duration) { - if leaseDuration == 0 { - r.grace = 0 - return - } - - leaseNanos := float64(leaseDuration.Nanoseconds()) - jitterMax := 0.1 * leaseNanos - - // For a given lease duration, we want to allow 80-90% of that to elapse, - // so the remaining amount is the grace period - r.grace = time.Duration(jitterMax) + time.Duration(uint64(r.random.Int63())%uint64(jitterMax)) -} diff --git a/api/renewer_test.go b/api/renewer_test.go index 7d481f12b266..b23a24643800 100644 --- a/api/renewer_test.go +++ b/api/renewer_test.go @@ -1,8 +1,9 @@ package api import ( - "reflect" "testing" + + "github.com/go-test/deep" ) func TestRenewer_NewRenewer(t *testing.T) { @@ -63,8 +64,8 @@ func TestRenewer_NewRenewer(t *testing.T) { v.renewCh = nil v.stopCh = nil - if !reflect.DeepEqual(tc.e, v) { - t.Errorf("not equal\nexp: %#v\nact: %#v", tc.e, v) + if diff := deep.Equal(tc.e, v); diff != nil { + t.Error(diff) } }) } diff --git a/api/sys_leases.go b/api/sys_leases.go index 09c9642a95d8..40826a7d23f1 100644 --- a/api/sys_leases.go +++ b/api/sys_leases.go @@ -28,7 +28,13 @@ func (c *Sys) Renew(id string, increment int) (*Secret, error) { } func (c *Sys) Revoke(id string) error { - r := c.c.NewRequest("PUT", "/v1/sys/leases/revoke/"+id) + r := c.c.NewRequest("PUT", "/v1/sys/leases/revoke") + body := map[string]interface{}{ + "lease_id": id, + } + if err := r.SetJSONBody(body); err != nil { + return err + } ctx, cancelFunc := context.WithCancel(context.Background()) defer cancelFunc() diff --git a/api/sys_raft.go b/api/sys_raft.go index 5057541f577f..e1106a0671cd 100644 --- a/api/sys_raft.go +++ b/api/sys_raft.go @@ -16,7 +16,7 @@ type RaftJoinResponse struct { // RaftJoinRequest represents the parameters consumed by the raft join API type RaftJoinRequest struct { LeaderAPIAddr string `json:"leader_api_addr"` - LeaderCACert string `json:"leader_ca_cert":` + LeaderCACert string `json:"leader_ca_cert"` LeaderClientCert string `json:"leader_client_cert"` LeaderClientKey string `json:"leader_client_key"` Retry bool `json:"retry"` diff --git a/builtin/logical/aws/path_roles.go b/builtin/logical/aws/path_roles.go index 6df1459cc1c9..6633c48a62ac 100644 --- a/builtin/logical/aws/path_roles.go +++ b/builtin/logical/aws/path_roles.go @@ -37,7 +37,7 @@ func pathListRoles(b *backend) *framework.Path { func pathRoles(b *backend) *framework.Path { return &framework.Path{ - Pattern: "roles/" + framework.GenericNameRegex("name"), + Pattern: "roles/" + framework.GenericNameWithAtRegex("name"), Fields: map[string]*framework.FieldSchema{ "name": &framework.FieldSchema{ Type: framework.TypeString, diff --git a/builtin/logical/aws/path_user.go b/builtin/logical/aws/path_user.go index def69c826dc1..6c1f89ad15eb 100644 --- a/builtin/logical/aws/path_user.go +++ b/builtin/logical/aws/path_user.go @@ -18,7 +18,7 @@ import ( func pathUser(b *backend) *framework.Path { return &framework.Path{ - Pattern: "(creds|sts)/" + framework.GenericNameRegex("name"), + Pattern: "(creds|sts)/" + framework.GenericNameWithAtRegex("name"), Fields: map[string]*framework.FieldSchema{ "name": &framework.FieldSchema{ Type: framework.TypeString, diff --git a/builtin/logical/pki/backend_test.go b/builtin/logical/pki/backend_test.go index 7a05ce434fc8..a636db5ee6ea 100644 --- a/builtin/logical/pki/backend_test.go +++ b/builtin/logical/pki/backend_test.go @@ -2170,7 +2170,7 @@ func TestBackend_OID_SANs(t *testing.T) { resp, err = client.Logical().Write("root/issue/test", map[string]interface{}{ "common_name": "foobar.com", "ip_sans": "1.2.3.4", - "alt_names": "foo.foobar.com,bar.foobar.com", + "alt_names": "foobar.com,foo.foobar.com,bar.foobar.com", "ttl": "1h", }) if err != nil { @@ -2185,9 +2185,10 @@ func TestBackend_OID_SANs(t *testing.T) { if cert.IPAddresses[0].String() != "1.2.3.4" { t.Fatalf("unexpected IP SAN %q", cert.IPAddresses[0].String()) } - if cert.DNSNames[0] != "foobar.com" || - cert.DNSNames[1] != "bar.foobar.com" || - cert.DNSNames[2] != "foo.foobar.com" { + if len(cert.DNSNames) != 3 || + cert.DNSNames[0] != "bar.foobar.com" || + cert.DNSNames[1] != "foo.foobar.com" || + cert.DNSNames[2] != "foobar.com" { t.Fatalf("unexpected DNS SANs %v", cert.DNSNames) } @@ -2272,9 +2273,10 @@ func TestBackend_OID_SANs(t *testing.T) { if cert.IPAddresses[0].String() != "1.2.3.4" { t.Fatalf("unexpected IP SAN %q", cert.IPAddresses[0].String()) } - if cert.DNSNames[0] != "foobar.com" || - cert.DNSNames[1] != "bar.foobar.com" || - cert.DNSNames[2] != "foo.foobar.com" { + if len(cert.DNSNames) != 3 || + cert.DNSNames[0] != "bar.foobar.com" || + cert.DNSNames[1] != "foo.foobar.com" || + cert.DNSNames[2] != "foobar.com" { t.Fatalf("unexpected DNS SANs %v", cert.DNSNames) } t.Logf("certificate 1 to check:\n%s", certStr) @@ -2299,9 +2301,10 @@ func TestBackend_OID_SANs(t *testing.T) { if cert.IPAddresses[0].String() != "1.2.3.4" { t.Fatalf("unexpected IP SAN %q", cert.IPAddresses[0].String()) } - if cert.DNSNames[0] != "foobar.com" || - cert.DNSNames[1] != "bar.foobar.com" || - cert.DNSNames[2] != "foo.foobar.com" { + if len(cert.DNSNames) != 3 || + cert.DNSNames[0] != "bar.foobar.com" || + cert.DNSNames[1] != "foo.foobar.com" || + cert.DNSNames[2] != "foobar.com" { t.Fatalf("unexpected DNS SANs %v", cert.DNSNames) } t.Logf("certificate 2 to check:\n%s", certStr) @@ -2326,9 +2329,10 @@ func TestBackend_OID_SANs(t *testing.T) { if cert.IPAddresses[0].String() != "1.2.3.4" { t.Fatalf("unexpected IP SAN %q", cert.IPAddresses[0].String()) } - if cert.DNSNames[0] != "foobar.com" || - cert.DNSNames[1] != "bar.foobar.com" || - cert.DNSNames[2] != "foo.foobar.com" { + if len(cert.DNSNames) != 3 || + cert.DNSNames[0] != "bar.foobar.com" || + cert.DNSNames[1] != "foo.foobar.com" || + cert.DNSNames[2] != "foobar.com" { t.Fatalf("unexpected DNS SANs %v", cert.DNSNames) } t.Logf("certificate 3 to check:\n%s", certStr) diff --git a/builtin/logical/pki/cert_util.go b/builtin/logical/pki/cert_util.go index b82c28539f8d..94030f7f85cf 100644 --- a/builtin/logical/pki/cert_util.go +++ b/builtin/logical/pki/cert_util.go @@ -906,8 +906,8 @@ func generateCreationBundle(b *backend, data *inputBundle, caSign *certutil.CAIn creation := &certutil.CreationBundle{ Params: &certutil.CreationParameters{ Subject: subject, - DNSNames: dnsNames, - EmailAddresses: emailAddresses, + DNSNames: strutil.RemoveDuplicates(dnsNames, false), + EmailAddresses: strutil.RemoveDuplicates(emailAddresses, false), IPAddresses: ipAddresses, URIs: URIs, OtherSANs: otherSANs, diff --git a/builtin/logical/rabbitmq/backend_test.go b/builtin/logical/rabbitmq/backend_test.go index 3e6a27b2b0b5..ac76267f8785 100644 --- a/builtin/logical/rabbitmq/backend_test.go +++ b/builtin/logical/rabbitmq/backend_test.go @@ -23,6 +23,12 @@ const ( envRabbitMQPassword = "RABBITMQ_PASSWORD" ) +const ( + testTags = "administrator" + testVHosts = `{"/": {"configure": ".*", "write": ".*", "read": ".*"}}` + testVHostTopics = `{"/": {"amq.topic": {"write": ".*", "read": ".*"}}}` +) + func prepareRabbitMQTestContainer(t *testing.T) (func(), string, int) { if os.Getenv(envRabbitMQConnectionURI) != "" { return func() {}, os.Getenv(envRabbitMQConnectionURI), 0 @@ -107,9 +113,9 @@ func TestBackend_roleCrud(t *testing.T) { Steps: []logicaltest.TestStep{ testAccStepConfig(t, uri), testAccStepRole(t), - testAccStepReadRole(t, "web", "administrator", `{"/": {"configure": ".*", "write": ".*", "read": ".*"}}`), + testAccStepReadRole(t, "web", testTags, testVHosts, testVHostTopics), testAccStepDeleteRole(t, "web"), - testAccStepReadRole(t, "web", "", ""), + testAccStepReadRole(t, "web", "", "", ""), }, }) } @@ -148,8 +154,9 @@ func testAccStepRole(t *testing.T) logicaltest.TestStep { Operation: logical.UpdateOperation, Path: "roles/web", Data: map[string]interface{}{ - "tags": "administrator", - "vhosts": `{"/": {"configure": ".*", "write": ".*", "read": ".*"}}`, + "tags": testTags, + "vhosts": testVHosts, + "vhost_topics": testVHostTopics, }, } } @@ -218,13 +225,13 @@ func testAccStepReadCreds(t *testing.T, b logical.Backend, uri, name string) log } } -func testAccStepReadRole(t *testing.T, name, tags, rawVHosts string) logicaltest.TestStep { +func testAccStepReadRole(t *testing.T, name, tags, rawVHosts string, rawVHostTopics string) logicaltest.TestStep { return logicaltest.TestStep{ Operation: logical.ReadOperation, Path: "roles/" + name, Check: func(resp *logical.Response) error { if resp == nil { - if tags == "" && rawVHosts == "" { + if tags == "" && rawVHosts == "" && rawVHostTopics == "" { return nil } @@ -232,8 +239,9 @@ func testAccStepReadRole(t *testing.T, name, tags, rawVHosts string) logicaltest } var d struct { - Tags string `mapstructure:"tags"` - VHosts map[string]vhostPermission `mapstructure:"vhosts"` + Tags string `mapstructure:"tags"` + VHosts map[string]vhostPermission `mapstructure:"vhosts"` + VHostTopics map[string]map[string]vhostTopicPermission `mapstructure:"vhost_topics"` } if err := mapstructure.Decode(resp.Data, &d); err != nil { return err @@ -267,6 +275,33 @@ func testAccStepReadRole(t *testing.T, name, tags, rawVHosts string) logicaltest } } + var vhostTopics map[string]map[string]vhostTopicPermission + if err := jsonutil.DecodeJSON([]byte(rawVHostTopics), &vhostTopics); err != nil { + return fmt.Errorf("bad expected vhostTopics %#v: %s", vhostTopics, err) + } + + for host, permissions := range vhostTopics { + for exchange, permission := range permissions { + actualPermissions, ok := d.VHostTopics[host] + if !ok { + return fmt.Errorf("expected vhost topics: %s", host) + } + + actualPermission, ok := actualPermissions[exchange] + if !ok { + return fmt.Errorf("expected vhost topic exchange: %s", exchange) + } + + if actualPermission.Write != permission.Write { + return fmt.Errorf("expected permission %s to be %s, got %s", "write", permission.Write, actualPermission.Write) + } + + if actualPermission.Read != permission.Read { + return fmt.Errorf("expected permission %s to be %s, got %s", "read", permission.Read, actualPermission.Read) + } + } + } + return nil }, } diff --git a/builtin/logical/rabbitmq/path_role_create.go b/builtin/logical/rabbitmq/path_role_create.go index e4c930457775..71b211f14b80 100644 --- a/builtin/logical/rabbitmq/path_role_create.go +++ b/builtin/logical/rabbitmq/path_role_create.go @@ -93,6 +93,25 @@ func (b *backend) pathCredsRead(ctx context.Context, req *logical.Request, d *fr } } + // If the role had vhost topic permissions specified, assign those permissions + // to the created username for respective vhosts and exchange. + for vhost, permissions := range role.VHostTopics { + for exchange, permission := range permissions { + if _, err := client.UpdateTopicPermissionsIn(vhost, username, rabbithole.TopicPermissions{ + Exchange: exchange, + Write: permission.Write, + Read: permission.Read, + }); err != nil { + outerErr := errwrap.Wrapf(fmt.Sprintf("failed to update topic permissions to the %q user: {{err}}", username), err) + // Delete the user because it's in an unknown state + if _, rmErr := client.DeleteUser(username); rmErr != nil { + return nil, multierror.Append(errwrap.Wrapf("failed to delete user: {{err}}", rmErr), outerErr) + } + return nil, outerErr + } + } + } + // Return the secret resp := b.Secret(SecretCredsType).Response(map[string]interface{}{ "username": username, diff --git a/builtin/logical/rabbitmq/path_roles.go b/builtin/logical/rabbitmq/path_roles.go index 704ed456b367..6f16eba4944a 100644 --- a/builtin/logical/rabbitmq/path_roles.go +++ b/builtin/logical/rabbitmq/path_roles.go @@ -37,6 +37,10 @@ func pathRoles(b *backend) *framework.Path { Type: framework.TypeString, Description: "A map of virtual hosts to permissions.", }, + "vhost_topics": &framework.FieldSchema{ + Type: framework.TypeString, + Description: "A nested map of virtual hosts and exchanges to topic permissions.", + }, }, Callbacks: map[logical.Operation]framework.OperationFunc{ logical.ReadOperation: b.pathRoleRead, @@ -115,7 +119,9 @@ func (b *backend) pathRoleUpdate(ctx context.Context, req *logical.Request, d *f tags := d.Get("tags").(string) rawVHosts := d.Get("vhosts").(string) + rawVHostTopics := d.Get("vhost_topics").(string) + // Either tags or VHost permissions are always required, but topic permissions are always optional. if tags == "" && rawVHosts == "" { return logical.ErrorResponse("both tags and vhosts not specified"), nil } @@ -127,10 +133,18 @@ func (b *backend) pathRoleUpdate(ctx context.Context, req *logical.Request, d *f } } + var vhostTopics map[string]map[string]vhostTopicPermission + if len(rawVHostTopics) > 0 { + if err := jsonutil.DecodeJSON([]byte(rawVHostTopics), &vhostTopics); err != nil { + return logical.ErrorResponse(fmt.Sprintf("failed to unmarshal vhost_topics: %s", err)), nil + } + } + // Store it entry, err := logical.StorageEntryJSON("role/"+name, &roleEntry{ - Tags: tags, - VHosts: vhosts, + Tags: tags, + VHosts: vhosts, + VHostTopics: vhostTopics, }) if err != nil { return nil, err @@ -142,10 +156,15 @@ func (b *backend) pathRoleUpdate(ctx context.Context, req *logical.Request, d *f return nil, nil } -// Role that defines the capabilities of the credentials issued against it +// Role that defines the capabilities of the credentials issued against it. +// Maps are used because the names of vhosts and exchanges will vary widely. +// VHosts is a map with a vhost name as key and the permissions as value. +// VHostTopics is a nested map with vhost name and exchange name as keys and +// the topic permissions as value. type roleEntry struct { - Tags string `json:"tags" structs:"tags" mapstructure:"tags"` - VHosts map[string]vhostPermission `json:"vhosts" structs:"vhosts" mapstructure:"vhosts"` + Tags string `json:"tags" structs:"tags" mapstructure:"tags"` + VHosts map[string]vhostPermission `json:"vhosts" structs:"vhosts" mapstructure:"vhosts"` + VHostTopics map[string]map[string]vhostTopicPermission `json:"vhost_topics" structs:"vhost_topics" mapstructure:"vhost_topics"` } // Structure representing the permissions of a vhost @@ -155,6 +174,12 @@ type vhostPermission struct { Read string `json:"read" structs:"read" mapstructure:"read"` } +// Structure representing the topic permissions of an exchange +type vhostTopicPermission struct { + Write string `json:"write" structs:"write" mapstructure:"write"` + Read string `json:"read" structs:"read" mapstructure:"read"` +} + const pathRoleHelpSyn = ` Manage the roles that can be created with this backend. ` @@ -178,4 +203,24 @@ passed as a string in the form: "read": ".*" } } +The "vhost_topics" parameter customizes the topic permissions that this user +will be granted. This is a JSON object passed as a string in the form: +{ + "vhostOne": { + "exchangeOneOne": { + "write": ".*", + "read": ".*" + }, + "exchangeOneTwo": { + "write": ".*", + "read": ".*" + } + }, + "vhostTwo": { + "exchangeTwoOne": { + "write": ".*", + "read": ".*" + } + } +} ` diff --git a/command/agent.go b/command/agent.go index e2ebbf75dbf2..df36cea7ecc6 100644 --- a/command/agent.go +++ b/command/agent.go @@ -260,6 +260,12 @@ func (c *AgentCommand) Run(args []string) int { Default: false, EnvVar: api.EnvVaultSkipVerify, }) + c.setStringFlag(f, config.Vault.TLSServerName, &StringVar{ + Name: flagTLSServerName, + Target: &c.flagTLSServerName, + Default: "", + EnvVar: api.EnvVaultTLSServerName, + }) infoKeys := make([]string, 0, 10) info := make(map[string]string) diff --git a/command/agent/agentint/renewer.go b/command/agent/agentint/renewer.go deleted file mode 100644 index 3f280f608883..000000000000 --- a/command/agent/agentint/renewer.go +++ /dev/null @@ -1,378 +0,0 @@ -package agentint - -import ( - "errors" - "math/rand" - "sync" - "time" - - "github.com/hashicorp/vault/api" -) - -var ( - ErrRenewerMissingInput = errors.New("missing input to renewer") - ErrRenewerMissingSecret = errors.New("missing secret to renew") - ErrRenewerNotRenewable = errors.New("secret is not renewable") - ErrRenewerNoSecretData = errors.New("returned empty secret data") - - // DefaultRenewerRenewBuffer is the default size of the buffer for renew - // messages on the channel. - DefaultRenewerRenewBuffer = 5 -) - -// Renewer is a process for renewing a secret. -// -// renewer, err := client.NewRenewer(&RenewerInput{ -// Secret: mySecret, -// }) -// go renewer.Renew() -// defer renewer.Stop() -// -// for { -// select { -// case err := <-renewer.DoneCh(): -// if err != nil { -// log.Fatal(err) -// } -// -// // Renewal is now over -// case renewal := <-renewer.RenewCh(): -// log.Printf("Successfully renewed: %#v", renewal) -// } -// } -// -// -// The `DoneCh` will return if renewal fails or if the remaining lease duration -// after a renewal is less than or equal to the grace (in number of seconds). -// In both cases, the caller should attempt a re-read of the secret or -// reauthenticate to get a new token. Clients should check the return value of -// the channel to see if renewal was successful. -type Renewer struct { - l sync.Mutex - - client *api.Client - secret *api.Secret - grace time.Duration - random *rand.Rand - increment int - doneCh chan error - renewCh chan *renewOutput - - stopped bool - stopCh chan struct{} -} - -// RenewerInput is used as input to the renew function. -type RenewerInput struct { - // Secret is the secret to renew - Secret *api.Secret - - // DEPRECATED: this does not do anything. - Grace time.Duration - - // Rand is the randomizer to use for underlying randomization. If not - // provided, one will be generated and seeded automatically. If provided, it - // is assumed to have already been seeded. - Rand *rand.Rand - - // RenewBuffer is the size of the buffered channel where renew messages are - // dispatched. - RenewBuffer int - - // The new TTL, in seconds, that should be set on the lease. The TTL set - // here may or may not be honored by the vault server, based on Vault - // configuration or any associated max TTL values. - Increment int -} - -// renewOutput is the metadata returned to the client (if it's listening) to -// renew messages. -type renewOutput struct { - // RenewedAt is the timestamp when the renewal took place (UTC). - RenewedAt time.Time - - // Secret is the underlying renewal data. It's the same struct as all data - // that is returned from Vault, but since this is renewal data, it will not - // usually include the secret itself. - Secret *api.Secret -} - -// NewRenewer creates a new Renewer from the given input. -func NewRenewer(c *api.Client, i *RenewerInput) (*Renewer, error) { - if i == nil { - return nil, ErrRenewerMissingInput - } - - secret := i.Secret - if secret == nil { - return nil, ErrRenewerMissingSecret - } - - random := i.Rand - if random == nil { - random = rand.New(rand.NewSource(int64(time.Now().Nanosecond()))) - } - - renewBuffer := i.RenewBuffer - if renewBuffer == 0 { - renewBuffer = DefaultRenewerRenewBuffer - } - - return &Renewer{ - client: c, - secret: secret, - increment: i.Increment, - random: random, - doneCh: make(chan error, 1), - renewCh: make(chan *renewOutput, renewBuffer), - - stopped: false, - stopCh: make(chan struct{}), - }, nil -} - -// DoneCh returns the channel where the Renewer will publish when renewal stops. -// If there is an error, this will be an error. -func (r *Renewer) DoneCh() <-chan error { - return r.doneCh -} - -// RenewCh is a channel that receives a message when a successful renewal takes -// place and includes metadata about the renewal. -func (r *Renewer) RenewCh() <-chan *renewOutput { - return r.renewCh -} - -// Stop stops the Renewer. -func (r *Renewer) Stop() { - r.l.Lock() - if !r.stopped { - close(r.stopCh) - r.stopped = true - } - r.l.Unlock() -} - -// Renew starts a background process for renewing this secret. When the secret -// has auth data, this attempts to renew the auth (token). When the secret has -// a lease, this attempts to renew the lease. -func (r *Renewer) Renew() { - var result error - if r.secret.Auth != nil { - result = r.renewAuth() - } else { - result = r.renewLease() - } - - r.doneCh <- result -} - -// renewAuth is a helper for renewing authentication. -func (r *Renewer) renewAuth() error { - if r.secret.Auth.ClientToken == "" { - return ErrRenewerNotRenewable - } - - nonRenewable := !r.secret.Auth.Renewable - - initialTime := time.Now() - priorDuration := time.Duration(r.secret.Auth.LeaseDuration) * time.Second - r.calculateGrace(priorDuration) - - client, token := r.client, r.secret.Auth.ClientToken - - for { - // Check if we are stopped. - select { - case <-r.stopCh: - return nil - default: - } - - var leaseDuration time.Duration - - switch { - case nonRenewable: - // Can't renew, just keep same expiration so we exit when it's - // reauthentication time - leaseDuration = initialTime.Add(priorDuration).Sub(time.Now()) - - // Push a message that a renewal took place. - default: - renewal, err := client.Auth().Token().RenewTokenAsSelf(token, r.increment) - if err != nil { - return err - } - - // Push a message that a renewal took place. - select { - case r.renewCh <- &renewOutput{time.Now().UTC(), renewal}: - default: - } - - // Somehow, sometimes, this happens. - if renewal == nil || renewal.Auth == nil { - return ErrRenewerNoSecretData - } - - // Do nothing if we are not renewable - if !renewal.Auth.Renewable { - return ErrRenewerNotRenewable - } - - // Grab the lease duration - leaseDuration = time.Duration(renewal.Auth.LeaseDuration) * time.Second - } - - // We keep evaluating a new grace period so long as the lease is - // extending. Once it stops extending, we've hit the max and need to - // rely on the grace duration. - if leaseDuration > priorDuration { - r.calculateGrace(leaseDuration) - } - priorDuration = leaseDuration - - // The sleep duration is set to 2/3 of the current lease duration plus - // 1/3 of the current grace period, which adds jitter. - sleepDuration := time.Duration(float64(leaseDuration.Nanoseconds())*2/3 + float64(r.grace.Nanoseconds())/3) - - // If we are within grace, return now; or, if the amount of time we - // would sleep would land us in the grace period. This helps with short - // tokens; for example, you don't want a current lease duration of 4 - // seconds, a grace period of 3 seconds, and end up sleeping for more - // than three of those seconds and having a very small budget of time - // to renew. - if leaseDuration <= r.grace || leaseDuration-sleepDuration <= r.grace { - return nil - } - - select { - case <-r.stopCh: - return nil - case <-time.After(sleepDuration): - continue - } - } -} - -// renewLease is a helper for renewing a lease. -func (r *Renewer) renewLease() error { - if r.secret.LeaseID == "" { - return ErrRenewerNotRenewable - } - - nonRenewable := !r.secret.Renewable - - initialTime := time.Now() - priorDuration := time.Duration(r.secret.LeaseDuration) * time.Second - r.calculateGrace(priorDuration) - - client, leaseID := r.client, r.secret.LeaseID - - for { - // Check if we are stopped. - select { - case <-r.stopCh: - return nil - default: - } - - var leaseDuration time.Duration - - switch { - case nonRenewable: - // Can't renew, just keep same expiration so we exit when it's - // reread time - leaseDuration = initialTime.Add(priorDuration).Sub(time.Now()) - - default: - // Renew the lease. - renewal, err := client.Sys().Renew(leaseID, r.increment) - if err != nil { - return err - } - - // Push a message that a renewal took place. - select { - case r.renewCh <- &renewOutput{time.Now().UTC(), renewal}: - default: - } - - // Somehow, sometimes, this happens. - if renewal == nil { - return ErrRenewerNoSecretData - } - - // Do nothing if we are not renewable - if !renewal.Renewable { - return ErrRenewerNotRenewable - } - - // Grab the lease duration - leaseDuration = time.Duration(renewal.LeaseDuration) * time.Second - } - - // We keep evaluating a new grace period so long as the lease is - // extending. Once it stops extending, we've hit the max and need to - // rely on the grace duration. - if leaseDuration > priorDuration { - r.calculateGrace(leaseDuration) - } - priorDuration = leaseDuration - - // The sleep duration is set to 2/3 of the current lease duration plus - // 1/3 of the current grace period, which adds jitter. - sleepDuration := time.Duration(float64(leaseDuration.Nanoseconds())*2/3 + float64(r.grace.Nanoseconds())/3) - - // If we are within grace, return now; or, if the amount of time we - // would sleep would land us in the grace period. This helps with short - // tokens; for example, you don't want a current lease duration of 4 - // seconds, a grace period of 3 seconds, and end up sleeping for more - // than three of those seconds and having a very small budget of time - // to renew. - if leaseDuration <= r.grace || leaseDuration-sleepDuration <= r.grace { - return nil - } - - select { - case <-r.stopCh: - return nil - case <-time.After(sleepDuration): - continue - } - } -} - -// sleepDuration calculates the time to sleep given the base lease duration. The -// base is the resulting lease duration. It will be reduced to 1/3 and -// multiplied by a random float between 0.0 and 1.0. This extra randomness -// prevents multiple clients from all trying to renew simultaneously. -func (r *Renewer) sleepDuration(base time.Duration) time.Duration { - sleep := float64(base) - - // Renew at 1/3 the remaining lease. This will give us an opportunity to retry - // at least one more time should the first renewal fail. - sleep = sleep / 3.0 - - // Use a randomness so many clients do not hit Vault simultaneously. - sleep = sleep * (r.random.Float64() + 1) / 2.0 - - return time.Duration(sleep) -} - -// calculateGrace calculates the grace period based on a reasonable set of -// assumptions given the total lease time; it also adds some jitter to not have -// clients be in sync. -func (r *Renewer) calculateGrace(leaseDuration time.Duration) { - if leaseDuration == 0 { - r.grace = 0 - return - } - - leaseNanos := float64(leaseDuration.Nanoseconds()) - jitterMax := 0.1 * leaseNanos - - // For a given lease duration, we want to allow 80-90% of that to elapse, - // so the remaining amount is the grace period - r.grace = time.Duration(jitterMax) + time.Duration(uint64(r.random.Int63())%uint64(jitterMax)) -} diff --git a/command/agent/auth/auth.go b/command/agent/auth/auth.go index c293f91f9e70..3b5460df352f 100644 --- a/command/agent/auth/auth.go +++ b/command/agent/auth/auth.go @@ -7,7 +7,6 @@ import ( hclog "github.com/hashicorp/go-hclog" "github.com/hashicorp/vault/api" - "github.com/hashicorp/vault/command/agent/agentint" "github.com/hashicorp/vault/sdk/helper/jsonutil" ) @@ -106,7 +105,7 @@ func (ah *AuthHandler) Run(ctx context.Context, am AuthMethod) { credCh = make(chan struct{}) } - var renewer *agentint.Renewer + var watcher *api.LifetimeWatcher for { select { @@ -205,44 +204,44 @@ func (ah *AuthHandler) Run(ctx context.Context, am AuthMethod) { am.CredSuccess() } - if renewer != nil { - renewer.Stop() + if watcher != nil { + watcher.Stop() } - renewer, err = agentint.NewRenewer(ah.client, &agentint.RenewerInput{ + watcher, err = ah.client.NewLifetimeWatcher(&api.LifetimeWatcherInput{ Secret: secret, }) if err != nil { - ah.logger.Error("error creating renewer, backing off and retrying", "error", err, "backoff", backoff.Seconds()) + ah.logger.Error("error creating lifetime watcher, backing off and retrying", "error", err, "backoff", backoff.Seconds()) backoffOrQuit(ctx, backoff) continue } // Start the renewal process ah.logger.Info("starting renewal process") - go renewer.Renew() + go watcher.Renew() - RenewerLoop: + LifetimeWatcherLoop: for { select { case <-ctx.Done(): - ah.logger.Info("shutdown triggered, stopping renewer") - renewer.Stop() - break RenewerLoop + ah.logger.Info("shutdown triggered, stopping lifetime watcher") + watcher.Stop() + break LifetimeWatcherLoop - case err := <-renewer.DoneCh(): - ah.logger.Info("renewer done channel triggered") + case err := <-watcher.DoneCh(): + ah.logger.Info("lifetime watcher done channel triggered") if err != nil { ah.logger.Error("error renewing token", "error", err) } - break RenewerLoop + break LifetimeWatcherLoop - case <-renewer.RenewCh(): + case <-watcher.RenewCh(): ah.logger.Info("renewed auth token") case <-credCh: ah.logger.Info("auth method found new credentials, re-authenticating") - break RenewerLoop + break LifetimeWatcherLoop } } } diff --git a/command/agent/cache/lease_cache.go b/command/agent/cache/lease_cache.go index a03534d316d6..c20a03ed1bb5 100644 --- a/command/agent/cache/lease_cache.go +++ b/command/agent/cache/lease_cache.go @@ -18,7 +18,6 @@ import ( "github.com/hashicorp/errwrap" hclog "github.com/hashicorp/go-hclog" "github.com/hashicorp/vault/api" - "github.com/hashicorp/vault/command/agent/agentint" cachememdb "github.com/hashicorp/vault/command/agent/cache/cachememdb" "github.com/hashicorp/vault/helper/namespace" nshelper "github.com/hashicorp/vault/helper/namespace" @@ -343,10 +342,10 @@ func (c *LeaseCache) Send(ctx context.Context, req *SendRequest) (*SendResponse, // Set the index's Response index.Response = respBytes.Bytes() - // Store the index ID in the renewer context + // Store the index ID in the lifetimewatcher context renewCtx := context.WithValue(renewCtxInfo.Ctx, contextIndexID, index.ID) - // Store the renewer context in the index + // Store the lifetime watcher context in the index index.RenewCtxInfo = &cachememdb.ContextInfo{ Ctx: renewCtx, CancelFunc: renewCtxInfo.CancelFunc, @@ -389,23 +388,23 @@ func (c *LeaseCache) startRenewing(ctx context.Context, index *cachememdb.Index, client, err := c.client.Clone() if err != nil { - c.logger.Error("failed to create API client in the renewer", "error", err) + c.logger.Error("failed to create API client in the lifetime watcher", "error", err) return } client.SetToken(req.Token) client.SetHeaders(req.Request.Header) - renewer, err := agentint.NewRenewer(client, &agentint.RenewerInput{ + watcher, err := client.NewLifetimeWatcher(&api.LifetimeWatcherInput{ Secret: secret, }) if err != nil { - c.logger.Error("failed to create secret renewer", "error", err) + c.logger.Error("failed to create secret lifetime watcher", "error", err) return } c.logger.Debug("initiating renewal", "method", req.Request.Method, "path", req.Request.URL.Path) - go renewer.Renew() - defer renewer.Stop() + go watcher.Start() + defer watcher.Stop() for { select { @@ -413,9 +412,9 @@ func (c *LeaseCache) startRenewing(ctx context.Context, index *cachememdb.Index, // This is the case which captures context cancellations from token // and leases. Since all the contexts are derived from the agent's // context, this will also cover the shutdown scenario. - c.logger.Debug("context cancelled; stopping renewer", "path", req.Request.URL.Path) + c.logger.Debug("context cancelled; stopping lifetime watcher", "path", req.Request.URL.Path) return - case err := <-renewer.DoneCh(): + case err := <-watcher.DoneCh(): // This case covers renewal completion and renewal errors if err != nil { c.logger.Error("failed to renew secret", "error", err) @@ -423,7 +422,7 @@ func (c *LeaseCache) startRenewing(ctx context.Context, index *cachememdb.Index, } c.logger.Debug("renewal halted; evicting from cache", "path", req.Request.URL.Path) return - case <-renewer.RenewCh(): + case <-watcher.RenewCh(): c.logger.Debug("secret renewed", "path", req.Request.URL.Path) case <-index.RenewCtxInfo.DoneCh: // This case indicates the renewal process to shutdown and evict @@ -522,7 +521,7 @@ func (c *LeaseCache) handleCacheClear(ctx context.Context, in *cacheClearInput) } // Find all the cached entries which has the given request path and - // cancel the contexts of all the respective renewers + // cancel the contexts of all the respective lifetime watchers indexes, err := c.db.GetByPrefix(cachememdb.IndexNameRequestPath, in.Namespace, in.RequestPath) if err != nil { return err @@ -554,7 +553,8 @@ func (c *LeaseCache) handleCacheClear(ctx context.Context, in *cacheClearInput) return errors.New("token accessor not provided") } - // Get the cached index and cancel the corresponding renewer context + // Get the cached index and cancel the corresponding lifetime watcher + // context index, err := c.db.Get(cachememdb.IndexNameTokenAccessor, in.TokenAccessor) if err != nil { return err @@ -572,7 +572,8 @@ func (c *LeaseCache) handleCacheClear(ctx context.Context, in *cacheClearInput) return errors.New("lease not provided") } - // Get the cached index and cancel the corresponding renewer context + // Get the cached index and cancel the corresponding lifetime watcher + // context index, err := c.db.Get(cachememdb.IndexNameLease, in.Lease) if err != nil { return err @@ -698,7 +699,8 @@ func (c *LeaseCache) handleRevocationRequest(ctx context.Context, req *SendReque return false, fmt.Errorf("expected token in the request body to be string") } - // Kill the renewers of all the leases attached to the revoked token + // Kill the lifetime watchers of all the leases attached to the revoked + // token indexes, err := c.db.GetByPrefix(cachememdb.IndexNameLeaseToken, token) if err != nil { return false, err @@ -707,7 +709,7 @@ func (c *LeaseCache) handleRevocationRequest(ctx context.Context, req *SendReque index.RenewCtxInfo.CancelFunc() } - // Kill the renewer of the revoked token + // Kill the lifetime watchers of the revoked token index, err := c.db.Get(cachememdb.IndexNameToken, token) if err != nil { return false, err @@ -716,9 +718,9 @@ func (c *LeaseCache) handleRevocationRequest(ctx context.Context, req *SendReque return true, nil } - // Indicate the renewer goroutine for this index to return. This will - // not affect the child tokens because the context is not getting - // cancelled. + // Indicate the lifetime watcher goroutine for this index to return. + // This will not affect the child tokens because the context is not + // getting cancelled. close(index.RenewCtxInfo.DoneCh) // Clear the parent references of the revoked token in the entries @@ -763,7 +765,7 @@ func (c *LeaseCache) handleRevocationRequest(ctx context.Context, req *SendReque // Trim the URL path to get the request path prefix prefix := strings.TrimPrefix(path, vaultPathLeaseRevokeForce) // Get all the cache indexes that use the request path containing the - // prefix and cancel the renewer context of each. + // prefix and cancel the lifetime watcher context of each. indexes, err := c.db.GetByPrefix(cachememdb.IndexNameLease, prefix) if err != nil { return false, err @@ -782,7 +784,7 @@ func (c *LeaseCache) handleRevocationRequest(ctx context.Context, req *SendReque // Trim the URL path to get the request path prefix prefix := strings.TrimPrefix(path, vaultPathLeaseRevokePrefix) // Get all the cache indexes that use the request path containing the - // prefix and cancel the renewer context of each. + // prefix and cancel the lifetime watcher context of each. indexes, err := c.db.GetByPrefix(cachememdb.IndexNameLease, prefix) if err != nil { return false, err diff --git a/command/agent/config/config.go b/command/agent/config/config.go index 97da8170b235..8ce02b054e43 100644 --- a/command/agent/config/config.go +++ b/command/agent/config/config.go @@ -38,6 +38,7 @@ type Vault struct { TLSSkipVerifyRaw interface{} `hcl:"tls_skip_verify"` ClientCert string `hcl:"client_cert"` ClientKey string `hcl:"client_key"` + TLSServerName string `hcl:"tls_server_name"` } // Cache contains any configuration needed for Cache mode diff --git a/command/base.go b/command/base.go index 42490eeb3b91..5314d325cc4c 100644 --- a/command/base.go +++ b/command/base.go @@ -296,7 +296,7 @@ func (c *BaseCommand) flagSet(bit FlagSetBit) *FlagSets { }) f.StringVar(&StringVar{ - Name: "tls-server-name", + Name: flagTLSServerName, Target: &c.flagTLSServerName, Default: "", EnvVar: api.EnvVaultTLSServerName, diff --git a/command/commands.go b/command/commands.go index 5dc5abe0feac..745ae8851d41 100644 --- a/command/commands.go +++ b/command/commands.go @@ -88,6 +88,9 @@ const ( // flagNameTLSSkipVerify is the flag used in the base command to read in // the option to ignore TLS certificate verification. flagNameTLSSkipVerify = "tls-skip-verify" + // flagTLSServerName is the flag used in the base command to read in + // the TLS server name. + flagTLSServerName = "tls-server-name" // flagNameAuditNonHMACRequestKeys is the flag name used for auth/secrets enable flagNameAuditNonHMACRequestKeys = "audit-non-hmac-request-keys" // flagNameAuditNonHMACResponseKeys is the flag name used for auth/secrets enable diff --git a/command/debug.go b/command/debug.go index aa2fc1d48b7f..3fd54ea4f99e 100644 --- a/command/debug.go +++ b/command/debug.go @@ -814,7 +814,8 @@ func (c *DebugCommand) collectReplicationStatus(ctx context.Context) { if err != nil { c.captureError("replication-status", err) } - if replicationEntry := secret.Data; replicationEntry != nil { + if secret != nil && secret.Data != nil { + replicationEntry := secret.Data replicationEntry["timestamp"] = time.Now().UTC() c.replicationStatusCollection = append(c.replicationStatusCollection, replicationEntry) } diff --git a/command/server_test.go b/command/server_test.go index 4722d0f63fc6..cddbdd5ae7ed 100644 --- a/command/server_test.go +++ b/command/server_test.go @@ -1,4 +1,4 @@ -// +build !race,!hsm +// +build !race !hsm // NOTE: we can't use this with HSM. We can't set testing mode on and it's not // safe to use env vars since that provides an attack vector in the real world. @@ -12,7 +12,6 @@ import ( "crypto/x509" "fmt" "io/ioutil" - "net" "os" "strings" "sync" @@ -24,23 +23,6 @@ import ( "github.com/mitchellh/cli" ) -func testRandomPort(tb testing.TB) int { - tb.Helper() - - addr, err := net.ResolveTCPAddr("tcp", "127.0.0.1:0") - if err != nil { - tb.Fatal(err) - } - - l, err := net.ListenTCP("tcp", addr) - if err != nil { - tb.Fatal(err) - } - defer l.Close() - - return l.Addr().(*net.TCPAddr).Port -} - func testBaseHCL(tb testing.TB, listenerExtras string) string { tb.Helper() @@ -51,7 +33,7 @@ func testBaseHCL(tb testing.TB, listenerExtras string) string { tls_disable = "true" %s } - `, testRandomPort(tb), listenerExtras)) + `, 0, listenerExtras)) } const ( diff --git a/command/token_create.go b/command/token_create.go index 3192cd9f282a..10b4e92dfdac 100644 --- a/command/token_create.go +++ b/command/token_create.go @@ -69,8 +69,8 @@ func (c *TokenCreateCommand) Flags() *FlagSets { Name: "id", Target: &c.flagID, Completion: complete.PredictAnything, - Usage: "Value for the token. By default, this is an auto-generated 36 " + - "character UUID. Specifying this value requires sudo permissions.", + Usage: "Value for the token. By default, this is an auto-generated " + + "string. Specifying this value requires sudo permissions.", }) f.StringVar(&StringVar{ diff --git a/go.mod b/go.mod index d4b28e3a2c76..ea6a44699d9f 100644 --- a/go.mod +++ b/go.mod @@ -14,11 +14,12 @@ require ( github.com/Azure/go-autorest v11.7.1+incompatible github.com/NYTimes/gziphandler v1.1.1 github.com/SAP/go-hdb v0.14.1 + github.com/StackExchange/wmi v0.0.0-20180116203802-5d049714c4a6 // indirect github.com/abdullin/seq v0.0.0-20160510034733-d5467c17e7af // indirect github.com/aliyun/alibaba-cloud-sdk-go v0.0.0-20190620160927-9418d7b0cd0f github.com/aliyun/aliyun-oss-go-sdk v0.0.0-20190307165228-86c17b95fcd5 github.com/apple/foundationdb/bindings/go v0.0.0-20190411004307-cd5c9d91fad2 - github.com/armon/go-metrics v0.0.0-20190430140413-ec5e00d3c878 + github.com/armon/go-metrics v0.3.0 github.com/armon/go-proxyproto v0.0.0-20190211145416-68259f75880e github.com/armon/go-radix v1.0.0 github.com/asaskevich/govalidator v0.0.0-20180720115003-f9ffefc3facf @@ -29,7 +30,6 @@ require ( github.com/cockroachdb/apd v1.1.0 // indirect github.com/cockroachdb/cockroach-go v0.0.0-20181001143604-e0a95dfd547c github.com/coreos/go-semver v0.2.0 - github.com/coreos/go-systemd v0.0.0-20181012123002-c6f51f82210d // indirect github.com/denisenkom/go-mssqldb v0.0.0-20190412130859-3b1d194e553a github.com/dnaeon/go-vcr v1.0.1 // indirect github.com/dsnet/compress v0.0.1 // indirect @@ -41,6 +41,7 @@ require ( github.com/ghodss/yaml v1.0.1-0.20190212211648-25d852aebe32 github.com/go-errors/errors v1.0.1 github.com/go-ldap/ldap v3.0.2+incompatible + github.com/go-ole/go-ole v1.2.1 // indirect github.com/go-sql-driver/mysql v1.4.1 github.com/go-test/deep v1.0.2 github.com/gocql/gocql v0.0.0-20190402132108-0e1d5de854df @@ -48,7 +49,6 @@ require ( github.com/golang/protobuf v1.3.2 github.com/google/go-github v17.0.0+incompatible github.com/google/go-metrics-stackdriver v0.0.0-20190816035513-b52628e82e2a - github.com/google/go-querystring v1.0.0 // indirect github.com/hashicorp/consul-template v0.22.0 github.com/hashicorp/consul/api v1.1.0 github.com/hashicorp/errwrap v1.0.0 @@ -73,18 +73,18 @@ require ( github.com/hashicorp/vault-plugin-auth-centrify v0.5.2-0.20190814210042-090ec2ed93ce github.com/hashicorp/vault-plugin-auth-cf v0.0.0-20190821162840-1c2205826fee github.com/hashicorp/vault-plugin-auth-gcp v0.5.2-0.20190814210049-1ccb3dc10102 - github.com/hashicorp/vault-plugin-auth-jwt v0.5.2-0.20190815164639-5fa0eef3a023 + github.com/hashicorp/vault-plugin-auth-jwt v0.5.2-0.20191010173058-65cf93bad3f2 github.com/hashicorp/vault-plugin-auth-kubernetes v0.5.2-0.20190826163451-8461c66275a9 github.com/hashicorp/vault-plugin-auth-oci v0.0.0-20190904175623-97c0c0187c5c github.com/hashicorp/vault-plugin-database-elasticsearch v0.0.0-20190814210117-e079e01fbb93 github.com/hashicorp/vault-plugin-secrets-ad v0.6.0 github.com/hashicorp/vault-plugin-secrets-alicloud v0.5.2-0.20190814210129-4d18bec92f56 - github.com/hashicorp/vault-plugin-secrets-azure v0.5.2-0.20190814210135-54b8afbc42ae + github.com/hashicorp/vault-plugin-secrets-azure v0.5.2 github.com/hashicorp/vault-plugin-secrets-gcp v0.5.3-0.20190814210141-d2086ff79b04 github.com/hashicorp/vault-plugin-secrets-gcpkms v0.5.2-0.20190814210149-315cdbf5de6e github.com/hashicorp/vault-plugin-secrets-kv v0.5.2-0.20191017213228-e8cf7060a4d0 github.com/hashicorp/vault/api v1.0.5-0.20191017194845-99f7184d3326 - github.com/hashicorp/vault/sdk v0.1.14-0.20191017211055-9bd3a27a36c4 + github.com/hashicorp/vault/sdk v0.1.14-0.20191105202707-aebb13c5a343 github.com/influxdata/influxdb v0.0.0-20190411212539-d24b7ba8c4c4 github.com/jackc/fake v0.0.0-20150926172116-812a484cc733 // indirect github.com/jackc/pgx v3.3.0+incompatible // indirect @@ -93,12 +93,11 @@ require ( github.com/joyent/triton-go v0.0.0-20190112182421-51ffac552869 github.com/keybase/go-crypto v0.0.0-20190403132359-d65b6b94177f github.com/kr/pretty v0.1.0 - github.com/kr/pty v1.1.3 // indirect github.com/kr/text v0.1.0 github.com/lib/pq v1.2.0 github.com/mattn/go-colorable v0.1.2 github.com/mholt/archiver v3.1.1+incompatible - github.com/michaelklishin/rabbit-hole v1.5.0 + github.com/michaelklishin/rabbit-hole v0.0.0-20191008194146-93d9988f0cd5 github.com/mitchellh/cli v1.0.0 github.com/mitchellh/copystructure v1.0.0 github.com/mitchellh/go-homedir v1.1.0 @@ -108,7 +107,6 @@ require ( github.com/ncw/swift v1.0.47 github.com/nwaples/rardecode v1.0.0 // indirect github.com/oklog/run v1.0.0 - github.com/onsi/ginkgo v1.7.0 // indirect github.com/oracle/oci-go-sdk v7.0.0+incompatible github.com/ory/dockertest v3.3.4+incompatible github.com/patrickmn/go-cache v2.1.0+incompatible @@ -120,9 +118,9 @@ require ( github.com/ryanuber/columnize v2.1.0+incompatible github.com/ryanuber/go-glob v1.0.0 github.com/samuel/go-zookeeper v0.0.0-20180130194729-c4fab1ac1bec - github.com/shirou/gopsutil v0.0.0-20190731134726-d80c43f9c984 + github.com/shirou/gopsutil v2.19.9+incompatible + github.com/shirou/w32 v0.0.0-20160930032740-bb4de0191aa4 // indirect github.com/shopspring/decimal v0.0.0-20180709203117-cd690d0c9e24 // indirect - github.com/streadway/amqp v0.0.0-20190404075320-75d898a42a94 // indirect github.com/stretchr/testify v1.3.0 github.com/xi2/xz v0.0.0-20171230120015-48954b6210f8 // indirect go.etcd.io/bbolt v1.3.2 diff --git a/go.sum b/go.sum index 8bdced0f10b8..d63a8a76cc85 100644 --- a/go.sum +++ b/go.sum @@ -20,6 +20,8 @@ github.com/BurntSushi/toml v0.3.1 h1:WXkYYl6Yr3qBf1K79EBnL4mak0OimBfB0XUf9Vl28OQ github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= github.com/DataDog/datadog-go v2.2.0+incompatible h1:V5BKkxACZLjzHjSgBbr2gvLA2Ae49yhc6CSY7MLy5k4= github.com/DataDog/datadog-go v2.2.0+incompatible/go.mod h1:LButxg5PwREeZtORoXG3tL4fMGNddJ+vMq1mwgfaqoQ= +github.com/DataDog/datadog-go v3.2.0+incompatible h1:qSG2N4FghB1He/r2mFrWKCaL7dXCilEuNEeAn20fdD4= +github.com/DataDog/datadog-go v3.2.0+incompatible/go.mod h1:LButxg5PwREeZtORoXG3tL4fMGNddJ+vMq1mwgfaqoQ= github.com/Jeffail/gabs v1.1.1 h1:V0uzR08Hj22EX8+8QMhyI9sX2hwRu+/RJhJUmnwda/E= github.com/Jeffail/gabs v1.1.1/go.mod h1:6xMvQMK4k33lb7GUUpaAPh6nKMmemQeg5d4gn7/bOXc= github.com/Masterminds/semver v1.4.2 h1:WBLTQ37jOCzSLtXNdoo8bNM8876KhNqOKvrlGITgsTc= @@ -55,6 +57,8 @@ github.com/armon/go-metrics v0.0.0-20180917152333-f0300d1749da h1:8GUt8eRujhVEGZ github.com/armon/go-metrics v0.0.0-20180917152333-f0300d1749da/go.mod h1:Q73ZrmVTwzkszR9V5SSuryQ31EELlFMUz1kKyl939pY= github.com/armon/go-metrics v0.0.0-20190430140413-ec5e00d3c878 h1:EFSB7Zo9Eg91v7MJPVsifUysc/wPdN+NOnVe6bWbdBM= github.com/armon/go-metrics v0.0.0-20190430140413-ec5e00d3c878/go.mod h1:3AMJUQhVx52RsWOnlkpikZr01T/yAVN2gn0861vByNg= +github.com/armon/go-metrics v0.3.0 h1:B7AQgHi8QSEi4uHu7Sbsga+IJDU+CENgjxoo81vDUqU= +github.com/armon/go-metrics v0.3.0/go.mod h1:zXjbSimjXTd7vOpY8B0/2LpvNvDoXBuplAD+gJD3GYs= github.com/armon/go-proxyproto v0.0.0-20190211145416-68259f75880e h1:h0gP0hBU6DsA5IQduhLWGOEfIUKzJS5hhXQBSgHuF/g= github.com/armon/go-proxyproto v0.0.0-20190211145416-68259f75880e/go.mod h1:QmP9hvJ91BbJmGVGSbutW19IC0Q9phDCLGaomwTJbgU= github.com/armon/go-radix v0.0.0-20180808171621-7fddfc383310/go.mod h1:ufUuZ+zHj4x4TnLV4JWEpy2hxWSpsRywHrMgIH9cCH8= @@ -236,6 +240,7 @@ github.com/google/martian v2.1.0+incompatible/go.mod h1:9I4somxYTbIHy5NJKHRl3wXi github.com/google/pprof v0.0.0-20181206194817-3ea8567a2e57/go.mod h1:zfwlbNMJ+OItoe0UupaVj+oy1omPYYDuagoSzA8v9mc= github.com/google/uuid v1.0.0 h1:b4Gk+7WdP/d3HZH8EJsZpvV7EtDOgaZLtnaNGIu1adA= github.com/google/uuid v1.0.0/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo= +github.com/googleapis/gax-go v2.0.0+incompatible h1:j0GKcs05QVmm7yesiZq2+9cxHkNK9YM6zKx4D2qucQU= github.com/googleapis/gax-go v2.0.0+incompatible/go.mod h1:SFVmujtThgffbyetf+mdk2eWhX2bMyUtNHzFKcPA9HY= github.com/googleapis/gax-go/v2 v2.0.4 h1:hU4mGcQI4DaAYW+IbTun+2qEZVFxK0ySjQLTbS0VQKc= github.com/googleapis/gax-go/v2 v2.0.4/go.mod h1:0Wqv26UfaUD9n4G6kQubkQ+KchISgw+vpHVxEJEs9eg= @@ -362,8 +367,8 @@ github.com/hashicorp/vault-plugin-auth-gcp v0.5.1 h1:8DR00s+Wmc21i3sfzvsqW88VMdf github.com/hashicorp/vault-plugin-auth-gcp v0.5.1/go.mod h1:eLj92eX8MPI4vY1jaazVLF2sVbSAJ3LRHLRhF/pUmlI= github.com/hashicorp/vault-plugin-auth-gcp v0.5.2-0.20190814210049-1ccb3dc10102 h1:RTHVdxCDwxTq/4zZFkV+b8zexkSU5EOXkY2D/kAvyFU= github.com/hashicorp/vault-plugin-auth-gcp v0.5.2-0.20190814210049-1ccb3dc10102/go.mod h1:j0hMnnTD44zXGQhLM1jarYDaTmSp6OPiOzgFQ6mNgzc= -github.com/hashicorp/vault-plugin-auth-jwt v0.5.2-0.20190815164639-5fa0eef3a023 h1:RMGN5WLZ6QnTGNsDT5jmTf3RO54lOV7JMeveLMngOuk= -github.com/hashicorp/vault-plugin-auth-jwt v0.5.2-0.20190815164639-5fa0eef3a023/go.mod h1:Ti2NPndKhSGpSL6gWg11n7TkmuI7318BIPeojayIVRU= +github.com/hashicorp/vault-plugin-auth-jwt v0.5.2-0.20191010173058-65cf93bad3f2 h1:Oi9HO9/JItId2XYLEoTIW9Wcfg5sblxxO5Nr7ln1jnk= +github.com/hashicorp/vault-plugin-auth-jwt v0.5.2-0.20191010173058-65cf93bad3f2/go.mod h1:Ti2NPndKhSGpSL6gWg11n7TkmuI7318BIPeojayIVRU= github.com/hashicorp/vault-plugin-auth-kubernetes v0.5.2-0.20190826163451-8461c66275a9 h1:PjbIf3mlPBJopQSJstQAhVbdGTVZ/W35RZtm/GCOTUs= github.com/hashicorp/vault-plugin-auth-kubernetes v0.5.2-0.20190826163451-8461c66275a9/go.mod h1:qkrONCr71ckSCTItJQ1j9uet/faieZJ5c7+GZugTm7s= github.com/hashicorp/vault-plugin-auth-oci v0.0.0-20190904175623-97c0c0187c5c h1:z6LQZvs1OtoVy2XgbgNhiDgp0U62Xbstn7/cgNZvh6g= @@ -374,8 +379,8 @@ github.com/hashicorp/vault-plugin-secrets-ad v0.6.0 h1:N0AtdV3w6VCtU7rZiTbPxsxhl github.com/hashicorp/vault-plugin-secrets-ad v0.6.0/go.mod h1:qm2QDW9KNY+pFoxBEYGYvcHnVjdiOr3tXeO9DMeo3mI= github.com/hashicorp/vault-plugin-secrets-alicloud v0.5.2-0.20190814210129-4d18bec92f56 h1:PGE26//x1eiAbZ1ExffhKa4y9xgDKLd9BHDZRkOzbEY= github.com/hashicorp/vault-plugin-secrets-alicloud v0.5.2-0.20190814210129-4d18bec92f56/go.mod h1:hJ42zFd3bHyE8O2liBUG+VPY0JxdMrj51TOwVGViUIU= -github.com/hashicorp/vault-plugin-secrets-azure v0.5.2-0.20190814210135-54b8afbc42ae h1:LtRJy7H/9ftjHGo5SMLG8/7DI7CYL1Zur9jBJTyzXg8= -github.com/hashicorp/vault-plugin-secrets-azure v0.5.2-0.20190814210135-54b8afbc42ae/go.mod h1:SBc53adxMmf+o8zqRbqYvq+nuSrz8OHYmgmPfxVMJEo= +github.com/hashicorp/vault-plugin-secrets-azure v0.5.2 h1:8Jz4kl0D4+DPpP13jbIrysv1RYogUBucxC4D5xPBkiA= +github.com/hashicorp/vault-plugin-secrets-azure v0.5.2/go.mod h1:SBc53adxMmf+o8zqRbqYvq+nuSrz8OHYmgmPfxVMJEo= github.com/hashicorp/vault-plugin-secrets-gcp v0.5.3-0.20190814210141-d2086ff79b04 h1:2FLjwVqpWueSoxaNdcC2Za7RX8FNp8Xt8pF/03dinV4= github.com/hashicorp/vault-plugin-secrets-gcp v0.5.3-0.20190814210141-d2086ff79b04/go.mod h1:Sc+ba3kscakE5a/pi8JJhWvXWok3cpt1P77DApmUuDc= github.com/hashicorp/vault-plugin-secrets-gcpkms v0.5.2-0.20190814210149-315cdbf5de6e h1:RjQBOFneGwxhHsymNtbEUJXAjMO74GlZcmUrGqJnYxY= @@ -455,8 +460,8 @@ github.com/matttproud/golang_protobuf_extensions v1.0.1 h1:4hp9jkHxhMHkqkrB3Ix0j github.com/matttproud/golang_protobuf_extensions v1.0.1/go.mod h1:D8He9yQNgCq6Z5Ld7szi9bcBfOoFv/3dc6xSMkL2PC0= github.com/mholt/archiver v3.1.1+incompatible h1:1dCVxuqs0dJseYEhi5pl7MYPH9zDa1wBi7mF09cbNkU= github.com/mholt/archiver v3.1.1+incompatible/go.mod h1:Dh2dOXnSdiLxRiPoVfIr/fI1TwETms9B8CTWfeh7ROU= -github.com/michaelklishin/rabbit-hole v1.5.0 h1:Bex27BiFDsijCM9D0ezSHqyy0kehpYHuNKaPqq/a4RM= -github.com/michaelklishin/rabbit-hole v1.5.0/go.mod h1:vvI1uOitYZi0O5HEGXhaWC1XT80Gy+HvFheJ+5Krlhk= +github.com/michaelklishin/rabbit-hole v0.0.0-20191008194146-93d9988f0cd5 h1:uA3b4GgZMZxAJsTkd+CVQ85b7KBlD7HLpd/FfTNlGN0= +github.com/michaelklishin/rabbit-hole v0.0.0-20191008194146-93d9988f0cd5/go.mod h1:+pmbihVqjC3GPdfWv1V2TnRSuVvwrWLKfEP/MZVB/Wc= github.com/miekg/dns v1.0.14/go.mod h1:W1PPwlIAgtquWBMBEV9nkV9Cazfe8ScdGz/Lj7v3Nrg= github.com/miekg/dns v1.1.15 h1:CSSIDtllwGLMoA6zjdKnaE6Tx6eVUxQ29LUgGetiDCI= github.com/miekg/dns v1.1.15/go.mod h1:W1PPwlIAgtquWBMBEV9nkV9Cazfe8ScdGz/Lj7v3Nrg= @@ -502,10 +507,14 @@ github.com/olekukonko/tablewriter v0.0.0-20170122224234-a0225b3f23b5/go.mod h1:v github.com/onsi/ginkgo v1.6.0/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= github.com/onsi/ginkgo v1.7.0 h1:WSHQ+IS43OoUrWtD1/bbclrwK8TTH5hzp+umCiuxHgs= github.com/onsi/ginkgo v1.7.0/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= +github.com/onsi/ginkgo v1.8.0 h1:VkHVNpR4iVnU8XQR6DBm8BqYjN7CRzw+xKUbVVbbW9w= +github.com/onsi/ginkgo v1.8.0/go.mod h1:lLunBs/Ym6LB5Z9jYTR76FiuTmxDTDusOGeTQH+WWjE= github.com/onsi/gomega v0.0.0-20190113212917-5533ce8a0da3/go.mod h1:ex+gbHU/CVuBBDIJjb2X0qEXbFg53c61hWP/1CpauHY= github.com/onsi/gomega v1.4.2/go.mod h1:ex+gbHU/CVuBBDIJjb2X0qEXbFg53c61hWP/1CpauHY= github.com/onsi/gomega v1.4.3 h1:RE1xgDvH7imwFD45h+u2SgIfERHlS2yNG4DObb5BSKU= github.com/onsi/gomega v1.4.3/go.mod h1:ex+gbHU/CVuBBDIJjb2X0qEXbFg53c61hWP/1CpauHY= +github.com/onsi/gomega v1.5.0 h1:izbySO9zDPmjJ8rDjLvkA2zJHIo+HkYXHnf7eN7SSyo= +github.com/onsi/gomega v1.5.0/go.mod h1:ex+gbHU/CVuBBDIJjb2X0qEXbFg53c61hWP/1CpauHY= github.com/opencontainers/go-digest v1.0.0-rc1 h1:WzifXhOVOEOuFYOJAW6aQqW0TooG2iki3E3Ii+WN7gQ= github.com/opencontainers/go-digest v1.0.0-rc1/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= github.com/opencontainers/image-spec v1.0.1 h1:JMemWkRwHx4Zj+fVxWoMCFm/8sYGGrUVojFA6h/TRcI= @@ -582,8 +591,8 @@ github.com/satori/go.uuid v1.2.0 h1:0uYX9dsZ2yD7q2RtLRtPSdGDWzjeM3TbMJP9utgA0ww= github.com/satori/go.uuid v1.2.0/go.mod h1:dA0hQrYB0VpLJoorglMZABFdXlWrHn1NEOzdhQKdks0= github.com/sean-/seed v0.0.0-20170313163322-e2103e2c3529 h1:nn5Wsu0esKSJiIVhscUtVbo7ada43DJhG55ua/hjS5I= github.com/sean-/seed v0.0.0-20170313163322-e2103e2c3529/go.mod h1:DxrIzT+xaE7yg65j358z/aeFdxmN0P9QXhEzd20vsDc= -github.com/shirou/gopsutil v0.0.0-20190731134726-d80c43f9c984 h1:wsZAb4P8F7uQSwsnxE1gk9AHCcc5U0wvyDzcLwFY0Eo= -github.com/shirou/gopsutil v0.0.0-20190731134726-d80c43f9c984/go.mod h1:WWnYX4lzhCH5h/3YBfyVA3VbLYjlMZZAQcW9ojMexNc= +github.com/shirou/gopsutil v2.19.9+incompatible h1:IrPVlK4nfwW10DF7pW+7YJKws9NkgNzWozwwWv9FsgY= +github.com/shirou/gopsutil v2.19.9+incompatible/go.mod h1:5b4v6he4MtMOwMlS0TUMTu2PcXUg8+E1lC7eC3UO/RA= github.com/shirou/w32 v0.0.0-20160930032740-bb4de0191aa4 h1:udFKJ0aHUL60LboW/A+DfgoHVedieIzIXE8uylPue0U= github.com/shirou/w32 v0.0.0-20160930032740-bb4de0191aa4/go.mod h1:qsXQc7+bwAM3Q1u/4XEfrquwF8Lw7D7y5cD8CuHnfIc= github.com/shopspring/decimal v0.0.0-20180709203117-cd690d0c9e24 h1:pntxY8Ary0t43dCZ5dqY4YTJCObLY1kIXl0uzMv+7DE= @@ -674,6 +683,7 @@ golang.org/x/lint v0.0.0-20181217174547-8f45f776aaf1/go.mod h1:UVdnD1Gm6xHRNCYTk golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= golang.org/x/lint v0.0.0-20190301231843-5614ed5bae6f/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= +golang.org/x/lint v0.0.0-20190409202823-959b441ac422/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20180906233101-161cd47e91fd h1:nTDtHvHSdCn1m6ITfMRqtOd/9+7a3s8RBNOZ3eYZzJA= @@ -693,6 +703,7 @@ golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3 h1:0GoQqolDA55aaLxZyTzK/Y2eP golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= golang.org/x/net v0.0.0-20190620200207-3b0461eec859 h1:R/3boaszxrf1GEUWTVDzSKVwLmSJpwZ1yqXm8j0v2QI= golang.org/x/net v0.0.0-20190620200207-3b0461eec859/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= +golang.org/x/net v0.0.0-20190628185345-da137c7871d7/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= golang.org/x/net v0.0.0-20190724013045-ca1201d0de80/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= golang.org/x/net v0.0.0-20190813141303-74dc4d7220e7 h1:fHDIZ2oxGnUZRN6WgWFCbYBjH9uqVPRCUVUDhs0wnbA= golang.org/x/net v0.0.0-20190813141303-74dc4d7220e7/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= @@ -735,6 +746,7 @@ golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7w golang.org/x/sys v0.0.0-20190514135907-3a4b5fb9f71f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190523142557-0e01d883c5c5 h1:sM3evRHxE/1RuMe1FYAL3j7C7fUfIjkbE+NiDAYUF8U= golang.org/x/sys v0.0.0-20190523142557-0e01d883c5c5/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20190712062909-fae7ac547cb7/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190730183949-1393eb018365/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190813064441-fde4db37ae7a h1:aYOabOQFp6Vj6W1F80affTUvO9UxmJRx8K0gsfABByQ= golang.org/x/sys v0.0.0-20190813064441-fde4db37ae7a/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= @@ -761,6 +773,7 @@ golang.org/x/tools v0.0.0-20190312170243-e65039ee4138/go.mod h1:LCzVGOaR6xXOjkQ3 golang.org/x/tools v0.0.0-20190328211700-ab21143f2384 h1:TFlARGu6Czu1z7q93HTxcP1P+/ZFC/IKythI5RzrnRg= golang.org/x/tools v0.0.0-20190328211700-ab21143f2384/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= golang.org/x/tools v0.0.0-20190524140312-2c0ae7006135/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q= +golang.org/x/tools v0.0.0-20190718200317-82a3ea8a504c/go.mod h1:jcCCGcm9btYwXyDqrUWc6MKQKKGJCWEQ3AfLSRIbEuI= google.golang.org/api v0.0.0-20180910000450-7ca32eb868bf/go.mod h1:4mhQ8q/RsB7i+udVvVy5NUi08OU8ZlA0gRVgrF7VFY0= google.golang.org/api v0.0.0-20181030000543-1d582fd0359e/go.mod h1:4mhQ8q/RsB7i+udVvVy5NUi08OU8ZlA0gRVgrF7VFY0= google.golang.org/api v0.0.0-20181220000619-583d854617af/go.mod h1:4mhQ8q/RsB7i+udVvVy5NUi08OU8ZlA0gRVgrF7VFY0= diff --git a/helper/hostutil/hostinfo.go b/helper/hostutil/hostinfo.go index 116cda704381..5244b1810f20 100644 --- a/helper/hostutil/hostinfo.go +++ b/helper/hostutil/hostinfo.go @@ -3,6 +3,7 @@ package hostutil import ( + "context" "fmt" "time" @@ -39,29 +40,29 @@ type HostInfo struct { // The function does a best-effort capture on the most information possible, // continuing on capture errors encountered and appending them to a resulting // multierror.Error that gets returned at the end. -func CollectHostInfo() (*HostInfo, error) { +func CollectHostInfo(ctx context.Context) (*HostInfo, error) { var retErr *multierror.Error info := &HostInfo{Timestamp: time.Now().UTC()} - if h, err := host.Info(); err != nil { + if h, err := host.InfoWithContext(ctx); err != nil { retErr = multierror.Append(retErr, &HostInfoError{"host", err}) } else { info.Host = h } - if v, err := mem.VirtualMemory(); err != nil { + if v, err := mem.VirtualMemoryWithContext(ctx); err != nil { retErr = multierror.Append(retErr, &HostInfoError{"memory", err}) } else { info.Memory = v } - parts, err := disk.Partitions(false) + parts, err := disk.PartitionsWithContext(ctx, false) if err != nil { retErr = multierror.Append(retErr, &HostInfoError{"disk", err}) } else { var usage []*disk.UsageStat for i, part := range parts { - u, err := disk.Usage(part.Mountpoint) + u, err := disk.UsageWithContext(ctx, part.Mountpoint) if err != nil { retErr = multierror.Append(retErr, &HostInfoError{fmt.Sprintf("disk.%d", i), err}) continue @@ -72,13 +73,13 @@ func CollectHostInfo() (*HostInfo, error) { info.Disk = usage } - if c, err := cpu.Info(); err != nil { + if c, err := cpu.InfoWithContext(ctx); err != nil { retErr = multierror.Append(retErr, &HostInfoError{"cpu", err}) } else { info.CPU = c } - t, err := cpu.Times(true) + t, err := cpu.TimesWithContext(ctx, true) if err != nil { retErr = multierror.Append(retErr, &HostInfoError{"cpu_times", err}) } else { diff --git a/helper/hostutil/hostinfo_test.go b/helper/hostutil/hostinfo_test.go index a96307b4b255..c54893b17dbb 100644 --- a/helper/hostutil/hostinfo_test.go +++ b/helper/hostutil/hostinfo_test.go @@ -1,30 +1,60 @@ package hostutil import ( + "context" + "strings" "testing" + + "github.com/hashicorp/errwrap" ) func TestCollectHostInfo(t *testing.T) { - info, err := CollectHostInfo() - if err != nil { + info, err := CollectHostInfo(context.Background()) + if err != nil && !errwrap.ContainsType(err, new(HostInfoError)) { t.Fatal(err) } + + // Get all the possible HostInfoError errors and check for the resulting + // stat if the package is able to fetch it for the platform we're testing + // on. + errs := errwrap.GetAllType(err, new(HostInfoError)) + if info.Timestamp.IsZero() { t.Fatal("expected non-zero Timestamp") } - if info.CPU == nil { + if !checkErrTypeExists(errs, "cpu") && info.CPU == nil { t.Fatal("expected non-nil CPU value") } - if info.CPUTimes == nil { + if !checkErrTypeExists(errs, "cpu_times") && info.CPUTimes == nil { t.Fatal("expected non-nil CPUTimes value") } - if info.Disk == nil { + if !checkErrTypeExists(errs, "disk") && info.Disk == nil { t.Fatal("expected non-nil Disk value") } - if info.Host == nil { + if !checkErrTypeExists(errs, "host") && info.Host == nil { t.Fatal("expected non-nil Host value") } - if info.Memory == nil { + if !checkErrTypeExists(errs, "memory") && info.Memory == nil { t.Fatal("expected non-nil Memory value") } } + +// checkErrTypeExists is a helper that checks whether an particular +// HostInfoError.Type exists within a set of errors. +func checkErrTypeExists(errs []error, errType string) bool { + for _, e := range errs { + err, ok := e.(*HostInfoError) + if !ok { + return false + } + + // This is mainly for disk error since the type string can contain an + // index for the disk. + parts := strings.SplitN(err.Type, ".", 2) + + if parts[0] == errType { + return true + } + } + return false +} diff --git a/http/logical.go b/http/logical.go index 9a6653383ad0..445c842b65df 100644 --- a/http/logical.go +++ b/http/logical.go @@ -128,7 +128,7 @@ func buildLogicalRequestNoAuth(perfStandby bool, w http.ResponseWriter, r *http. func buildLogicalRequest(core *vault.Core, w http.ResponseWriter, r *http.Request) (*logical.Request, io.ReadCloser, int, error) { req, origBody, status, err := buildLogicalRequestNoAuth(core.PerfStandby(), w, r) - if err != nil { + if err != nil || status != 0 { return nil, nil, status, err } diff --git a/http/sys_health.go b/http/sys_health.go index 59f9b5a6959a..973b79b29041 100644 --- a/http/sys_health.go +++ b/http/sys_health.go @@ -8,7 +8,9 @@ import ( "strconv" "time" + "github.com/hashicorp/errwrap" "github.com/hashicorp/vault/sdk/helper/consts" + "github.com/hashicorp/vault/sdk/helper/parseutil" "github.com/hashicorp/vault/sdk/version" "github.com/hashicorp/vault/vault" ) @@ -43,7 +45,7 @@ func handleSysHealthGet(core *vault.Core, w http.ResponseWriter, r *http.Request code, body, err := getSysHealth(core, r) if err != nil { core.Logger().Error("error checking health", "error", err) - respondError(w, http.StatusInternalServerError, nil) + respondError(w, code, nil) return } @@ -61,10 +63,7 @@ func handleSysHealthGet(core *vault.Core, w http.ResponseWriter, r *http.Request } func handleSysHealthHead(core *vault.Core, w http.ResponseWriter, r *http.Request) { - code, body, err := getSysHealth(core, r) - if err != nil { - code = http.StatusInternalServerError - } + code, body, _ := getSysHealth(core, r) if body != nil { w.Header().Set("Content-Type", "application/json") @@ -73,9 +72,23 @@ func handleSysHealthHead(core *vault.Core, w http.ResponseWriter, r *http.Reques } func getSysHealth(core *vault.Core, r *http.Request) (int, *HealthResponse, error) { + var err error + // Check if being a standby is allowed for the purpose of a 200 OK - _, standbyOK := r.URL.Query()["standbyok"] - _, perfStandbyOK := r.URL.Query()["perfstandbyok"] + standbyOKStr, standbyOK := r.URL.Query()["standbyok"] + if standbyOK { + standbyOK, err = parseutil.ParseBool(standbyOKStr[0]) + if err != nil { + return http.StatusBadRequest, nil, errwrap.Wrapf("bad value for standbyok parameter: {{err}}", err) + } + } + perfStandbyOKStr, perfStandbyOK := r.URL.Query()["perfstandbyok"] + if perfStandbyOK { + perfStandbyOK, err = parseutil.ParseBool(perfStandbyOKStr[0]) + if err != nil { + return http.StatusBadRequest, nil, errwrap.Wrapf("bad value for perfstandbyok parameter: {{err}}", err) + } + } uninitCode := http.StatusNotImplemented if code, found, ok := fetchStatusCode(r, "uninitcode"); !ok { diff --git a/physical/oci/oci_test.go b/physical/oci/oci_test.go index bf85f0b566da..d17c0c8a7d14 100644 --- a/physical/oci/oci_test.go +++ b/physical/oci/oci_test.go @@ -67,10 +67,10 @@ func getTenancyOcid(configProvider common.ConfigurationProvider, t *testing.T) ( func createBackend(bucketName string, namespaceName string, haEnabledStr string, lockBucketName string, t *testing.T) physical.Backend { backend, err := NewBackend(map[string]string{ "auth_type_api_key": "true", - "bucket_name": bucketName, - "namespace_name": namespaceName, - "ha_enabled": haEnabledStr, - "lock_bucket_name": lockBucketName, + "bucket_name": bucketName, + "namespace_name": namespaceName, + "ha_enabled": haEnabledStr, + "lock_bucket_name": lockBucketName, }, logging.NewVaultLogger(log.Trace)) if err != nil { t.Fatalf("Failed to create new backend: %v", err) diff --git a/physical/raft/raft.go b/physical/raft/raft.go index 015dcb480db1..d1fdfcb0deaa 100644 --- a/physical/raft/raft.go +++ b/physical/raft/raft.go @@ -4,7 +4,6 @@ import ( "context" "errors" "fmt" - "github.com/armon/go-metrics" "io" "io/ioutil" "os" @@ -13,6 +12,7 @@ import ( "sync" "time" + "github.com/armon/go-metrics" "github.com/golang/protobuf/proto" "github.com/hashicorp/errwrap" log "github.com/hashicorp/go-hclog" @@ -29,6 +29,12 @@ import ( "github.com/hashicorp/vault/sdk/physical" ) +// EnvVaultRaftNodeID is used to fetch the Raft node ID from the environment. +const EnvVaultRaftNodeID = "VAULT_RAFT_NODE_ID" + +// EnvVaultRaftPath is used to fetch the path where Raft data is stored from the environment. +const EnvVaultRaftPath = "VAULT_RAFT_PATH" + // Verify RaftBackend satisfies the correct interfaces var _ physical.Backend = (*RaftBackend)(nil) var _ physical.Transactional = (*RaftBackend)(nil) @@ -116,9 +122,13 @@ func NewRaftBackend(conf map[string]string, logger log.Logger) (physical.Backend return nil, fmt.Errorf("failed to create fsm: %v", err) } - path, ok := conf["path"] - if !ok { - return nil, fmt.Errorf("'path' must be set") + path := os.Getenv(EnvVaultRaftPath) + if path == "" { + pathFromConfig, ok := conf["path"] + if !ok { + return nil, fmt.Errorf("'path' must be set") + } + path = pathFromConfig } // Build an all in-memory setup for dev mode, otherwise prepare a full @@ -163,8 +173,15 @@ func NewRaftBackend(conf map[string]string, logger log.Logger) (physical.Backend var localID string { - // Determine the local node ID - localID = conf["node_id"] + // Determine the local node ID from the environment. + if raftNodeID := os.Getenv(EnvVaultRaftNodeID); raftNodeID != "" { + localID = raftNodeID + } + + // If not set in the environment check the configuration file. + if len(localID) == 0 { + localID = conf["node_id"] + } // If not set in the config check the "node-id" file. if len(localID) == 0 { @@ -180,7 +197,7 @@ func NewRaftBackend(conf map[string]string, logger log.Logger) (physical.Backend } } - // If the file didn't exist generate a UUID and persist it to tne + // If all of the above fails generate a UUID and persist it to the // "node-id" file. if len(localID) == 0 { id, err := uuid.GenerateUUID() diff --git a/scripts/cross/Dockerfile b/scripts/cross/Dockerfile index 84fb826919ed..86a69b3dd5dd 100644 --- a/scripts/cross/Dockerfile +++ b/scripts/cross/Dockerfile @@ -16,7 +16,7 @@ RUN curl -sL https://deb.nodesource.com/setup_10.x | bash - RUN curl -sL https://dl.yarnpkg.com/debian/pubkey.gpg | apt-key add - RUN echo "deb https://dl.yarnpkg.com/debian/ stable main" | tee /etc/apt/sources.list.d/yarn.list -RUN apt-get update -y && apt-get install -y -q nodejs yarn=1.17.3 +RUN apt-get update -y && apt-get install -y -q nodejs yarn RUN rm -rf /var/lib/apt/lists/* diff --git a/scripts/testciphers.sh b/scripts/testciphers.sh new file mode 100755 index 000000000000..324d6bce7e02 --- /dev/null +++ b/scripts/testciphers.sh @@ -0,0 +1,26 @@ +#!/usr/bin/env bash + +# Adapted from https://superuser.com/a/224263 + +# OpenSSL requires the port number. +SERVER=$1 +ciphers=$(openssl ciphers 'ALL:eNULL' | sed -e 's/:/ /g') + +echo Obtaining cipher list from $(openssl version). + +for cipher in ${ciphers[@]} +do +echo -n Testing $cipher... +result=$(echo -n | openssl s_client -cipher "$cipher" -alpn req_fw_sb-act_v1 -connect $SERVER 2>&1) +if [[ "$result" =~ ":error:" ]] ; then + error=$(echo -n $result | cut -d':' -f6) + echo NO \($error\) +else + if [[ "$result" =~ "Cipher is ${cipher}" || "$result" =~ "Cipher :" ]] ; then + echo YES + else + echo UNKNOWN RESPONSE + echo $result + fi +fi +done diff --git a/sdk/go.mod b/sdk/go.mod index 9ff321d5eff2..95760ae189da 100644 --- a/sdk/go.mod +++ b/sdk/go.mod @@ -3,7 +3,7 @@ module github.com/hashicorp/vault/sdk go 1.12 require ( - github.com/armon/go-metrics v0.0.0-20180917152333-f0300d1749da + github.com/armon/go-metrics v0.3.0 github.com/armon/go-radix v0.0.0-20180808171621-7fddfc383310 github.com/fatih/structs v1.1.0 github.com/go-ldap/ldap v3.0.2+incompatible @@ -24,14 +24,12 @@ require ( github.com/mitchellh/copystructure v1.0.0 github.com/mitchellh/go-testing-interface v1.0.0 github.com/mitchellh/mapstructure v1.1.2 - github.com/pascaldekloe/goe v0.1.0 // indirect github.com/pierrec/lz4 v2.0.5+incompatible github.com/ryanuber/go-glob v1.0.0 golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2 golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3 // indirect golang.org/x/sys v0.0.0-20190403152447-81d4e9dc473e golang.org/x/text v0.3.1-0.20181227161524-e6919f6577db // indirect - google.golang.org/appengine v1.4.0 // indirect google.golang.org/genproto v0.0.0-20190404172233-64821d5d2107 // indirect google.golang.org/grpc v1.22.0 gopkg.in/asn1-ber.v1 v1.0.0-20181015200546-f715ec2f112d // indirect diff --git a/sdk/go.sum b/sdk/go.sum index 16eb2c154ddd..49124f87402b 100644 --- a/sdk/go.sum +++ b/sdk/go.sum @@ -1,11 +1,15 @@ cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= -github.com/armon/go-metrics v0.0.0-20180917152333-f0300d1749da h1:8GUt8eRujhVEGZFFEjBj46YV4rDjvGrNxb0KMWYkL2I= -github.com/armon/go-metrics v0.0.0-20180917152333-f0300d1749da/go.mod h1:Q73ZrmVTwzkszR9V5SSuryQ31EELlFMUz1kKyl939pY= +github.com/DataDog/datadog-go v3.2.0+incompatible/go.mod h1:LButxg5PwREeZtORoXG3tL4fMGNddJ+vMq1mwgfaqoQ= +github.com/armon/go-metrics v0.3.0 h1:B7AQgHi8QSEi4uHu7Sbsga+IJDU+CENgjxoo81vDUqU= +github.com/armon/go-metrics v0.3.0/go.mod h1:zXjbSimjXTd7vOpY8B0/2LpvNvDoXBuplAD+gJD3GYs= github.com/armon/go-radix v0.0.0-20180808171621-7fddfc383310 h1:BUAU3CGlLvorLI26FmByPp2eC2qla6E1Tw+scpcg/to= github.com/armon/go-radix v0.0.0-20180808171621-7fddfc383310/go.mod h1:ufUuZ+zHj4x4TnLV4JWEpy2hxWSpsRywHrMgIH9cCH8= +github.com/beorn7/perks v0.0.0-20180321164747-3a771d992973/go.mod h1:Dwedo/Wpr24TaqPxmxbtue+5NUziq4I4S80YR8gNf3Q= github.com/bgentry/speakeasy v0.1.0 h1:ByYyxL9InA1OWqxJqqp2A5pYHUrCiAL6K3J+LKSsQkY= github.com/bgentry/speakeasy v0.1.0/go.mod h1:+zsyZBPWlz7T6j88CTgSN5bM796AkVf0kBD4zp0CCIs= +github.com/circonus-labs/circonus-gometrics v2.3.1+incompatible/go.mod h1:nmEj6Dob7S7YxXgwXpfOuvO54S+tGdZdw9fuRZt25Ag= +github.com/circonus-labs/circonusllhist v0.1.3/go.mod h1:kMXHVDlOchFAehlya5ePtbp5jckzBHf4XRpQvBOLI+I= github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c= @@ -30,6 +34,7 @@ github.com/golang/snappy v0.0.1/go.mod h1:/XxbfmMg8lxefKM7IXC3fBNl/7bRcc72aCRzEW github.com/google/go-cmp v0.2.0/go.mod h1:oXzfMopK8JAjlY9xF4vHSVASa0yLyX7SntLO5aqRK0M= github.com/hashicorp/errwrap v1.0.0 h1:hLrqtEDnRye3+sgx6z4qVLNuviH3MR5aQ0ykNJa/UYA= github.com/hashicorp/errwrap v1.0.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= +github.com/hashicorp/go-cleanhttp v0.5.0/go.mod h1:JpRdi6/HCYpAwUzNwuwqhbovhLtngrth3wmdIIUrZ80= github.com/hashicorp/go-hclog v0.0.0-20180709165350-ff2cf002a8dd/go.mod h1:9bjs9uLqI8l75knNv3lV1kA55veR+WUPSiKIWcQHudI= github.com/hashicorp/go-hclog v0.8.0 h1:z3ollgGRg8RjfJH6UVBaG54R70GFd++QOkvnJH3VSBY= github.com/hashicorp/go-hclog v0.8.0/go.mod h1:5CU+agLiy3J7N7QjHK5d05KxGsuXiQLrjA0H7acj2lQ= @@ -39,11 +44,11 @@ github.com/hashicorp/go-multierror v1.0.0 h1:iVjPR7a6H0tWELX5NxNe7bYopibicUzc7uP github.com/hashicorp/go-multierror v1.0.0/go.mod h1:dHtQlpGsu+cZNNAkkCN/P3hoUDHhCYQXV3UM06sGGrk= github.com/hashicorp/go-plugin v1.0.1 h1:4OtAfUGbnKC6yS48p0CtMX2oFYtzFZVv6rok3cRWgnE= github.com/hashicorp/go-plugin v1.0.1/go.mod h1:++UyYGoz3o5w9ZzAdZxtQKrWWP+iqPBn3cQptSMzBuY= +github.com/hashicorp/go-retryablehttp v0.5.3/go.mod h1:9B5zBasrRhHXnJnui7y6sL7es7NDiJgTc6Er0maI1Xs= github.com/hashicorp/go-sockaddr v1.0.2 h1:ztczhD1jLxIRjVejw8gFomI1BQZOe2WoVOu0SyteCQc= github.com/hashicorp/go-sockaddr v1.0.2/go.mod h1:rB4wwRAUzs07qva3c5SdrY/NEtAUjGlgmH/UkBUC97A= github.com/hashicorp/go-uuid v1.0.0/go.mod h1:6SBZvOh/SIDV7/2o3Jml5SYk/TvGqwFJ/bN7x4byOro= -github.com/hashicorp/go-uuid v1.0.1 h1:fv1ep09latC32wFoVwnqcnKJGnMSdBanPczbHAYm1BE= -github.com/hashicorp/go-uuid v1.0.1/go.mod h1:6SBZvOh/SIDV7/2o3Jml5SYk/TvGqwFJ/bN7x4byOro= +github.com/hashicorp/go-uuid v1.0.2-0.20191001231223-f32f5fe8d6a8 h1:PKbxRbsOP7R3f/TpdqcgXrO69T3yd9nLoR+RMRUxSxA= github.com/hashicorp/go-uuid v1.0.2-0.20191001231223-f32f5fe8d6a8/go.mod h1:6SBZvOh/SIDV7/2o3Jml5SYk/TvGqwFJ/bN7x4byOro= github.com/hashicorp/go-version v1.1.0 h1:bPIoEKD27tNdebFGGxxYwcL4nepeY4j1QP23PFRGzg0= github.com/hashicorp/go-version v1.1.0/go.mod h1:fltr4n8CU8Ke44wwGCBoEymUuxUHl09ZGVZPK5anwXA= @@ -60,6 +65,7 @@ github.com/mattn/go-colorable v0.0.9 h1:UVL0vNpWh04HeJXV0KLcaT7r06gOH2l4OW6ddYRU github.com/mattn/go-colorable v0.0.9/go.mod h1:9vuHe8Xs5qXnSaW/c/ABM9alt+Vo+STaOChaDxuIBZU= github.com/mattn/go-isatty v0.0.3 h1:ns/ykhmWi7G9O+8a448SecJU3nSMBXJfqQkl0upE1jI= github.com/mattn/go-isatty v0.0.3/go.mod h1:M+lRXTBqGeGNdLjl/ufCoiOlB5xdOkqRJdNxMWT7Zi4= +github.com/matttproud/golang_protobuf_extensions v1.0.1/go.mod h1:D8He9yQNgCq6Z5Ld7szi9bcBfOoFv/3dc6xSMkL2PC0= github.com/mitchellh/cli v1.0.0 h1:iGBIsUe3+HZ/AD/Vd7DErOt5sU9fa8Uj7A2s1aggv1Y= github.com/mitchellh/cli v1.0.0/go.mod h1:hNIlj7HEI86fIcpObd7a0FcrxTWetlwJDGcceTlRvqc= github.com/mitchellh/copystructure v1.0.0 h1:Laisrj+bAB6b/yJwB5Bt3ITZhGJdqmxquMKeZ+mmkFQ= @@ -79,10 +85,15 @@ github.com/pascaldekloe/goe v0.1.0 h1:cBOtyMzM9HTpWjXfbbunk26uA6nG3a8n06Wieeh0Mw github.com/pascaldekloe/goe v0.1.0/go.mod h1:lzWF7FIEvWOWxwDKqyGYQf6ZUaNfKdP144TG7ZOy1lc= github.com/pierrec/lz4 v2.0.5+incompatible h1:2xWsjqPFWcplujydGg4WmhC/6fZqK42wMM8aXeqhl0I= github.com/pierrec/lz4 v2.0.5+incompatible/go.mod h1:pdkljMzZIN41W+lC3N2tnIh5sFi+IEE17M5jbnwPHcY= +github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM= github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= github.com/posener/complete v1.1.1 h1:ccV59UEOTzVDnDUEFdT95ZzHVZ+5+158q8+SJb2QV5w= github.com/posener/complete v1.1.1/go.mod h1:em0nMJCgc9GFtwrmVmEMR/ZL6WyhyjMBndrE9hABlRI= +github.com/prometheus/client_golang v0.9.2/go.mod h1:OsXs2jCmiKlQ1lTBmv21f2mNfw4xf/QclQDMrYNZzcM= +github.com/prometheus/client_model v0.0.0-20180712105110-5c3871d89910/go.mod h1:MbSGuTsp3dbXC40dX6PRTWyKYBIrTGTE9sqQNg2J8bo= +github.com/prometheus/common v0.0.0-20181126121408-4724e9255275/go.mod h1:daVV7qP5qjZbuso7PdcryaAu0sAZbrN9i7WWcTMWvro= +github.com/prometheus/procfs v0.0.0-20181204211112-1dc9a6cbc91a/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk= github.com/ryanuber/columnize v2.1.0+incompatible h1:j1Wcmh8OrK4Q7GXY+V7SVSY8nUWQxHW5TkBe7YUl+2s= github.com/ryanuber/columnize v2.1.0+incompatible/go.mod h1:sm1tb6uqfes/u+d4ooFouqFdy9/2g9QGwK3SQygK0Ts= github.com/ryanuber/go-glob v1.0.0 h1:iQh3xXAumdQ+4Ufa5b25cRpC5TYKlno6hsv6Cb3pkBk= @@ -91,6 +102,7 @@ github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+ github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs= github.com/stretchr/testify v1.3.0 h1:TivCn/peBQ7UY8ooIcPgZFpTNSz0Q2U6UrFlUfqbe0Q= github.com/stretchr/testify v1.3.0/go.mod h1:M5WIy9Dh21IEIfnGCwXGc5bZfKNJtfHm1UVUgZn+9EI= +github.com/tv42/httpunix v0.0.0-20150427012821-b75d8614f926/go.mod h1:9ESjWnEqriFuLhtthL60Sar/7RFoluCcXsuvEwTV5KM= golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2 h1:VklqNMn3ovrHsnt90PveolxSbWFaJdECFbxSq0Mqo2M= golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= @@ -100,6 +112,7 @@ golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHl golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20180826012351-8a410e7b638d h1:g9qWBGx4puODJTMVyoPrpoxPFgVGd+z1DZwjfRu4d0I= golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= +golang.org/x/net v0.0.0-20181201002055-351d144fa1fc/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3 h1:0GoQqolDA55aaLxZyTzK/Y2ePZzZTUrRacwib7cNsYQ= diff --git a/ui/.eslintignore b/ui/.eslintignore index 6319d71e899c..7b9bbcf62917 100644 --- a/ui/.eslintignore +++ b/ui/.eslintignore @@ -10,6 +10,7 @@ /bower_components/ /node_modules/ /.storybook/ +/.yarn/ /stories/ # misc diff --git a/ui/.yarn/releases/yarn-1.19.1.js b/ui/.yarn/releases/yarn-1.19.1.js new file mode 100755 index 000000000000..3907b87325d0 --- /dev/null +++ b/ui/.yarn/releases/yarn-1.19.1.js @@ -0,0 +1,147216 @@ +#!/usr/bin/env node +module.exports = +/******/ (function(modules) { // webpackBootstrap +/******/ // The module cache +/******/ var installedModules = {}; +/******/ +/******/ // The require function +/******/ function __webpack_require__(moduleId) { +/******/ +/******/ // Check if module is in cache +/******/ if(installedModules[moduleId]) { +/******/ return installedModules[moduleId].exports; +/******/ } +/******/ // Create a new module (and put it into the cache) +/******/ var module = installedModules[moduleId] = { +/******/ i: moduleId, +/******/ l: false, +/******/ exports: {} +/******/ }; +/******/ +/******/ // Execute the module function +/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); +/******/ +/******/ // Flag the module as loaded +/******/ module.l = true; +/******/ +/******/ // Return the exports of the module +/******/ return module.exports; +/******/ } +/******/ +/******/ +/******/ // expose the modules object (__webpack_modules__) +/******/ __webpack_require__.m = modules; +/******/ +/******/ // expose the module cache +/******/ __webpack_require__.c = installedModules; +/******/ +/******/ // identity function for calling harmony imports with the correct context +/******/ __webpack_require__.i = function(value) { return value; }; +/******/ +/******/ // define getter function for harmony exports +/******/ __webpack_require__.d = function(exports, name, getter) { +/******/ if(!__webpack_require__.o(exports, name)) { +/******/ Object.defineProperty(exports, name, { +/******/ configurable: false, +/******/ enumerable: true, +/******/ get: getter +/******/ }); +/******/ } +/******/ }; +/******/ +/******/ // getDefaultExport function for compatibility with non-harmony modules +/******/ __webpack_require__.n = function(module) { +/******/ var getter = module && module.__esModule ? +/******/ function getDefault() { return module['default']; } : +/******/ function getModuleExports() { return module; }; +/******/ __webpack_require__.d(getter, 'a', getter); +/******/ return getter; +/******/ }; +/******/ +/******/ // Object.prototype.hasOwnProperty.call +/******/ __webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); }; +/******/ +/******/ // __webpack_public_path__ +/******/ __webpack_require__.p = ""; +/******/ +/******/ // Load entry module and return exports +/******/ return __webpack_require__(__webpack_require__.s = 549); +/******/ }) +/************************************************************************/ +/******/ ([ +/* 0 */ +/***/ (function(module, exports) { + +module.exports = require("path"); + +/***/ }), +/* 1 */ +/***/ (function(module, __webpack_exports__, __webpack_require__) { + +"use strict"; +/* harmony export (immutable) */ __webpack_exports__["a"] = __extends; +/* unused harmony export __assign */ +/* unused harmony export __rest */ +/* unused harmony export __decorate */ +/* unused harmony export __param */ +/* unused harmony export __metadata */ +/* unused harmony export __awaiter */ +/* unused harmony export __generator */ +/* unused harmony export __exportStar */ +/* unused harmony export __values */ +/* unused harmony export __read */ +/* unused harmony export __spread */ +/* unused harmony export __await */ +/* unused harmony export __asyncGenerator */ +/* unused harmony export __asyncDelegator */ +/* unused harmony export __asyncValues */ +/* unused harmony export __makeTemplateObject */ +/* unused harmony export __importStar */ +/* unused harmony export __importDefault */ +/*! ***************************************************************************** +Copyright (c) Microsoft Corporation. All rights reserved. +Licensed under the Apache License, Version 2.0 (the "License"); you may not use +this file except in compliance with the License. You may obtain a copy of the +License at http://www.apache.org/licenses/LICENSE-2.0 + +THIS CODE IS PROVIDED ON AN *AS IS* BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +KIND, EITHER EXPRESS OR IMPLIED, INCLUDING WITHOUT LIMITATION ANY IMPLIED +WARRANTIES OR CONDITIONS OF TITLE, FITNESS FOR A PARTICULAR PURPOSE, +MERCHANTABLITY OR NON-INFRINGEMENT. + +See the Apache Version 2.0 License for specific language governing permissions +and limitations under the License. +***************************************************************************** */ +/* global Reflect, Promise */ + +var extendStatics = function(d, b) { + extendStatics = Object.setPrototypeOf || + ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) || + function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; }; + return extendStatics(d, b); +}; + +function __extends(d, b) { + extendStatics(d, b); + function __() { this.constructor = d; } + d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __()); +} + +var __assign = function() { + __assign = Object.assign || function __assign(t) { + for (var s, i = 1, n = arguments.length; i < n; i++) { + s = arguments[i]; + for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p]; + } + return t; + } + return __assign.apply(this, arguments); +} + +function __rest(s, e) { + var t = {}; + for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0) + t[p] = s[p]; + if (s != null && typeof Object.getOwnPropertySymbols === "function") + for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) if (e.indexOf(p[i]) < 0) + t[p[i]] = s[p[i]]; + return t; +} + +function __decorate(decorators, target, key, desc) { + var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r = Reflect.decorate(decorators, target, key, desc); + else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r; + return c > 3 && r && Object.defineProperty(target, key, r), r; +} + +function __param(paramIndex, decorator) { + return function (target, key) { decorator(target, key, paramIndex); } +} + +function __metadata(metadataKey, metadataValue) { + if (typeof Reflect === "object" && typeof Reflect.metadata === "function") return Reflect.metadata(metadataKey, metadataValue); +} + +function __awaiter(thisArg, _arguments, P, generator) { + return new (P || (P = Promise))(function (resolve, reject) { + function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } + function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } + function step(result) { result.done ? resolve(result.value) : new P(function (resolve) { resolve(result.value); }).then(fulfilled, rejected); } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); +} + +function __generator(thisArg, body) { + var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g; + return g = { next: verb(0), "throw": verb(1), "return": verb(2) }, typeof Symbol === "function" && (g[Symbol.iterator] = function() { return this; }), g; + function verb(n) { return function (v) { return step([n, v]); }; } + function step(op) { + if (f) throw new TypeError("Generator is already executing."); + while (_) try { + if (f = 1, y && (t = op[0] & 2 ? y["return"] : op[0] ? y["throw"] || ((t = y["return"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t; + if (y = 0, t) op = [op[0] & 2, t.value]; + switch (op[0]) { + case 0: case 1: t = op; break; + case 4: _.label++; return { value: op[1], done: false }; + case 5: _.label++; y = op[1]; op = [0]; continue; + case 7: op = _.ops.pop(); _.trys.pop(); continue; + default: + if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; } + if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; } + if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; } + if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; } + if (t[2]) _.ops.pop(); + _.trys.pop(); continue; + } + op = body.call(thisArg, _); + } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; } + if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true }; + } +} + +function __exportStar(m, exports) { + for (var p in m) if (!exports.hasOwnProperty(p)) exports[p] = m[p]; +} + +function __values(o) { + var m = typeof Symbol === "function" && o[Symbol.iterator], i = 0; + if (m) return m.call(o); + return { + next: function () { + if (o && i >= o.length) o = void 0; + return { value: o && o[i++], done: !o }; + } + }; +} + +function __read(o, n) { + var m = typeof Symbol === "function" && o[Symbol.iterator]; + if (!m) return o; + var i = m.call(o), r, ar = [], e; + try { + while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value); + } + catch (error) { e = { error: error }; } + finally { + try { + if (r && !r.done && (m = i["return"])) m.call(i); + } + finally { if (e) throw e.error; } + } + return ar; +} + +function __spread() { + for (var ar = [], i = 0; i < arguments.length; i++) + ar = ar.concat(__read(arguments[i])); + return ar; +} + +function __await(v) { + return this instanceof __await ? (this.v = v, this) : new __await(v); +} + +function __asyncGenerator(thisArg, _arguments, generator) { + if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined."); + var g = generator.apply(thisArg, _arguments || []), i, q = []; + return i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i; + function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; } + function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } } + function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); } + function fulfill(value) { resume("next", value); } + function reject(value) { resume("throw", value); } + function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); } +} + +function __asyncDelegator(o) { + var i, p; + return i = {}, verb("next"), verb("throw", function (e) { throw e; }), verb("return"), i[Symbol.iterator] = function () { return this; }, i; + function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: n === "return" } : f ? f(v) : v; } : f; } +} + +function __asyncValues(o) { + if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined."); + var m = o[Symbol.asyncIterator], i; + return m ? m.call(o) : (o = typeof __values === "function" ? __values(o) : o[Symbol.iterator](), i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i); + function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; } + function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); } +} + +function __makeTemplateObject(cooked, raw) { + if (Object.defineProperty) { Object.defineProperty(cooked, "raw", { value: raw }); } else { cooked.raw = raw; } + return cooked; +}; + +function __importStar(mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k]; + result.default = mod; + return result; +} + +function __importDefault(mod) { + return (mod && mod.__esModule) ? mod : { default: mod }; +} + + +/***/ }), +/* 2 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +exports.__esModule = true; + +var _promise = __webpack_require__(227); + +var _promise2 = _interopRequireDefault(_promise); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +exports.default = function (fn) { + return function () { + var gen = fn.apply(this, arguments); + return new _promise2.default(function (resolve, reject) { + function step(key, arg) { + try { + var info = gen[key](arg); + var value = info.value; + } catch (error) { + reject(error); + return; + } + + if (info.done) { + resolve(value); + } else { + return _promise2.default.resolve(value).then(function (value) { + step("next", value); + }, function (err) { + step("throw", err); + }); + } + } + + return step("next"); + }); + }; +}; + +/***/ }), +/* 3 */ +/***/ (function(module, exports) { + +module.exports = require("util"); + +/***/ }), +/* 4 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.getFirstSuitableFolder = exports.readFirstAvailableStream = exports.makeTempDir = exports.hardlinksWork = exports.writeFilePreservingEol = exports.getFileSizeOnDisk = exports.walk = exports.symlink = exports.find = exports.readJsonAndFile = exports.readJson = exports.readFileAny = exports.hardlinkBulk = exports.copyBulk = exports.unlink = exports.glob = exports.link = exports.chmod = exports.lstat = exports.exists = exports.mkdirp = exports.stat = exports.access = exports.rename = exports.readdir = exports.realpath = exports.readlink = exports.writeFile = exports.open = exports.readFileBuffer = exports.lockQueue = exports.constants = undefined; + +var _asyncToGenerator2; + +function _load_asyncToGenerator() { + return _asyncToGenerator2 = _interopRequireDefault(__webpack_require__(2)); +} + +let buildActionsForCopy = (() => { + var _ref = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, events, possibleExtraneous, reporter) { + + // + let build = (() => { + var _ref5 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) { + const src = data.src, + dest = data.dest, + type = data.type; + + const onFresh = data.onFresh || noop; + const onDone = data.onDone || noop; + + // TODO https://github.com/yarnpkg/yarn/issues/3751 + // related to bundled dependencies handling + if (files.has(dest.toLowerCase())) { + reporter.verbose(`The case-insensitive file ${dest} shouldn't be copied twice in one bulk copy`); + } else { + files.add(dest.toLowerCase()); + } + + if (type === 'symlink') { + yield mkdirp((_path || _load_path()).default.dirname(dest)); + onFresh(); + actions.symlink.push({ + dest, + linkname: src + }); + onDone(); + return; + } + + if (events.ignoreBasenames.indexOf((_path || _load_path()).default.basename(src)) >= 0) { + // ignored file + return; + } + + const srcStat = yield lstat(src); + let srcFiles; + + if (srcStat.isDirectory()) { + srcFiles = yield readdir(src); + } + + let destStat; + try { + // try accessing the destination + destStat = yield lstat(dest); + } catch (e) { + // proceed if destination doesn't exist, otherwise error + if (e.code !== 'ENOENT') { + throw e; + } + } + + // if destination exists + if (destStat) { + const bothSymlinks = srcStat.isSymbolicLink() && destStat.isSymbolicLink(); + const bothFolders = srcStat.isDirectory() && destStat.isDirectory(); + const bothFiles = srcStat.isFile() && destStat.isFile(); + + // EINVAL access errors sometimes happen which shouldn't because node shouldn't be giving + // us modes that aren't valid. investigate this, it's generally safe to proceed. + + /* if (srcStat.mode !== destStat.mode) { + try { + await access(dest, srcStat.mode); + } catch (err) {} + } */ + + if (bothFiles && artifactFiles.has(dest)) { + // this file gets changed during build, likely by a custom install script. Don't bother checking it. + onDone(); + reporter.verbose(reporter.lang('verboseFileSkipArtifact', src)); + return; + } + + if (bothFiles && srcStat.size === destStat.size && (0, (_fsNormalized || _load_fsNormalized()).fileDatesEqual)(srcStat.mtime, destStat.mtime)) { + // we can safely assume this is the same file + onDone(); + reporter.verbose(reporter.lang('verboseFileSkip', src, dest, srcStat.size, +srcStat.mtime)); + return; + } + + if (bothSymlinks) { + const srcReallink = yield readlink(src); + if (srcReallink === (yield readlink(dest))) { + // if both symlinks are the same then we can continue on + onDone(); + reporter.verbose(reporter.lang('verboseFileSkipSymlink', src, dest, srcReallink)); + return; + } + } + + if (bothFolders) { + // mark files that aren't in this folder as possibly extraneous + const destFiles = yield readdir(dest); + invariant(srcFiles, 'src files not initialised'); + + for (var _iterator4 = destFiles, _isArray4 = Array.isArray(_iterator4), _i4 = 0, _iterator4 = _isArray4 ? _iterator4 : _iterator4[Symbol.iterator]();;) { + var _ref6; + + if (_isArray4) { + if (_i4 >= _iterator4.length) break; + _ref6 = _iterator4[_i4++]; + } else { + _i4 = _iterator4.next(); + if (_i4.done) break; + _ref6 = _i4.value; + } + + const file = _ref6; + + if (srcFiles.indexOf(file) < 0) { + const loc = (_path || _load_path()).default.join(dest, file); + possibleExtraneous.add(loc); + + if ((yield lstat(loc)).isDirectory()) { + for (var _iterator5 = yield readdir(loc), _isArray5 = Array.isArray(_iterator5), _i5 = 0, _iterator5 = _isArray5 ? _iterator5 : _iterator5[Symbol.iterator]();;) { + var _ref7; + + if (_isArray5) { + if (_i5 >= _iterator5.length) break; + _ref7 = _iterator5[_i5++]; + } else { + _i5 = _iterator5.next(); + if (_i5.done) break; + _ref7 = _i5.value; + } + + const file = _ref7; + + possibleExtraneous.add((_path || _load_path()).default.join(loc, file)); + } + } + } + } + } + } + + if (destStat && destStat.isSymbolicLink()) { + yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(dest); + destStat = null; + } + + if (srcStat.isSymbolicLink()) { + onFresh(); + const linkname = yield readlink(src); + actions.symlink.push({ + dest, + linkname + }); + onDone(); + } else if (srcStat.isDirectory()) { + if (!destStat) { + reporter.verbose(reporter.lang('verboseFileFolder', dest)); + yield mkdirp(dest); + } + + const destParts = dest.split((_path || _load_path()).default.sep); + while (destParts.length) { + files.add(destParts.join((_path || _load_path()).default.sep).toLowerCase()); + destParts.pop(); + } + + // push all files to queue + invariant(srcFiles, 'src files not initialised'); + let remaining = srcFiles.length; + if (!remaining) { + onDone(); + } + for (var _iterator6 = srcFiles, _isArray6 = Array.isArray(_iterator6), _i6 = 0, _iterator6 = _isArray6 ? _iterator6 : _iterator6[Symbol.iterator]();;) { + var _ref8; + + if (_isArray6) { + if (_i6 >= _iterator6.length) break; + _ref8 = _iterator6[_i6++]; + } else { + _i6 = _iterator6.next(); + if (_i6.done) break; + _ref8 = _i6.value; + } + + const file = _ref8; + + queue.push({ + dest: (_path || _load_path()).default.join(dest, file), + onFresh, + onDone: function (_onDone) { + function onDone() { + return _onDone.apply(this, arguments); + } + + onDone.toString = function () { + return _onDone.toString(); + }; + + return onDone; + }(function () { + if (--remaining === 0) { + onDone(); + } + }), + src: (_path || _load_path()).default.join(src, file) + }); + } + } else if (srcStat.isFile()) { + onFresh(); + actions.file.push({ + src, + dest, + atime: srcStat.atime, + mtime: srcStat.mtime, + mode: srcStat.mode + }); + onDone(); + } else { + throw new Error(`unsure how to copy this: ${src}`); + } + }); + + return function build(_x5) { + return _ref5.apply(this, arguments); + }; + })(); + + const artifactFiles = new Set(events.artifactFiles || []); + const files = new Set(); + + // initialise events + for (var _iterator = queue, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) { + var _ref2; + + if (_isArray) { + if (_i >= _iterator.length) break; + _ref2 = _iterator[_i++]; + } else { + _i = _iterator.next(); + if (_i.done) break; + _ref2 = _i.value; + } + + const item = _ref2; + + const onDone = item.onDone; + item.onDone = function () { + events.onProgress(item.dest); + if (onDone) { + onDone(); + } + }; + } + events.onStart(queue.length); + + // start building actions + const actions = { + file: [], + symlink: [], + link: [] + }; + + // custom concurrency logic as we're always executing stacks of CONCURRENT_QUEUE_ITEMS queue items + // at a time due to the requirement to push items onto the queue + while (queue.length) { + const items = queue.splice(0, CONCURRENT_QUEUE_ITEMS); + yield Promise.all(items.map(build)); + } + + // simulate the existence of some files to prevent considering them extraneous + for (var _iterator2 = artifactFiles, _isArray2 = Array.isArray(_iterator2), _i2 = 0, _iterator2 = _isArray2 ? _iterator2 : _iterator2[Symbol.iterator]();;) { + var _ref3; + + if (_isArray2) { + if (_i2 >= _iterator2.length) break; + _ref3 = _iterator2[_i2++]; + } else { + _i2 = _iterator2.next(); + if (_i2.done) break; + _ref3 = _i2.value; + } + + const file = _ref3; + + if (possibleExtraneous.has(file)) { + reporter.verbose(reporter.lang('verboseFilePhantomExtraneous', file)); + possibleExtraneous.delete(file); + } + } + + for (var _iterator3 = possibleExtraneous, _isArray3 = Array.isArray(_iterator3), _i3 = 0, _iterator3 = _isArray3 ? _iterator3 : _iterator3[Symbol.iterator]();;) { + var _ref4; + + if (_isArray3) { + if (_i3 >= _iterator3.length) break; + _ref4 = _iterator3[_i3++]; + } else { + _i3 = _iterator3.next(); + if (_i3.done) break; + _ref4 = _i3.value; + } + + const loc = _ref4; + + if (files.has(loc.toLowerCase())) { + possibleExtraneous.delete(loc); + } + } + + return actions; + }); + + return function buildActionsForCopy(_x, _x2, _x3, _x4) { + return _ref.apply(this, arguments); + }; +})(); + +let buildActionsForHardlink = (() => { + var _ref9 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, events, possibleExtraneous, reporter) { + + // + let build = (() => { + var _ref13 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) { + const src = data.src, + dest = data.dest; + + const onFresh = data.onFresh || noop; + const onDone = data.onDone || noop; + if (files.has(dest.toLowerCase())) { + // Fixes issue https://github.com/yarnpkg/yarn/issues/2734 + // When bulk hardlinking we have A -> B structure that we want to hardlink to A1 -> B1, + // package-linker passes that modules A1 and B1 need to be hardlinked, + // the recursive linking algorithm of A1 ends up scheduling files in B1 to be linked twice which will case + // an exception. + onDone(); + return; + } + files.add(dest.toLowerCase()); + + if (events.ignoreBasenames.indexOf((_path || _load_path()).default.basename(src)) >= 0) { + // ignored file + return; + } + + const srcStat = yield lstat(src); + let srcFiles; + + if (srcStat.isDirectory()) { + srcFiles = yield readdir(src); + } + + const destExists = yield exists(dest); + if (destExists) { + const destStat = yield lstat(dest); + + const bothSymlinks = srcStat.isSymbolicLink() && destStat.isSymbolicLink(); + const bothFolders = srcStat.isDirectory() && destStat.isDirectory(); + const bothFiles = srcStat.isFile() && destStat.isFile(); + + if (srcStat.mode !== destStat.mode) { + try { + yield access(dest, srcStat.mode); + } catch (err) { + // EINVAL access errors sometimes happen which shouldn't because node shouldn't be giving + // us modes that aren't valid. investigate this, it's generally safe to proceed. + reporter.verbose(err); + } + } + + if (bothFiles && artifactFiles.has(dest)) { + // this file gets changed during build, likely by a custom install script. Don't bother checking it. + onDone(); + reporter.verbose(reporter.lang('verboseFileSkipArtifact', src)); + return; + } + + // correct hardlink + if (bothFiles && srcStat.ino !== null && srcStat.ino === destStat.ino) { + onDone(); + reporter.verbose(reporter.lang('verboseFileSkip', src, dest, srcStat.ino)); + return; + } + + if (bothSymlinks) { + const srcReallink = yield readlink(src); + if (srcReallink === (yield readlink(dest))) { + // if both symlinks are the same then we can continue on + onDone(); + reporter.verbose(reporter.lang('verboseFileSkipSymlink', src, dest, srcReallink)); + return; + } + } + + if (bothFolders) { + // mark files that aren't in this folder as possibly extraneous + const destFiles = yield readdir(dest); + invariant(srcFiles, 'src files not initialised'); + + for (var _iterator10 = destFiles, _isArray10 = Array.isArray(_iterator10), _i10 = 0, _iterator10 = _isArray10 ? _iterator10 : _iterator10[Symbol.iterator]();;) { + var _ref14; + + if (_isArray10) { + if (_i10 >= _iterator10.length) break; + _ref14 = _iterator10[_i10++]; + } else { + _i10 = _iterator10.next(); + if (_i10.done) break; + _ref14 = _i10.value; + } + + const file = _ref14; + + if (srcFiles.indexOf(file) < 0) { + const loc = (_path || _load_path()).default.join(dest, file); + possibleExtraneous.add(loc); + + if ((yield lstat(loc)).isDirectory()) { + for (var _iterator11 = yield readdir(loc), _isArray11 = Array.isArray(_iterator11), _i11 = 0, _iterator11 = _isArray11 ? _iterator11 : _iterator11[Symbol.iterator]();;) { + var _ref15; + + if (_isArray11) { + if (_i11 >= _iterator11.length) break; + _ref15 = _iterator11[_i11++]; + } else { + _i11 = _iterator11.next(); + if (_i11.done) break; + _ref15 = _i11.value; + } + + const file = _ref15; + + possibleExtraneous.add((_path || _load_path()).default.join(loc, file)); + } + } + } + } + } + } + + if (srcStat.isSymbolicLink()) { + onFresh(); + const linkname = yield readlink(src); + actions.symlink.push({ + dest, + linkname + }); + onDone(); + } else if (srcStat.isDirectory()) { + reporter.verbose(reporter.lang('verboseFileFolder', dest)); + yield mkdirp(dest); + + const destParts = dest.split((_path || _load_path()).default.sep); + while (destParts.length) { + files.add(destParts.join((_path || _load_path()).default.sep).toLowerCase()); + destParts.pop(); + } + + // push all files to queue + invariant(srcFiles, 'src files not initialised'); + let remaining = srcFiles.length; + if (!remaining) { + onDone(); + } + for (var _iterator12 = srcFiles, _isArray12 = Array.isArray(_iterator12), _i12 = 0, _iterator12 = _isArray12 ? _iterator12 : _iterator12[Symbol.iterator]();;) { + var _ref16; + + if (_isArray12) { + if (_i12 >= _iterator12.length) break; + _ref16 = _iterator12[_i12++]; + } else { + _i12 = _iterator12.next(); + if (_i12.done) break; + _ref16 = _i12.value; + } + + const file = _ref16; + + queue.push({ + onFresh, + src: (_path || _load_path()).default.join(src, file), + dest: (_path || _load_path()).default.join(dest, file), + onDone: function (_onDone2) { + function onDone() { + return _onDone2.apply(this, arguments); + } + + onDone.toString = function () { + return _onDone2.toString(); + }; + + return onDone; + }(function () { + if (--remaining === 0) { + onDone(); + } + }) + }); + } + } else if (srcStat.isFile()) { + onFresh(); + actions.link.push({ + src, + dest, + removeDest: destExists + }); + onDone(); + } else { + throw new Error(`unsure how to copy this: ${src}`); + } + }); + + return function build(_x10) { + return _ref13.apply(this, arguments); + }; + })(); + + const artifactFiles = new Set(events.artifactFiles || []); + const files = new Set(); + + // initialise events + for (var _iterator7 = queue, _isArray7 = Array.isArray(_iterator7), _i7 = 0, _iterator7 = _isArray7 ? _iterator7 : _iterator7[Symbol.iterator]();;) { + var _ref10; + + if (_isArray7) { + if (_i7 >= _iterator7.length) break; + _ref10 = _iterator7[_i7++]; + } else { + _i7 = _iterator7.next(); + if (_i7.done) break; + _ref10 = _i7.value; + } + + const item = _ref10; + + const onDone = item.onDone || noop; + item.onDone = function () { + events.onProgress(item.dest); + onDone(); + }; + } + events.onStart(queue.length); + + // start building actions + const actions = { + file: [], + symlink: [], + link: [] + }; + + // custom concurrency logic as we're always executing stacks of CONCURRENT_QUEUE_ITEMS queue items + // at a time due to the requirement to push items onto the queue + while (queue.length) { + const items = queue.splice(0, CONCURRENT_QUEUE_ITEMS); + yield Promise.all(items.map(build)); + } + + // simulate the existence of some files to prevent considering them extraneous + for (var _iterator8 = artifactFiles, _isArray8 = Array.isArray(_iterator8), _i8 = 0, _iterator8 = _isArray8 ? _iterator8 : _iterator8[Symbol.iterator]();;) { + var _ref11; + + if (_isArray8) { + if (_i8 >= _iterator8.length) break; + _ref11 = _iterator8[_i8++]; + } else { + _i8 = _iterator8.next(); + if (_i8.done) break; + _ref11 = _i8.value; + } + + const file = _ref11; + + if (possibleExtraneous.has(file)) { + reporter.verbose(reporter.lang('verboseFilePhantomExtraneous', file)); + possibleExtraneous.delete(file); + } + } + + for (var _iterator9 = possibleExtraneous, _isArray9 = Array.isArray(_iterator9), _i9 = 0, _iterator9 = _isArray9 ? _iterator9 : _iterator9[Symbol.iterator]();;) { + var _ref12; + + if (_isArray9) { + if (_i9 >= _iterator9.length) break; + _ref12 = _iterator9[_i9++]; + } else { + _i9 = _iterator9.next(); + if (_i9.done) break; + _ref12 = _i9.value; + } + + const loc = _ref12; + + if (files.has(loc.toLowerCase())) { + possibleExtraneous.delete(loc); + } + } + + return actions; + }); + + return function buildActionsForHardlink(_x6, _x7, _x8, _x9) { + return _ref9.apply(this, arguments); + }; +})(); + +let copyBulk = exports.copyBulk = (() => { + var _ref17 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, reporter, _events) { + const events = { + onStart: _events && _events.onStart || noop, + onProgress: _events && _events.onProgress || noop, + possibleExtraneous: _events ? _events.possibleExtraneous : new Set(), + ignoreBasenames: _events && _events.ignoreBasenames || [], + artifactFiles: _events && _events.artifactFiles || [] + }; + + const actions = yield buildActionsForCopy(queue, events, events.possibleExtraneous, reporter); + events.onStart(actions.file.length + actions.symlink.length + actions.link.length); + + const fileActions = actions.file; + + const currentlyWriting = new Map(); + + yield (_promise || _load_promise()).queue(fileActions, (() => { + var _ref18 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) { + let writePromise; + while (writePromise = currentlyWriting.get(data.dest)) { + yield writePromise; + } + + reporter.verbose(reporter.lang('verboseFileCopy', data.src, data.dest)); + const copier = (0, (_fsNormalized || _load_fsNormalized()).copyFile)(data, function () { + return currentlyWriting.delete(data.dest); + }); + currentlyWriting.set(data.dest, copier); + events.onProgress(data.dest); + return copier; + }); + + return function (_x14) { + return _ref18.apply(this, arguments); + }; + })(), CONCURRENT_QUEUE_ITEMS); + + // we need to copy symlinks last as they could reference files we were copying + const symlinkActions = actions.symlink; + yield (_promise || _load_promise()).queue(symlinkActions, function (data) { + const linkname = (_path || _load_path()).default.resolve((_path || _load_path()).default.dirname(data.dest), data.linkname); + reporter.verbose(reporter.lang('verboseFileSymlink', data.dest, linkname)); + return symlink(linkname, data.dest); + }); + }); + + return function copyBulk(_x11, _x12, _x13) { + return _ref17.apply(this, arguments); + }; +})(); + +let hardlinkBulk = exports.hardlinkBulk = (() => { + var _ref19 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, reporter, _events) { + const events = { + onStart: _events && _events.onStart || noop, + onProgress: _events && _events.onProgress || noop, + possibleExtraneous: _events ? _events.possibleExtraneous : new Set(), + artifactFiles: _events && _events.artifactFiles || [], + ignoreBasenames: [] + }; + + const actions = yield buildActionsForHardlink(queue, events, events.possibleExtraneous, reporter); + events.onStart(actions.file.length + actions.symlink.length + actions.link.length); + + const fileActions = actions.link; + + yield (_promise || _load_promise()).queue(fileActions, (() => { + var _ref20 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) { + reporter.verbose(reporter.lang('verboseFileLink', data.src, data.dest)); + if (data.removeDest) { + yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(data.dest); + } + yield link(data.src, data.dest); + }); + + return function (_x18) { + return _ref20.apply(this, arguments); + }; + })(), CONCURRENT_QUEUE_ITEMS); + + // we need to copy symlinks last as they could reference files we were copying + const symlinkActions = actions.symlink; + yield (_promise || _load_promise()).queue(symlinkActions, function (data) { + const linkname = (_path || _load_path()).default.resolve((_path || _load_path()).default.dirname(data.dest), data.linkname); + reporter.verbose(reporter.lang('verboseFileSymlink', data.dest, linkname)); + return symlink(linkname, data.dest); + }); + }); + + return function hardlinkBulk(_x15, _x16, _x17) { + return _ref19.apply(this, arguments); + }; +})(); + +let readFileAny = exports.readFileAny = (() => { + var _ref21 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (files) { + for (var _iterator13 = files, _isArray13 = Array.isArray(_iterator13), _i13 = 0, _iterator13 = _isArray13 ? _iterator13 : _iterator13[Symbol.iterator]();;) { + var _ref22; + + if (_isArray13) { + if (_i13 >= _iterator13.length) break; + _ref22 = _iterator13[_i13++]; + } else { + _i13 = _iterator13.next(); + if (_i13.done) break; + _ref22 = _i13.value; + } + + const file = _ref22; + + if (yield exists(file)) { + return readFile(file); + } + } + return null; + }); + + return function readFileAny(_x19) { + return _ref21.apply(this, arguments); + }; +})(); + +let readJson = exports.readJson = (() => { + var _ref23 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (loc) { + return (yield readJsonAndFile(loc)).object; + }); + + return function readJson(_x20) { + return _ref23.apply(this, arguments); + }; +})(); + +let readJsonAndFile = exports.readJsonAndFile = (() => { + var _ref24 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (loc) { + const file = yield readFile(loc); + try { + return { + object: (0, (_map || _load_map()).default)(JSON.parse(stripBOM(file))), + content: file + }; + } catch (err) { + err.message = `${loc}: ${err.message}`; + throw err; + } + }); + + return function readJsonAndFile(_x21) { + return _ref24.apply(this, arguments); + }; +})(); + +let find = exports.find = (() => { + var _ref25 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (filename, dir) { + const parts = dir.split((_path || _load_path()).default.sep); + + while (parts.length) { + const loc = parts.concat(filename).join((_path || _load_path()).default.sep); + + if (yield exists(loc)) { + return loc; + } else { + parts.pop(); + } + } + + return false; + }); + + return function find(_x22, _x23) { + return _ref25.apply(this, arguments); + }; +})(); + +let symlink = exports.symlink = (() => { + var _ref26 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (src, dest) { + if (process.platform !== 'win32') { + // use relative paths otherwise which will be retained if the directory is moved + src = (_path || _load_path()).default.relative((_path || _load_path()).default.dirname(dest), src); + // When path.relative returns an empty string for the current directory, we should instead use + // '.', which is a valid fs.symlink target. + src = src || '.'; + } + + try { + const stats = yield lstat(dest); + if (stats.isSymbolicLink()) { + const resolved = dest; + if (resolved === src) { + return; + } + } + } catch (err) { + if (err.code !== 'ENOENT') { + throw err; + } + } + + // We use rimraf for unlink which never throws an ENOENT on missing target + yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(dest); + + if (process.platform === 'win32') { + // use directory junctions if possible on win32, this requires absolute paths + yield fsSymlink(src, dest, 'junction'); + } else { + yield fsSymlink(src, dest); + } + }); + + return function symlink(_x24, _x25) { + return _ref26.apply(this, arguments); + }; +})(); + +let walk = exports.walk = (() => { + var _ref27 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (dir, relativeDir, ignoreBasenames = new Set()) { + let files = []; + + let filenames = yield readdir(dir); + if (ignoreBasenames.size) { + filenames = filenames.filter(function (name) { + return !ignoreBasenames.has(name); + }); + } + + for (var _iterator14 = filenames, _isArray14 = Array.isArray(_iterator14), _i14 = 0, _iterator14 = _isArray14 ? _iterator14 : _iterator14[Symbol.iterator]();;) { + var _ref28; + + if (_isArray14) { + if (_i14 >= _iterator14.length) break; + _ref28 = _iterator14[_i14++]; + } else { + _i14 = _iterator14.next(); + if (_i14.done) break; + _ref28 = _i14.value; + } + + const name = _ref28; + + const relative = relativeDir ? (_path || _load_path()).default.join(relativeDir, name) : name; + const loc = (_path || _load_path()).default.join(dir, name); + const stat = yield lstat(loc); + + files.push({ + relative, + basename: name, + absolute: loc, + mtime: +stat.mtime + }); + + if (stat.isDirectory()) { + files = files.concat((yield walk(loc, relative, ignoreBasenames))); + } + } + + return files; + }); + + return function walk(_x26, _x27) { + return _ref27.apply(this, arguments); + }; +})(); + +let getFileSizeOnDisk = exports.getFileSizeOnDisk = (() => { + var _ref29 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (loc) { + const stat = yield lstat(loc); + const size = stat.size, + blockSize = stat.blksize; + + + return Math.ceil(size / blockSize) * blockSize; + }); + + return function getFileSizeOnDisk(_x28) { + return _ref29.apply(this, arguments); + }; +})(); + +let getEolFromFile = (() => { + var _ref30 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (path) { + if (!(yield exists(path))) { + return undefined; + } + + const buffer = yield readFileBuffer(path); + + for (let i = 0; i < buffer.length; ++i) { + if (buffer[i] === cr) { + return '\r\n'; + } + if (buffer[i] === lf) { + return '\n'; + } + } + return undefined; + }); + + return function getEolFromFile(_x29) { + return _ref30.apply(this, arguments); + }; +})(); + +let writeFilePreservingEol = exports.writeFilePreservingEol = (() => { + var _ref31 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (path, data) { + const eol = (yield getEolFromFile(path)) || (_os || _load_os()).default.EOL; + if (eol !== '\n') { + data = data.replace(/\n/g, eol); + } + yield writeFile(path, data); + }); + + return function writeFilePreservingEol(_x30, _x31) { + return _ref31.apply(this, arguments); + }; +})(); + +let hardlinksWork = exports.hardlinksWork = (() => { + var _ref32 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (dir) { + const filename = 'test-file' + Math.random(); + const file = (_path || _load_path()).default.join(dir, filename); + const fileLink = (_path || _load_path()).default.join(dir, filename + '-link'); + try { + yield writeFile(file, 'test'); + yield link(file, fileLink); + } catch (err) { + return false; + } finally { + yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(file); + yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(fileLink); + } + return true; + }); + + return function hardlinksWork(_x32) { + return _ref32.apply(this, arguments); + }; +})(); + +// not a strict polyfill for Node's fs.mkdtemp + + +let makeTempDir = exports.makeTempDir = (() => { + var _ref33 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (prefix) { + const dir = (_path || _load_path()).default.join((_os || _load_os()).default.tmpdir(), `yarn-${prefix || ''}-${Date.now()}-${Math.random()}`); + yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(dir); + yield mkdirp(dir); + return dir; + }); + + return function makeTempDir(_x33) { + return _ref33.apply(this, arguments); + }; +})(); + +let readFirstAvailableStream = exports.readFirstAvailableStream = (() => { + var _ref34 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (paths) { + for (var _iterator15 = paths, _isArray15 = Array.isArray(_iterator15), _i15 = 0, _iterator15 = _isArray15 ? _iterator15 : _iterator15[Symbol.iterator]();;) { + var _ref35; + + if (_isArray15) { + if (_i15 >= _iterator15.length) break; + _ref35 = _iterator15[_i15++]; + } else { + _i15 = _iterator15.next(); + if (_i15.done) break; + _ref35 = _i15.value; + } + + const path = _ref35; + + try { + const fd = yield open(path, 'r'); + return (_fs || _load_fs()).default.createReadStream(path, { fd }); + } catch (err) { + // Try the next one + } + } + return null; + }); + + return function readFirstAvailableStream(_x34) { + return _ref34.apply(this, arguments); + }; +})(); + +let getFirstSuitableFolder = exports.getFirstSuitableFolder = (() => { + var _ref36 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (paths, mode = constants.W_OK | constants.X_OK) { + const result = { + skipped: [], + folder: null + }; + + for (var _iterator16 = paths, _isArray16 = Array.isArray(_iterator16), _i16 = 0, _iterator16 = _isArray16 ? _iterator16 : _iterator16[Symbol.iterator]();;) { + var _ref37; + + if (_isArray16) { + if (_i16 >= _iterator16.length) break; + _ref37 = _iterator16[_i16++]; + } else { + _i16 = _iterator16.next(); + if (_i16.done) break; + _ref37 = _i16.value; + } + + const folder = _ref37; + + try { + yield mkdirp(folder); + yield access(folder, mode); + + result.folder = folder; + + return result; + } catch (error) { + result.skipped.push({ + error, + folder + }); + } + } + return result; + }); + + return function getFirstSuitableFolder(_x35) { + return _ref36.apply(this, arguments); + }; +})(); + +exports.copy = copy; +exports.readFile = readFile; +exports.readFileRaw = readFileRaw; +exports.normalizeOS = normalizeOS; + +var _fs; + +function _load_fs() { + return _fs = _interopRequireDefault(__webpack_require__(5)); +} + +var _glob; + +function _load_glob() { + return _glob = _interopRequireDefault(__webpack_require__(99)); +} + +var _os; + +function _load_os() { + return _os = _interopRequireDefault(__webpack_require__(49)); +} + +var _path; + +function _load_path() { + return _path = _interopRequireDefault(__webpack_require__(0)); +} + +var _blockingQueue; + +function _load_blockingQueue() { + return _blockingQueue = _interopRequireDefault(__webpack_require__(110)); +} + +var _promise; + +function _load_promise() { + return _promise = _interopRequireWildcard(__webpack_require__(50)); +} + +var _promise2; + +function _load_promise2() { + return _promise2 = __webpack_require__(50); +} + +var _map; + +function _load_map() { + return _map = _interopRequireDefault(__webpack_require__(29)); +} + +var _fsNormalized; + +function _load_fsNormalized() { + return _fsNormalized = __webpack_require__(218); +} + +function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +const constants = exports.constants = typeof (_fs || _load_fs()).default.constants !== 'undefined' ? (_fs || _load_fs()).default.constants : { + R_OK: (_fs || _load_fs()).default.R_OK, + W_OK: (_fs || _load_fs()).default.W_OK, + X_OK: (_fs || _load_fs()).default.X_OK +}; + +const lockQueue = exports.lockQueue = new (_blockingQueue || _load_blockingQueue()).default('fs lock'); + +const readFileBuffer = exports.readFileBuffer = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.readFile); +const open = exports.open = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.open); +const writeFile = exports.writeFile = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.writeFile); +const readlink = exports.readlink = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.readlink); +const realpath = exports.realpath = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.realpath); +const readdir = exports.readdir = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.readdir); +const rename = exports.rename = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.rename); +const access = exports.access = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.access); +const stat = exports.stat = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.stat); +const mkdirp = exports.mkdirp = (0, (_promise2 || _load_promise2()).promisify)(__webpack_require__(145)); +const exists = exports.exists = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.exists, true); +const lstat = exports.lstat = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.lstat); +const chmod = exports.chmod = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.chmod); +const link = exports.link = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.link); +const glob = exports.glob = (0, (_promise2 || _load_promise2()).promisify)((_glob || _load_glob()).default); +exports.unlink = (_fsNormalized || _load_fsNormalized()).unlink; + +// fs.copyFile uses the native file copying instructions on the system, performing much better +// than any JS-based solution and consumes fewer resources. Repeated testing to fine tune the +// concurrency level revealed 128 as the sweet spot on a quad-core, 16 CPU Intel system with SSD. + +const CONCURRENT_QUEUE_ITEMS = (_fs || _load_fs()).default.copyFile ? 128 : 4; + +const fsSymlink = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.symlink); +const invariant = __webpack_require__(9); +const stripBOM = __webpack_require__(160); + +const noop = () => {}; + +function copy(src, dest, reporter) { + return copyBulk([{ src, dest }], reporter); +} + +function _readFile(loc, encoding) { + return new Promise((resolve, reject) => { + (_fs || _load_fs()).default.readFile(loc, encoding, function (err, content) { + if (err) { + reject(err); + } else { + resolve(content); + } + }); + }); +} + +function readFile(loc) { + return _readFile(loc, 'utf8').then(normalizeOS); +} + +function readFileRaw(loc) { + return _readFile(loc, 'binary'); +} + +function normalizeOS(body) { + return body.replace(/\r\n/g, '\n'); +} + +const cr = '\r'.charCodeAt(0); +const lf = '\n'.charCodeAt(0); + +/***/ }), +/* 5 */ +/***/ (function(module, exports) { + +module.exports = require("fs"); + +/***/ }), +/* 6 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); +class MessageError extends Error { + constructor(msg, code) { + super(msg); + this.code = code; + } + +} + +exports.MessageError = MessageError; +class ProcessSpawnError extends MessageError { + constructor(msg, code, process) { + super(msg, code); + this.process = process; + } + +} + +exports.ProcessSpawnError = ProcessSpawnError; +class SecurityError extends MessageError {} + +exports.SecurityError = SecurityError; +class ProcessTermError extends MessageError {} + +exports.ProcessTermError = ProcessTermError; +class ResponseError extends Error { + constructor(msg, responseCode) { + super(msg); + this.responseCode = responseCode; + } + +} + +exports.ResponseError = ResponseError; +class OneTimePasswordError extends Error {} +exports.OneTimePasswordError = OneTimePasswordError; + +/***/ }), +/* 7 */ +/***/ (function(module, __webpack_exports__, __webpack_require__) { + +"use strict"; +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Subscriber; }); +/* unused harmony export SafeSubscriber */ +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_tslib__ = __webpack_require__(1); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_isFunction__ = __webpack_require__(154); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__Observer__ = __webpack_require__(420); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__Subscription__ = __webpack_require__(25); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__internal_symbol_rxSubscriber__ = __webpack_require__(321); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__config__ = __webpack_require__(185); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__util_hostReportError__ = __webpack_require__(323); +/** PURE_IMPORTS_START tslib,_util_isFunction,_Observer,_Subscription,_internal_symbol_rxSubscriber,_config,_util_hostReportError PURE_IMPORTS_END */ + + + + + + + +var Subscriber = /*@__PURE__*/ (function (_super) { + __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](Subscriber, _super); + function Subscriber(destinationOrNext, error, complete) { + var _this = _super.call(this) || this; + _this.syncErrorValue = null; + _this.syncErrorThrown = false; + _this.syncErrorThrowable = false; + _this.isStopped = false; + _this._parentSubscription = null; + switch (arguments.length) { + case 0: + _this.destination = __WEBPACK_IMPORTED_MODULE_2__Observer__["a" /* empty */]; + break; + case 1: + if (!destinationOrNext) { + _this.destination = __WEBPACK_IMPORTED_MODULE_2__Observer__["a" /* empty */]; + break; + } + if (typeof destinationOrNext === 'object') { + if (destinationOrNext instanceof Subscriber) { + _this.syncErrorThrowable = destinationOrNext.syncErrorThrowable; + _this.destination = destinationOrNext; + destinationOrNext.add(_this); + } + else { + _this.syncErrorThrowable = true; + _this.destination = new SafeSubscriber(_this, destinationOrNext); + } + break; + } + default: + _this.syncErrorThrowable = true; + _this.destination = new SafeSubscriber(_this, destinationOrNext, error, complete); + break; + } + return _this; + } + Subscriber.prototype[__WEBPACK_IMPORTED_MODULE_4__internal_symbol_rxSubscriber__["a" /* rxSubscriber */]] = function () { return this; }; + Subscriber.create = function (next, error, complete) { + var subscriber = new Subscriber(next, error, complete); + subscriber.syncErrorThrowable = false; + return subscriber; + }; + Subscriber.prototype.next = function (value) { + if (!this.isStopped) { + this._next(value); + } + }; + Subscriber.prototype.error = function (err) { + if (!this.isStopped) { + this.isStopped = true; + this._error(err); + } + }; + Subscriber.prototype.complete = function () { + if (!this.isStopped) { + this.isStopped = true; + this._complete(); + } + }; + Subscriber.prototype.unsubscribe = function () { + if (this.closed) { + return; + } + this.isStopped = true; + _super.prototype.unsubscribe.call(this); + }; + Subscriber.prototype._next = function (value) { + this.destination.next(value); + }; + Subscriber.prototype._error = function (err) { + this.destination.error(err); + this.unsubscribe(); + }; + Subscriber.prototype._complete = function () { + this.destination.complete(); + this.unsubscribe(); + }; + Subscriber.prototype._unsubscribeAndRecycle = function () { + var _a = this, _parent = _a._parent, _parents = _a._parents; + this._parent = null; + this._parents = null; + this.unsubscribe(); + this.closed = false; + this.isStopped = false; + this._parent = _parent; + this._parents = _parents; + this._parentSubscription = null; + return this; + }; + return Subscriber; +}(__WEBPACK_IMPORTED_MODULE_3__Subscription__["a" /* Subscription */])); + +var SafeSubscriber = /*@__PURE__*/ (function (_super) { + __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](SafeSubscriber, _super); + function SafeSubscriber(_parentSubscriber, observerOrNext, error, complete) { + var _this = _super.call(this) || this; + _this._parentSubscriber = _parentSubscriber; + var next; + var context = _this; + if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__util_isFunction__["a" /* isFunction */])(observerOrNext)) { + next = observerOrNext; + } + else if (observerOrNext) { + next = observerOrNext.next; + error = observerOrNext.error; + complete = observerOrNext.complete; + if (observerOrNext !== __WEBPACK_IMPORTED_MODULE_2__Observer__["a" /* empty */]) { + context = Object.create(observerOrNext); + if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__util_isFunction__["a" /* isFunction */])(context.unsubscribe)) { + _this.add(context.unsubscribe.bind(context)); + } + context.unsubscribe = _this.unsubscribe.bind(_this); + } + } + _this._context = context; + _this._next = next; + _this._error = error; + _this._complete = complete; + return _this; + } + SafeSubscriber.prototype.next = function (value) { + if (!this.isStopped && this._next) { + var _parentSubscriber = this._parentSubscriber; + if (!__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) { + this.__tryOrUnsub(this._next, value); + } + else if (this.__tryOrSetError(_parentSubscriber, this._next, value)) { + this.unsubscribe(); + } + } + }; + SafeSubscriber.prototype.error = function (err) { + if (!this.isStopped) { + var _parentSubscriber = this._parentSubscriber; + var useDeprecatedSynchronousErrorHandling = __WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling; + if (this._error) { + if (!useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) { + this.__tryOrUnsub(this._error, err); + this.unsubscribe(); + } + else { + this.__tryOrSetError(_parentSubscriber, this._error, err); + this.unsubscribe(); + } + } + else if (!_parentSubscriber.syncErrorThrowable) { + this.unsubscribe(); + if (useDeprecatedSynchronousErrorHandling) { + throw err; + } + __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__util_hostReportError__["a" /* hostReportError */])(err); + } + else { + if (useDeprecatedSynchronousErrorHandling) { + _parentSubscriber.syncErrorValue = err; + _parentSubscriber.syncErrorThrown = true; + } + else { + __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__util_hostReportError__["a" /* hostReportError */])(err); + } + this.unsubscribe(); + } + } + }; + SafeSubscriber.prototype.complete = function () { + var _this = this; + if (!this.isStopped) { + var _parentSubscriber = this._parentSubscriber; + if (this._complete) { + var wrappedComplete = function () { return _this._complete.call(_this._context); }; + if (!__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) { + this.__tryOrUnsub(wrappedComplete); + this.unsubscribe(); + } + else { + this.__tryOrSetError(_parentSubscriber, wrappedComplete); + this.unsubscribe(); + } + } + else { + this.unsubscribe(); + } + } + }; + SafeSubscriber.prototype.__tryOrUnsub = function (fn, value) { + try { + fn.call(this._context, value); + } + catch (err) { + this.unsubscribe(); + if (__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) { + throw err; + } + else { + __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__util_hostReportError__["a" /* hostReportError */])(err); + } + } + }; + SafeSubscriber.prototype.__tryOrSetError = function (parent, fn, value) { + if (!__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) { + throw new Error('bad call'); + } + try { + fn.call(this._context, value); + } + catch (err) { + if (__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) { + parent.syncErrorValue = err; + parent.syncErrorThrown = true; + return true; + } + else { + __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__util_hostReportError__["a" /* hostReportError */])(err); + return true; + } + } + return false; + }; + SafeSubscriber.prototype._unsubscribe = function () { + var _parentSubscriber = this._parentSubscriber; + this._context = null; + this._parentSubscriber = null; + _parentSubscriber.unsubscribe(); + }; + return SafeSubscriber; +}(Subscriber)); + +//# sourceMappingURL=Subscriber.js.map + + +/***/ }), +/* 8 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.getPathKey = getPathKey; +const os = __webpack_require__(49); +const path = __webpack_require__(0); +const userHome = __webpack_require__(67).default; + +var _require = __webpack_require__(225); + +const getCacheDir = _require.getCacheDir, + getConfigDir = _require.getConfigDir, + getDataDir = _require.getDataDir; + +const isWebpackBundle = __webpack_require__(278); + +const DEPENDENCY_TYPES = exports.DEPENDENCY_TYPES = ['devDependencies', 'dependencies', 'optionalDependencies', 'peerDependencies']; +const OWNED_DEPENDENCY_TYPES = exports.OWNED_DEPENDENCY_TYPES = ['devDependencies', 'dependencies', 'optionalDependencies']; + +const RESOLUTIONS = exports.RESOLUTIONS = 'resolutions'; +const MANIFEST_FIELDS = exports.MANIFEST_FIELDS = [RESOLUTIONS, ...DEPENDENCY_TYPES]; + +const SUPPORTED_NODE_VERSIONS = exports.SUPPORTED_NODE_VERSIONS = '^4.8.0 || ^5.7.0 || ^6.2.2 || >=8.0.0'; + +const YARN_REGISTRY = exports.YARN_REGISTRY = 'https://registry.yarnpkg.com'; +const NPM_REGISTRY_RE = exports.NPM_REGISTRY_RE = /https?:\/\/registry\.npmjs\.org/g; + +const YARN_DOCS = exports.YARN_DOCS = 'https://yarnpkg.com/en/docs/cli/'; +const YARN_INSTALLER_SH = exports.YARN_INSTALLER_SH = 'https://yarnpkg.com/install.sh'; +const YARN_INSTALLER_MSI = exports.YARN_INSTALLER_MSI = 'https://yarnpkg.com/latest.msi'; + +const SELF_UPDATE_VERSION_URL = exports.SELF_UPDATE_VERSION_URL = 'https://yarnpkg.com/latest-version'; + +// cache version, bump whenever we make backwards incompatible changes +const CACHE_VERSION = exports.CACHE_VERSION = 6; + +// lockfile version, bump whenever we make backwards incompatible changes +const LOCKFILE_VERSION = exports.LOCKFILE_VERSION = 1; + +// max amount of network requests to perform concurrently +const NETWORK_CONCURRENCY = exports.NETWORK_CONCURRENCY = 8; + +// HTTP timeout used when downloading packages +const NETWORK_TIMEOUT = exports.NETWORK_TIMEOUT = 30 * 1000; // in milliseconds + +// max amount of child processes to execute concurrently +const CHILD_CONCURRENCY = exports.CHILD_CONCURRENCY = 5; + +const REQUIRED_PACKAGE_KEYS = exports.REQUIRED_PACKAGE_KEYS = ['name', 'version', '_uid']; + +function getPreferredCacheDirectories() { + const preferredCacheDirectories = [getCacheDir()]; + + if (process.getuid) { + // $FlowFixMe: process.getuid exists, dammit + preferredCacheDirectories.push(path.join(os.tmpdir(), `.yarn-cache-${process.getuid()}`)); + } + + preferredCacheDirectories.push(path.join(os.tmpdir(), `.yarn-cache`)); + + return preferredCacheDirectories; +} + +const PREFERRED_MODULE_CACHE_DIRECTORIES = exports.PREFERRED_MODULE_CACHE_DIRECTORIES = getPreferredCacheDirectories(); +const CONFIG_DIRECTORY = exports.CONFIG_DIRECTORY = getConfigDir(); +const DATA_DIRECTORY = exports.DATA_DIRECTORY = getDataDir(); +const LINK_REGISTRY_DIRECTORY = exports.LINK_REGISTRY_DIRECTORY = path.join(DATA_DIRECTORY, 'link'); +const GLOBAL_MODULE_DIRECTORY = exports.GLOBAL_MODULE_DIRECTORY = path.join(DATA_DIRECTORY, 'global'); + +const NODE_BIN_PATH = exports.NODE_BIN_PATH = process.execPath; +const YARN_BIN_PATH = exports.YARN_BIN_PATH = getYarnBinPath(); + +// Webpack needs to be configured with node.__dirname/__filename = false +function getYarnBinPath() { + if (isWebpackBundle) { + return __filename; + } else { + return path.join(__dirname, '..', 'bin', 'yarn.js'); + } +} + +const NODE_MODULES_FOLDER = exports.NODE_MODULES_FOLDER = 'node_modules'; +const NODE_PACKAGE_JSON = exports.NODE_PACKAGE_JSON = 'package.json'; + +const PNP_FILENAME = exports.PNP_FILENAME = '.pnp.js'; + +const POSIX_GLOBAL_PREFIX = exports.POSIX_GLOBAL_PREFIX = `${process.env.DESTDIR || ''}/usr/local`; +const FALLBACK_GLOBAL_PREFIX = exports.FALLBACK_GLOBAL_PREFIX = path.join(userHome, '.yarn'); + +const META_FOLDER = exports.META_FOLDER = '.yarn-meta'; +const INTEGRITY_FILENAME = exports.INTEGRITY_FILENAME = '.yarn-integrity'; +const LOCKFILE_FILENAME = exports.LOCKFILE_FILENAME = 'yarn.lock'; +const METADATA_FILENAME = exports.METADATA_FILENAME = '.yarn-metadata.json'; +const TARBALL_FILENAME = exports.TARBALL_FILENAME = '.yarn-tarball.tgz'; +const CLEAN_FILENAME = exports.CLEAN_FILENAME = '.yarnclean'; + +const NPM_LOCK_FILENAME = exports.NPM_LOCK_FILENAME = 'package-lock.json'; +const NPM_SHRINKWRAP_FILENAME = exports.NPM_SHRINKWRAP_FILENAME = 'npm-shrinkwrap.json'; + +const DEFAULT_INDENT = exports.DEFAULT_INDENT = ' '; +const SINGLE_INSTANCE_PORT = exports.SINGLE_INSTANCE_PORT = 31997; +const SINGLE_INSTANCE_FILENAME = exports.SINGLE_INSTANCE_FILENAME = '.yarn-single-instance'; + +const ENV_PATH_KEY = exports.ENV_PATH_KEY = getPathKey(process.platform, process.env); + +function getPathKey(platform, env) { + let pathKey = 'PATH'; + + // windows calls its path "Path" usually, but this is not guaranteed. + if (platform === 'win32') { + pathKey = 'Path'; + + for (const key in env) { + if (key.toLowerCase() === 'path') { + pathKey = key; + } + } + } + + return pathKey; +} + +const VERSION_COLOR_SCHEME = exports.VERSION_COLOR_SCHEME = { + major: 'red', + premajor: 'red', + minor: 'yellow', + preminor: 'yellow', + patch: 'green', + prepatch: 'green', + prerelease: 'red', + unchanged: 'white', + unknown: 'red' +}; + +/***/ }), +/* 9 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; +/** + * Copyright (c) 2013-present, Facebook, Inc. + * + * This source code is licensed under the MIT license found in the + * LICENSE file in the root directory of this source tree. + */ + + + +/** + * Use invariant() to assert state which your program assumes to be true. + * + * Provide sprintf-style format (only %s is supported) and arguments + * to provide information about what broke and what you were + * expecting. + * + * The invariant message will be stripped in production, but the invariant + * will remain to ensure logic does not differ in production. + */ + +var NODE_ENV = process.env.NODE_ENV; + +var invariant = function(condition, format, a, b, c, d, e, f) { + if (NODE_ENV !== 'production') { + if (format === undefined) { + throw new Error('invariant requires an error message argument'); + } + } + + if (!condition) { + var error; + if (format === undefined) { + error = new Error( + 'Minified exception occurred; use the non-minified dev environment ' + + 'for the full error message and additional helpful warnings.' + ); + } else { + var args = [a, b, c, d, e, f]; + var argIndex = 0; + error = new Error( + format.replace(/%s/g, function() { return args[argIndex++]; }) + ); + error.name = 'Invariant Violation'; + } + + error.framesToPop = 1; // we don't care about invariant's own frame + throw error; + } +}; + +module.exports = invariant; + + +/***/ }), +/* 10 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +var YAMLException = __webpack_require__(54); + +var TYPE_CONSTRUCTOR_OPTIONS = [ + 'kind', + 'resolve', + 'construct', + 'instanceOf', + 'predicate', + 'represent', + 'defaultStyle', + 'styleAliases' +]; + +var YAML_NODE_KINDS = [ + 'scalar', + 'sequence', + 'mapping' +]; + +function compileStyleAliases(map) { + var result = {}; + + if (map !== null) { + Object.keys(map).forEach(function (style) { + map[style].forEach(function (alias) { + result[String(alias)] = style; + }); + }); + } + + return result; +} + +function Type(tag, options) { + options = options || {}; + + Object.keys(options).forEach(function (name) { + if (TYPE_CONSTRUCTOR_OPTIONS.indexOf(name) === -1) { + throw new YAMLException('Unknown option "' + name + '" is met in definition of "' + tag + '" YAML type.'); + } + }); + + // TODO: Add tag format check. + this.tag = tag; + this.kind = options['kind'] || null; + this.resolve = options['resolve'] || function () { return true; }; + this.construct = options['construct'] || function (data) { return data; }; + this.instanceOf = options['instanceOf'] || null; + this.predicate = options['predicate'] || null; + this.represent = options['represent'] || null; + this.defaultStyle = options['defaultStyle'] || null; + this.styleAliases = compileStyleAliases(options['styleAliases'] || null); + + if (YAML_NODE_KINDS.indexOf(this.kind) === -1) { + throw new YAMLException('Unknown kind "' + this.kind + '" is specified for "' + tag + '" YAML type.'); + } +} + +module.exports = Type; + + +/***/ }), +/* 11 */ +/***/ (function(module, exports) { + +module.exports = require("crypto"); + +/***/ }), +/* 12 */ +/***/ (function(module, __webpack_exports__, __webpack_require__) { + +"use strict"; +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Observable; }); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__util_canReportError__ = __webpack_require__(322); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_toSubscriber__ = __webpack_require__(932); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__internal_symbol_observable__ = __webpack_require__(117); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__util_pipe__ = __webpack_require__(324); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__config__ = __webpack_require__(185); +/** PURE_IMPORTS_START _util_canReportError,_util_toSubscriber,_internal_symbol_observable,_util_pipe,_config PURE_IMPORTS_END */ + + + + + +var Observable = /*@__PURE__*/ (function () { + function Observable(subscribe) { + this._isScalar = false; + if (subscribe) { + this._subscribe = subscribe; + } + } + Observable.prototype.lift = function (operator) { + var observable = new Observable(); + observable.source = this; + observable.operator = operator; + return observable; + }; + Observable.prototype.subscribe = function (observerOrNext, error, complete) { + var operator = this.operator; + var sink = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__util_toSubscriber__["a" /* toSubscriber */])(observerOrNext, error, complete); + if (operator) { + operator.call(sink, this.source); + } + else { + sink.add(this.source || (__WEBPACK_IMPORTED_MODULE_4__config__["a" /* config */].useDeprecatedSynchronousErrorHandling && !sink.syncErrorThrowable) ? + this._subscribe(sink) : + this._trySubscribe(sink)); + } + if (__WEBPACK_IMPORTED_MODULE_4__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) { + if (sink.syncErrorThrowable) { + sink.syncErrorThrowable = false; + if (sink.syncErrorThrown) { + throw sink.syncErrorValue; + } + } + } + return sink; + }; + Observable.prototype._trySubscribe = function (sink) { + try { + return this._subscribe(sink); + } + catch (err) { + if (__WEBPACK_IMPORTED_MODULE_4__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) { + sink.syncErrorThrown = true; + sink.syncErrorValue = err; + } + if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_0__util_canReportError__["a" /* canReportError */])(sink)) { + sink.error(err); + } + else { + console.warn(err); + } + } + }; + Observable.prototype.forEach = function (next, promiseCtor) { + var _this = this; + promiseCtor = getPromiseCtor(promiseCtor); + return new promiseCtor(function (resolve, reject) { + var subscription; + subscription = _this.subscribe(function (value) { + try { + next(value); + } + catch (err) { + reject(err); + if (subscription) { + subscription.unsubscribe(); + } + } + }, reject, resolve); + }); + }; + Observable.prototype._subscribe = function (subscriber) { + var source = this.source; + return source && source.subscribe(subscriber); + }; + Observable.prototype[__WEBPACK_IMPORTED_MODULE_2__internal_symbol_observable__["a" /* observable */]] = function () { + return this; + }; + Observable.prototype.pipe = function () { + var operations = []; + for (var _i = 0; _i < arguments.length; _i++) { + operations[_i] = arguments[_i]; + } + if (operations.length === 0) { + return this; + } + return __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__util_pipe__["b" /* pipeFromArray */])(operations)(this); + }; + Observable.prototype.toPromise = function (promiseCtor) { + var _this = this; + promiseCtor = getPromiseCtor(promiseCtor); + return new promiseCtor(function (resolve, reject) { + var value; + _this.subscribe(function (x) { return value = x; }, function (err) { return reject(err); }, function () { return resolve(value); }); + }); + }; + Observable.create = function (subscribe) { + return new Observable(subscribe); + }; + return Observable; +}()); + +function getPromiseCtor(promiseCtor) { + if (!promiseCtor) { + promiseCtor = __WEBPACK_IMPORTED_MODULE_4__config__["a" /* config */].Promise || Promise; + } + if (!promiseCtor) { + throw new Error('no Promise impl found'); + } + return promiseCtor; +} +//# sourceMappingURL=Observable.js.map + + +/***/ }), +/* 13 */ +/***/ (function(module, __webpack_exports__, __webpack_require__) { + +"use strict"; +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return OuterSubscriber; }); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_tslib__ = __webpack_require__(1); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__Subscriber__ = __webpack_require__(7); +/** PURE_IMPORTS_START tslib,_Subscriber PURE_IMPORTS_END */ + + +var OuterSubscriber = /*@__PURE__*/ (function (_super) { + __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](OuterSubscriber, _super); + function OuterSubscriber() { + return _super !== null && _super.apply(this, arguments) || this; + } + OuterSubscriber.prototype.notifyNext = function (outerValue, innerValue, outerIndex, innerIndex, innerSub) { + this.destination.next(innerValue); + }; + OuterSubscriber.prototype.notifyError = function (error, innerSub) { + this.destination.error(error); + }; + OuterSubscriber.prototype.notifyComplete = function (innerSub) { + this.destination.complete(); + }; + return OuterSubscriber; +}(__WEBPACK_IMPORTED_MODULE_1__Subscriber__["a" /* Subscriber */])); + +//# sourceMappingURL=OuterSubscriber.js.map + + +/***/ }), +/* 14 */ +/***/ (function(module, __webpack_exports__, __webpack_require__) { + +"use strict"; +/* harmony export (immutable) */ __webpack_exports__["a"] = subscribeToResult; +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__InnerSubscriber__ = __webpack_require__(84); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__subscribeTo__ = __webpack_require__(446); +/** PURE_IMPORTS_START _InnerSubscriber,_subscribeTo PURE_IMPORTS_END */ + + +function subscribeToResult(outerSubscriber, result, outerValue, outerIndex, destination) { + if (destination === void 0) { + destination = new __WEBPACK_IMPORTED_MODULE_0__InnerSubscriber__["a" /* InnerSubscriber */](outerSubscriber, outerValue, outerIndex); + } + if (destination.closed) { + return; + } + return __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__subscribeTo__["a" /* subscribeTo */])(result)(destination); +} +//# sourceMappingURL=subscribeToResult.js.map + + +/***/ }), +/* 15 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; +/* eslint-disable node/no-deprecated-api */ + + + +var buffer = __webpack_require__(64) +var Buffer = buffer.Buffer + +var safer = {} + +var key + +for (key in buffer) { + if (!buffer.hasOwnProperty(key)) continue + if (key === 'SlowBuffer' || key === 'Buffer') continue + safer[key] = buffer[key] +} + +var Safer = safer.Buffer = {} +for (key in Buffer) { + if (!Buffer.hasOwnProperty(key)) continue + if (key === 'allocUnsafe' || key === 'allocUnsafeSlow') continue + Safer[key] = Buffer[key] +} + +safer.Buffer.prototype = Buffer.prototype + +if (!Safer.from || Safer.from === Uint8Array.from) { + Safer.from = function (value, encodingOrOffset, length) { + if (typeof value === 'number') { + throw new TypeError('The "value" argument must not be of type number. Received type ' + typeof value) + } + if (value && typeof value.length === 'undefined') { + throw new TypeError('The first argument must be one of type string, Buffer, ArrayBuffer, Array, or Array-like Object. Received type ' + typeof value) + } + return Buffer(value, encodingOrOffset, length) + } +} + +if (!Safer.alloc) { + Safer.alloc = function (size, fill, encoding) { + if (typeof size !== 'number') { + throw new TypeError('The "size" argument must be of type number. Received type ' + typeof size) + } + if (size < 0 || size >= 2 * (1 << 30)) { + throw new RangeError('The value "' + size + '" is invalid for option "size"') + } + var buf = Buffer(size) + if (!fill || fill.length === 0) { + buf.fill(0) + } else if (typeof encoding === 'string') { + buf.fill(fill, encoding) + } else { + buf.fill(fill) + } + return buf + } +} + +if (!safer.kStringMaxLength) { + try { + safer.kStringMaxLength = process.binding('buffer').kStringMaxLength + } catch (e) { + // we can't determine kStringMaxLength in environments where process.binding + // is unsupported, so let's not set it + } +} + +if (!safer.constants) { + safer.constants = { + MAX_LENGTH: safer.kMaxLength + } + if (safer.kStringMaxLength) { + safer.constants.MAX_STRING_LENGTH = safer.kStringMaxLength + } +} + +module.exports = safer + + +/***/ }), +/* 16 */ +/***/ (function(module, exports, __webpack_require__) { + +// Copyright (c) 2012, Mark Cavage. All rights reserved. +// Copyright 2015 Joyent, Inc. + +var assert = __webpack_require__(28); +var Stream = __webpack_require__(23).Stream; +var util = __webpack_require__(3); + + +///--- Globals + +/* JSSTYLED */ +var UUID_REGEXP = /^[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12}$/; + + +///--- Internal + +function _capitalize(str) { + return (str.charAt(0).toUpperCase() + str.slice(1)); +} + +function _toss(name, expected, oper, arg, actual) { + throw new assert.AssertionError({ + message: util.format('%s (%s) is required', name, expected), + actual: (actual === undefined) ? typeof (arg) : actual(arg), + expected: expected, + operator: oper || '===', + stackStartFunction: _toss.caller + }); +} + +function _getClass(arg) { + return (Object.prototype.toString.call(arg).slice(8, -1)); +} + +function noop() { + // Why even bother with asserts? +} + + +///--- Exports + +var types = { + bool: { + check: function (arg) { return typeof (arg) === 'boolean'; } + }, + func: { + check: function (arg) { return typeof (arg) === 'function'; } + }, + string: { + check: function (arg) { return typeof (arg) === 'string'; } + }, + object: { + check: function (arg) { + return typeof (arg) === 'object' && arg !== null; + } + }, + number: { + check: function (arg) { + return typeof (arg) === 'number' && !isNaN(arg); + } + }, + finite: { + check: function (arg) { + return typeof (arg) === 'number' && !isNaN(arg) && isFinite(arg); + } + }, + buffer: { + check: function (arg) { return Buffer.isBuffer(arg); }, + operator: 'Buffer.isBuffer' + }, + array: { + check: function (arg) { return Array.isArray(arg); }, + operator: 'Array.isArray' + }, + stream: { + check: function (arg) { return arg instanceof Stream; }, + operator: 'instanceof', + actual: _getClass + }, + date: { + check: function (arg) { return arg instanceof Date; }, + operator: 'instanceof', + actual: _getClass + }, + regexp: { + check: function (arg) { return arg instanceof RegExp; }, + operator: 'instanceof', + actual: _getClass + }, + uuid: { + check: function (arg) { + return typeof (arg) === 'string' && UUID_REGEXP.test(arg); + }, + operator: 'isUUID' + } +}; + +function _setExports(ndebug) { + var keys = Object.keys(types); + var out; + + /* re-export standard assert */ + if (process.env.NODE_NDEBUG) { + out = noop; + } else { + out = function (arg, msg) { + if (!arg) { + _toss(msg, 'true', arg); + } + }; + } + + /* standard checks */ + keys.forEach(function (k) { + if (ndebug) { + out[k] = noop; + return; + } + var type = types[k]; + out[k] = function (arg, msg) { + if (!type.check(arg)) { + _toss(msg, k, type.operator, arg, type.actual); + } + }; + }); + + /* optional checks */ + keys.forEach(function (k) { + var name = 'optional' + _capitalize(k); + if (ndebug) { + out[name] = noop; + return; + } + var type = types[k]; + out[name] = function (arg, msg) { + if (arg === undefined || arg === null) { + return; + } + if (!type.check(arg)) { + _toss(msg, k, type.operator, arg, type.actual); + } + }; + }); + + /* arrayOf checks */ + keys.forEach(function (k) { + var name = 'arrayOf' + _capitalize(k); + if (ndebug) { + out[name] = noop; + return; + } + var type = types[k]; + var expected = '[' + k + ']'; + out[name] = function (arg, msg) { + if (!Array.isArray(arg)) { + _toss(msg, expected, type.operator, arg, type.actual); + } + var i; + for (i = 0; i < arg.length; i++) { + if (!type.check(arg[i])) { + _toss(msg, expected, type.operator, arg, type.actual); + } + } + }; + }); + + /* optionalArrayOf checks */ + keys.forEach(function (k) { + var name = 'optionalArrayOf' + _capitalize(k); + if (ndebug) { + out[name] = noop; + return; + } + var type = types[k]; + var expected = '[' + k + ']'; + out[name] = function (arg, msg) { + if (arg === undefined || arg === null) { + return; + } + if (!Array.isArray(arg)) { + _toss(msg, expected, type.operator, arg, type.actual); + } + var i; + for (i = 0; i < arg.length; i++) { + if (!type.check(arg[i])) { + _toss(msg, expected, type.operator, arg, type.actual); + } + } + }; + }); + + /* re-export built-in assertions */ + Object.keys(assert).forEach(function (k) { + if (k === 'AssertionError') { + out[k] = assert[k]; + return; + } + if (ndebug) { + out[k] = noop; + return; + } + out[k] = assert[k]; + }); + + /* export ourselves (for unit tests _only_) */ + out._setExports = _setExports; + + return out; +} + +module.exports = _setExports(process.env.NODE_NDEBUG); + + +/***/ }), +/* 17 */ +/***/ (function(module, exports) { + +// https://github.com/zloirock/core-js/issues/86#issuecomment-115759028 +var global = module.exports = typeof window != 'undefined' && window.Math == Math + ? window : typeof self != 'undefined' && self.Math == Math ? self + // eslint-disable-next-line no-new-func + : Function('return this')(); +if (typeof __g == 'number') __g = global; // eslint-disable-line no-undef + + +/***/ }), +/* 18 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.sortAlpha = sortAlpha; +exports.sortOptionsByFlags = sortOptionsByFlags; +exports.entries = entries; +exports.removePrefix = removePrefix; +exports.removeSuffix = removeSuffix; +exports.addSuffix = addSuffix; +exports.hyphenate = hyphenate; +exports.camelCase = camelCase; +exports.compareSortedArrays = compareSortedArrays; +exports.sleep = sleep; +const _camelCase = __webpack_require__(230); + +function sortAlpha(a, b) { + // sort alphabetically in a deterministic way + const shortLen = Math.min(a.length, b.length); + for (let i = 0; i < shortLen; i++) { + const aChar = a.charCodeAt(i); + const bChar = b.charCodeAt(i); + if (aChar !== bChar) { + return aChar - bChar; + } + } + return a.length - b.length; +} + +function sortOptionsByFlags(a, b) { + const aOpt = a.flags.replace(/-/g, ''); + const bOpt = b.flags.replace(/-/g, ''); + return sortAlpha(aOpt, bOpt); +} + +function entries(obj) { + const entries = []; + if (obj) { + for (const key in obj) { + entries.push([key, obj[key]]); + } + } + return entries; +} + +function removePrefix(pattern, prefix) { + if (pattern.startsWith(prefix)) { + pattern = pattern.slice(prefix.length); + } + + return pattern; +} + +function removeSuffix(pattern, suffix) { + if (pattern.endsWith(suffix)) { + return pattern.slice(0, -suffix.length); + } + + return pattern; +} + +function addSuffix(pattern, suffix) { + if (!pattern.endsWith(suffix)) { + return pattern + suffix; + } + + return pattern; +} + +function hyphenate(str) { + return str.replace(/[A-Z]/g, match => { + return '-' + match.charAt(0).toLowerCase(); + }); +} + +function camelCase(str) { + if (/[A-Z]/.test(str)) { + return null; + } else { + return _camelCase(str); + } +} + +function compareSortedArrays(array1, array2) { + if (array1.length !== array2.length) { + return false; + } + for (let i = 0, len = array1.length; i < len; i++) { + if (array1[i] !== array2[i]) { + return false; + } + } + return true; +} + +function sleep(ms) { + return new Promise(resolve => { + setTimeout(resolve, ms); + }); +} + +/***/ }), +/* 19 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.stringify = exports.parse = undefined; + +var _asyncToGenerator2; + +function _load_asyncToGenerator() { + return _asyncToGenerator2 = _interopRequireDefault(__webpack_require__(2)); +} + +var _parse; + +function _load_parse() { + return _parse = __webpack_require__(105); +} + +Object.defineProperty(exports, 'parse', { + enumerable: true, + get: function get() { + return _interopRequireDefault(_parse || _load_parse()).default; + } +}); + +var _stringify; + +function _load_stringify() { + return _stringify = __webpack_require__(199); +} + +Object.defineProperty(exports, 'stringify', { + enumerable: true, + get: function get() { + return _interopRequireDefault(_stringify || _load_stringify()).default; + } +}); +exports.implodeEntry = implodeEntry; +exports.explodeEntry = explodeEntry; + +var _misc; + +function _load_misc() { + return _misc = __webpack_require__(18); +} + +var _normalizePattern; + +function _load_normalizePattern() { + return _normalizePattern = __webpack_require__(37); +} + +var _parse2; + +function _load_parse2() { + return _parse2 = _interopRequireDefault(__webpack_require__(105)); +} + +var _constants; + +function _load_constants() { + return _constants = __webpack_require__(8); +} + +var _fs; + +function _load_fs() { + return _fs = _interopRequireWildcard(__webpack_require__(4)); +} + +function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +const invariant = __webpack_require__(9); + +const path = __webpack_require__(0); +const ssri = __webpack_require__(65); + +function getName(pattern) { + return (0, (_normalizePattern || _load_normalizePattern()).normalizePattern)(pattern).name; +} + +function blankObjectUndefined(obj) { + return obj && Object.keys(obj).length ? obj : undefined; +} + +function keyForRemote(remote) { + return remote.resolved || (remote.reference && remote.hash ? `${remote.reference}#${remote.hash}` : null); +} + +function serializeIntegrity(integrity) { + // We need this because `Integrity.toString()` does not use sorting to ensure a stable string output + // See https://git.io/vx2Hy + return integrity.toString().split(' ').sort().join(' '); +} + +function implodeEntry(pattern, obj) { + const inferredName = getName(pattern); + const integrity = obj.integrity ? serializeIntegrity(obj.integrity) : ''; + const imploded = { + name: inferredName === obj.name ? undefined : obj.name, + version: obj.version, + uid: obj.uid === obj.version ? undefined : obj.uid, + resolved: obj.resolved, + registry: obj.registry === 'npm' ? undefined : obj.registry, + dependencies: blankObjectUndefined(obj.dependencies), + optionalDependencies: blankObjectUndefined(obj.optionalDependencies), + permissions: blankObjectUndefined(obj.permissions), + prebuiltVariants: blankObjectUndefined(obj.prebuiltVariants) + }; + if (integrity) { + imploded.integrity = integrity; + } + return imploded; +} + +function explodeEntry(pattern, obj) { + obj.optionalDependencies = obj.optionalDependencies || {}; + obj.dependencies = obj.dependencies || {}; + obj.uid = obj.uid || obj.version; + obj.permissions = obj.permissions || {}; + obj.registry = obj.registry || 'npm'; + obj.name = obj.name || getName(pattern); + const integrity = obj.integrity; + if (integrity && integrity.isIntegrity) { + obj.integrity = ssri.parse(integrity); + } + return obj; +} + +class Lockfile { + constructor({ cache, source, parseResultType } = {}) { + this.source = source || ''; + this.cache = cache; + this.parseResultType = parseResultType; + } + + // source string if the `cache` was parsed + + + // if true, we're parsing an old yarn file and need to update integrity fields + hasEntriesExistWithoutIntegrity() { + if (!this.cache) { + return false; + } + + for (const key in this.cache) { + // $FlowFixMe - `this.cache` is clearly defined at this point + if (!/^.*@(file:|http)/.test(key) && this.cache[key] && !this.cache[key].integrity) { + return true; + } + } + + return false; + } + + static fromDirectory(dir, reporter) { + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { + // read the manifest in this directory + const lockfileLoc = path.join(dir, (_constants || _load_constants()).LOCKFILE_FILENAME); + + let lockfile; + let rawLockfile = ''; + let parseResult; + + if (yield (_fs || _load_fs()).exists(lockfileLoc)) { + rawLockfile = yield (_fs || _load_fs()).readFile(lockfileLoc); + parseResult = (0, (_parse2 || _load_parse2()).default)(rawLockfile, lockfileLoc); + + if (reporter) { + if (parseResult.type === 'merge') { + reporter.info(reporter.lang('lockfileMerged')); + } else if (parseResult.type === 'conflict') { + reporter.warn(reporter.lang('lockfileConflict')); + } + } + + lockfile = parseResult.object; + } else if (reporter) { + reporter.info(reporter.lang('noLockfileFound')); + } + + if (lockfile && lockfile.__metadata) { + const lockfilev2 = lockfile; + lockfile = {}; + } + + return new Lockfile({ cache: lockfile, source: rawLockfile, parseResultType: parseResult && parseResult.type }); + })(); + } + + getLocked(pattern) { + const cache = this.cache; + if (!cache) { + return undefined; + } + + const shrunk = pattern in cache && cache[pattern]; + + if (typeof shrunk === 'string') { + return this.getLocked(shrunk); + } else if (shrunk) { + explodeEntry(pattern, shrunk); + return shrunk; + } + + return undefined; + } + + removePattern(pattern) { + const cache = this.cache; + if (!cache) { + return; + } + delete cache[pattern]; + } + + getLockfile(patterns) { + const lockfile = {}; + const seen = new Map(); + + // order by name so that lockfile manifest is assigned to the first dependency with this manifest + // the others that have the same remoteKey will just refer to the first + // ordering allows for consistency in lockfile when it is serialized + const sortedPatternsKeys = Object.keys(patterns).sort((_misc || _load_misc()).sortAlpha); + + for (var _iterator = sortedPatternsKeys, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) { + var _ref; + + if (_isArray) { + if (_i >= _iterator.length) break; + _ref = _iterator[_i++]; + } else { + _i = _iterator.next(); + if (_i.done) break; + _ref = _i.value; + } + + const pattern = _ref; + + const pkg = patterns[pattern]; + const remote = pkg._remote, + ref = pkg._reference; + + invariant(ref, 'Package is missing a reference'); + invariant(remote, 'Package is missing a remote'); + + const remoteKey = keyForRemote(remote); + const seenPattern = remoteKey && seen.get(remoteKey); + if (seenPattern) { + // no point in duplicating it + lockfile[pattern] = seenPattern; + + // if we're relying on our name being inferred and two of the patterns have + // different inferred names then we need to set it + if (!seenPattern.name && getName(pattern) !== pkg.name) { + seenPattern.name = pkg.name; + } + continue; + } + const obj = implodeEntry(pattern, { + name: pkg.name, + version: pkg.version, + uid: pkg._uid, + resolved: remote.resolved, + integrity: remote.integrity, + registry: remote.registry, + dependencies: pkg.dependencies, + peerDependencies: pkg.peerDependencies, + optionalDependencies: pkg.optionalDependencies, + permissions: ref.permissions, + prebuiltVariants: pkg.prebuiltVariants + }); + + lockfile[pattern] = obj; + + if (remoteKey) { + seen.set(remoteKey, obj); + } + } + + return lockfile; + } +} +exports.default = Lockfile; + +/***/ }), +/* 20 */ +/***/ (function(module, exports, __webpack_require__) { + +var store = __webpack_require__(133)('wks'); +var uid = __webpack_require__(137); +var Symbol = __webpack_require__(17).Symbol; +var USE_SYMBOL = typeof Symbol == 'function'; + +var $exports = module.exports = function (name) { + return store[name] || (store[name] = + USE_SYMBOL && Symbol[name] || (USE_SYMBOL ? Symbol : uid)('Symbol.' + name)); +}; + +$exports.store = store; + + +/***/ }), +/* 21 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +exports.__esModule = true; + +var _assign = __webpack_require__(591); + +var _assign2 = _interopRequireDefault(_assign); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +exports.default = _assign2.default || function (target) { + for (var i = 1; i < arguments.length; i++) { + var source = arguments[i]; + + for (var key in source) { + if (Object.prototype.hasOwnProperty.call(source, key)) { + target[key] = source[key]; + } + } + } + + return target; +}; + +/***/ }), +/* 22 */ +/***/ (function(module, exports) { + +exports = module.exports = SemVer; + +// The debug function is excluded entirely from the minified version. +/* nomin */ var debug; +/* nomin */ if (typeof process === 'object' && + /* nomin */ process.env && + /* nomin */ process.env.NODE_DEBUG && + /* nomin */ /\bsemver\b/i.test(process.env.NODE_DEBUG)) + /* nomin */ debug = function() { + /* nomin */ var args = Array.prototype.slice.call(arguments, 0); + /* nomin */ args.unshift('SEMVER'); + /* nomin */ console.log.apply(console, args); + /* nomin */ }; +/* nomin */ else + /* nomin */ debug = function() {}; + +// Note: this is the semver.org version of the spec that it implements +// Not necessarily the package version of this code. +exports.SEMVER_SPEC_VERSION = '2.0.0'; + +var MAX_LENGTH = 256; +var MAX_SAFE_INTEGER = Number.MAX_SAFE_INTEGER || 9007199254740991; + +// Max safe segment length for coercion. +var MAX_SAFE_COMPONENT_LENGTH = 16; + +// The actual regexps go on exports.re +var re = exports.re = []; +var src = exports.src = []; +var R = 0; + +// The following Regular Expressions can be used for tokenizing, +// validating, and parsing SemVer version strings. + +// ## Numeric Identifier +// A single `0`, or a non-zero digit followed by zero or more digits. + +var NUMERICIDENTIFIER = R++; +src[NUMERICIDENTIFIER] = '0|[1-9]\\d*'; +var NUMERICIDENTIFIERLOOSE = R++; +src[NUMERICIDENTIFIERLOOSE] = '[0-9]+'; + + +// ## Non-numeric Identifier +// Zero or more digits, followed by a letter or hyphen, and then zero or +// more letters, digits, or hyphens. + +var NONNUMERICIDENTIFIER = R++; +src[NONNUMERICIDENTIFIER] = '\\d*[a-zA-Z-][a-zA-Z0-9-]*'; + + +// ## Main Version +// Three dot-separated numeric identifiers. + +var MAINVERSION = R++; +src[MAINVERSION] = '(' + src[NUMERICIDENTIFIER] + ')\\.' + + '(' + src[NUMERICIDENTIFIER] + ')\\.' + + '(' + src[NUMERICIDENTIFIER] + ')'; + +var MAINVERSIONLOOSE = R++; +src[MAINVERSIONLOOSE] = '(' + src[NUMERICIDENTIFIERLOOSE] + ')\\.' + + '(' + src[NUMERICIDENTIFIERLOOSE] + ')\\.' + + '(' + src[NUMERICIDENTIFIERLOOSE] + ')'; + +// ## Pre-release Version Identifier +// A numeric identifier, or a non-numeric identifier. + +var PRERELEASEIDENTIFIER = R++; +src[PRERELEASEIDENTIFIER] = '(?:' + src[NUMERICIDENTIFIER] + + '|' + src[NONNUMERICIDENTIFIER] + ')'; + +var PRERELEASEIDENTIFIERLOOSE = R++; +src[PRERELEASEIDENTIFIERLOOSE] = '(?:' + src[NUMERICIDENTIFIERLOOSE] + + '|' + src[NONNUMERICIDENTIFIER] + ')'; + + +// ## Pre-release Version +// Hyphen, followed by one or more dot-separated pre-release version +// identifiers. + +var PRERELEASE = R++; +src[PRERELEASE] = '(?:-(' + src[PRERELEASEIDENTIFIER] + + '(?:\\.' + src[PRERELEASEIDENTIFIER] + ')*))'; + +var PRERELEASELOOSE = R++; +src[PRERELEASELOOSE] = '(?:-?(' + src[PRERELEASEIDENTIFIERLOOSE] + + '(?:\\.' + src[PRERELEASEIDENTIFIERLOOSE] + ')*))'; + +// ## Build Metadata Identifier +// Any combination of digits, letters, or hyphens. + +var BUILDIDENTIFIER = R++; +src[BUILDIDENTIFIER] = '[0-9A-Za-z-]+'; + +// ## Build Metadata +// Plus sign, followed by one or more period-separated build metadata +// identifiers. + +var BUILD = R++; +src[BUILD] = '(?:\\+(' + src[BUILDIDENTIFIER] + + '(?:\\.' + src[BUILDIDENTIFIER] + ')*))'; + + +// ## Full Version String +// A main version, followed optionally by a pre-release version and +// build metadata. + +// Note that the only major, minor, patch, and pre-release sections of +// the version string are capturing groups. The build metadata is not a +// capturing group, because it should not ever be used in version +// comparison. + +var FULL = R++; +var FULLPLAIN = 'v?' + src[MAINVERSION] + + src[PRERELEASE] + '?' + + src[BUILD] + '?'; + +src[FULL] = '^' + FULLPLAIN + '$'; + +// like full, but allows v1.2.3 and =1.2.3, which people do sometimes. +// also, 1.0.0alpha1 (prerelease without the hyphen) which is pretty +// common in the npm registry. +var LOOSEPLAIN = '[v=\\s]*' + src[MAINVERSIONLOOSE] + + src[PRERELEASELOOSE] + '?' + + src[BUILD] + '?'; + +var LOOSE = R++; +src[LOOSE] = '^' + LOOSEPLAIN + '$'; + +var GTLT = R++; +src[GTLT] = '((?:<|>)?=?)'; + +// Something like "2.*" or "1.2.x". +// Note that "x.x" is a valid xRange identifer, meaning "any version" +// Only the first item is strictly required. +var XRANGEIDENTIFIERLOOSE = R++; +src[XRANGEIDENTIFIERLOOSE] = src[NUMERICIDENTIFIERLOOSE] + '|x|X|\\*'; +var XRANGEIDENTIFIER = R++; +src[XRANGEIDENTIFIER] = src[NUMERICIDENTIFIER] + '|x|X|\\*'; + +var XRANGEPLAIN = R++; +src[XRANGEPLAIN] = '[v=\\s]*(' + src[XRANGEIDENTIFIER] + ')' + + '(?:\\.(' + src[XRANGEIDENTIFIER] + ')' + + '(?:\\.(' + src[XRANGEIDENTIFIER] + ')' + + '(?:' + src[PRERELEASE] + ')?' + + src[BUILD] + '?' + + ')?)?'; + +var XRANGEPLAINLOOSE = R++; +src[XRANGEPLAINLOOSE] = '[v=\\s]*(' + src[XRANGEIDENTIFIERLOOSE] + ')' + + '(?:\\.(' + src[XRANGEIDENTIFIERLOOSE] + ')' + + '(?:\\.(' + src[XRANGEIDENTIFIERLOOSE] + ')' + + '(?:' + src[PRERELEASELOOSE] + ')?' + + src[BUILD] + '?' + + ')?)?'; + +var XRANGE = R++; +src[XRANGE] = '^' + src[GTLT] + '\\s*' + src[XRANGEPLAIN] + '$'; +var XRANGELOOSE = R++; +src[XRANGELOOSE] = '^' + src[GTLT] + '\\s*' + src[XRANGEPLAINLOOSE] + '$'; + +// Coercion. +// Extract anything that could conceivably be a part of a valid semver +var COERCE = R++; +src[COERCE] = '(?:^|[^\\d])' + + '(\\d{1,' + MAX_SAFE_COMPONENT_LENGTH + '})' + + '(?:\\.(\\d{1,' + MAX_SAFE_COMPONENT_LENGTH + '}))?' + + '(?:\\.(\\d{1,' + MAX_SAFE_COMPONENT_LENGTH + '}))?' + + '(?:$|[^\\d])'; + +// Tilde ranges. +// Meaning is "reasonably at or greater than" +var LONETILDE = R++; +src[LONETILDE] = '(?:~>?)'; + +var TILDETRIM = R++; +src[TILDETRIM] = '(\\s*)' + src[LONETILDE] + '\\s+'; +re[TILDETRIM] = new RegExp(src[TILDETRIM], 'g'); +var tildeTrimReplace = '$1~'; + +var TILDE = R++; +src[TILDE] = '^' + src[LONETILDE] + src[XRANGEPLAIN] + '$'; +var TILDELOOSE = R++; +src[TILDELOOSE] = '^' + src[LONETILDE] + src[XRANGEPLAINLOOSE] + '$'; + +// Caret ranges. +// Meaning is "at least and backwards compatible with" +var LONECARET = R++; +src[LONECARET] = '(?:\\^)'; + +var CARETTRIM = R++; +src[CARETTRIM] = '(\\s*)' + src[LONECARET] + '\\s+'; +re[CARETTRIM] = new RegExp(src[CARETTRIM], 'g'); +var caretTrimReplace = '$1^'; + +var CARET = R++; +src[CARET] = '^' + src[LONECARET] + src[XRANGEPLAIN] + '$'; +var CARETLOOSE = R++; +src[CARETLOOSE] = '^' + src[LONECARET] + src[XRANGEPLAINLOOSE] + '$'; + +// A simple gt/lt/eq thing, or just "" to indicate "any version" +var COMPARATORLOOSE = R++; +src[COMPARATORLOOSE] = '^' + src[GTLT] + '\\s*(' + LOOSEPLAIN + ')$|^$'; +var COMPARATOR = R++; +src[COMPARATOR] = '^' + src[GTLT] + '\\s*(' + FULLPLAIN + ')$|^$'; + + +// An expression to strip any whitespace between the gtlt and the thing +// it modifies, so that `> 1.2.3` ==> `>1.2.3` +var COMPARATORTRIM = R++; +src[COMPARATORTRIM] = '(\\s*)' + src[GTLT] + + '\\s*(' + LOOSEPLAIN + '|' + src[XRANGEPLAIN] + ')'; + +// this one has to use the /g flag +re[COMPARATORTRIM] = new RegExp(src[COMPARATORTRIM], 'g'); +var comparatorTrimReplace = '$1$2$3'; + + +// Something like `1.2.3 - 1.2.4` +// Note that these all use the loose form, because they'll be +// checked against either the strict or loose comparator form +// later. +var HYPHENRANGE = R++; +src[HYPHENRANGE] = '^\\s*(' + src[XRANGEPLAIN] + ')' + + '\\s+-\\s+' + + '(' + src[XRANGEPLAIN] + ')' + + '\\s*$'; + +var HYPHENRANGELOOSE = R++; +src[HYPHENRANGELOOSE] = '^\\s*(' + src[XRANGEPLAINLOOSE] + ')' + + '\\s+-\\s+' + + '(' + src[XRANGEPLAINLOOSE] + ')' + + '\\s*$'; + +// Star ranges basically just allow anything at all. +var STAR = R++; +src[STAR] = '(<|>)?=?\\s*\\*'; + +// Compile to actual regexp objects. +// All are flag-free, unless they were created above with a flag. +for (var i = 0; i < R; i++) { + debug(i, src[i]); + if (!re[i]) + re[i] = new RegExp(src[i]); +} + +exports.parse = parse; +function parse(version, loose) { + if (version instanceof SemVer) + return version; + + if (typeof version !== 'string') + return null; + + if (version.length > MAX_LENGTH) + return null; + + var r = loose ? re[LOOSE] : re[FULL]; + if (!r.test(version)) + return null; + + try { + return new SemVer(version, loose); + } catch (er) { + return null; + } +} + +exports.valid = valid; +function valid(version, loose) { + var v = parse(version, loose); + return v ? v.version : null; +} + + +exports.clean = clean; +function clean(version, loose) { + var s = parse(version.trim().replace(/^[=v]+/, ''), loose); + return s ? s.version : null; +} + +exports.SemVer = SemVer; + +function SemVer(version, loose) { + if (version instanceof SemVer) { + if (version.loose === loose) + return version; + else + version = version.version; + } else if (typeof version !== 'string') { + throw new TypeError('Invalid Version: ' + version); + } + + if (version.length > MAX_LENGTH) + throw new TypeError('version is longer than ' + MAX_LENGTH + ' characters') + + if (!(this instanceof SemVer)) + return new SemVer(version, loose); + + debug('SemVer', version, loose); + this.loose = loose; + var m = version.trim().match(loose ? re[LOOSE] : re[FULL]); + + if (!m) + throw new TypeError('Invalid Version: ' + version); + + this.raw = version; + + // these are actually numbers + this.major = +m[1]; + this.minor = +m[2]; + this.patch = +m[3]; + + if (this.major > MAX_SAFE_INTEGER || this.major < 0) + throw new TypeError('Invalid major version') + + if (this.minor > MAX_SAFE_INTEGER || this.minor < 0) + throw new TypeError('Invalid minor version') + + if (this.patch > MAX_SAFE_INTEGER || this.patch < 0) + throw new TypeError('Invalid patch version') + + // numberify any prerelease numeric ids + if (!m[4]) + this.prerelease = []; + else + this.prerelease = m[4].split('.').map(function(id) { + if (/^[0-9]+$/.test(id)) { + var num = +id; + if (num >= 0 && num < MAX_SAFE_INTEGER) + return num; + } + return id; + }); + + this.build = m[5] ? m[5].split('.') : []; + this.format(); +} + +SemVer.prototype.format = function() { + this.version = this.major + '.' + this.minor + '.' + this.patch; + if (this.prerelease.length) + this.version += '-' + this.prerelease.join('.'); + return this.version; +}; + +SemVer.prototype.toString = function() { + return this.version; +}; + +SemVer.prototype.compare = function(other) { + debug('SemVer.compare', this.version, this.loose, other); + if (!(other instanceof SemVer)) + other = new SemVer(other, this.loose); + + return this.compareMain(other) || this.comparePre(other); +}; + +SemVer.prototype.compareMain = function(other) { + if (!(other instanceof SemVer)) + other = new SemVer(other, this.loose); + + return compareIdentifiers(this.major, other.major) || + compareIdentifiers(this.minor, other.minor) || + compareIdentifiers(this.patch, other.patch); +}; + +SemVer.prototype.comparePre = function(other) { + if (!(other instanceof SemVer)) + other = new SemVer(other, this.loose); + + // NOT having a prerelease is > having one + if (this.prerelease.length && !other.prerelease.length) + return -1; + else if (!this.prerelease.length && other.prerelease.length) + return 1; + else if (!this.prerelease.length && !other.prerelease.length) + return 0; + + var i = 0; + do { + var a = this.prerelease[i]; + var b = other.prerelease[i]; + debug('prerelease compare', i, a, b); + if (a === undefined && b === undefined) + return 0; + else if (b === undefined) + return 1; + else if (a === undefined) + return -1; + else if (a === b) + continue; + else + return compareIdentifiers(a, b); + } while (++i); +}; + +// preminor will bump the version up to the next minor release, and immediately +// down to pre-release. premajor and prepatch work the same way. +SemVer.prototype.inc = function(release, identifier) { + switch (release) { + case 'premajor': + this.prerelease.length = 0; + this.patch = 0; + this.minor = 0; + this.major++; + this.inc('pre', identifier); + break; + case 'preminor': + this.prerelease.length = 0; + this.patch = 0; + this.minor++; + this.inc('pre', identifier); + break; + case 'prepatch': + // If this is already a prerelease, it will bump to the next version + // drop any prereleases that might already exist, since they are not + // relevant at this point. + this.prerelease.length = 0; + this.inc('patch', identifier); + this.inc('pre', identifier); + break; + // If the input is a non-prerelease version, this acts the same as + // prepatch. + case 'prerelease': + if (this.prerelease.length === 0) + this.inc('patch', identifier); + this.inc('pre', identifier); + break; + + case 'major': + // If this is a pre-major version, bump up to the same major version. + // Otherwise increment major. + // 1.0.0-5 bumps to 1.0.0 + // 1.1.0 bumps to 2.0.0 + if (this.minor !== 0 || this.patch !== 0 || this.prerelease.length === 0) + this.major++; + this.minor = 0; + this.patch = 0; + this.prerelease = []; + break; + case 'minor': + // If this is a pre-minor version, bump up to the same minor version. + // Otherwise increment minor. + // 1.2.0-5 bumps to 1.2.0 + // 1.2.1 bumps to 1.3.0 + if (this.patch !== 0 || this.prerelease.length === 0) + this.minor++; + this.patch = 0; + this.prerelease = []; + break; + case 'patch': + // If this is not a pre-release version, it will increment the patch. + // If it is a pre-release it will bump up to the same patch version. + // 1.2.0-5 patches to 1.2.0 + // 1.2.0 patches to 1.2.1 + if (this.prerelease.length === 0) + this.patch++; + this.prerelease = []; + break; + // This probably shouldn't be used publicly. + // 1.0.0 "pre" would become 1.0.0-0 which is the wrong direction. + case 'pre': + if (this.prerelease.length === 0) + this.prerelease = [0]; + else { + var i = this.prerelease.length; + while (--i >= 0) { + if (typeof this.prerelease[i] === 'number') { + this.prerelease[i]++; + i = -2; + } + } + if (i === -1) // didn't increment anything + this.prerelease.push(0); + } + if (identifier) { + // 1.2.0-beta.1 bumps to 1.2.0-beta.2, + // 1.2.0-beta.fooblz or 1.2.0-beta bumps to 1.2.0-beta.0 + if (this.prerelease[0] === identifier) { + if (isNaN(this.prerelease[1])) + this.prerelease = [identifier, 0]; + } else + this.prerelease = [identifier, 0]; + } + break; + + default: + throw new Error('invalid increment argument: ' + release); + } + this.format(); + this.raw = this.version; + return this; +}; + +exports.inc = inc; +function inc(version, release, loose, identifier) { + if (typeof(loose) === 'string') { + identifier = loose; + loose = undefined; + } + + try { + return new SemVer(version, loose).inc(release, identifier).version; + } catch (er) { + return null; + } +} + +exports.diff = diff; +function diff(version1, version2) { + if (eq(version1, version2)) { + return null; + } else { + var v1 = parse(version1); + var v2 = parse(version2); + if (v1.prerelease.length || v2.prerelease.length) { + for (var key in v1) { + if (key === 'major' || key === 'minor' || key === 'patch') { + if (v1[key] !== v2[key]) { + return 'pre'+key; + } + } + } + return 'prerelease'; + } + for (var key in v1) { + if (key === 'major' || key === 'minor' || key === 'patch') { + if (v1[key] !== v2[key]) { + return key; + } + } + } + } +} + +exports.compareIdentifiers = compareIdentifiers; + +var numeric = /^[0-9]+$/; +function compareIdentifiers(a, b) { + var anum = numeric.test(a); + var bnum = numeric.test(b); + + if (anum && bnum) { + a = +a; + b = +b; + } + + return (anum && !bnum) ? -1 : + (bnum && !anum) ? 1 : + a < b ? -1 : + a > b ? 1 : + 0; +} + +exports.rcompareIdentifiers = rcompareIdentifiers; +function rcompareIdentifiers(a, b) { + return compareIdentifiers(b, a); +} + +exports.major = major; +function major(a, loose) { + return new SemVer(a, loose).major; +} + +exports.minor = minor; +function minor(a, loose) { + return new SemVer(a, loose).minor; +} + +exports.patch = patch; +function patch(a, loose) { + return new SemVer(a, loose).patch; +} + +exports.compare = compare; +function compare(a, b, loose) { + return new SemVer(a, loose).compare(new SemVer(b, loose)); +} + +exports.compareLoose = compareLoose; +function compareLoose(a, b) { + return compare(a, b, true); +} + +exports.rcompare = rcompare; +function rcompare(a, b, loose) { + return compare(b, a, loose); +} + +exports.sort = sort; +function sort(list, loose) { + return list.sort(function(a, b) { + return exports.compare(a, b, loose); + }); +} + +exports.rsort = rsort; +function rsort(list, loose) { + return list.sort(function(a, b) { + return exports.rcompare(a, b, loose); + }); +} + +exports.gt = gt; +function gt(a, b, loose) { + return compare(a, b, loose) > 0; +} + +exports.lt = lt; +function lt(a, b, loose) { + return compare(a, b, loose) < 0; +} + +exports.eq = eq; +function eq(a, b, loose) { + return compare(a, b, loose) === 0; +} + +exports.neq = neq; +function neq(a, b, loose) { + return compare(a, b, loose) !== 0; +} + +exports.gte = gte; +function gte(a, b, loose) { + return compare(a, b, loose) >= 0; +} + +exports.lte = lte; +function lte(a, b, loose) { + return compare(a, b, loose) <= 0; +} + +exports.cmp = cmp; +function cmp(a, op, b, loose) { + var ret; + switch (op) { + case '===': + if (typeof a === 'object') a = a.version; + if (typeof b === 'object') b = b.version; + ret = a === b; + break; + case '!==': + if (typeof a === 'object') a = a.version; + if (typeof b === 'object') b = b.version; + ret = a !== b; + break; + case '': case '=': case '==': ret = eq(a, b, loose); break; + case '!=': ret = neq(a, b, loose); break; + case '>': ret = gt(a, b, loose); break; + case '>=': ret = gte(a, b, loose); break; + case '<': ret = lt(a, b, loose); break; + case '<=': ret = lte(a, b, loose); break; + default: throw new TypeError('Invalid operator: ' + op); + } + return ret; +} + +exports.Comparator = Comparator; +function Comparator(comp, loose) { + if (comp instanceof Comparator) { + if (comp.loose === loose) + return comp; + else + comp = comp.value; + } + + if (!(this instanceof Comparator)) + return new Comparator(comp, loose); + + debug('comparator', comp, loose); + this.loose = loose; + this.parse(comp); + + if (this.semver === ANY) + this.value = ''; + else + this.value = this.operator + this.semver.version; + + debug('comp', this); +} + +var ANY = {}; +Comparator.prototype.parse = function(comp) { + var r = this.loose ? re[COMPARATORLOOSE] : re[COMPARATOR]; + var m = comp.match(r); + + if (!m) + throw new TypeError('Invalid comparator: ' + comp); + + this.operator = m[1]; + if (this.operator === '=') + this.operator = ''; + + // if it literally is just '>' or '' then allow anything. + if (!m[2]) + this.semver = ANY; + else + this.semver = new SemVer(m[2], this.loose); +}; + +Comparator.prototype.toString = function() { + return this.value; +}; + +Comparator.prototype.test = function(version) { + debug('Comparator.test', version, this.loose); + + if (this.semver === ANY) + return true; + + if (typeof version === 'string') + version = new SemVer(version, this.loose); + + return cmp(version, this.operator, this.semver, this.loose); +}; + +Comparator.prototype.intersects = function(comp, loose) { + if (!(comp instanceof Comparator)) { + throw new TypeError('a Comparator is required'); + } + + var rangeTmp; + + if (this.operator === '') { + rangeTmp = new Range(comp.value, loose); + return satisfies(this.value, rangeTmp, loose); + } else if (comp.operator === '') { + rangeTmp = new Range(this.value, loose); + return satisfies(comp.semver, rangeTmp, loose); + } + + var sameDirectionIncreasing = + (this.operator === '>=' || this.operator === '>') && + (comp.operator === '>=' || comp.operator === '>'); + var sameDirectionDecreasing = + (this.operator === '<=' || this.operator === '<') && + (comp.operator === '<=' || comp.operator === '<'); + var sameSemVer = this.semver.version === comp.semver.version; + var differentDirectionsInclusive = + (this.operator === '>=' || this.operator === '<=') && + (comp.operator === '>=' || comp.operator === '<='); + var oppositeDirectionsLessThan = + cmp(this.semver, '<', comp.semver, loose) && + ((this.operator === '>=' || this.operator === '>') && + (comp.operator === '<=' || comp.operator === '<')); + var oppositeDirectionsGreaterThan = + cmp(this.semver, '>', comp.semver, loose) && + ((this.operator === '<=' || this.operator === '<') && + (comp.operator === '>=' || comp.operator === '>')); + + return sameDirectionIncreasing || sameDirectionDecreasing || + (sameSemVer && differentDirectionsInclusive) || + oppositeDirectionsLessThan || oppositeDirectionsGreaterThan; +}; + + +exports.Range = Range; +function Range(range, loose) { + if (range instanceof Range) { + if (range.loose === loose) { + return range; + } else { + return new Range(range.raw, loose); + } + } + + if (range instanceof Comparator) { + return new Range(range.value, loose); + } + + if (!(this instanceof Range)) + return new Range(range, loose); + + this.loose = loose; + + // First, split based on boolean or || + this.raw = range; + this.set = range.split(/\s*\|\|\s*/).map(function(range) { + return this.parseRange(range.trim()); + }, this).filter(function(c) { + // throw out any that are not relevant for whatever reason + return c.length; + }); + + if (!this.set.length) { + throw new TypeError('Invalid SemVer Range: ' + range); + } + + this.format(); +} + +Range.prototype.format = function() { + this.range = this.set.map(function(comps) { + return comps.join(' ').trim(); + }).join('||').trim(); + return this.range; +}; + +Range.prototype.toString = function() { + return this.range; +}; + +Range.prototype.parseRange = function(range) { + var loose = this.loose; + range = range.trim(); + debug('range', range, loose); + // `1.2.3 - 1.2.4` => `>=1.2.3 <=1.2.4` + var hr = loose ? re[HYPHENRANGELOOSE] : re[HYPHENRANGE]; + range = range.replace(hr, hyphenReplace); + debug('hyphen replace', range); + // `> 1.2.3 < 1.2.5` => `>1.2.3 <1.2.5` + range = range.replace(re[COMPARATORTRIM], comparatorTrimReplace); + debug('comparator trim', range, re[COMPARATORTRIM]); + + // `~ 1.2.3` => `~1.2.3` + range = range.replace(re[TILDETRIM], tildeTrimReplace); + + // `^ 1.2.3` => `^1.2.3` + range = range.replace(re[CARETTRIM], caretTrimReplace); + + // normalize spaces + range = range.split(/\s+/).join(' '); + + // At this point, the range is completely trimmed and + // ready to be split into comparators. + + var compRe = loose ? re[COMPARATORLOOSE] : re[COMPARATOR]; + var set = range.split(' ').map(function(comp) { + return parseComparator(comp, loose); + }).join(' ').split(/\s+/); + if (this.loose) { + // in loose mode, throw out any that are not valid comparators + set = set.filter(function(comp) { + return !!comp.match(compRe); + }); + } + set = set.map(function(comp) { + return new Comparator(comp, loose); + }); + + return set; +}; + +Range.prototype.intersects = function(range, loose) { + if (!(range instanceof Range)) { + throw new TypeError('a Range is required'); + } + + return this.set.some(function(thisComparators) { + return thisComparators.every(function(thisComparator) { + return range.set.some(function(rangeComparators) { + return rangeComparators.every(function(rangeComparator) { + return thisComparator.intersects(rangeComparator, loose); + }); + }); + }); + }); +}; + +// Mostly just for testing and legacy API reasons +exports.toComparators = toComparators; +function toComparators(range, loose) { + return new Range(range, loose).set.map(function(comp) { + return comp.map(function(c) { + return c.value; + }).join(' ').trim().split(' '); + }); +} + +// comprised of xranges, tildes, stars, and gtlt's at this point. +// already replaced the hyphen ranges +// turn into a set of JUST comparators. +function parseComparator(comp, loose) { + debug('comp', comp); + comp = replaceCarets(comp, loose); + debug('caret', comp); + comp = replaceTildes(comp, loose); + debug('tildes', comp); + comp = replaceXRanges(comp, loose); + debug('xrange', comp); + comp = replaceStars(comp, loose); + debug('stars', comp); + return comp; +} + +function isX(id) { + return !id || id.toLowerCase() === 'x' || id === '*'; +} + +// ~, ~> --> * (any, kinda silly) +// ~2, ~2.x, ~2.x.x, ~>2, ~>2.x ~>2.x.x --> >=2.0.0 <3.0.0 +// ~2.0, ~2.0.x, ~>2.0, ~>2.0.x --> >=2.0.0 <2.1.0 +// ~1.2, ~1.2.x, ~>1.2, ~>1.2.x --> >=1.2.0 <1.3.0 +// ~1.2.3, ~>1.2.3 --> >=1.2.3 <1.3.0 +// ~1.2.0, ~>1.2.0 --> >=1.2.0 <1.3.0 +function replaceTildes(comp, loose) { + return comp.trim().split(/\s+/).map(function(comp) { + return replaceTilde(comp, loose); + }).join(' '); +} + +function replaceTilde(comp, loose) { + var r = loose ? re[TILDELOOSE] : re[TILDE]; + return comp.replace(r, function(_, M, m, p, pr) { + debug('tilde', comp, _, M, m, p, pr); + var ret; + + if (isX(M)) + ret = ''; + else if (isX(m)) + ret = '>=' + M + '.0.0 <' + (+M + 1) + '.0.0'; + else if (isX(p)) + // ~1.2 == >=1.2.0 <1.3.0 + ret = '>=' + M + '.' + m + '.0 <' + M + '.' + (+m + 1) + '.0'; + else if (pr) { + debug('replaceTilde pr', pr); + if (pr.charAt(0) !== '-') + pr = '-' + pr; + ret = '>=' + M + '.' + m + '.' + p + pr + + ' <' + M + '.' + (+m + 1) + '.0'; + } else + // ~1.2.3 == >=1.2.3 <1.3.0 + ret = '>=' + M + '.' + m + '.' + p + + ' <' + M + '.' + (+m + 1) + '.0'; + + debug('tilde return', ret); + return ret; + }); +} + +// ^ --> * (any, kinda silly) +// ^2, ^2.x, ^2.x.x --> >=2.0.0 <3.0.0 +// ^2.0, ^2.0.x --> >=2.0.0 <3.0.0 +// ^1.2, ^1.2.x --> >=1.2.0 <2.0.0 +// ^1.2.3 --> >=1.2.3 <2.0.0 +// ^1.2.0 --> >=1.2.0 <2.0.0 +function replaceCarets(comp, loose) { + return comp.trim().split(/\s+/).map(function(comp) { + return replaceCaret(comp, loose); + }).join(' '); +} + +function replaceCaret(comp, loose) { + debug('caret', comp, loose); + var r = loose ? re[CARETLOOSE] : re[CARET]; + return comp.replace(r, function(_, M, m, p, pr) { + debug('caret', comp, _, M, m, p, pr); + var ret; + + if (isX(M)) + ret = ''; + else if (isX(m)) + ret = '>=' + M + '.0.0 <' + (+M + 1) + '.0.0'; + else if (isX(p)) { + if (M === '0') + ret = '>=' + M + '.' + m + '.0 <' + M + '.' + (+m + 1) + '.0'; + else + ret = '>=' + M + '.' + m + '.0 <' + (+M + 1) + '.0.0'; + } else if (pr) { + debug('replaceCaret pr', pr); + if (pr.charAt(0) !== '-') + pr = '-' + pr; + if (M === '0') { + if (m === '0') + ret = '>=' + M + '.' + m + '.' + p + pr + + ' <' + M + '.' + m + '.' + (+p + 1); + else + ret = '>=' + M + '.' + m + '.' + p + pr + + ' <' + M + '.' + (+m + 1) + '.0'; + } else + ret = '>=' + M + '.' + m + '.' + p + pr + + ' <' + (+M + 1) + '.0.0'; + } else { + debug('no pr'); + if (M === '0') { + if (m === '0') + ret = '>=' + M + '.' + m + '.' + p + + ' <' + M + '.' + m + '.' + (+p + 1); + else + ret = '>=' + M + '.' + m + '.' + p + + ' <' + M + '.' + (+m + 1) + '.0'; + } else + ret = '>=' + M + '.' + m + '.' + p + + ' <' + (+M + 1) + '.0.0'; + } + + debug('caret return', ret); + return ret; + }); +} + +function replaceXRanges(comp, loose) { + debug('replaceXRanges', comp, loose); + return comp.split(/\s+/).map(function(comp) { + return replaceXRange(comp, loose); + }).join(' '); +} + +function replaceXRange(comp, loose) { + comp = comp.trim(); + var r = loose ? re[XRANGELOOSE] : re[XRANGE]; + return comp.replace(r, function(ret, gtlt, M, m, p, pr) { + debug('xRange', comp, ret, gtlt, M, m, p, pr); + var xM = isX(M); + var xm = xM || isX(m); + var xp = xm || isX(p); + var anyX = xp; + + if (gtlt === '=' && anyX) + gtlt = ''; + + if (xM) { + if (gtlt === '>' || gtlt === '<') { + // nothing is allowed + ret = '<0.0.0'; + } else { + // nothing is forbidden + ret = '*'; + } + } else if (gtlt && anyX) { + // replace X with 0 + if (xm) + m = 0; + if (xp) + p = 0; + + if (gtlt === '>') { + // >1 => >=2.0.0 + // >1.2 => >=1.3.0 + // >1.2.3 => >= 1.2.4 + gtlt = '>='; + if (xm) { + M = +M + 1; + m = 0; + p = 0; + } else if (xp) { + m = +m + 1; + p = 0; + } + } else if (gtlt === '<=') { + // <=0.7.x is actually <0.8.0, since any 0.7.x should + // pass. Similarly, <=7.x is actually <8.0.0, etc. + gtlt = '<'; + if (xm) + M = +M + 1; + else + m = +m + 1; + } + + ret = gtlt + M + '.' + m + '.' + p; + } else if (xm) { + ret = '>=' + M + '.0.0 <' + (+M + 1) + '.0.0'; + } else if (xp) { + ret = '>=' + M + '.' + m + '.0 <' + M + '.' + (+m + 1) + '.0'; + } + + debug('xRange return', ret); + + return ret; + }); +} + +// Because * is AND-ed with everything else in the comparator, +// and '' means "any version", just remove the *s entirely. +function replaceStars(comp, loose) { + debug('replaceStars', comp, loose); + // Looseness is ignored here. star is always as loose as it gets! + return comp.trim().replace(re[STAR], ''); +} + +// This function is passed to string.replace(re[HYPHENRANGE]) +// M, m, patch, prerelease, build +// 1.2 - 3.4.5 => >=1.2.0 <=3.4.5 +// 1.2.3 - 3.4 => >=1.2.0 <3.5.0 Any 3.4.x will do +// 1.2 - 3.4 => >=1.2.0 <3.5.0 +function hyphenReplace($0, + from, fM, fm, fp, fpr, fb, + to, tM, tm, tp, tpr, tb) { + + if (isX(fM)) + from = ''; + else if (isX(fm)) + from = '>=' + fM + '.0.0'; + else if (isX(fp)) + from = '>=' + fM + '.' + fm + '.0'; + else + from = '>=' + from; + + if (isX(tM)) + to = ''; + else if (isX(tm)) + to = '<' + (+tM + 1) + '.0.0'; + else if (isX(tp)) + to = '<' + tM + '.' + (+tm + 1) + '.0'; + else if (tpr) + to = '<=' + tM + '.' + tm + '.' + tp + '-' + tpr; + else + to = '<=' + to; + + return (from + ' ' + to).trim(); +} + + +// if ANY of the sets match ALL of its comparators, then pass +Range.prototype.test = function(version) { + if (!version) + return false; + + if (typeof version === 'string') + version = new SemVer(version, this.loose); + + for (var i = 0; i < this.set.length; i++) { + if (testSet(this.set[i], version)) + return true; + } + return false; +}; + +function testSet(set, version) { + for (var i = 0; i < set.length; i++) { + if (!set[i].test(version)) + return false; + } + + if (version.prerelease.length) { + // Find the set of versions that are allowed to have prereleases + // For example, ^1.2.3-pr.1 desugars to >=1.2.3-pr.1 <2.0.0 + // That should allow `1.2.3-pr.2` to pass. + // However, `1.2.4-alpha.notready` should NOT be allowed, + // even though it's within the range set by the comparators. + for (var i = 0; i < set.length; i++) { + debug(set[i].semver); + if (set[i].semver === ANY) + continue; + + if (set[i].semver.prerelease.length > 0) { + var allowed = set[i].semver; + if (allowed.major === version.major && + allowed.minor === version.minor && + allowed.patch === version.patch) + return true; + } + } + + // Version has a -pre, but it's not one of the ones we like. + return false; + } + + return true; +} + +exports.satisfies = satisfies; +function satisfies(version, range, loose) { + try { + range = new Range(range, loose); + } catch (er) { + return false; + } + return range.test(version); +} + +exports.maxSatisfying = maxSatisfying; +function maxSatisfying(versions, range, loose) { + var max = null; + var maxSV = null; + try { + var rangeObj = new Range(range, loose); + } catch (er) { + return null; + } + versions.forEach(function (v) { + if (rangeObj.test(v)) { // satisfies(v, range, loose) + if (!max || maxSV.compare(v) === -1) { // compare(max, v, true) + max = v; + maxSV = new SemVer(max, loose); + } + } + }) + return max; +} + +exports.minSatisfying = minSatisfying; +function minSatisfying(versions, range, loose) { + var min = null; + var minSV = null; + try { + var rangeObj = new Range(range, loose); + } catch (er) { + return null; + } + versions.forEach(function (v) { + if (rangeObj.test(v)) { // satisfies(v, range, loose) + if (!min || minSV.compare(v) === 1) { // compare(min, v, true) + min = v; + minSV = new SemVer(min, loose); + } + } + }) + return min; +} + +exports.validRange = validRange; +function validRange(range, loose) { + try { + // Return '*' instead of '' so that truthiness works. + // This will throw if it's invalid anyway + return new Range(range, loose).range || '*'; + } catch (er) { + return null; + } +} + +// Determine if version is less than all the versions possible in the range +exports.ltr = ltr; +function ltr(version, range, loose) { + return outside(version, range, '<', loose); +} + +// Determine if version is greater than all the versions possible in the range. +exports.gtr = gtr; +function gtr(version, range, loose) { + return outside(version, range, '>', loose); +} + +exports.outside = outside; +function outside(version, range, hilo, loose) { + version = new SemVer(version, loose); + range = new Range(range, loose); + + var gtfn, ltefn, ltfn, comp, ecomp; + switch (hilo) { + case '>': + gtfn = gt; + ltefn = lte; + ltfn = lt; + comp = '>'; + ecomp = '>='; + break; + case '<': + gtfn = lt; + ltefn = gte; + ltfn = gt; + comp = '<'; + ecomp = '<='; + break; + default: + throw new TypeError('Must provide a hilo val of "<" or ">"'); + } + + // If it satisifes the range it is not outside + if (satisfies(version, range, loose)) { + return false; + } + + // From now on, variable terms are as if we're in "gtr" mode. + // but note that everything is flipped for the "ltr" function. + + for (var i = 0; i < range.set.length; ++i) { + var comparators = range.set[i]; + + var high = null; + var low = null; + + comparators.forEach(function(comparator) { + if (comparator.semver === ANY) { + comparator = new Comparator('>=0.0.0') + } + high = high || comparator; + low = low || comparator; + if (gtfn(comparator.semver, high.semver, loose)) { + high = comparator; + } else if (ltfn(comparator.semver, low.semver, loose)) { + low = comparator; + } + }); + + // If the edge version comparator has a operator then our version + // isn't outside it + if (high.operator === comp || high.operator === ecomp) { + return false; + } + + // If the lowest version comparator has an operator and our version + // is less than it then it isn't higher than the range + if ((!low.operator || low.operator === comp) && + ltefn(version, low.semver)) { + return false; + } else if (low.operator === ecomp && ltfn(version, low.semver)) { + return false; + } + } + return true; +} + +exports.prerelease = prerelease; +function prerelease(version, loose) { + var parsed = parse(version, loose); + return (parsed && parsed.prerelease.length) ? parsed.prerelease : null; +} + +exports.intersects = intersects; +function intersects(r1, r2, loose) { + r1 = new Range(r1, loose) + r2 = new Range(r2, loose) + return r1.intersects(r2) +} + +exports.coerce = coerce; +function coerce(version) { + if (version instanceof SemVer) + return version; + + if (typeof version !== 'string') + return null; + + var match = version.match(re[COERCE]); + + if (match == null) + return null; + + return parse((match[1] || '0') + '.' + (match[2] || '0') + '.' + (match[3] || '0')); +} + + +/***/ }), +/* 23 */ +/***/ (function(module, exports) { + +module.exports = require("stream"); + +/***/ }), +/* 24 */ +/***/ (function(module, exports) { + +module.exports = require("url"); + +/***/ }), +/* 25 */ +/***/ (function(module, __webpack_exports__, __webpack_require__) { + +"use strict"; +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Subscription; }); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__util_isArray__ = __webpack_require__(41); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_isObject__ = __webpack_require__(444); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__util_isFunction__ = __webpack_require__(154); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__util_tryCatch__ = __webpack_require__(56); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__util_errorObject__ = __webpack_require__(47); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__ = __webpack_require__(441); +/** PURE_IMPORTS_START _util_isArray,_util_isObject,_util_isFunction,_util_tryCatch,_util_errorObject,_util_UnsubscriptionError PURE_IMPORTS_END */ + + + + + + +var Subscription = /*@__PURE__*/ (function () { + function Subscription(unsubscribe) { + this.closed = false; + this._parent = null; + this._parents = null; + this._subscriptions = null; + if (unsubscribe) { + this._unsubscribe = unsubscribe; + } + } + Subscription.prototype.unsubscribe = function () { + var hasErrors = false; + var errors; + if (this.closed) { + return; + } + var _a = this, _parent = _a._parent, _parents = _a._parents, _unsubscribe = _a._unsubscribe, _subscriptions = _a._subscriptions; + this.closed = true; + this._parent = null; + this._parents = null; + this._subscriptions = null; + var index = -1; + var len = _parents ? _parents.length : 0; + while (_parent) { + _parent.remove(this); + _parent = ++index < len && _parents[index] || null; + } + if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_2__util_isFunction__["a" /* isFunction */])(_unsubscribe)) { + var trial = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__util_tryCatch__["a" /* tryCatch */])(_unsubscribe).call(this); + if (trial === __WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */]) { + hasErrors = true; + errors = errors || (__WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */].e instanceof __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__["a" /* UnsubscriptionError */] ? + flattenUnsubscriptionErrors(__WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */].e.errors) : [__WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */].e]); + } + } + if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_0__util_isArray__["a" /* isArray */])(_subscriptions)) { + index = -1; + len = _subscriptions.length; + while (++index < len) { + var sub = _subscriptions[index]; + if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__util_isObject__["a" /* isObject */])(sub)) { + var trial = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__util_tryCatch__["a" /* tryCatch */])(sub.unsubscribe).call(sub); + if (trial === __WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */]) { + hasErrors = true; + errors = errors || []; + var err = __WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */].e; + if (err instanceof __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__["a" /* UnsubscriptionError */]) { + errors = errors.concat(flattenUnsubscriptionErrors(err.errors)); + } + else { + errors.push(err); + } + } + } + } + } + if (hasErrors) { + throw new __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__["a" /* UnsubscriptionError */](errors); + } + }; + Subscription.prototype.add = function (teardown) { + if (!teardown || (teardown === Subscription.EMPTY)) { + return Subscription.EMPTY; + } + if (teardown === this) { + return this; + } + var subscription = teardown; + switch (typeof teardown) { + case 'function': + subscription = new Subscription(teardown); + case 'object': + if (subscription.closed || typeof subscription.unsubscribe !== 'function') { + return subscription; + } + else if (this.closed) { + subscription.unsubscribe(); + return subscription; + } + else if (typeof subscription._addParent !== 'function') { + var tmp = subscription; + subscription = new Subscription(); + subscription._subscriptions = [tmp]; + } + break; + default: + throw new Error('unrecognized teardown ' + teardown + ' added to Subscription.'); + } + var subscriptions = this._subscriptions || (this._subscriptions = []); + subscriptions.push(subscription); + subscription._addParent(this); + return subscription; + }; + Subscription.prototype.remove = function (subscription) { + var subscriptions = this._subscriptions; + if (subscriptions) { + var subscriptionIndex = subscriptions.indexOf(subscription); + if (subscriptionIndex !== -1) { + subscriptions.splice(subscriptionIndex, 1); + } + } + }; + Subscription.prototype._addParent = function (parent) { + var _a = this, _parent = _a._parent, _parents = _a._parents; + if (!_parent || _parent === parent) { + this._parent = parent; + } + else if (!_parents) { + this._parents = [parent]; + } + else if (_parents.indexOf(parent) === -1) { + _parents.push(parent); + } + }; + Subscription.EMPTY = (function (empty) { + empty.closed = true; + return empty; + }(new Subscription())); + return Subscription; +}()); + +function flattenUnsubscriptionErrors(errors) { + return errors.reduce(function (errs, err) { return errs.concat((err instanceof __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__["a" /* UnsubscriptionError */]) ? err.errors : err); }, []); +} +//# sourceMappingURL=Subscription.js.map + + +/***/ }), +/* 26 */ +/***/ (function(module, exports, __webpack_require__) { + +// Copyright 2015 Joyent, Inc. + +module.exports = { + bufferSplit: bufferSplit, + addRSAMissing: addRSAMissing, + calculateDSAPublic: calculateDSAPublic, + calculateED25519Public: calculateED25519Public, + calculateX25519Public: calculateX25519Public, + mpNormalize: mpNormalize, + mpDenormalize: mpDenormalize, + ecNormalize: ecNormalize, + countZeros: countZeros, + assertCompatible: assertCompatible, + isCompatible: isCompatible, + opensslKeyDeriv: opensslKeyDeriv, + opensshCipherInfo: opensshCipherInfo, + publicFromPrivateECDSA: publicFromPrivateECDSA, + zeroPadToLength: zeroPadToLength, + writeBitString: writeBitString, + readBitString: readBitString +}; + +var assert = __webpack_require__(16); +var Buffer = __webpack_require__(15).Buffer; +var PrivateKey = __webpack_require__(33); +var Key = __webpack_require__(27); +var crypto = __webpack_require__(11); +var algs = __webpack_require__(32); +var asn1 = __webpack_require__(66); + +var ec, jsbn; +var nacl; + +var MAX_CLASS_DEPTH = 3; + +function isCompatible(obj, klass, needVer) { + if (obj === null || typeof (obj) !== 'object') + return (false); + if (needVer === undefined) + needVer = klass.prototype._sshpkApiVersion; + if (obj instanceof klass && + klass.prototype._sshpkApiVersion[0] == needVer[0]) + return (true); + var proto = Object.getPrototypeOf(obj); + var depth = 0; + while (proto.constructor.name !== klass.name) { + proto = Object.getPrototypeOf(proto); + if (!proto || ++depth > MAX_CLASS_DEPTH) + return (false); + } + if (proto.constructor.name !== klass.name) + return (false); + var ver = proto._sshpkApiVersion; + if (ver === undefined) + ver = klass._oldVersionDetect(obj); + if (ver[0] != needVer[0] || ver[1] < needVer[1]) + return (false); + return (true); +} + +function assertCompatible(obj, klass, needVer, name) { + if (name === undefined) + name = 'object'; + assert.ok(obj, name + ' must not be null'); + assert.object(obj, name + ' must be an object'); + if (needVer === undefined) + needVer = klass.prototype._sshpkApiVersion; + if (obj instanceof klass && + klass.prototype._sshpkApiVersion[0] == needVer[0]) + return; + var proto = Object.getPrototypeOf(obj); + var depth = 0; + while (proto.constructor.name !== klass.name) { + proto = Object.getPrototypeOf(proto); + assert.ok(proto && ++depth <= MAX_CLASS_DEPTH, + name + ' must be a ' + klass.name + ' instance'); + } + assert.strictEqual(proto.constructor.name, klass.name, + name + ' must be a ' + klass.name + ' instance'); + var ver = proto._sshpkApiVersion; + if (ver === undefined) + ver = klass._oldVersionDetect(obj); + assert.ok(ver[0] == needVer[0] && ver[1] >= needVer[1], + name + ' must be compatible with ' + klass.name + ' klass ' + + 'version ' + needVer[0] + '.' + needVer[1]); +} + +var CIPHER_LEN = { + 'des-ede3-cbc': { key: 7, iv: 8 }, + 'aes-128-cbc': { key: 16, iv: 16 } +}; +var PKCS5_SALT_LEN = 8; + +function opensslKeyDeriv(cipher, salt, passphrase, count) { + assert.buffer(salt, 'salt'); + assert.buffer(passphrase, 'passphrase'); + assert.number(count, 'iteration count'); + + var clen = CIPHER_LEN[cipher]; + assert.object(clen, 'supported cipher'); + + salt = salt.slice(0, PKCS5_SALT_LEN); + + var D, D_prev, bufs; + var material = Buffer.alloc(0); + while (material.length < clen.key + clen.iv) { + bufs = []; + if (D_prev) + bufs.push(D_prev); + bufs.push(passphrase); + bufs.push(salt); + D = Buffer.concat(bufs); + for (var j = 0; j < count; ++j) + D = crypto.createHash('md5').update(D).digest(); + material = Buffer.concat([material, D]); + D_prev = D; + } + + return ({ + key: material.slice(0, clen.key), + iv: material.slice(clen.key, clen.key + clen.iv) + }); +} + +/* Count leading zero bits on a buffer */ +function countZeros(buf) { + var o = 0, obit = 8; + while (o < buf.length) { + var mask = (1 << obit); + if ((buf[o] & mask) === mask) + break; + obit--; + if (obit < 0) { + o++; + obit = 8; + } + } + return (o*8 + (8 - obit) - 1); +} + +function bufferSplit(buf, chr) { + assert.buffer(buf); + assert.string(chr); + + var parts = []; + var lastPart = 0; + var matches = 0; + for (var i = 0; i < buf.length; ++i) { + if (buf[i] === chr.charCodeAt(matches)) + ++matches; + else if (buf[i] === chr.charCodeAt(0)) + matches = 1; + else + matches = 0; + + if (matches >= chr.length) { + var newPart = i + 1; + parts.push(buf.slice(lastPart, newPart - matches)); + lastPart = newPart; + matches = 0; + } + } + if (lastPart <= buf.length) + parts.push(buf.slice(lastPart, buf.length)); + + return (parts); +} + +function ecNormalize(buf, addZero) { + assert.buffer(buf); + if (buf[0] === 0x00 && buf[1] === 0x04) { + if (addZero) + return (buf); + return (buf.slice(1)); + } else if (buf[0] === 0x04) { + if (!addZero) + return (buf); + } else { + while (buf[0] === 0x00) + buf = buf.slice(1); + if (buf[0] === 0x02 || buf[0] === 0x03) + throw (new Error('Compressed elliptic curve points ' + + 'are not supported')); + if (buf[0] !== 0x04) + throw (new Error('Not a valid elliptic curve point')); + if (!addZero) + return (buf); + } + var b = Buffer.alloc(buf.length + 1); + b[0] = 0x0; + buf.copy(b, 1); + return (b); +} + +function readBitString(der, tag) { + if (tag === undefined) + tag = asn1.Ber.BitString; + var buf = der.readString(tag, true); + assert.strictEqual(buf[0], 0x00, 'bit strings with unused bits are ' + + 'not supported (0x' + buf[0].toString(16) + ')'); + return (buf.slice(1)); +} + +function writeBitString(der, buf, tag) { + if (tag === undefined) + tag = asn1.Ber.BitString; + var b = Buffer.alloc(buf.length + 1); + b[0] = 0x00; + buf.copy(b, 1); + der.writeBuffer(b, tag); +} + +function mpNormalize(buf) { + assert.buffer(buf); + while (buf.length > 1 && buf[0] === 0x00 && (buf[1] & 0x80) === 0x00) + buf = buf.slice(1); + if ((buf[0] & 0x80) === 0x80) { + var b = Buffer.alloc(buf.length + 1); + b[0] = 0x00; + buf.copy(b, 1); + buf = b; + } + return (buf); +} + +function mpDenormalize(buf) { + assert.buffer(buf); + while (buf.length > 1 && buf[0] === 0x00) + buf = buf.slice(1); + return (buf); +} + +function zeroPadToLength(buf, len) { + assert.buffer(buf); + assert.number(len); + while (buf.length > len) { + assert.equal(buf[0], 0x00); + buf = buf.slice(1); + } + while (buf.length < len) { + var b = Buffer.alloc(buf.length + 1); + b[0] = 0x00; + buf.copy(b, 1); + buf = b; + } + return (buf); +} + +function bigintToMpBuf(bigint) { + var buf = Buffer.from(bigint.toByteArray()); + buf = mpNormalize(buf); + return (buf); +} + +function calculateDSAPublic(g, p, x) { + assert.buffer(g); + assert.buffer(p); + assert.buffer(x); + try { + var bigInt = __webpack_require__(81).BigInteger; + } catch (e) { + throw (new Error('To load a PKCS#8 format DSA private key, ' + + 'the node jsbn library is required.')); + } + g = new bigInt(g); + p = new bigInt(p); + x = new bigInt(x); + var y = g.modPow(x, p); + var ybuf = bigintToMpBuf(y); + return (ybuf); +} + +function calculateED25519Public(k) { + assert.buffer(k); + + if (nacl === undefined) + nacl = __webpack_require__(76); + + var kp = nacl.sign.keyPair.fromSeed(new Uint8Array(k)); + return (Buffer.from(kp.publicKey)); +} + +function calculateX25519Public(k) { + assert.buffer(k); + + if (nacl === undefined) + nacl = __webpack_require__(76); + + var kp = nacl.box.keyPair.fromSeed(new Uint8Array(k)); + return (Buffer.from(kp.publicKey)); +} + +function addRSAMissing(key) { + assert.object(key); + assertCompatible(key, PrivateKey, [1, 1]); + try { + var bigInt = __webpack_require__(81).BigInteger; + } catch (e) { + throw (new Error('To write a PEM private key from ' + + 'this source, the node jsbn lib is required.')); + } + + var d = new bigInt(key.part.d.data); + var buf; + + if (!key.part.dmodp) { + var p = new bigInt(key.part.p.data); + var dmodp = d.mod(p.subtract(1)); + + buf = bigintToMpBuf(dmodp); + key.part.dmodp = {name: 'dmodp', data: buf}; + key.parts.push(key.part.dmodp); + } + if (!key.part.dmodq) { + var q = new bigInt(key.part.q.data); + var dmodq = d.mod(q.subtract(1)); + + buf = bigintToMpBuf(dmodq); + key.part.dmodq = {name: 'dmodq', data: buf}; + key.parts.push(key.part.dmodq); + } +} + +function publicFromPrivateECDSA(curveName, priv) { + assert.string(curveName, 'curveName'); + assert.buffer(priv); + if (ec === undefined) + ec = __webpack_require__(139); + if (jsbn === undefined) + jsbn = __webpack_require__(81).BigInteger; + var params = algs.curves[curveName]; + var p = new jsbn(params.p); + var a = new jsbn(params.a); + var b = new jsbn(params.b); + var curve = new ec.ECCurveFp(p, a, b); + var G = curve.decodePointHex(params.G.toString('hex')); + + var d = new jsbn(mpNormalize(priv)); + var pub = G.multiply(d); + pub = Buffer.from(curve.encodePointHex(pub), 'hex'); + + var parts = []; + parts.push({name: 'curve', data: Buffer.from(curveName)}); + parts.push({name: 'Q', data: pub}); + + var key = new Key({type: 'ecdsa', curve: curve, parts: parts}); + return (key); +} + +function opensshCipherInfo(cipher) { + var inf = {}; + switch (cipher) { + case '3des-cbc': + inf.keySize = 24; + inf.blockSize = 8; + inf.opensslName = 'des-ede3-cbc'; + break; + case 'blowfish-cbc': + inf.keySize = 16; + inf.blockSize = 8; + inf.opensslName = 'bf-cbc'; + break; + case 'aes128-cbc': + case 'aes128-ctr': + case 'aes128-gcm@openssh.com': + inf.keySize = 16; + inf.blockSize = 16; + inf.opensslName = 'aes-128-' + cipher.slice(7, 10); + break; + case 'aes192-cbc': + case 'aes192-ctr': + case 'aes192-gcm@openssh.com': + inf.keySize = 24; + inf.blockSize = 16; + inf.opensslName = 'aes-192-' + cipher.slice(7, 10); + break; + case 'aes256-cbc': + case 'aes256-ctr': + case 'aes256-gcm@openssh.com': + inf.keySize = 32; + inf.blockSize = 16; + inf.opensslName = 'aes-256-' + cipher.slice(7, 10); + break; + default: + throw (new Error( + 'Unsupported openssl cipher "' + cipher + '"')); + } + return (inf); +} + + +/***/ }), +/* 27 */ +/***/ (function(module, exports, __webpack_require__) { + +// Copyright 2017 Joyent, Inc. + +module.exports = Key; + +var assert = __webpack_require__(16); +var algs = __webpack_require__(32); +var crypto = __webpack_require__(11); +var Fingerprint = __webpack_require__(156); +var Signature = __webpack_require__(75); +var DiffieHellman = __webpack_require__(325).DiffieHellman; +var errs = __webpack_require__(74); +var utils = __webpack_require__(26); +var PrivateKey = __webpack_require__(33); +var edCompat; + +try { + edCompat = __webpack_require__(454); +} catch (e) { + /* Just continue through, and bail out if we try to use it. */ +} + +var InvalidAlgorithmError = errs.InvalidAlgorithmError; +var KeyParseError = errs.KeyParseError; + +var formats = {}; +formats['auto'] = __webpack_require__(455); +formats['pem'] = __webpack_require__(86); +formats['pkcs1'] = __webpack_require__(327); +formats['pkcs8'] = __webpack_require__(157); +formats['rfc4253'] = __webpack_require__(103); +formats['ssh'] = __webpack_require__(456); +formats['ssh-private'] = __webpack_require__(192); +formats['openssh'] = formats['ssh-private']; +formats['dnssec'] = __webpack_require__(326); + +function Key(opts) { + assert.object(opts, 'options'); + assert.arrayOfObject(opts.parts, 'options.parts'); + assert.string(opts.type, 'options.type'); + assert.optionalString(opts.comment, 'options.comment'); + + var algInfo = algs.info[opts.type]; + if (typeof (algInfo) !== 'object') + throw (new InvalidAlgorithmError(opts.type)); + + var partLookup = {}; + for (var i = 0; i < opts.parts.length; ++i) { + var part = opts.parts[i]; + partLookup[part.name] = part; + } + + this.type = opts.type; + this.parts = opts.parts; + this.part = partLookup; + this.comment = undefined; + this.source = opts.source; + + /* for speeding up hashing/fingerprint operations */ + this._rfc4253Cache = opts._rfc4253Cache; + this._hashCache = {}; + + var sz; + this.curve = undefined; + if (this.type === 'ecdsa') { + var curve = this.part.curve.data.toString(); + this.curve = curve; + sz = algs.curves[curve].size; + } else if (this.type === 'ed25519' || this.type === 'curve25519') { + sz = 256; + this.curve = 'curve25519'; + } else { + var szPart = this.part[algInfo.sizePart]; + sz = szPart.data.length; + sz = sz * 8 - utils.countZeros(szPart.data); + } + this.size = sz; +} + +Key.formats = formats; + +Key.prototype.toBuffer = function (format, options) { + if (format === undefined) + format = 'ssh'; + assert.string(format, 'format'); + assert.object(formats[format], 'formats[format]'); + assert.optionalObject(options, 'options'); + + if (format === 'rfc4253') { + if (this._rfc4253Cache === undefined) + this._rfc4253Cache = formats['rfc4253'].write(this); + return (this._rfc4253Cache); + } + + return (formats[format].write(this, options)); +}; + +Key.prototype.toString = function (format, options) { + return (this.toBuffer(format, options).toString()); +}; + +Key.prototype.hash = function (algo) { + assert.string(algo, 'algorithm'); + algo = algo.toLowerCase(); + if (algs.hashAlgs[algo] === undefined) + throw (new InvalidAlgorithmError(algo)); + + if (this._hashCache[algo]) + return (this._hashCache[algo]); + var hash = crypto.createHash(algo). + update(this.toBuffer('rfc4253')).digest(); + this._hashCache[algo] = hash; + return (hash); +}; + +Key.prototype.fingerprint = function (algo) { + if (algo === undefined) + algo = 'sha256'; + assert.string(algo, 'algorithm'); + var opts = { + type: 'key', + hash: this.hash(algo), + algorithm: algo + }; + return (new Fingerprint(opts)); +}; + +Key.prototype.defaultHashAlgorithm = function () { + var hashAlgo = 'sha1'; + if (this.type === 'rsa') + hashAlgo = 'sha256'; + if (this.type === 'dsa' && this.size > 1024) + hashAlgo = 'sha256'; + if (this.type === 'ed25519') + hashAlgo = 'sha512'; + if (this.type === 'ecdsa') { + if (this.size <= 256) + hashAlgo = 'sha256'; + else if (this.size <= 384) + hashAlgo = 'sha384'; + else + hashAlgo = 'sha512'; + } + return (hashAlgo); +}; + +Key.prototype.createVerify = function (hashAlgo) { + if (hashAlgo === undefined) + hashAlgo = this.defaultHashAlgorithm(); + assert.string(hashAlgo, 'hash algorithm'); + + /* ED25519 is not supported by OpenSSL, use a javascript impl. */ + if (this.type === 'ed25519' && edCompat !== undefined) + return (new edCompat.Verifier(this, hashAlgo)); + if (this.type === 'curve25519') + throw (new Error('Curve25519 keys are not suitable for ' + + 'signing or verification')); + + var v, nm, err; + try { + nm = hashAlgo.toUpperCase(); + v = crypto.createVerify(nm); + } catch (e) { + err = e; + } + if (v === undefined || (err instanceof Error && + err.message.match(/Unknown message digest/))) { + nm = 'RSA-'; + nm += hashAlgo.toUpperCase(); + v = crypto.createVerify(nm); + } + assert.ok(v, 'failed to create verifier'); + var oldVerify = v.verify.bind(v); + var key = this.toBuffer('pkcs8'); + var curve = this.curve; + var self = this; + v.verify = function (signature, fmt) { + if (Signature.isSignature(signature, [2, 0])) { + if (signature.type !== self.type) + return (false); + if (signature.hashAlgorithm && + signature.hashAlgorithm !== hashAlgo) + return (false); + if (signature.curve && self.type === 'ecdsa' && + signature.curve !== curve) + return (false); + return (oldVerify(key, signature.toBuffer('asn1'))); + + } else if (typeof (signature) === 'string' || + Buffer.isBuffer(signature)) { + return (oldVerify(key, signature, fmt)); + + /* + * Avoid doing this on valid arguments, walking the prototype + * chain can be quite slow. + */ + } else if (Signature.isSignature(signature, [1, 0])) { + throw (new Error('signature was created by too old ' + + 'a version of sshpk and cannot be verified')); + + } else { + throw (new TypeError('signature must be a string, ' + + 'Buffer, or Signature object')); + } + }; + return (v); +}; + +Key.prototype.createDiffieHellman = function () { + if (this.type === 'rsa') + throw (new Error('RSA keys do not support Diffie-Hellman')); + + return (new DiffieHellman(this)); +}; +Key.prototype.createDH = Key.prototype.createDiffieHellman; + +Key.parse = function (data, format, options) { + if (typeof (data) !== 'string') + assert.buffer(data, 'data'); + if (format === undefined) + format = 'auto'; + assert.string(format, 'format'); + if (typeof (options) === 'string') + options = { filename: options }; + assert.optionalObject(options, 'options'); + if (options === undefined) + options = {}; + assert.optionalString(options.filename, 'options.filename'); + if (options.filename === undefined) + options.filename = '(unnamed)'; + + assert.object(formats[format], 'formats[format]'); + + try { + var k = formats[format].read(data, options); + if (k instanceof PrivateKey) + k = k.toPublic(); + if (!k.comment) + k.comment = options.filename; + return (k); + } catch (e) { + if (e.name === 'KeyEncryptedError') + throw (e); + throw (new KeyParseError(options.filename, format, e)); + } +}; + +Key.isKey = function (obj, ver) { + return (utils.isCompatible(obj, Key, ver)); +}; + +/* + * API versions for Key: + * [1,0] -- initial ver, may take Signature for createVerify or may not + * [1,1] -- added pkcs1, pkcs8 formats + * [1,2] -- added auto, ssh-private, openssh formats + * [1,3] -- added defaultHashAlgorithm + * [1,4] -- added ed support, createDH + * [1,5] -- first explicitly tagged version + * [1,6] -- changed ed25519 part names + */ +Key.prototype._sshpkApiVersion = [1, 6]; + +Key._oldVersionDetect = function (obj) { + assert.func(obj.toBuffer); + assert.func(obj.fingerprint); + if (obj.createDH) + return ([1, 4]); + if (obj.defaultHashAlgorithm) + return ([1, 3]); + if (obj.formats['auto']) + return ([1, 2]); + if (obj.formats['pkcs1']) + return ([1, 1]); + return ([1, 0]); +}; + + +/***/ }), +/* 28 */ +/***/ (function(module, exports) { + +module.exports = require("assert"); + +/***/ }), +/* 29 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.default = nullify; +function nullify(obj = {}) { + if (Array.isArray(obj)) { + for (var _iterator = obj, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) { + var _ref; + + if (_isArray) { + if (_i >= _iterator.length) break; + _ref = _iterator[_i++]; + } else { + _i = _iterator.next(); + if (_i.done) break; + _ref = _i.value; + } + + const item = _ref; + + nullify(item); + } + } else if (obj !== null && typeof obj === 'object' || typeof obj === 'function') { + Object.setPrototypeOf(obj, null); + + // for..in can only be applied to 'object', not 'function' + if (typeof obj === 'object') { + for (const key in obj) { + nullify(obj[key]); + } + } + } + + return obj; +} + +/***/ }), +/* 30 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + +const escapeStringRegexp = __webpack_require__(388); +const ansiStyles = __webpack_require__(506); +const stdoutColor = __webpack_require__(598).stdout; + +const template = __webpack_require__(599); + +const isSimpleWindowsTerm = process.platform === 'win32' && !(process.env.TERM || '').toLowerCase().startsWith('xterm'); + +// `supportsColor.level` → `ansiStyles.color[name]` mapping +const levelMapping = ['ansi', 'ansi', 'ansi256', 'ansi16m']; + +// `color-convert` models to exclude from the Chalk API due to conflicts and such +const skipModels = new Set(['gray']); + +const styles = Object.create(null); + +function applyOptions(obj, options) { + options = options || {}; + + // Detect level if not set manually + const scLevel = stdoutColor ? stdoutColor.level : 0; + obj.level = options.level === undefined ? scLevel : options.level; + obj.enabled = 'enabled' in options ? options.enabled : obj.level > 0; +} + +function Chalk(options) { + // We check for this.template here since calling `chalk.constructor()` + // by itself will have a `this` of a previously constructed chalk object + if (!this || !(this instanceof Chalk) || this.template) { + const chalk = {}; + applyOptions(chalk, options); + + chalk.template = function () { + const args = [].slice.call(arguments); + return chalkTag.apply(null, [chalk.template].concat(args)); + }; + + Object.setPrototypeOf(chalk, Chalk.prototype); + Object.setPrototypeOf(chalk.template, chalk); + + chalk.template.constructor = Chalk; + + return chalk.template; + } + + applyOptions(this, options); +} + +// Use bright blue on Windows as the normal blue color is illegible +if (isSimpleWindowsTerm) { + ansiStyles.blue.open = '\u001B[94m'; +} + +for (const key of Object.keys(ansiStyles)) { + ansiStyles[key].closeRe = new RegExp(escapeStringRegexp(ansiStyles[key].close), 'g'); + + styles[key] = { + get() { + const codes = ansiStyles[key]; + return build.call(this, this._styles ? this._styles.concat(codes) : [codes], this._empty, key); + } + }; +} + +styles.visible = { + get() { + return build.call(this, this._styles || [], true, 'visible'); + } +}; + +ansiStyles.color.closeRe = new RegExp(escapeStringRegexp(ansiStyles.color.close), 'g'); +for (const model of Object.keys(ansiStyles.color.ansi)) { + if (skipModels.has(model)) { + continue; + } + + styles[model] = { + get() { + const level = this.level; + return function () { + const open = ansiStyles.color[levelMapping[level]][model].apply(null, arguments); + const codes = { + open, + close: ansiStyles.color.close, + closeRe: ansiStyles.color.closeRe + }; + return build.call(this, this._styles ? this._styles.concat(codes) : [codes], this._empty, model); + }; + } + }; +} + +ansiStyles.bgColor.closeRe = new RegExp(escapeStringRegexp(ansiStyles.bgColor.close), 'g'); +for (const model of Object.keys(ansiStyles.bgColor.ansi)) { + if (skipModels.has(model)) { + continue; + } + + const bgModel = 'bg' + model[0].toUpperCase() + model.slice(1); + styles[bgModel] = { + get() { + const level = this.level; + return function () { + const open = ansiStyles.bgColor[levelMapping[level]][model].apply(null, arguments); + const codes = { + open, + close: ansiStyles.bgColor.close, + closeRe: ansiStyles.bgColor.closeRe + }; + return build.call(this, this._styles ? this._styles.concat(codes) : [codes], this._empty, model); + }; + } + }; +} + +const proto = Object.defineProperties(() => {}, styles); + +function build(_styles, _empty, key) { + const builder = function () { + return applyStyle.apply(builder, arguments); + }; + + builder._styles = _styles; + builder._empty = _empty; + + const self = this; + + Object.defineProperty(builder, 'level', { + enumerable: true, + get() { + return self.level; + }, + set(level) { + self.level = level; + } + }); + + Object.defineProperty(builder, 'enabled', { + enumerable: true, + get() { + return self.enabled; + }, + set(enabled) { + self.enabled = enabled; + } + }); + + // See below for fix regarding invisible grey/dim combination on Windows + builder.hasGrey = this.hasGrey || key === 'gray' || key === 'grey'; + + // `__proto__` is used because we must return a function, but there is + // no way to create a function with a different prototype + builder.__proto__ = proto; // eslint-disable-line no-proto + + return builder; +} + +function applyStyle() { + // Support varags, but simply cast to string in case there's only one arg + const args = arguments; + const argsLen = args.length; + let str = String(arguments[0]); + + if (argsLen === 0) { + return ''; + } + + if (argsLen > 1) { + // Don't slice `arguments`, it prevents V8 optimizations + for (let a = 1; a < argsLen; a++) { + str += ' ' + args[a]; + } + } + + if (!this.enabled || this.level <= 0 || !str) { + return this._empty ? '' : str; + } + + // Turns out that on Windows dimmed gray text becomes invisible in cmd.exe, + // see https://github.com/chalk/chalk/issues/58 + // If we're on Windows and we're dealing with a gray color, temporarily make 'dim' a noop. + const originalDim = ansiStyles.dim.open; + if (isSimpleWindowsTerm && this.hasGrey) { + ansiStyles.dim.open = ''; + } + + for (const code of this._styles.slice().reverse()) { + // Replace any instances already present with a re-opening code + // otherwise only the part of the string until said closing code + // will be colored, and the rest will simply be 'plain'. + str = code.open + str.replace(code.closeRe, code.open) + code.close; + + // Close the styling before a linebreak and reopen + // after next line to fix a bleed issue on macOS + // https://github.com/chalk/chalk/pull/92 + str = str.replace(/\r?\n/g, `${code.close}$&${code.open}`); + } + + // Reset the original `dim` if we changed it to work around the Windows dimmed gray issue + ansiStyles.dim.open = originalDim; + + return str; +} + +function chalkTag(chalk, strings) { + if (!Array.isArray(strings)) { + // If chalk() was called by itself or with a string, + // return the string itself as a string. + return [].slice.call(arguments, 1).join(' '); + } + + const args = [].slice.call(arguments, 2); + const parts = [strings.raw[0]]; + + for (let i = 1; i < strings.length; i++) { + parts.push(String(args[i - 1]).replace(/[{}\\]/g, '\\$&')); + parts.push(String(strings.raw[i])); + } + + return template(chalk, parts.join('')); +} + +Object.defineProperties(Chalk.prototype, styles); + +module.exports = Chalk(); // eslint-disable-line new-cap +module.exports.supportsColor = stdoutColor; +module.exports.default = module.exports; // For TypeScript + + +/***/ }), +/* 31 */ +/***/ (function(module, exports) { + +var core = module.exports = { version: '2.5.7' }; +if (typeof __e == 'number') __e = core; // eslint-disable-line no-undef + + +/***/ }), +/* 32 */ +/***/ (function(module, exports, __webpack_require__) { + +// Copyright 2015 Joyent, Inc. + +var Buffer = __webpack_require__(15).Buffer; + +var algInfo = { + 'dsa': { + parts: ['p', 'q', 'g', 'y'], + sizePart: 'p' + }, + 'rsa': { + parts: ['e', 'n'], + sizePart: 'n' + }, + 'ecdsa': { + parts: ['curve', 'Q'], + sizePart: 'Q' + }, + 'ed25519': { + parts: ['A'], + sizePart: 'A' + } +}; +algInfo['curve25519'] = algInfo['ed25519']; + +var algPrivInfo = { + 'dsa': { + parts: ['p', 'q', 'g', 'y', 'x'] + }, + 'rsa': { + parts: ['n', 'e', 'd', 'iqmp', 'p', 'q'] + }, + 'ecdsa': { + parts: ['curve', 'Q', 'd'] + }, + 'ed25519': { + parts: ['A', 'k'] + } +}; +algPrivInfo['curve25519'] = algPrivInfo['ed25519']; + +var hashAlgs = { + 'md5': true, + 'sha1': true, + 'sha256': true, + 'sha384': true, + 'sha512': true +}; + +/* + * Taken from + * http://csrc.nist.gov/groups/ST/toolkit/documents/dss/NISTReCur.pdf + */ +var curves = { + 'nistp256': { + size: 256, + pkcs8oid: '1.2.840.10045.3.1.7', + p: Buffer.from(('00' + + 'ffffffff 00000001 00000000 00000000' + + '00000000 ffffffff ffffffff ffffffff'). + replace(/ /g, ''), 'hex'), + a: Buffer.from(('00' + + 'FFFFFFFF 00000001 00000000 00000000' + + '00000000 FFFFFFFF FFFFFFFF FFFFFFFC'). + replace(/ /g, ''), 'hex'), + b: Buffer.from(( + '5ac635d8 aa3a93e7 b3ebbd55 769886bc' + + '651d06b0 cc53b0f6 3bce3c3e 27d2604b'). + replace(/ /g, ''), 'hex'), + s: Buffer.from(('00' + + 'c49d3608 86e70493 6a6678e1 139d26b7' + + '819f7e90'). + replace(/ /g, ''), 'hex'), + n: Buffer.from(('00' + + 'ffffffff 00000000 ffffffff ffffffff' + + 'bce6faad a7179e84 f3b9cac2 fc632551'). + replace(/ /g, ''), 'hex'), + G: Buffer.from(('04' + + '6b17d1f2 e12c4247 f8bce6e5 63a440f2' + + '77037d81 2deb33a0 f4a13945 d898c296' + + '4fe342e2 fe1a7f9b 8ee7eb4a 7c0f9e16' + + '2bce3357 6b315ece cbb64068 37bf51f5'). + replace(/ /g, ''), 'hex') + }, + 'nistp384': { + size: 384, + pkcs8oid: '1.3.132.0.34', + p: Buffer.from(('00' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff fffffffe' + + 'ffffffff 00000000 00000000 ffffffff'). + replace(/ /g, ''), 'hex'), + a: Buffer.from(('00' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFE' + + 'FFFFFFFF 00000000 00000000 FFFFFFFC'). + replace(/ /g, ''), 'hex'), + b: Buffer.from(( + 'b3312fa7 e23ee7e4 988e056b e3f82d19' + + '181d9c6e fe814112 0314088f 5013875a' + + 'c656398d 8a2ed19d 2a85c8ed d3ec2aef'). + replace(/ /g, ''), 'hex'), + s: Buffer.from(('00' + + 'a335926a a319a27a 1d00896a 6773a482' + + '7acdac73'). + replace(/ /g, ''), 'hex'), + n: Buffer.from(('00' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff c7634d81 f4372ddf' + + '581a0db2 48b0a77a ecec196a ccc52973'). + replace(/ /g, ''), 'hex'), + G: Buffer.from(('04' + + 'aa87ca22 be8b0537 8eb1c71e f320ad74' + + '6e1d3b62 8ba79b98 59f741e0 82542a38' + + '5502f25d bf55296c 3a545e38 72760ab7' + + '3617de4a 96262c6f 5d9e98bf 9292dc29' + + 'f8f41dbd 289a147c e9da3113 b5f0b8c0' + + '0a60b1ce 1d7e819d 7a431d7c 90ea0e5f'). + replace(/ /g, ''), 'hex') + }, + 'nistp521': { + size: 521, + pkcs8oid: '1.3.132.0.35', + p: Buffer.from(( + '01ffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffff').replace(/ /g, ''), 'hex'), + a: Buffer.from(('01FF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFC'). + replace(/ /g, ''), 'hex'), + b: Buffer.from(('51' + + '953eb961 8e1c9a1f 929a21a0 b68540ee' + + 'a2da725b 99b315f3 b8b48991 8ef109e1' + + '56193951 ec7e937b 1652c0bd 3bb1bf07' + + '3573df88 3d2c34f1 ef451fd4 6b503f00'). + replace(/ /g, ''), 'hex'), + s: Buffer.from(('00' + + 'd09e8800 291cb853 96cc6717 393284aa' + + 'a0da64ba').replace(/ /g, ''), 'hex'), + n: Buffer.from(('01ff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff fffffffa' + + '51868783 bf2f966b 7fcc0148 f709a5d0' + + '3bb5c9b8 899c47ae bb6fb71e 91386409'). + replace(/ /g, ''), 'hex'), + G: Buffer.from(('04' + + '00c6 858e06b7 0404e9cd 9e3ecb66 2395b442' + + '9c648139 053fb521 f828af60 6b4d3dba' + + 'a14b5e77 efe75928 fe1dc127 a2ffa8de' + + '3348b3c1 856a429b f97e7e31 c2e5bd66' + + '0118 39296a78 9a3bc004 5c8a5fb4 2c7d1bd9' + + '98f54449 579b4468 17afbd17 273e662c' + + '97ee7299 5ef42640 c550b901 3fad0761' + + '353c7086 a272c240 88be9476 9fd16650'). + replace(/ /g, ''), 'hex') + } +}; + +module.exports = { + info: algInfo, + privInfo: algPrivInfo, + hashAlgs: hashAlgs, + curves: curves +}; + + +/***/ }), +/* 33 */ +/***/ (function(module, exports, __webpack_require__) { + +// Copyright 2017 Joyent, Inc. + +module.exports = PrivateKey; + +var assert = __webpack_require__(16); +var Buffer = __webpack_require__(15).Buffer; +var algs = __webpack_require__(32); +var crypto = __webpack_require__(11); +var Fingerprint = __webpack_require__(156); +var Signature = __webpack_require__(75); +var errs = __webpack_require__(74); +var util = __webpack_require__(3); +var utils = __webpack_require__(26); +var dhe = __webpack_require__(325); +var generateECDSA = dhe.generateECDSA; +var generateED25519 = dhe.generateED25519; +var edCompat; +var nacl; + +try { + edCompat = __webpack_require__(454); +} catch (e) { + /* Just continue through, and bail out if we try to use it. */ +} + +var Key = __webpack_require__(27); + +var InvalidAlgorithmError = errs.InvalidAlgorithmError; +var KeyParseError = errs.KeyParseError; +var KeyEncryptedError = errs.KeyEncryptedError; + +var formats = {}; +formats['auto'] = __webpack_require__(455); +formats['pem'] = __webpack_require__(86); +formats['pkcs1'] = __webpack_require__(327); +formats['pkcs8'] = __webpack_require__(157); +formats['rfc4253'] = __webpack_require__(103); +formats['ssh-private'] = __webpack_require__(192); +formats['openssh'] = formats['ssh-private']; +formats['ssh'] = formats['ssh-private']; +formats['dnssec'] = __webpack_require__(326); + +function PrivateKey(opts) { + assert.object(opts, 'options'); + Key.call(this, opts); + + this._pubCache = undefined; +} +util.inherits(PrivateKey, Key); + +PrivateKey.formats = formats; + +PrivateKey.prototype.toBuffer = function (format, options) { + if (format === undefined) + format = 'pkcs1'; + assert.string(format, 'format'); + assert.object(formats[format], 'formats[format]'); + assert.optionalObject(options, 'options'); + + return (formats[format].write(this, options)); +}; + +PrivateKey.prototype.hash = function (algo) { + return (this.toPublic().hash(algo)); +}; + +PrivateKey.prototype.toPublic = function () { + if (this._pubCache) + return (this._pubCache); + + var algInfo = algs.info[this.type]; + var pubParts = []; + for (var i = 0; i < algInfo.parts.length; ++i) { + var p = algInfo.parts[i]; + pubParts.push(this.part[p]); + } + + this._pubCache = new Key({ + type: this.type, + source: this, + parts: pubParts + }); + if (this.comment) + this._pubCache.comment = this.comment; + return (this._pubCache); +}; + +PrivateKey.prototype.derive = function (newType) { + assert.string(newType, 'type'); + var priv, pub, pair; + + if (this.type === 'ed25519' && newType === 'curve25519') { + if (nacl === undefined) + nacl = __webpack_require__(76); + + priv = this.part.k.data; + if (priv[0] === 0x00) + priv = priv.slice(1); + + pair = nacl.box.keyPair.fromSecretKey(new Uint8Array(priv)); + pub = Buffer.from(pair.publicKey); + + return (new PrivateKey({ + type: 'curve25519', + parts: [ + { name: 'A', data: utils.mpNormalize(pub) }, + { name: 'k', data: utils.mpNormalize(priv) } + ] + })); + } else if (this.type === 'curve25519' && newType === 'ed25519') { + if (nacl === undefined) + nacl = __webpack_require__(76); + + priv = this.part.k.data; + if (priv[0] === 0x00) + priv = priv.slice(1); + + pair = nacl.sign.keyPair.fromSeed(new Uint8Array(priv)); + pub = Buffer.from(pair.publicKey); + + return (new PrivateKey({ + type: 'ed25519', + parts: [ + { name: 'A', data: utils.mpNormalize(pub) }, + { name: 'k', data: utils.mpNormalize(priv) } + ] + })); + } + throw (new Error('Key derivation not supported from ' + this.type + + ' to ' + newType)); +}; + +PrivateKey.prototype.createVerify = function (hashAlgo) { + return (this.toPublic().createVerify(hashAlgo)); +}; + +PrivateKey.prototype.createSign = function (hashAlgo) { + if (hashAlgo === undefined) + hashAlgo = this.defaultHashAlgorithm(); + assert.string(hashAlgo, 'hash algorithm'); + + /* ED25519 is not supported by OpenSSL, use a javascript impl. */ + if (this.type === 'ed25519' && edCompat !== undefined) + return (new edCompat.Signer(this, hashAlgo)); + if (this.type === 'curve25519') + throw (new Error('Curve25519 keys are not suitable for ' + + 'signing or verification')); + + var v, nm, err; + try { + nm = hashAlgo.toUpperCase(); + v = crypto.createSign(nm); + } catch (e) { + err = e; + } + if (v === undefined || (err instanceof Error && + err.message.match(/Unknown message digest/))) { + nm = 'RSA-'; + nm += hashAlgo.toUpperCase(); + v = crypto.createSign(nm); + } + assert.ok(v, 'failed to create verifier'); + var oldSign = v.sign.bind(v); + var key = this.toBuffer('pkcs1'); + var type = this.type; + var curve = this.curve; + v.sign = function () { + var sig = oldSign(key); + if (typeof (sig) === 'string') + sig = Buffer.from(sig, 'binary'); + sig = Signature.parse(sig, type, 'asn1'); + sig.hashAlgorithm = hashAlgo; + sig.curve = curve; + return (sig); + }; + return (v); +}; + +PrivateKey.parse = function (data, format, options) { + if (typeof (data) !== 'string') + assert.buffer(data, 'data'); + if (format === undefined) + format = 'auto'; + assert.string(format, 'format'); + if (typeof (options) === 'string') + options = { filename: options }; + assert.optionalObject(options, 'options'); + if (options === undefined) + options = {}; + assert.optionalString(options.filename, 'options.filename'); + if (options.filename === undefined) + options.filename = '(unnamed)'; + + assert.object(formats[format], 'formats[format]'); + + try { + var k = formats[format].read(data, options); + assert.ok(k instanceof PrivateKey, 'key is not a private key'); + if (!k.comment) + k.comment = options.filename; + return (k); + } catch (e) { + if (e.name === 'KeyEncryptedError') + throw (e); + throw (new KeyParseError(options.filename, format, e)); + } +}; + +PrivateKey.isPrivateKey = function (obj, ver) { + return (utils.isCompatible(obj, PrivateKey, ver)); +}; + +PrivateKey.generate = function (type, options) { + if (options === undefined) + options = {}; + assert.object(options, 'options'); + + switch (type) { + case 'ecdsa': + if (options.curve === undefined) + options.curve = 'nistp256'; + assert.string(options.curve, 'options.curve'); + return (generateECDSA(options.curve)); + case 'ed25519': + return (generateED25519()); + default: + throw (new Error('Key generation not supported with key ' + + 'type "' + type + '"')); + } +}; + +/* + * API versions for PrivateKey: + * [1,0] -- initial ver + * [1,1] -- added auto, pkcs[18], openssh/ssh-private formats + * [1,2] -- added defaultHashAlgorithm + * [1,3] -- added derive, ed, createDH + * [1,4] -- first tagged version + * [1,5] -- changed ed25519 part names and format + */ +PrivateKey.prototype._sshpkApiVersion = [1, 5]; + +PrivateKey._oldVersionDetect = function (obj) { + assert.func(obj.toPublic); + assert.func(obj.createSign); + if (obj.derive) + return ([1, 3]); + if (obj.defaultHashAlgorithm) + return ([1, 2]); + if (obj.formats['auto']) + return ([1, 1]); + return ([1, 0]); +}; + + +/***/ }), +/* 34 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.wrapLifecycle = exports.run = exports.install = exports.Install = undefined; + +var _extends2; + +function _load_extends() { + return _extends2 = _interopRequireDefault(__webpack_require__(21)); +} + +var _asyncToGenerator2; + +function _load_asyncToGenerator() { + return _asyncToGenerator2 = _interopRequireDefault(__webpack_require__(2)); +} + +let install = exports.install = (() => { + var _ref29 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (config, reporter, flags, lockfile) { + yield wrapLifecycle(config, flags, (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { + const install = new Install(flags, config, reporter, lockfile); + yield install.init(); + })); + }); + + return function install(_x7, _x8, _x9, _x10) { + return _ref29.apply(this, arguments); + }; +})(); + +let run = exports.run = (() => { + var _ref31 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (config, reporter, flags, args) { + let lockfile; + let error = 'installCommandRenamed'; + if (flags.lockfile === false) { + lockfile = new (_lockfile || _load_lockfile()).default(); + } else { + lockfile = yield (_lockfile || _load_lockfile()).default.fromDirectory(config.lockfileFolder, reporter); + } + + if (args.length) { + const exampleArgs = args.slice(); + + if (flags.saveDev) { + exampleArgs.push('--dev'); + } + if (flags.savePeer) { + exampleArgs.push('--peer'); + } + if (flags.saveOptional) { + exampleArgs.push('--optional'); + } + if (flags.saveExact) { + exampleArgs.push('--exact'); + } + if (flags.saveTilde) { + exampleArgs.push('--tilde'); + } + let command = 'add'; + if (flags.global) { + error = 'globalFlagRemoved'; + command = 'global add'; + } + throw new (_errors || _load_errors()).MessageError(reporter.lang(error, `yarn ${command} ${exampleArgs.join(' ')}`)); + } + + yield install(config, reporter, flags, lockfile); + }); + + return function run(_x11, _x12, _x13, _x14) { + return _ref31.apply(this, arguments); + }; +})(); + +let wrapLifecycle = exports.wrapLifecycle = (() => { + var _ref32 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (config, flags, factory) { + yield config.executeLifecycleScript('preinstall'); + + yield factory(); + + // npm behaviour, seems kinda funky but yay compatibility + yield config.executeLifecycleScript('install'); + yield config.executeLifecycleScript('postinstall'); + + if (!config.production) { + if (!config.disablePrepublish) { + yield config.executeLifecycleScript('prepublish'); + } + yield config.executeLifecycleScript('prepare'); + } + }); + + return function wrapLifecycle(_x15, _x16, _x17) { + return _ref32.apply(this, arguments); + }; +})(); + +exports.hasWrapper = hasWrapper; +exports.setFlags = setFlags; + +var _objectPath; + +function _load_objectPath() { + return _objectPath = _interopRequireDefault(__webpack_require__(304)); +} + +var _hooks; + +function _load_hooks() { + return _hooks = __webpack_require__(374); +} + +var _index; + +function _load_index() { + return _index = _interopRequireDefault(__webpack_require__(220)); +} + +var _errors; + +function _load_errors() { + return _errors = __webpack_require__(6); +} + +var _integrityChecker; + +function _load_integrityChecker() { + return _integrityChecker = _interopRequireDefault(__webpack_require__(208)); +} + +var _lockfile; + +function _load_lockfile() { + return _lockfile = _interopRequireDefault(__webpack_require__(19)); +} + +var _lockfile2; + +function _load_lockfile2() { + return _lockfile2 = __webpack_require__(19); +} + +var _packageFetcher; + +function _load_packageFetcher() { + return _packageFetcher = _interopRequireWildcard(__webpack_require__(210)); +} + +var _packageInstallScripts; + +function _load_packageInstallScripts() { + return _packageInstallScripts = _interopRequireDefault(__webpack_require__(557)); +} + +var _packageCompatibility; + +function _load_packageCompatibility() { + return _packageCompatibility = _interopRequireWildcard(__webpack_require__(209)); +} + +var _packageResolver; + +function _load_packageResolver() { + return _packageResolver = _interopRequireDefault(__webpack_require__(366)); +} + +var _packageLinker; + +function _load_packageLinker() { + return _packageLinker = _interopRequireDefault(__webpack_require__(211)); +} + +var _index2; + +function _load_index2() { + return _index2 = __webpack_require__(57); +} + +var _index3; + +function _load_index3() { + return _index3 = __webpack_require__(78); +} + +var _autoclean; + +function _load_autoclean() { + return _autoclean = __webpack_require__(354); +} + +var _constants; + +function _load_constants() { + return _constants = _interopRequireWildcard(__webpack_require__(8)); +} + +var _normalizePattern; + +function _load_normalizePattern() { + return _normalizePattern = __webpack_require__(37); +} + +var _fs; + +function _load_fs() { + return _fs = _interopRequireWildcard(__webpack_require__(4)); +} + +var _map; + +function _load_map() { + return _map = _interopRequireDefault(__webpack_require__(29)); +} + +var _yarnVersion; + +function _load_yarnVersion() { + return _yarnVersion = __webpack_require__(120); +} + +var _generatePnpMap; + +function _load_generatePnpMap() { + return _generatePnpMap = __webpack_require__(579); +} + +var _workspaceLayout; + +function _load_workspaceLayout() { + return _workspaceLayout = _interopRequireDefault(__webpack_require__(90)); +} + +var _resolutionMap; + +function _load_resolutionMap() { + return _resolutionMap = _interopRequireDefault(__webpack_require__(214)); +} + +var _guessName; + +function _load_guessName() { + return _guessName = _interopRequireDefault(__webpack_require__(169)); +} + +var _audit; + +function _load_audit() { + return _audit = _interopRequireDefault(__webpack_require__(353)); +} + +function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +const deepEqual = __webpack_require__(631); + +const emoji = __webpack_require__(302); +const invariant = __webpack_require__(9); +const path = __webpack_require__(0); +const semver = __webpack_require__(22); +const uuid = __webpack_require__(119); +const ssri = __webpack_require__(65); + +const ONE_DAY = 1000 * 60 * 60 * 24; + +/** + * Try and detect the installation method for Yarn and provide a command to update it with. + */ + +function getUpdateCommand(installationMethod) { + if (installationMethod === 'tar') { + return `curl --compressed -o- -L ${(_constants || _load_constants()).YARN_INSTALLER_SH} | bash`; + } + + if (installationMethod === 'homebrew') { + return 'brew upgrade yarn'; + } + + if (installationMethod === 'deb') { + return 'sudo apt-get update && sudo apt-get install yarn'; + } + + if (installationMethod === 'rpm') { + return 'sudo yum install yarn'; + } + + if (installationMethod === 'npm') { + return 'npm install --global yarn'; + } + + if (installationMethod === 'chocolatey') { + return 'choco upgrade yarn'; + } + + if (installationMethod === 'apk') { + return 'apk update && apk add -u yarn'; + } + + if (installationMethod === 'portage') { + return 'sudo emerge --sync && sudo emerge -au sys-apps/yarn'; + } + + return null; +} + +function getUpdateInstaller(installationMethod) { + // Windows + if (installationMethod === 'msi') { + return (_constants || _load_constants()).YARN_INSTALLER_MSI; + } + + return null; +} + +function normalizeFlags(config, rawFlags) { + const flags = { + // install + har: !!rawFlags.har, + ignorePlatform: !!rawFlags.ignorePlatform, + ignoreEngines: !!rawFlags.ignoreEngines, + ignoreScripts: !!rawFlags.ignoreScripts, + ignoreOptional: !!rawFlags.ignoreOptional, + force: !!rawFlags.force, + flat: !!rawFlags.flat, + lockfile: rawFlags.lockfile !== false, + pureLockfile: !!rawFlags.pureLockfile, + updateChecksums: !!rawFlags.updateChecksums, + skipIntegrityCheck: !!rawFlags.skipIntegrityCheck, + frozenLockfile: !!rawFlags.frozenLockfile, + linkDuplicates: !!rawFlags.linkDuplicates, + checkFiles: !!rawFlags.checkFiles, + audit: !!rawFlags.audit, + + // add + peer: !!rawFlags.peer, + dev: !!rawFlags.dev, + optional: !!rawFlags.optional, + exact: !!rawFlags.exact, + tilde: !!rawFlags.tilde, + ignoreWorkspaceRootCheck: !!rawFlags.ignoreWorkspaceRootCheck, + + // outdated, update-interactive + includeWorkspaceDeps: !!rawFlags.includeWorkspaceDeps, + + // add, remove, update + workspaceRootIsCwd: rawFlags.workspaceRootIsCwd !== false + }; + + if (config.getOption('ignore-scripts')) { + flags.ignoreScripts = true; + } + + if (config.getOption('ignore-platform')) { + flags.ignorePlatform = true; + } + + if (config.getOption('ignore-engines')) { + flags.ignoreEngines = true; + } + + if (config.getOption('ignore-optional')) { + flags.ignoreOptional = true; + } + + if (config.getOption('force')) { + flags.force = true; + } + + return flags; +} + +class Install { + constructor(flags, config, reporter, lockfile) { + this.rootManifestRegistries = []; + this.rootPatternsToOrigin = (0, (_map || _load_map()).default)(); + this.lockfile = lockfile; + this.reporter = reporter; + this.config = config; + this.flags = normalizeFlags(config, flags); + this.resolutions = (0, (_map || _load_map()).default)(); // Legacy resolutions field used for flat install mode + this.resolutionMap = new (_resolutionMap || _load_resolutionMap()).default(config); // Selective resolutions for nested dependencies + this.resolver = new (_packageResolver || _load_packageResolver()).default(config, lockfile, this.resolutionMap); + this.integrityChecker = new (_integrityChecker || _load_integrityChecker()).default(config); + this.linker = new (_packageLinker || _load_packageLinker()).default(config, this.resolver); + this.scripts = new (_packageInstallScripts || _load_packageInstallScripts()).default(config, this.resolver, this.flags.force); + } + + /** + * Create a list of dependency requests from the current directories manifests. + */ + + fetchRequestFromCwd(excludePatterns = [], ignoreUnusedPatterns = false) { + var _this = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { + const patterns = []; + const deps = []; + let resolutionDeps = []; + const manifest = {}; + + const ignorePatterns = []; + const usedPatterns = []; + let workspaceLayout; + + // some commands should always run in the context of the entire workspace + const cwd = _this.flags.includeWorkspaceDeps || _this.flags.workspaceRootIsCwd ? _this.config.lockfileFolder : _this.config.cwd; + + // non-workspaces are always root, otherwise check for workspace root + const cwdIsRoot = !_this.config.workspaceRootFolder || _this.config.lockfileFolder === cwd; + + // exclude package names that are in install args + const excludeNames = []; + for (var _iterator = excludePatterns, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) { + var _ref; + + if (_isArray) { + if (_i >= _iterator.length) break; + _ref = _iterator[_i++]; + } else { + _i = _iterator.next(); + if (_i.done) break; + _ref = _i.value; + } + + const pattern = _ref; + + if ((0, (_index3 || _load_index3()).getExoticResolver)(pattern)) { + excludeNames.push((0, (_guessName || _load_guessName()).default)(pattern)); + } else { + // extract the name + const parts = (0, (_normalizePattern || _load_normalizePattern()).normalizePattern)(pattern); + excludeNames.push(parts.name); + } + } + + const stripExcluded = function stripExcluded(manifest) { + for (var _iterator2 = excludeNames, _isArray2 = Array.isArray(_iterator2), _i2 = 0, _iterator2 = _isArray2 ? _iterator2 : _iterator2[Symbol.iterator]();;) { + var _ref2; + + if (_isArray2) { + if (_i2 >= _iterator2.length) break; + _ref2 = _iterator2[_i2++]; + } else { + _i2 = _iterator2.next(); + if (_i2.done) break; + _ref2 = _i2.value; + } + + const exclude = _ref2; + + if (manifest.dependencies && manifest.dependencies[exclude]) { + delete manifest.dependencies[exclude]; + } + if (manifest.devDependencies && manifest.devDependencies[exclude]) { + delete manifest.devDependencies[exclude]; + } + if (manifest.optionalDependencies && manifest.optionalDependencies[exclude]) { + delete manifest.optionalDependencies[exclude]; + } + } + }; + + for (var _iterator3 = Object.keys((_index2 || _load_index2()).registries), _isArray3 = Array.isArray(_iterator3), _i3 = 0, _iterator3 = _isArray3 ? _iterator3 : _iterator3[Symbol.iterator]();;) { + var _ref3; + + if (_isArray3) { + if (_i3 >= _iterator3.length) break; + _ref3 = _iterator3[_i3++]; + } else { + _i3 = _iterator3.next(); + if (_i3.done) break; + _ref3 = _i3.value; + } + + const registry = _ref3; + + const filename = (_index2 || _load_index2()).registries[registry].filename; + + const loc = path.join(cwd, filename); + if (!(yield (_fs || _load_fs()).exists(loc))) { + continue; + } + + _this.rootManifestRegistries.push(registry); + + const projectManifestJson = yield _this.config.readJson(loc); + yield (0, (_index || _load_index()).default)(projectManifestJson, cwd, _this.config, cwdIsRoot); + + Object.assign(_this.resolutions, projectManifestJson.resolutions); + Object.assign(manifest, projectManifestJson); + + _this.resolutionMap.init(_this.resolutions); + for (var _iterator4 = Object.keys(_this.resolutionMap.resolutionsByPackage), _isArray4 = Array.isArray(_iterator4), _i4 = 0, _iterator4 = _isArray4 ? _iterator4 : _iterator4[Symbol.iterator]();;) { + var _ref4; + + if (_isArray4) { + if (_i4 >= _iterator4.length) break; + _ref4 = _iterator4[_i4++]; + } else { + _i4 = _iterator4.next(); + if (_i4.done) break; + _ref4 = _i4.value; + } + + const packageName = _ref4; + + const optional = (_objectPath || _load_objectPath()).default.has(manifest.optionalDependencies, packageName) && _this.flags.ignoreOptional; + for (var _iterator8 = _this.resolutionMap.resolutionsByPackage[packageName], _isArray8 = Array.isArray(_iterator8), _i8 = 0, _iterator8 = _isArray8 ? _iterator8 : _iterator8[Symbol.iterator]();;) { + var _ref9; + + if (_isArray8) { + if (_i8 >= _iterator8.length) break; + _ref9 = _iterator8[_i8++]; + } else { + _i8 = _iterator8.next(); + if (_i8.done) break; + _ref9 = _i8.value; + } + + const _ref8 = _ref9; + const pattern = _ref8.pattern; + + resolutionDeps = [...resolutionDeps, { registry, pattern, optional, hint: 'resolution' }]; + } + } + + const pushDeps = function pushDeps(depType, manifest, { hint, optional }, isUsed) { + if (ignoreUnusedPatterns && !isUsed) { + return; + } + // We only take unused dependencies into consideration to get deterministic hoisting. + // Since flat mode doesn't care about hoisting and everything is top level and specified then we can safely + // leave these out. + if (_this.flags.flat && !isUsed) { + return; + } + const depMap = manifest[depType]; + for (const name in depMap) { + if (excludeNames.indexOf(name) >= 0) { + continue; + } + + let pattern = name; + if (!_this.lockfile.getLocked(pattern)) { + // when we use --save we save the dependency to the lockfile with just the name rather than the + // version combo + pattern += '@' + depMap[name]; + } + + // normalization made sure packages are mentioned only once + if (isUsed) { + usedPatterns.push(pattern); + } else { + ignorePatterns.push(pattern); + } + + _this.rootPatternsToOrigin[pattern] = depType; + patterns.push(pattern); + deps.push({ pattern, registry, hint, optional, workspaceName: manifest.name, workspaceLoc: manifest._loc }); + } + }; + + if (cwdIsRoot) { + pushDeps('dependencies', projectManifestJson, { hint: null, optional: false }, true); + pushDeps('devDependencies', projectManifestJson, { hint: 'dev', optional: false }, !_this.config.production); + pushDeps('optionalDependencies', projectManifestJson, { hint: 'optional', optional: true }, true); + } + + if (_this.config.workspaceRootFolder) { + const workspaceLoc = cwdIsRoot ? loc : path.join(_this.config.lockfileFolder, filename); + const workspacesRoot = path.dirname(workspaceLoc); + + let workspaceManifestJson = projectManifestJson; + if (!cwdIsRoot) { + // the manifest we read before was a child workspace, so get the root + workspaceManifestJson = yield _this.config.readJson(workspaceLoc); + yield (0, (_index || _load_index()).default)(workspaceManifestJson, workspacesRoot, _this.config, true); + } + + const workspaces = yield _this.config.resolveWorkspaces(workspacesRoot, workspaceManifestJson); + workspaceLayout = new (_workspaceLayout || _load_workspaceLayout()).default(workspaces, _this.config); + + // add virtual manifest that depends on all workspaces, this way package hoisters and resolvers will work fine + const workspaceDependencies = (0, (_extends2 || _load_extends()).default)({}, workspaceManifestJson.dependencies); + for (var _iterator5 = Object.keys(workspaces), _isArray5 = Array.isArray(_iterator5), _i5 = 0, _iterator5 = _isArray5 ? _iterator5 : _iterator5[Symbol.iterator]();;) { + var _ref5; + + if (_isArray5) { + if (_i5 >= _iterator5.length) break; + _ref5 = _iterator5[_i5++]; + } else { + _i5 = _iterator5.next(); + if (_i5.done) break; + _ref5 = _i5.value; + } + + const workspaceName = _ref5; + + const workspaceManifest = workspaces[workspaceName].manifest; + workspaceDependencies[workspaceName] = workspaceManifest.version; + + // include dependencies from all workspaces + if (_this.flags.includeWorkspaceDeps) { + pushDeps('dependencies', workspaceManifest, { hint: null, optional: false }, true); + pushDeps('devDependencies', workspaceManifest, { hint: 'dev', optional: false }, !_this.config.production); + pushDeps('optionalDependencies', workspaceManifest, { hint: 'optional', optional: true }, true); + } + } + const virtualDependencyManifest = { + _uid: '', + name: `workspace-aggregator-${uuid.v4()}`, + version: '1.0.0', + _registry: 'npm', + _loc: workspacesRoot, + dependencies: workspaceDependencies, + devDependencies: (0, (_extends2 || _load_extends()).default)({}, workspaceManifestJson.devDependencies), + optionalDependencies: (0, (_extends2 || _load_extends()).default)({}, workspaceManifestJson.optionalDependencies), + private: workspaceManifestJson.private, + workspaces: workspaceManifestJson.workspaces + }; + workspaceLayout.virtualManifestName = virtualDependencyManifest.name; + const virtualDep = {}; + virtualDep[virtualDependencyManifest.name] = virtualDependencyManifest.version; + workspaces[virtualDependencyManifest.name] = { loc: workspacesRoot, manifest: virtualDependencyManifest }; + + // ensure dependencies that should be excluded are stripped from the correct manifest + stripExcluded(cwdIsRoot ? virtualDependencyManifest : workspaces[projectManifestJson.name].manifest); + + pushDeps('workspaces', { workspaces: virtualDep }, { hint: 'workspaces', optional: false }, true); + + const implicitWorkspaceDependencies = (0, (_extends2 || _load_extends()).default)({}, workspaceDependencies); + + for (var _iterator6 = (_constants || _load_constants()).OWNED_DEPENDENCY_TYPES, _isArray6 = Array.isArray(_iterator6), _i6 = 0, _iterator6 = _isArray6 ? _iterator6 : _iterator6[Symbol.iterator]();;) { + var _ref6; + + if (_isArray6) { + if (_i6 >= _iterator6.length) break; + _ref6 = _iterator6[_i6++]; + } else { + _i6 = _iterator6.next(); + if (_i6.done) break; + _ref6 = _i6.value; + } + + const type = _ref6; + + for (var _iterator7 = Object.keys(projectManifestJson[type] || {}), _isArray7 = Array.isArray(_iterator7), _i7 = 0, _iterator7 = _isArray7 ? _iterator7 : _iterator7[Symbol.iterator]();;) { + var _ref7; + + if (_isArray7) { + if (_i7 >= _iterator7.length) break; + _ref7 = _iterator7[_i7++]; + } else { + _i7 = _iterator7.next(); + if (_i7.done) break; + _ref7 = _i7.value; + } + + const dependencyName = _ref7; + + delete implicitWorkspaceDependencies[dependencyName]; + } + } + + pushDeps('dependencies', { dependencies: implicitWorkspaceDependencies }, { hint: 'workspaces', optional: false }, true); + } + + break; + } + + // inherit root flat flag + if (manifest.flat) { + _this.flags.flat = true; + } + + return { + requests: [...resolutionDeps, ...deps], + patterns, + manifest, + usedPatterns, + ignorePatterns, + workspaceLayout + }; + })(); + } + + /** + * TODO description + */ + + prepareRequests(requests) { + return requests; + } + + preparePatterns(patterns) { + return patterns; + } + preparePatternsForLinking(patterns, cwdManifest, cwdIsRoot) { + return patterns; + } + + prepareManifests() { + var _this2 = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { + const manifests = yield _this2.config.getRootManifests(); + return manifests; + })(); + } + + bailout(patterns, workspaceLayout) { + var _this3 = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { + // We don't want to skip the audit - it could yield important errors + if (_this3.flags.audit) { + return false; + } + // PNP is so fast that the integrity check isn't pertinent + if (_this3.config.plugnplayEnabled) { + return false; + } + if (_this3.flags.skipIntegrityCheck || _this3.flags.force) { + return false; + } + const lockfileCache = _this3.lockfile.cache; + if (!lockfileCache) { + return false; + } + const lockfileClean = _this3.lockfile.parseResultType === 'success'; + const match = yield _this3.integrityChecker.check(patterns, lockfileCache, _this3.flags, workspaceLayout); + if (_this3.flags.frozenLockfile && (!lockfileClean || match.missingPatterns.length > 0)) { + throw new (_errors || _load_errors()).MessageError(_this3.reporter.lang('frozenLockfileError')); + } + + const haveLockfile = yield (_fs || _load_fs()).exists(path.join(_this3.config.lockfileFolder, (_constants || _load_constants()).LOCKFILE_FILENAME)); + + const lockfileIntegrityPresent = !_this3.lockfile.hasEntriesExistWithoutIntegrity(); + const integrityBailout = lockfileIntegrityPresent || !_this3.config.autoAddIntegrity; + + if (match.integrityMatches && haveLockfile && lockfileClean && integrityBailout) { + _this3.reporter.success(_this3.reporter.lang('upToDate')); + return true; + } + + if (match.integrityFileMissing && haveLockfile) { + // Integrity file missing, force script installations + _this3.scripts.setForce(true); + return false; + } + + if (match.hardRefreshRequired) { + // e.g. node version doesn't match, force script installations + _this3.scripts.setForce(true); + return false; + } + + if (!patterns.length && !match.integrityFileMissing) { + _this3.reporter.success(_this3.reporter.lang('nothingToInstall')); + yield _this3.createEmptyManifestFolders(); + yield _this3.saveLockfileAndIntegrity(patterns, workspaceLayout); + return true; + } + + return false; + })(); + } + + /** + * Produce empty folders for all used root manifests. + */ + + createEmptyManifestFolders() { + var _this4 = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { + if (_this4.config.modulesFolder) { + // already created + return; + } + + for (var _iterator9 = _this4.rootManifestRegistries, _isArray9 = Array.isArray(_iterator9), _i9 = 0, _iterator9 = _isArray9 ? _iterator9 : _iterator9[Symbol.iterator]();;) { + var _ref10; + + if (_isArray9) { + if (_i9 >= _iterator9.length) break; + _ref10 = _iterator9[_i9++]; + } else { + _i9 = _iterator9.next(); + if (_i9.done) break; + _ref10 = _i9.value; + } + + const registryName = _ref10; + const folder = _this4.config.registries[registryName].folder; + + yield (_fs || _load_fs()).mkdirp(path.join(_this4.config.lockfileFolder, folder)); + } + })(); + } + + /** + * TODO description + */ + + markIgnored(patterns) { + for (var _iterator10 = patterns, _isArray10 = Array.isArray(_iterator10), _i10 = 0, _iterator10 = _isArray10 ? _iterator10 : _iterator10[Symbol.iterator]();;) { + var _ref11; + + if (_isArray10) { + if (_i10 >= _iterator10.length) break; + _ref11 = _iterator10[_i10++]; + } else { + _i10 = _iterator10.next(); + if (_i10.done) break; + _ref11 = _i10.value; + } + + const pattern = _ref11; + + const manifest = this.resolver.getStrictResolvedPattern(pattern); + const ref = manifest._reference; + invariant(ref, 'expected package reference'); + + // just mark the package as ignored. if the package is used by a required package, the hoister + // will take care of that. + ref.ignore = true; + } + } + + /** + * helper method that gets only recent manifests + * used by global.ls command + */ + getFlattenedDeps() { + var _this5 = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { + var _ref12 = yield _this5.fetchRequestFromCwd(); + + const depRequests = _ref12.requests, + rawPatterns = _ref12.patterns; + + + yield _this5.resolver.init(depRequests, {}); + + const manifests = yield (_packageFetcher || _load_packageFetcher()).fetch(_this5.resolver.getManifests(), _this5.config); + _this5.resolver.updateManifests(manifests); + + return _this5.flatten(rawPatterns); + })(); + } + + /** + * TODO description + */ + + init() { + var _this6 = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { + _this6.checkUpdate(); + + // warn if we have a shrinkwrap + if (yield (_fs || _load_fs()).exists(path.join(_this6.config.lockfileFolder, (_constants || _load_constants()).NPM_SHRINKWRAP_FILENAME))) { + _this6.reporter.warn(_this6.reporter.lang('shrinkwrapWarning')); + } + + // warn if we have an npm lockfile + if (yield (_fs || _load_fs()).exists(path.join(_this6.config.lockfileFolder, (_constants || _load_constants()).NPM_LOCK_FILENAME))) { + _this6.reporter.warn(_this6.reporter.lang('npmLockfileWarning')); + } + + if (_this6.config.plugnplayEnabled) { + _this6.reporter.info(_this6.reporter.lang('plugnplaySuggestV2L1')); + _this6.reporter.info(_this6.reporter.lang('plugnplaySuggestV2L2')); + } + + let flattenedTopLevelPatterns = []; + const steps = []; + + var _ref13 = yield _this6.fetchRequestFromCwd(); + + const depRequests = _ref13.requests, + rawPatterns = _ref13.patterns, + ignorePatterns = _ref13.ignorePatterns, + workspaceLayout = _ref13.workspaceLayout, + manifest = _ref13.manifest; + + let topLevelPatterns = []; + + const artifacts = yield _this6.integrityChecker.getArtifacts(); + if (artifacts) { + _this6.linker.setArtifacts(artifacts); + _this6.scripts.setArtifacts(artifacts); + } + + if ((_packageCompatibility || _load_packageCompatibility()).shouldCheck(manifest, _this6.flags)) { + steps.push((() => { + var _ref14 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (curr, total) { + _this6.reporter.step(curr, total, _this6.reporter.lang('checkingManifest'), emoji.get('mag')); + yield _this6.checkCompatibility(); + }); + + return function (_x, _x2) { + return _ref14.apply(this, arguments); + }; + })()); + } + + const audit = new (_audit || _load_audit()).default(_this6.config, _this6.reporter, { groups: (_constants || _load_constants()).OWNED_DEPENDENCY_TYPES }); + let auditFoundProblems = false; + + steps.push(function (curr, total) { + return (0, (_hooks || _load_hooks()).callThroughHook)('resolveStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { + _this6.reporter.step(curr, total, _this6.reporter.lang('resolvingPackages'), emoji.get('mag')); + yield _this6.resolver.init(_this6.prepareRequests(depRequests), { + isFlat: _this6.flags.flat, + isFrozen: _this6.flags.frozenLockfile, + workspaceLayout + }); + topLevelPatterns = _this6.preparePatterns(rawPatterns); + flattenedTopLevelPatterns = yield _this6.flatten(topLevelPatterns); + return { bailout: !_this6.flags.audit && (yield _this6.bailout(topLevelPatterns, workspaceLayout)) }; + })); + }); + + if (_this6.flags.audit) { + steps.push(function (curr, total) { + return (0, (_hooks || _load_hooks()).callThroughHook)('auditStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { + _this6.reporter.step(curr, total, _this6.reporter.lang('auditRunning'), emoji.get('mag')); + if (_this6.flags.offline) { + _this6.reporter.warn(_this6.reporter.lang('auditOffline')); + return { bailout: false }; + } + const preparedManifests = yield _this6.prepareManifests(); + // $FlowFixMe - Flow considers `m` in the map operation to be "mixed", so does not recognize `m.object` + const mergedManifest = Object.assign({}, ...Object.values(preparedManifests).map(function (m) { + return m.object; + })); + const auditVulnerabilityCounts = yield audit.performAudit(mergedManifest, _this6.lockfile, _this6.resolver, _this6.linker, topLevelPatterns); + auditFoundProblems = auditVulnerabilityCounts.info || auditVulnerabilityCounts.low || auditVulnerabilityCounts.moderate || auditVulnerabilityCounts.high || auditVulnerabilityCounts.critical; + return { bailout: yield _this6.bailout(topLevelPatterns, workspaceLayout) }; + })); + }); + } + + steps.push(function (curr, total) { + return (0, (_hooks || _load_hooks()).callThroughHook)('fetchStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { + _this6.markIgnored(ignorePatterns); + _this6.reporter.step(curr, total, _this6.reporter.lang('fetchingPackages'), emoji.get('truck')); + const manifests = yield (_packageFetcher || _load_packageFetcher()).fetch(_this6.resolver.getManifests(), _this6.config); + _this6.resolver.updateManifests(manifests); + yield (_packageCompatibility || _load_packageCompatibility()).check(_this6.resolver.getManifests(), _this6.config, _this6.flags.ignoreEngines); + })); + }); + + steps.push(function (curr, total) { + return (0, (_hooks || _load_hooks()).callThroughHook)('linkStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { + // remove integrity hash to make this operation atomic + yield _this6.integrityChecker.removeIntegrityFile(); + _this6.reporter.step(curr, total, _this6.reporter.lang('linkingDependencies'), emoji.get('link')); + flattenedTopLevelPatterns = _this6.preparePatternsForLinking(flattenedTopLevelPatterns, manifest, _this6.config.lockfileFolder === _this6.config.cwd); + yield _this6.linker.init(flattenedTopLevelPatterns, workspaceLayout, { + linkDuplicates: _this6.flags.linkDuplicates, + ignoreOptional: _this6.flags.ignoreOptional + }); + })); + }); + + if (_this6.config.plugnplayEnabled) { + steps.push(function (curr, total) { + return (0, (_hooks || _load_hooks()).callThroughHook)('pnpStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { + const pnpPath = `${_this6.config.lockfileFolder}/${(_constants || _load_constants()).PNP_FILENAME}`; + + const code = yield (0, (_generatePnpMap || _load_generatePnpMap()).generatePnpMap)(_this6.config, flattenedTopLevelPatterns, { + resolver: _this6.resolver, + reporter: _this6.reporter, + targetPath: pnpPath, + workspaceLayout + }); + + try { + const file = yield (_fs || _load_fs()).readFile(pnpPath); + if (file === code) { + return; + } + } catch (error) {} + + yield (_fs || _load_fs()).writeFile(pnpPath, code); + yield (_fs || _load_fs()).chmod(pnpPath, 0o755); + })); + }); + } + + steps.push(function (curr, total) { + return (0, (_hooks || _load_hooks()).callThroughHook)('buildStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { + _this6.reporter.step(curr, total, _this6.flags.force ? _this6.reporter.lang('rebuildingPackages') : _this6.reporter.lang('buildingFreshPackages'), emoji.get('hammer')); + + if (_this6.config.ignoreScripts) { + _this6.reporter.warn(_this6.reporter.lang('ignoredScripts')); + } else { + yield _this6.scripts.init(flattenedTopLevelPatterns); + } + })); + }); + + if (_this6.flags.har) { + steps.push((() => { + var _ref21 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (curr, total) { + const formattedDate = new Date().toISOString().replace(/:/g, '-'); + const filename = `yarn-install_${formattedDate}.har`; + _this6.reporter.step(curr, total, _this6.reporter.lang('savingHar', filename), emoji.get('black_circle_for_record')); + yield _this6.config.requestManager.saveHar(filename); + }); + + return function (_x3, _x4) { + return _ref21.apply(this, arguments); + }; + })()); + } + + if (yield _this6.shouldClean()) { + steps.push((() => { + var _ref22 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (curr, total) { + _this6.reporter.step(curr, total, _this6.reporter.lang('cleaningModules'), emoji.get('recycle')); + yield (0, (_autoclean || _load_autoclean()).clean)(_this6.config, _this6.reporter); + }); + + return function (_x5, _x6) { + return _ref22.apply(this, arguments); + }; + })()); + } + + let currentStep = 0; + for (var _iterator11 = steps, _isArray11 = Array.isArray(_iterator11), _i11 = 0, _iterator11 = _isArray11 ? _iterator11 : _iterator11[Symbol.iterator]();;) { + var _ref23; + + if (_isArray11) { + if (_i11 >= _iterator11.length) break; + _ref23 = _iterator11[_i11++]; + } else { + _i11 = _iterator11.next(); + if (_i11.done) break; + _ref23 = _i11.value; + } + + const step = _ref23; + + const stepResult = yield step(++currentStep, steps.length); + if (stepResult && stepResult.bailout) { + if (_this6.flags.audit) { + audit.summary(); + } + if (auditFoundProblems) { + _this6.reporter.warn(_this6.reporter.lang('auditRunAuditForDetails')); + } + _this6.maybeOutputUpdate(); + return flattenedTopLevelPatterns; + } + } + + // fin! + if (_this6.flags.audit) { + audit.summary(); + } + if (auditFoundProblems) { + _this6.reporter.warn(_this6.reporter.lang('auditRunAuditForDetails')); + } + yield _this6.saveLockfileAndIntegrity(topLevelPatterns, workspaceLayout); + yield _this6.persistChanges(); + _this6.maybeOutputUpdate(); + _this6.config.requestManager.clearCache(); + return flattenedTopLevelPatterns; + })(); + } + + checkCompatibility() { + var _this7 = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { + var _ref24 = yield _this7.fetchRequestFromCwd(); + + const manifest = _ref24.manifest; + + yield (_packageCompatibility || _load_packageCompatibility()).checkOne(manifest, _this7.config, _this7.flags.ignoreEngines); + })(); + } + + persistChanges() { + var _this8 = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { + // get all the different registry manifests in this folder + const manifests = yield _this8.config.getRootManifests(); + + if (yield _this8.applyChanges(manifests)) { + yield _this8.config.saveRootManifests(manifests); + } + })(); + } + + applyChanges(manifests) { + let hasChanged = false; + + if (this.config.plugnplayPersist) { + const object = manifests.npm.object; + + + if (typeof object.installConfig !== 'object') { + object.installConfig = {}; + } + + if (this.config.plugnplayEnabled && object.installConfig.pnp !== true) { + object.installConfig.pnp = true; + hasChanged = true; + } else if (!this.config.plugnplayEnabled && typeof object.installConfig.pnp !== 'undefined') { + delete object.installConfig.pnp; + hasChanged = true; + } + + if (Object.keys(object.installConfig).length === 0) { + delete object.installConfig; + } + } + + return Promise.resolve(hasChanged); + } + + /** + * Check if we should run the cleaning step. + */ + + shouldClean() { + return (_fs || _load_fs()).exists(path.join(this.config.lockfileFolder, (_constants || _load_constants()).CLEAN_FILENAME)); + } + + /** + * TODO + */ + + flatten(patterns) { + var _this9 = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { + if (!_this9.flags.flat) { + return patterns; + } + + const flattenedPatterns = []; + + for (var _iterator12 = _this9.resolver.getAllDependencyNamesByLevelOrder(patterns), _isArray12 = Array.isArray(_iterator12), _i12 = 0, _iterator12 = _isArray12 ? _iterator12 : _iterator12[Symbol.iterator]();;) { + var _ref25; + + if (_isArray12) { + if (_i12 >= _iterator12.length) break; + _ref25 = _iterator12[_i12++]; + } else { + _i12 = _iterator12.next(); + if (_i12.done) break; + _ref25 = _i12.value; + } + + const name = _ref25; + + const infos = _this9.resolver.getAllInfoForPackageName(name).filter(function (manifest) { + const ref = manifest._reference; + invariant(ref, 'expected package reference'); + return !ref.ignore; + }); + + if (infos.length === 0) { + continue; + } + + if (infos.length === 1) { + // single version of this package + // take out a single pattern as multiple patterns may have resolved to this package + flattenedPatterns.push(_this9.resolver.patternsByPackage[name][0]); + continue; + } + + const options = infos.map(function (info) { + const ref = info._reference; + invariant(ref, 'expected reference'); + return { + // TODO `and is required by {PARENT}`, + name: _this9.reporter.lang('manualVersionResolutionOption', ref.patterns.join(', '), info.version), + + value: info.version + }; + }); + const versions = infos.map(function (info) { + return info.version; + }); + let version; + + const resolutionVersion = _this9.resolutions[name]; + if (resolutionVersion && versions.indexOf(resolutionVersion) >= 0) { + // use json `resolution` version + version = resolutionVersion; + } else { + version = yield _this9.reporter.select(_this9.reporter.lang('manualVersionResolution', name), _this9.reporter.lang('answer'), options); + _this9.resolutions[name] = version; + } + + flattenedPatterns.push(_this9.resolver.collapseAllVersionsOfPackage(name, version)); + } + + // save resolutions to their appropriate root manifest + if (Object.keys(_this9.resolutions).length) { + const manifests = yield _this9.config.getRootManifests(); + + for (const name in _this9.resolutions) { + const version = _this9.resolutions[name]; + + const patterns = _this9.resolver.patternsByPackage[name]; + if (!patterns) { + continue; + } + + let manifest; + for (var _iterator13 = patterns, _isArray13 = Array.isArray(_iterator13), _i13 = 0, _iterator13 = _isArray13 ? _iterator13 : _iterator13[Symbol.iterator]();;) { + var _ref26; + + if (_isArray13) { + if (_i13 >= _iterator13.length) break; + _ref26 = _iterator13[_i13++]; + } else { + _i13 = _iterator13.next(); + if (_i13.done) break; + _ref26 = _i13.value; + } + + const pattern = _ref26; + + manifest = _this9.resolver.getResolvedPattern(pattern); + if (manifest) { + break; + } + } + invariant(manifest, 'expected manifest'); + + const ref = manifest._reference; + invariant(ref, 'expected reference'); + + const object = manifests[ref.registry].object; + object.resolutions = object.resolutions || {}; + object.resolutions[name] = version; + } + + yield _this9.config.saveRootManifests(manifests); + } + + return flattenedPatterns; + })(); + } + + /** + * Remove offline tarballs that are no longer required + */ + + pruneOfflineMirror(lockfile) { + var _this10 = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { + const mirror = _this10.config.getOfflineMirrorPath(); + if (!mirror) { + return; + } + + const requiredTarballs = new Set(); + for (const dependency in lockfile) { + const resolved = lockfile[dependency].resolved; + if (resolved) { + const basename = path.basename(resolved.split('#')[0]); + if (dependency[0] === '@' && basename[0] !== '@') { + requiredTarballs.add(`${dependency.split('/')[0]}-${basename}`); + } + requiredTarballs.add(basename); + } + } + + const mirrorFiles = yield (_fs || _load_fs()).walk(mirror); + for (var _iterator14 = mirrorFiles, _isArray14 = Array.isArray(_iterator14), _i14 = 0, _iterator14 = _isArray14 ? _iterator14 : _iterator14[Symbol.iterator]();;) { + var _ref27; + + if (_isArray14) { + if (_i14 >= _iterator14.length) break; + _ref27 = _iterator14[_i14++]; + } else { + _i14 = _iterator14.next(); + if (_i14.done) break; + _ref27 = _i14.value; + } + + const file = _ref27; + + const isTarball = path.extname(file.basename) === '.tgz'; + // if using experimental-pack-script-packages-in-mirror flag, don't unlink prebuilt packages + const hasPrebuiltPackage = file.relative.startsWith('prebuilt/'); + if (isTarball && !hasPrebuiltPackage && !requiredTarballs.has(file.basename)) { + yield (_fs || _load_fs()).unlink(file.absolute); + } + } + })(); + } + + /** + * Save updated integrity and lockfiles. + */ + + saveLockfileAndIntegrity(patterns, workspaceLayout) { + var _this11 = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { + const resolvedPatterns = {}; + Object.keys(_this11.resolver.patterns).forEach(function (pattern) { + if (!workspaceLayout || !workspaceLayout.getManifestByPattern(pattern)) { + resolvedPatterns[pattern] = _this11.resolver.patterns[pattern]; + } + }); + + // TODO this code is duplicated in a few places, need a common way to filter out workspace patterns from lockfile + patterns = patterns.filter(function (p) { + return !workspaceLayout || !workspaceLayout.getManifestByPattern(p); + }); + + const lockfileBasedOnResolver = _this11.lockfile.getLockfile(resolvedPatterns); + + if (_this11.config.pruneOfflineMirror) { + yield _this11.pruneOfflineMirror(lockfileBasedOnResolver); + } + + // write integrity hash + if (!_this11.config.plugnplayEnabled) { + yield _this11.integrityChecker.save(patterns, lockfileBasedOnResolver, _this11.flags, workspaceLayout, _this11.scripts.getArtifacts()); + } + + // --no-lockfile or --pure-lockfile or --frozen-lockfile + if (_this11.flags.lockfile === false || _this11.flags.pureLockfile || _this11.flags.frozenLockfile) { + return; + } + + const lockFileHasAllPatterns = patterns.every(function (p) { + return _this11.lockfile.getLocked(p); + }); + const lockfilePatternsMatch = Object.keys(_this11.lockfile.cache || {}).every(function (p) { + return lockfileBasedOnResolver[p]; + }); + const resolverPatternsAreSameAsInLockfile = Object.keys(lockfileBasedOnResolver).every(function (pattern) { + const manifest = _this11.lockfile.getLocked(pattern); + return manifest && manifest.resolved === lockfileBasedOnResolver[pattern].resolved && deepEqual(manifest.prebuiltVariants, lockfileBasedOnResolver[pattern].prebuiltVariants); + }); + const integrityPatternsAreSameAsInLockfile = Object.keys(lockfileBasedOnResolver).every(function (pattern) { + const existingIntegrityInfo = lockfileBasedOnResolver[pattern].integrity; + if (!existingIntegrityInfo) { + // if this entry does not have an integrity, no need to re-write the lockfile because of it + return true; + } + const manifest = _this11.lockfile.getLocked(pattern); + if (manifest && manifest.integrity) { + const manifestIntegrity = ssri.stringify(manifest.integrity); + return manifestIntegrity === existingIntegrityInfo; + } + return false; + }); + + // remove command is followed by install with force, lockfile will be rewritten in any case then + if (!_this11.flags.force && _this11.lockfile.parseResultType === 'success' && lockFileHasAllPatterns && lockfilePatternsMatch && resolverPatternsAreSameAsInLockfile && integrityPatternsAreSameAsInLockfile && patterns.length) { + return; + } + + // build lockfile location + const loc = path.join(_this11.config.lockfileFolder, (_constants || _load_constants()).LOCKFILE_FILENAME); + + // write lockfile + const lockSource = (0, (_lockfile2 || _load_lockfile2()).stringify)(lockfileBasedOnResolver, false, _this11.config.enableLockfileVersions); + yield (_fs || _load_fs()).writeFilePreservingEol(loc, lockSource); + + _this11._logSuccessSaveLockfile(); + })(); + } + + _logSuccessSaveLockfile() { + this.reporter.success(this.reporter.lang('savedLockfile')); + } + + /** + * Load the dependency graph of the current install. Only does package resolving and wont write to the cwd. + */ + hydrate(ignoreUnusedPatterns) { + var _this12 = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { + const request = yield _this12.fetchRequestFromCwd([], ignoreUnusedPatterns); + const depRequests = request.requests, + rawPatterns = request.patterns, + ignorePatterns = request.ignorePatterns, + workspaceLayout = request.workspaceLayout; + + + yield _this12.resolver.init(depRequests, { + isFlat: _this12.flags.flat, + isFrozen: _this12.flags.frozenLockfile, + workspaceLayout + }); + yield _this12.flatten(rawPatterns); + _this12.markIgnored(ignorePatterns); + + // fetch packages, should hit cache most of the time + const manifests = yield (_packageFetcher || _load_packageFetcher()).fetch(_this12.resolver.getManifests(), _this12.config); + _this12.resolver.updateManifests(manifests); + yield (_packageCompatibility || _load_packageCompatibility()).check(_this12.resolver.getManifests(), _this12.config, _this12.flags.ignoreEngines); + + // expand minimal manifests + for (var _iterator15 = _this12.resolver.getManifests(), _isArray15 = Array.isArray(_iterator15), _i15 = 0, _iterator15 = _isArray15 ? _iterator15 : _iterator15[Symbol.iterator]();;) { + var _ref28; + + if (_isArray15) { + if (_i15 >= _iterator15.length) break; + _ref28 = _iterator15[_i15++]; + } else { + _i15 = _iterator15.next(); + if (_i15.done) break; + _ref28 = _i15.value; + } + + const manifest = _ref28; + + const ref = manifest._reference; + invariant(ref, 'expected reference'); + const type = ref.remote.type; + // link specifier won't ever hit cache + + let loc = ''; + if (type === 'link') { + continue; + } else if (type === 'workspace') { + if (!ref.remote.reference) { + continue; + } + loc = ref.remote.reference; + } else { + loc = _this12.config.generateModuleCachePath(ref); + } + const newPkg = yield _this12.config.readManifest(loc); + yield _this12.resolver.updateManifest(ref, newPkg); + } + + return request; + })(); + } + + /** + * Check for updates every day and output a nag message if there's a newer version. + */ + + checkUpdate() { + if (this.config.nonInteractive) { + // don't show upgrade dialog on CI or non-TTY terminals + return; + } + + // don't check if disabled + if (this.config.getOption('disable-self-update-check')) { + return; + } + + // only check for updates once a day + const lastUpdateCheck = Number(this.config.getOption('lastUpdateCheck')) || 0; + if (lastUpdateCheck && Date.now() - lastUpdateCheck < ONE_DAY) { + return; + } + + // don't bug for updates on tagged releases + if ((_yarnVersion || _load_yarnVersion()).version.indexOf('-') >= 0) { + return; + } + + this._checkUpdate().catch(() => { + // swallow errors + }); + } + + _checkUpdate() { + var _this13 = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { + let latestVersion = yield _this13.config.requestManager.request({ + url: (_constants || _load_constants()).SELF_UPDATE_VERSION_URL + }); + invariant(typeof latestVersion === 'string', 'expected string'); + latestVersion = latestVersion.trim(); + if (!semver.valid(latestVersion)) { + return; + } + + // ensure we only check for updates periodically + _this13.config.registries.yarn.saveHomeConfig({ + lastUpdateCheck: Date.now() + }); + + if (semver.gt(latestVersion, (_yarnVersion || _load_yarnVersion()).version)) { + const installationMethod = yield (0, (_yarnVersion || _load_yarnVersion()).getInstallationMethod)(); + _this13.maybeOutputUpdate = function () { + _this13.reporter.warn(_this13.reporter.lang('yarnOutdated', latestVersion, (_yarnVersion || _load_yarnVersion()).version)); + + const command = getUpdateCommand(installationMethod); + if (command) { + _this13.reporter.info(_this13.reporter.lang('yarnOutdatedCommand')); + _this13.reporter.command(command); + } else { + const installer = getUpdateInstaller(installationMethod); + if (installer) { + _this13.reporter.info(_this13.reporter.lang('yarnOutdatedInstaller', installer)); + } + } + }; + } + })(); + } + + /** + * Method to override with a possible upgrade message. + */ + + maybeOutputUpdate() {} +} + +exports.Install = Install; +function hasWrapper(commander, args) { + return true; +} + +function setFlags(commander) { + commander.description('Yarn install is used to install all dependencies for a project.'); + commander.usage('install [flags]'); + commander.option('-A, --audit', 'Run vulnerability audit on installed packages'); + commander.option('-g, --global', 'DEPRECATED'); + commander.option('-S, --save', 'DEPRECATED - save package to your `dependencies`'); + commander.option('-D, --save-dev', 'DEPRECATED - save package to your `devDependencies`'); + commander.option('-P, --save-peer', 'DEPRECATED - save package to your `peerDependencies`'); + commander.option('-O, --save-optional', 'DEPRECATED - save package to your `optionalDependencies`'); + commander.option('-E, --save-exact', 'DEPRECATED'); + commander.option('-T, --save-tilde', 'DEPRECATED'); +} + +/***/ }), +/* 35 */ +/***/ (function(module, exports, __webpack_require__) { + +var isObject = __webpack_require__(52); +module.exports = function (it) { + if (!isObject(it)) throw TypeError(it + ' is not an object!'); + return it; +}; + + +/***/ }), +/* 36 */ +/***/ (function(module, __webpack_exports__, __webpack_require__) { + +"use strict"; +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return SubjectSubscriber; }); +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Subject; }); +/* unused harmony export AnonymousSubject */ +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_tslib__ = __webpack_require__(1); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__Observable__ = __webpack_require__(12); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__Subscriber__ = __webpack_require__(7); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__Subscription__ = __webpack_require__(25); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__ = __webpack_require__(189); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__SubjectSubscription__ = __webpack_require__(422); +/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__internal_symbol_rxSubscriber__ = __webpack_require__(321); +/** PURE_IMPORTS_START tslib,_Observable,_Subscriber,_Subscription,_util_ObjectUnsubscribedError,_SubjectSubscription,_internal_symbol_rxSubscriber PURE_IMPORTS_END */ + + + + + + + +var SubjectSubscriber = /*@__PURE__*/ (function (_super) { + __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](SubjectSubscriber, _super); + function SubjectSubscriber(destination) { + var _this = _super.call(this, destination) || this; + _this.destination = destination; + return _this; + } + return SubjectSubscriber; +}(__WEBPACK_IMPORTED_MODULE_2__Subscriber__["a" /* Subscriber */])); + +var Subject = /*@__PURE__*/ (function (_super) { + __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](Subject, _super); + function Subject() { + var _this = _super.call(this) || this; + _this.observers = []; + _this.closed = false; + _this.isStopped = false; + _this.hasError = false; + _this.thrownError = null; + return _this; + } + Subject.prototype[__WEBPACK_IMPORTED_MODULE_6__internal_symbol_rxSubscriber__["a" /* rxSubscriber */]] = function () { + return new SubjectSubscriber(this); + }; + Subject.prototype.lift = function (operator) { + var subject = new AnonymousSubject(this, this); + subject.operator = operator; + return subject; + }; + Subject.prototype.next = function (value) { + if (this.closed) { + throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */](); + } + if (!this.isStopped) { + var observers = this.observers; + var len = observers.length; + var copy = observers.slice(); + for (var i = 0; i < len; i++) { + copy[i].next(value); + } + } + }; + Subject.prototype.error = function (err) { + if (this.closed) { + throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */](); + } + this.hasError = true; + this.thrownError = err; + this.isStopped = true; + var observers = this.observers; + var len = observers.length; + var copy = observers.slice(); + for (var i = 0; i < len; i++) { + copy[i].error(err); + } + this.observers.length = 0; + }; + Subject.prototype.complete = function () { + if (this.closed) { + throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */](); + } + this.isStopped = true; + var observers = this.observers; + var len = observers.length; + var copy = observers.slice(); + for (var i = 0; i < len; i++) { + copy[i].complete(); + } + this.observers.length = 0; + }; + Subject.prototype.unsubscribe = function () { + this.isStopped = true; + this.closed = true; + this.observers = null; + }; + Subject.prototype._trySubscribe = function (subscriber) { + if (this.closed) { + throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */](); + } + else { + return _super.prototype._trySubscribe.call(this, subscriber); + } + }; + Subject.prototype._subscribe = function (subscriber) { + if (this.closed) { + throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */](); + } + else if (this.hasError) { + subscriber.error(this.thrownError); + return __WEBPACK_IMPORTED_MODULE_3__Subscription__["a" /* Subscription */].EMPTY; + } + else if (this.isStopped) { + subscriber.complete(); + return __WEBPACK_IMPORTED_MODULE_3__Subscription__["a" /* Subscription */].EMPTY; + } + else { + this.observers.push(subscriber); + return new __WEBPACK_IMPORTED_MODULE_5__SubjectSubscription__["a" /* SubjectSubscription */](this, subscriber); + } + }; + Subject.prototype.asObservable = function () { + var observable = new __WEBPACK_IMPORTED_MODULE_1__Observable__["a" /* Observable */](); + observable.source = this; + return observable; + }; + Subject.create = function (destination, source) { + return new AnonymousSubject(destination, source); + }; + return Subject; +}(__WEBPACK_IMPORTED_MODULE_1__Observable__["a" /* Observable */])); + +var AnonymousSubject = /*@__PURE__*/ (function (_super) { + __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](AnonymousSubject, _super); + function AnonymousSubject(destination, source) { + var _this = _super.call(this) || this; + _this.destination = destination; + _this.source = source; + return _this; + } + AnonymousSubject.prototype.next = function (value) { + var destination = this.destination; + if (destination && destination.next) { + destination.next(value); + } + }; + AnonymousSubject.prototype.error = function (err) { + var destination = this.destination; + if (destination && destination.error) { + this.destination.error(err); + } + }; + AnonymousSubject.prototype.complete = function () { + var destination = this.destination; + if (destination && destination.complete) { + this.destination.complete(); + } + }; + AnonymousSubject.prototype._subscribe = function (subscriber) { + var source = this.source; + if (source) { + return this.source.subscribe(subscriber); + } + else { + return __WEBPACK_IMPORTED_MODULE_3__Subscription__["a" /* Subscription */].EMPTY; + } + }; + return AnonymousSubject; +}(Subject)); + +//# sourceMappingURL=Subject.js.map + + +/***/ }), +/* 37 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.normalizePattern = normalizePattern; + +/** + * Explode and normalize a pattern into its name and range. + */ + +function normalizePattern(pattern) { + let hasVersion = false; + let range = 'latest'; + let name = pattern; + + // if we're a scope then remove the @ and add it back later + let isScoped = false; + if (name[0] === '@') { + isScoped = true; + name = name.slice(1); + } + + // take first part as the name + const parts = name.split('@'); + if (parts.length > 1) { + name = parts.shift(); + range = parts.join('@'); + + if (range) { + hasVersion = true; + } else { + range = '*'; + } + } + + // add back @ scope suffix + if (isScoped) { + name = `@${name}`; + } + + return { name, range, hasVersion }; +} + +/***/ }), +/* 38 */ +/***/ (function(module, exports, __webpack_require__) { + +/* WEBPACK VAR INJECTION */(function(module) {var __WEBPACK_AMD_DEFINE_RESULT__;/** + * @license + * Lodash + * Copyright JS Foundation and other contributors + * Released under MIT license + * Based on Underscore.js 1.8.3 + * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors + */ +;(function() { + + /** Used as a safe reference for `undefined` in pre-ES5 environments. */ + var undefined; + + /** Used as the semantic version number. */ + var VERSION = '4.17.10'; + + /** Used as the size to enable large array optimizations. */ + var LARGE_ARRAY_SIZE = 200; + + /** Error message constants. */ + var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.', + FUNC_ERROR_TEXT = 'Expected a function'; + + /** Used to stand-in for `undefined` hash values. */ + var HASH_UNDEFINED = '__lodash_hash_undefined__'; + + /** Used as the maximum memoize cache size. */ + var MAX_MEMOIZE_SIZE = 500; + + /** Used as the internal argument placeholder. */ + var PLACEHOLDER = '__lodash_placeholder__'; + + /** Used to compose bitmasks for cloning. */ + var CLONE_DEEP_FLAG = 1, + CLONE_FLAT_FLAG = 2, + CLONE_SYMBOLS_FLAG = 4; + + /** Used to compose bitmasks for value comparisons. */ + var COMPARE_PARTIAL_FLAG = 1, + COMPARE_UNORDERED_FLAG = 2; + + /** Used to compose bitmasks for function metadata. */ + var WRAP_BIND_FLAG = 1, + WRAP_BIND_KEY_FLAG = 2, + WRAP_CURRY_BOUND_FLAG = 4, + WRAP_CURRY_FLAG = 8, + WRAP_CURRY_RIGHT_FLAG = 16, + WRAP_PARTIAL_FLAG = 32, + WRAP_PARTIAL_RIGHT_FLAG = 64, + WRAP_ARY_FLAG = 128, + WRAP_REARG_FLAG = 256, + WRAP_FLIP_FLAG = 512; + + /** Used as default options for `_.truncate`. */ + var DEFAULT_TRUNC_LENGTH = 30, + DEFAULT_TRUNC_OMISSION = '...'; + + /** Used to detect hot functions by number of calls within a span of milliseconds. */ + var HOT_COUNT = 800, + HOT_SPAN = 16; + + /** Used to indicate the type of lazy iteratees. */ + var LAZY_FILTER_FLAG = 1, + LAZY_MAP_FLAG = 2, + LAZY_WHILE_FLAG = 3; + + /** Used as references for various `Number` constants. */ + var INFINITY = 1 / 0, + MAX_SAFE_INTEGER = 9007199254740991, + MAX_INTEGER = 1.7976931348623157e+308, + NAN = 0 / 0; + + /** Used as references for the maximum length and index of an array. */ + var MAX_ARRAY_LENGTH = 4294967295, + MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1, + HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1; + + /** Used to associate wrap methods with their bit flags. */ + var wrapFlags = [ + ['ary', WRAP_ARY_FLAG], + ['bind', WRAP_BIND_FLAG], + ['bindKey', WRAP_BIND_KEY_FLAG], + ['curry', WRAP_CURRY_FLAG], + ['curryRight', WRAP_CURRY_RIGHT_FLAG], + ['flip', WRAP_FLIP_FLAG], + ['partial', WRAP_PARTIAL_FLAG], + ['partialRight', WRAP_PARTIAL_RIGHT_FLAG], + ['rearg', WRAP_REARG_FLAG] + ]; + + /** `Object#toString` result references. */ + var argsTag = '[object Arguments]', + arrayTag = '[object Array]', + asyncTag = '[object AsyncFunction]', + boolTag = '[object Boolean]', + dateTag = '[object Date]', + domExcTag = '[object DOMException]', + errorTag = '[object Error]', + funcTag = '[object Function]', + genTag = '[object GeneratorFunction]', + mapTag = '[object Map]', + numberTag = '[object Number]', + nullTag = '[object Null]', + objectTag = '[object Object]', + promiseTag = '[object Promise]', + proxyTag = '[object Proxy]', + regexpTag = '[object RegExp]', + setTag = '[object Set]', + stringTag = '[object String]', + symbolTag = '[object Symbol]', + undefinedTag = '[object Undefined]', + weakMapTag = '[object WeakMap]', + weakSetTag = '[object WeakSet]'; + + var arrayBufferTag = '[object ArrayBuffer]', + dataViewTag = '[object DataView]', + float32Tag = '[object Float32Array]', + float64Tag = '[object Float64Array]', + int8Tag = '[object Int8Array]', + int16Tag = '[object Int16Array]', + int32Tag = '[object Int32Array]', + uint8Tag = '[object Uint8Array]', + uint8ClampedTag = '[object Uint8ClampedArray]', + uint16Tag = '[object Uint16Array]', + uint32Tag = '[object Uint32Array]'; + + /** Used to match empty string literals in compiled template source. */ + var reEmptyStringLeading = /\b__p \+= '';/g, + reEmptyStringMiddle = /\b(__p \+=) '' \+/g, + reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g; + + /** Used to match HTML entities and HTML characters. */ + var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g, + reUnescapedHtml = /[&<>"']/g, + reHasEscapedHtml = RegExp(reEscapedHtml.source), + reHasUnescapedHtml = RegExp(reUnescapedHtml.source); + + /** Used to match template delimiters. */ + var reEscape = /<%-([\s\S]+?)%>/g, + reEvaluate = /<%([\s\S]+?)%>/g, + reInterpolate = /<%=([\s\S]+?)%>/g; + + /** Used to match property names within property paths. */ + var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, + reIsPlainProp = /^\w*$/, + rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g; + + /** + * Used to match `RegExp` + * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns). + */ + var reRegExpChar = /[\\^$.*+?()[\]{}|]/g, + reHasRegExpChar = RegExp(reRegExpChar.source); + + /** Used to match leading and trailing whitespace. */ + var reTrim = /^\s+|\s+$/g, + reTrimStart = /^\s+/, + reTrimEnd = /\s+$/; + + /** Used to match wrap detail comments. */ + var reWrapComment = /\{(?:\n\/\* \[wrapped with .+\] \*\/)?\n?/, + reWrapDetails = /\{\n\/\* \[wrapped with (.+)\] \*/, + reSplitDetails = /,? & /; + + /** Used to match words composed of alphanumeric characters. */ + var reAsciiWord = /[^\x00-\x2f\x3a-\x40\x5b-\x60\x7b-\x7f]+/g; + + /** Used to match backslashes in property paths. */ + var reEscapeChar = /\\(\\)?/g; + + /** + * Used to match + * [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components). + */ + var reEsTemplate = /\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g; + + /** Used to match `RegExp` flags from their coerced string values. */ + var reFlags = /\w*$/; + + /** Used to detect bad signed hexadecimal string values. */ + var reIsBadHex = /^[-+]0x[0-9a-f]+$/i; + + /** Used to detect binary string values. */ + var reIsBinary = /^0b[01]+$/i; + + /** Used to detect host constructors (Safari). */ + var reIsHostCtor = /^\[object .+?Constructor\]$/; + + /** Used to detect octal string values. */ + var reIsOctal = /^0o[0-7]+$/i; + + /** Used to detect unsigned integer values. */ + var reIsUint = /^(?:0|[1-9]\d*)$/; + + /** Used to match Latin Unicode letters (excluding mathematical operators). */ + var reLatin = /[\xc0-\xd6\xd8-\xf6\xf8-\xff\u0100-\u017f]/g; + + /** Used to ensure capturing order of template delimiters. */ + var reNoMatch = /($^)/; + + /** Used to match unescaped characters in compiled string literals. */ + var reUnescapedString = /['\n\r\u2028\u2029\\]/g; + + /** Used to compose unicode character classes. */ + var rsAstralRange = '\\ud800-\\udfff', + rsComboMarksRange = '\\u0300-\\u036f', + reComboHalfMarksRange = '\\ufe20-\\ufe2f', + rsComboSymbolsRange = '\\u20d0-\\u20ff', + rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange, + rsDingbatRange = '\\u2700-\\u27bf', + rsLowerRange = 'a-z\\xdf-\\xf6\\xf8-\\xff', + rsMathOpRange = '\\xac\\xb1\\xd7\\xf7', + rsNonCharRange = '\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\xbf', + rsPunctuationRange = '\\u2000-\\u206f', + rsSpaceRange = ' \\t\\x0b\\f\\xa0\\ufeff\\n\\r\\u2028\\u2029\\u1680\\u180e\\u2000\\u2001\\u2002\\u2003\\u2004\\u2005\\u2006\\u2007\\u2008\\u2009\\u200a\\u202f\\u205f\\u3000', + rsUpperRange = 'A-Z\\xc0-\\xd6\\xd8-\\xde', + rsVarRange = '\\ufe0e\\ufe0f', + rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange; + + /** Used to compose unicode capture groups. */ + var rsApos = "['\u2019]", + rsAstral = '[' + rsAstralRange + ']', + rsBreak = '[' + rsBreakRange + ']', + rsCombo = '[' + rsComboRange + ']', + rsDigits = '\\d+', + rsDingbat = '[' + rsDingbatRange + ']', + rsLower = '[' + rsLowerRange + ']', + rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']', + rsFitz = '\\ud83c[\\udffb-\\udfff]', + rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')', + rsNonAstral = '[^' + rsAstralRange + ']', + rsRegional = '(?:\\ud83c[\\udde6-\\uddff]){2}', + rsSurrPair = '[\\ud800-\\udbff][\\udc00-\\udfff]', + rsUpper = '[' + rsUpperRange + ']', + rsZWJ = '\\u200d'; + + /** Used to compose unicode regexes. */ + var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')', + rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')', + rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?', + rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?', + reOptMod = rsModifier + '?', + rsOptVar = '[' + rsVarRange + ']?', + rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*', + rsOrdLower = '\\d*(?:1st|2nd|3rd|(?![123])\\dth)(?=\\b|[A-Z_])', + rsOrdUpper = '\\d*(?:1ST|2ND|3RD|(?![123])\\dTH)(?=\\b|[a-z_])', + rsSeq = rsOptVar + reOptMod + rsOptJoin, + rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq, + rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')'; + + /** Used to match apostrophes. */ + var reApos = RegExp(rsApos, 'g'); + + /** + * Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and + * [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols). + */ + var reComboMark = RegExp(rsCombo, 'g'); + + /** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */ + var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g'); + + /** Used to match complex or compound words. */ + var reUnicodeWord = RegExp([ + rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')', + rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')', + rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower, + rsUpper + '+' + rsOptContrUpper, + rsOrdUpper, + rsOrdLower, + rsDigits, + rsEmoji + ].join('|'), 'g'); + + /** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */ + var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']'); + + /** Used to detect strings that need a more robust regexp to match words. */ + var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2,}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/; + + /** Used to assign default `context` object properties. */ + var contextProps = [ + 'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array', + 'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object', + 'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array', + 'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap', + '_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout' + ]; + + /** Used to make template sourceURLs easier to identify. */ + var templateCounter = -1; + + /** Used to identify `toStringTag` values of typed arrays. */ + var typedArrayTags = {}; + typedArrayTags[float32Tag] = typedArrayTags[float64Tag] = + typedArrayTags[int8Tag] = typedArrayTags[int16Tag] = + typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] = + typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] = + typedArrayTags[uint32Tag] = true; + typedArrayTags[argsTag] = typedArrayTags[arrayTag] = + typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] = + typedArrayTags[dataViewTag] = typedArrayTags[dateTag] = + typedArrayTags[errorTag] = typedArrayTags[funcTag] = + typedArrayTags[mapTag] = typedArrayTags[numberTag] = + typedArrayTags[objectTag] = typedArrayTags[regexpTag] = + typedArrayTags[setTag] = typedArrayTags[stringTag] = + typedArrayTags[weakMapTag] = false; + + /** Used to identify `toStringTag` values supported by `_.clone`. */ + var cloneableTags = {}; + cloneableTags[argsTag] = cloneableTags[arrayTag] = + cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] = + cloneableTags[boolTag] = cloneableTags[dateTag] = + cloneableTags[float32Tag] = cloneableTags[float64Tag] = + cloneableTags[int8Tag] = cloneableTags[int16Tag] = + cloneableTags[int32Tag] = cloneableTags[mapTag] = + cloneableTags[numberTag] = cloneableTags[objectTag] = + cloneableTags[regexpTag] = cloneableTags[setTag] = + cloneableTags[stringTag] = cloneableTags[symbolTag] = + cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] = + cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true; + cloneableTags[errorTag] = cloneableTags[funcTag] = + cloneableTags[weakMapTag] = false; + + /** Used to map Latin Unicode letters to basic Latin letters. */ + var deburredLetters = { + // Latin-1 Supplement block. + '\xc0': 'A', '\xc1': 'A', '\xc2': 'A', '\xc3': 'A', '\xc4': 'A', '\xc5': 'A', + '\xe0': 'a', '\xe1': 'a', '\xe2': 'a', '\xe3': 'a', '\xe4': 'a', '\xe5': 'a', + '\xc7': 'C', '\xe7': 'c', + '\xd0': 'D', '\xf0': 'd', + '\xc8': 'E', '\xc9': 'E', '\xca': 'E', '\xcb': 'E', + '\xe8': 'e', '\xe9': 'e', '\xea': 'e', '\xeb': 'e', + '\xcc': 'I', '\xcd': 'I', '\xce': 'I', '\xcf': 'I', + '\xec': 'i', '\xed': 'i', '\xee': 'i', '\xef': 'i', + '\xd1': 'N', '\xf1': 'n', + '\xd2': 'O', '\xd3': 'O', '\xd4': 'O', '\xd5': 'O', '\xd6': 'O', '\xd8': 'O', + '\xf2': 'o', '\xf3': 'o', '\xf4': 'o', '\xf5': 'o', '\xf6': 'o', '\xf8': 'o', + '\xd9': 'U', '\xda': 'U', '\xdb': 'U', '\xdc': 'U', + '\xf9': 'u', '\xfa': 'u', '\xfb': 'u', '\xfc': 'u', + '\xdd': 'Y', '\xfd': 'y', '\xff': 'y', + '\xc6': 'Ae', '\xe6': 'ae', + '\xde': 'Th', '\xfe': 'th', + '\xdf': 'ss', + // Latin Extended-A block. + '\u0100': 'A', '\u0102': 'A', '\u0104': 'A', + '\u0101': 'a', '\u0103': 'a', '\u0105': 'a', + '\u0106': 'C', '\u0108': 'C', '\u010a': 'C', '\u010c': 'C', + '\u0107': 'c', '\u0109': 'c', '\u010b': 'c', '\u010d': 'c', + '\u010e': 'D', '\u0110': 'D', '\u010f': 'd', '\u0111': 'd', + '\u0112': 'E', '\u0114': 'E', '\u0116': 'E', '\u0118': 'E', '\u011a': 'E', + '\u0113': 'e', '\u0115': 'e', '\u0117': 'e', '\u0119': 'e', '\u011b': 'e', + '\u011c': 'G', '\u011e': 'G', '\u0120': 'G', '\u0122': 'G', + '\u011d': 'g', '\u011f': 'g', '\u0121': 'g', '\u0123': 'g', + '\u0124': 'H', '\u0126': 'H', '\u0125': 'h', '\u0127': 'h', + '\u0128': 'I', '\u012a': 'I', '\u012c': 'I', '\u012e': 'I', '\u0130': 'I', + '\u0129': 'i', '\u012b': 'i', '\u012d': 'i', '\u012f': 'i', '\u0131': 'i', + '\u0134': 'J', '\u0135': 'j', + '\u0136': 'K', '\u0137': 'k', '\u0138': 'k', + '\u0139': 'L', '\u013b': 'L', '\u013d': 'L', '\u013f': 'L', '\u0141': 'L', + '\u013a': 'l', '\u013c': 'l', '\u013e': 'l', '\u0140': 'l', '\u0142': 'l', + '\u0143': 'N', '\u0145': 'N', '\u0147': 'N', '\u014a': 'N', + '\u0144': 'n', '\u0146': 'n', '\u0148': 'n', '\u014b': 'n', + '\u014c': 'O', '\u014e': 'O', '\u0150': 'O', + '\u014d': 'o', '\u014f': 'o', '\u0151': 'o', + '\u0154': 'R', '\u0156': 'R', '\u0158': 'R', + '\u0155': 'r', '\u0157': 'r', '\u0159': 'r', + '\u015a': 'S', '\u015c': 'S', '\u015e': 'S', '\u0160': 'S', + '\u015b': 's', '\u015d': 's', '\u015f': 's', '\u0161': 's', + '\u0162': 'T', '\u0164': 'T', '\u0166': 'T', + '\u0163': 't', '\u0165': 't', '\u0167': 't', + '\u0168': 'U', '\u016a': 'U', '\u016c': 'U', '\u016e': 'U', '\u0170': 'U', '\u0172': 'U', + '\u0169': 'u', '\u016b': 'u', '\u016d': 'u', '\u016f': 'u', '\u0171': 'u', '\u0173': 'u', + '\u0174': 'W', '\u0175': 'w', + '\u0176': 'Y', '\u0177': 'y', '\u0178': 'Y', + '\u0179': 'Z', '\u017b': 'Z', '\u017d': 'Z', + '\u017a': 'z', '\u017c': 'z', '\u017e': 'z', + '\u0132': 'IJ', '\u0133': 'ij', + '\u0152': 'Oe', '\u0153': 'oe', + '\u0149': "'n", '\u017f': 's' + }; + + /** Used to map characters to HTML entities. */ + var htmlEscapes = { + '&': '&', + '<': '<', + '>': '>', + '"': '"', + "'": ''' + }; + + /** Used to map HTML entities to characters. */ + var htmlUnescapes = { + '&': '&', + '<': '<', + '>': '>', + '"': '"', + ''': "'" + }; + + /** Used to escape characters for inclusion in compiled string literals. */ + var stringEscapes = { + '\\': '\\', + "'": "'", + '\n': 'n', + '\r': 'r', + '\u2028': 'u2028', + '\u2029': 'u2029' + }; + + /** Built-in method references without a dependency on `root`. */ + var freeParseFloat = parseFloat, + freeParseInt = parseInt; + + /** Detect free variable `global` from Node.js. */ + var freeGlobal = typeof global == 'object' && global && global.Object === Object && global; + + /** Detect free variable `self`. */ + var freeSelf = typeof self == 'object' && self && self.Object === Object && self; + + /** Used as a reference to the global object. */ + var root = freeGlobal || freeSelf || Function('return this')(); + + /** Detect free variable `exports`. */ + var freeExports = typeof exports == 'object' && exports && !exports.nodeType && exports; + + /** Detect free variable `module`. */ + var freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module; + + /** Detect the popular CommonJS extension `module.exports`. */ + var moduleExports = freeModule && freeModule.exports === freeExports; + + /** Detect free variable `process` from Node.js. */ + var freeProcess = moduleExports && freeGlobal.process; + + /** Used to access faster Node.js helpers. */ + var nodeUtil = (function() { + try { + // Use `util.types` for Node.js 10+. + var types = freeModule && freeModule.require && freeModule.require('util').types; + + if (types) { + return types; + } + + // Legacy `process.binding('util')` for Node.js < 10. + return freeProcess && freeProcess.binding && freeProcess.binding('util'); + } catch (e) {} + }()); + + /* Node.js helper references. */ + var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer, + nodeIsDate = nodeUtil && nodeUtil.isDate, + nodeIsMap = nodeUtil && nodeUtil.isMap, + nodeIsRegExp = nodeUtil && nodeUtil.isRegExp, + nodeIsSet = nodeUtil && nodeUtil.isSet, + nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray; + + /*--------------------------------------------------------------------------*/ + + /** + * A faster alternative to `Function#apply`, this function invokes `func` + * with the `this` binding of `thisArg` and the arguments of `args`. + * + * @private + * @param {Function} func The function to invoke. + * @param {*} thisArg The `this` binding of `func`. + * @param {Array} args The arguments to invoke `func` with. + * @returns {*} Returns the result of `func`. + */ + function apply(func, thisArg, args) { + switch (args.length) { + case 0: return func.call(thisArg); + case 1: return func.call(thisArg, args[0]); + case 2: return func.call(thisArg, args[0], args[1]); + case 3: return func.call(thisArg, args[0], args[1], args[2]); + } + return func.apply(thisArg, args); + } + + /** + * A specialized version of `baseAggregator` for arrays. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} setter The function to set `accumulator` values. + * @param {Function} iteratee The iteratee to transform keys. + * @param {Object} accumulator The initial aggregated object. + * @returns {Function} Returns `accumulator`. + */ + function arrayAggregator(array, setter, iteratee, accumulator) { + var index = -1, + length = array == null ? 0 : array.length; + + while (++index < length) { + var value = array[index]; + setter(accumulator, value, iteratee(value), array); + } + return accumulator; + } + + /** + * A specialized version of `_.forEach` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns `array`. + */ + function arrayEach(array, iteratee) { + var index = -1, + length = array == null ? 0 : array.length; + + while (++index < length) { + if (iteratee(array[index], index, array) === false) { + break; + } + } + return array; + } + + /** + * A specialized version of `_.forEachRight` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns `array`. + */ + function arrayEachRight(array, iteratee) { + var length = array == null ? 0 : array.length; + + while (length--) { + if (iteratee(array[length], length, array) === false) { + break; + } + } + return array; + } + + /** + * A specialized version of `_.every` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if all elements pass the predicate check, + * else `false`. + */ + function arrayEvery(array, predicate) { + var index = -1, + length = array == null ? 0 : array.length; + + while (++index < length) { + if (!predicate(array[index], index, array)) { + return false; + } + } + return true; + } + + /** + * A specialized version of `_.filter` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {Array} Returns the new filtered array. + */ + function arrayFilter(array, predicate) { + var index = -1, + length = array == null ? 0 : array.length, + resIndex = 0, + result = []; + + while (++index < length) { + var value = array[index]; + if (predicate(value, index, array)) { + result[resIndex++] = value; + } + } + return result; + } + + /** + * A specialized version of `_.includes` for arrays without support for + * specifying an index to search from. + * + * @private + * @param {Array} [array] The array to inspect. + * @param {*} target The value to search for. + * @returns {boolean} Returns `true` if `target` is found, else `false`. + */ + function arrayIncludes(array, value) { + var length = array == null ? 0 : array.length; + return !!length && baseIndexOf(array, value, 0) > -1; + } + + /** + * This function is like `arrayIncludes` except that it accepts a comparator. + * + * @private + * @param {Array} [array] The array to inspect. + * @param {*} target The value to search for. + * @param {Function} comparator The comparator invoked per element. + * @returns {boolean} Returns `true` if `target` is found, else `false`. + */ + function arrayIncludesWith(array, value, comparator) { + var index = -1, + length = array == null ? 0 : array.length; + + while (++index < length) { + if (comparator(value, array[index])) { + return true; + } + } + return false; + } + + /** + * A specialized version of `_.map` for arrays without support for iteratee + * shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns the new mapped array. + */ + function arrayMap(array, iteratee) { + var index = -1, + length = array == null ? 0 : array.length, + result = Array(length); + + while (++index < length) { + result[index] = iteratee(array[index], index, array); + } + return result; + } + + /** + * Appends the elements of `values` to `array`. + * + * @private + * @param {Array} array The array to modify. + * @param {Array} values The values to append. + * @returns {Array} Returns `array`. + */ + function arrayPush(array, values) { + var index = -1, + length = values.length, + offset = array.length; + + while (++index < length) { + array[offset + index] = values[index]; + } + return array; + } + + /** + * A specialized version of `_.reduce` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @param {boolean} [initAccum] Specify using the first element of `array` as + * the initial value. + * @returns {*} Returns the accumulated value. + */ + function arrayReduce(array, iteratee, accumulator, initAccum) { + var index = -1, + length = array == null ? 0 : array.length; + + if (initAccum && length) { + accumulator = array[++index]; + } + while (++index < length) { + accumulator = iteratee(accumulator, array[index], index, array); + } + return accumulator; + } + + /** + * A specialized version of `_.reduceRight` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @param {boolean} [initAccum] Specify using the last element of `array` as + * the initial value. + * @returns {*} Returns the accumulated value. + */ + function arrayReduceRight(array, iteratee, accumulator, initAccum) { + var length = array == null ? 0 : array.length; + if (initAccum && length) { + accumulator = array[--length]; + } + while (length--) { + accumulator = iteratee(accumulator, array[length], length, array); + } + return accumulator; + } + + /** + * A specialized version of `_.some` for arrays without support for iteratee + * shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if any element passes the predicate check, + * else `false`. + */ + function arraySome(array, predicate) { + var index = -1, + length = array == null ? 0 : array.length; + + while (++index < length) { + if (predicate(array[index], index, array)) { + return true; + } + } + return false; + } + + /** + * Gets the size of an ASCII `string`. + * + * @private + * @param {string} string The string inspect. + * @returns {number} Returns the string size. + */ + var asciiSize = baseProperty('length'); + + /** + * Converts an ASCII `string` to an array. + * + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the converted array. + */ + function asciiToArray(string) { + return string.split(''); + } + + /** + * Splits an ASCII `string` into an array of its words. + * + * @private + * @param {string} The string to inspect. + * @returns {Array} Returns the words of `string`. + */ + function asciiWords(string) { + return string.match(reAsciiWord) || []; + } + + /** + * The base implementation of methods like `_.findKey` and `_.findLastKey`, + * without support for iteratee shorthands, which iterates over `collection` + * using `eachFunc`. + * + * @private + * @param {Array|Object} collection The collection to inspect. + * @param {Function} predicate The function invoked per iteration. + * @param {Function} eachFunc The function to iterate over `collection`. + * @returns {*} Returns the found element or its key, else `undefined`. + */ + function baseFindKey(collection, predicate, eachFunc) { + var result; + eachFunc(collection, function(value, key, collection) { + if (predicate(value, key, collection)) { + result = key; + return false; + } + }); + return result; + } + + /** + * The base implementation of `_.findIndex` and `_.findLastIndex` without + * support for iteratee shorthands. + * + * @private + * @param {Array} array The array to inspect. + * @param {Function} predicate The function invoked per iteration. + * @param {number} fromIndex The index to search from. + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function baseFindIndex(array, predicate, fromIndex, fromRight) { + var length = array.length, + index = fromIndex + (fromRight ? 1 : -1); + + while ((fromRight ? index-- : ++index < length)) { + if (predicate(array[index], index, array)) { + return index; + } + } + return -1; + } + + /** + * The base implementation of `_.indexOf` without `fromIndex` bounds checks. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} fromIndex The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function baseIndexOf(array, value, fromIndex) { + return value === value + ? strictIndexOf(array, value, fromIndex) + : baseFindIndex(array, baseIsNaN, fromIndex); + } + + /** + * This function is like `baseIndexOf` except that it accepts a comparator. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} fromIndex The index to search from. + * @param {Function} comparator The comparator invoked per element. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function baseIndexOfWith(array, value, fromIndex, comparator) { + var index = fromIndex - 1, + length = array.length; + + while (++index < length) { + if (comparator(array[index], value)) { + return index; + } + } + return -1; + } + + /** + * The base implementation of `_.isNaN` without support for number objects. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. + */ + function baseIsNaN(value) { + return value !== value; + } + + /** + * The base implementation of `_.mean` and `_.meanBy` without support for + * iteratee shorthands. + * + * @private + * @param {Array} array The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {number} Returns the mean. + */ + function baseMean(array, iteratee) { + var length = array == null ? 0 : array.length; + return length ? (baseSum(array, iteratee) / length) : NAN; + } + + /** + * The base implementation of `_.property` without support for deep paths. + * + * @private + * @param {string} key The key of the property to get. + * @returns {Function} Returns the new accessor function. + */ + function baseProperty(key) { + return function(object) { + return object == null ? undefined : object[key]; + }; + } + + /** + * The base implementation of `_.propertyOf` without support for deep paths. + * + * @private + * @param {Object} object The object to query. + * @returns {Function} Returns the new accessor function. + */ + function basePropertyOf(object) { + return function(key) { + return object == null ? undefined : object[key]; + }; + } + + /** + * The base implementation of `_.reduce` and `_.reduceRight`, without support + * for iteratee shorthands, which iterates over `collection` using `eachFunc`. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {*} accumulator The initial value. + * @param {boolean} initAccum Specify using the first or last element of + * `collection` as the initial value. + * @param {Function} eachFunc The function to iterate over `collection`. + * @returns {*} Returns the accumulated value. + */ + function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) { + eachFunc(collection, function(value, index, collection) { + accumulator = initAccum + ? (initAccum = false, value) + : iteratee(accumulator, value, index, collection); + }); + return accumulator; + } + + /** + * The base implementation of `_.sortBy` which uses `comparer` to define the + * sort order of `array` and replaces criteria objects with their corresponding + * values. + * + * @private + * @param {Array} array The array to sort. + * @param {Function} comparer The function to define sort order. + * @returns {Array} Returns `array`. + */ + function baseSortBy(array, comparer) { + var length = array.length; + + array.sort(comparer); + while (length--) { + array[length] = array[length].value; + } + return array; + } + + /** + * The base implementation of `_.sum` and `_.sumBy` without support for + * iteratee shorthands. + * + * @private + * @param {Array} array The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {number} Returns the sum. + */ + function baseSum(array, iteratee) { + var result, + index = -1, + length = array.length; + + while (++index < length) { + var current = iteratee(array[index]); + if (current !== undefined) { + result = result === undefined ? current : (result + current); + } + } + return result; + } + + /** + * The base implementation of `_.times` without support for iteratee shorthands + * or max array length checks. + * + * @private + * @param {number} n The number of times to invoke `iteratee`. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns the array of results. + */ + function baseTimes(n, iteratee) { + var index = -1, + result = Array(n); + + while (++index < n) { + result[index] = iteratee(index); + } + return result; + } + + /** + * The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array + * of key-value pairs for `object` corresponding to the property names of `props`. + * + * @private + * @param {Object} object The object to query. + * @param {Array} props The property names to get values for. + * @returns {Object} Returns the key-value pairs. + */ + function baseToPairs(object, props) { + return arrayMap(props, function(key) { + return [key, object[key]]; + }); + } + + /** + * The base implementation of `_.unary` without support for storing metadata. + * + * @private + * @param {Function} func The function to cap arguments for. + * @returns {Function} Returns the new capped function. + */ + function baseUnary(func) { + return function(value) { + return func(value); + }; + } + + /** + * The base implementation of `_.values` and `_.valuesIn` which creates an + * array of `object` property values corresponding to the property names + * of `props`. + * + * @private + * @param {Object} object The object to query. + * @param {Array} props The property names to get values for. + * @returns {Object} Returns the array of property values. + */ + function baseValues(object, props) { + return arrayMap(props, function(key) { + return object[key]; + }); + } + + /** + * Checks if a `cache` value for `key` exists. + * + * @private + * @param {Object} cache The cache to query. + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ + function cacheHas(cache, key) { + return cache.has(key); + } + + /** + * Used by `_.trim` and `_.trimStart` to get the index of the first string symbol + * that is not found in the character symbols. + * + * @private + * @param {Array} strSymbols The string symbols to inspect. + * @param {Array} chrSymbols The character symbols to find. + * @returns {number} Returns the index of the first unmatched string symbol. + */ + function charsStartIndex(strSymbols, chrSymbols) { + var index = -1, + length = strSymbols.length; + + while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} + return index; + } + + /** + * Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol + * that is not found in the character symbols. + * + * @private + * @param {Array} strSymbols The string symbols to inspect. + * @param {Array} chrSymbols The character symbols to find. + * @returns {number} Returns the index of the last unmatched string symbol. + */ + function charsEndIndex(strSymbols, chrSymbols) { + var index = strSymbols.length; + + while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} + return index; + } + + /** + * Gets the number of `placeholder` occurrences in `array`. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} placeholder The placeholder to search for. + * @returns {number} Returns the placeholder count. + */ + function countHolders(array, placeholder) { + var length = array.length, + result = 0; + + while (length--) { + if (array[length] === placeholder) { + ++result; + } + } + return result; + } + + /** + * Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A + * letters to basic Latin letters. + * + * @private + * @param {string} letter The matched letter to deburr. + * @returns {string} Returns the deburred letter. + */ + var deburrLetter = basePropertyOf(deburredLetters); + + /** + * Used by `_.escape` to convert characters to HTML entities. + * + * @private + * @param {string} chr The matched character to escape. + * @returns {string} Returns the escaped character. + */ + var escapeHtmlChar = basePropertyOf(htmlEscapes); + + /** + * Used by `_.template` to escape characters for inclusion in compiled string literals. + * + * @private + * @param {string} chr The matched character to escape. + * @returns {string} Returns the escaped character. + */ + function escapeStringChar(chr) { + return '\\' + stringEscapes[chr]; + } + + /** + * Gets the value at `key` of `object`. + * + * @private + * @param {Object} [object] The object to query. + * @param {string} key The key of the property to get. + * @returns {*} Returns the property value. + */ + function getValue(object, key) { + return object == null ? undefined : object[key]; + } + + /** + * Checks if `string` contains Unicode symbols. + * + * @private + * @param {string} string The string to inspect. + * @returns {boolean} Returns `true` if a symbol is found, else `false`. + */ + function hasUnicode(string) { + return reHasUnicode.test(string); + } + + /** + * Checks if `string` contains a word composed of Unicode symbols. + * + * @private + * @param {string} string The string to inspect. + * @returns {boolean} Returns `true` if a word is found, else `false`. + */ + function hasUnicodeWord(string) { + return reHasUnicodeWord.test(string); + } + + /** + * Converts `iterator` to an array. + * + * @private + * @param {Object} iterator The iterator to convert. + * @returns {Array} Returns the converted array. + */ + function iteratorToArray(iterator) { + var data, + result = []; + + while (!(data = iterator.next()).done) { + result.push(data.value); + } + return result; + } + + /** + * Converts `map` to its key-value pairs. + * + * @private + * @param {Object} map The map to convert. + * @returns {Array} Returns the key-value pairs. + */ + function mapToArray(map) { + var index = -1, + result = Array(map.size); + + map.forEach(function(value, key) { + result[++index] = [key, value]; + }); + return result; + } + + /** + * Creates a unary function that invokes `func` with its argument transformed. + * + * @private + * @param {Function} func The function to wrap. + * @param {Function} transform The argument transform. + * @returns {Function} Returns the new function. + */ + function overArg(func, transform) { + return function(arg) { + return func(transform(arg)); + }; + } + + /** + * Replaces all `placeholder` elements in `array` with an internal placeholder + * and returns an array of their indexes. + * + * @private + * @param {Array} array The array to modify. + * @param {*} placeholder The placeholder to replace. + * @returns {Array} Returns the new array of placeholder indexes. + */ + function replaceHolders(array, placeholder) { + var index = -1, + length = array.length, + resIndex = 0, + result = []; + + while (++index < length) { + var value = array[index]; + if (value === placeholder || value === PLACEHOLDER) { + array[index] = PLACEHOLDER; + result[resIndex++] = index; + } + } + return result; + } + + /** + * Gets the value at `key`, unless `key` is "__proto__". + * + * @private + * @param {Object} object The object to query. + * @param {string} key The key of the property to get. + * @returns {*} Returns the property value. + */ + function safeGet(object, key) { + return key == '__proto__' + ? undefined + : object[key]; + } + + /** + * Converts `set` to an array of its values. + * + * @private + * @param {Object} set The set to convert. + * @returns {Array} Returns the values. + */ + function setToArray(set) { + var index = -1, + result = Array(set.size); + + set.forEach(function(value) { + result[++index] = value; + }); + return result; + } + + /** + * Converts `set` to its value-value pairs. + * + * @private + * @param {Object} set The set to convert. + * @returns {Array} Returns the value-value pairs. + */ + function setToPairs(set) { + var index = -1, + result = Array(set.size); + + set.forEach(function(value) { + result[++index] = [value, value]; + }); + return result; + } + + /** + * A specialized version of `_.indexOf` which performs strict equality + * comparisons of values, i.e. `===`. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} fromIndex The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function strictIndexOf(array, value, fromIndex) { + var index = fromIndex - 1, + length = array.length; + + while (++index < length) { + if (array[index] === value) { + return index; + } + } + return -1; + } + + /** + * A specialized version of `_.lastIndexOf` which performs strict equality + * comparisons of values, i.e. `===`. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} fromIndex The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function strictLastIndexOf(array, value, fromIndex) { + var index = fromIndex + 1; + while (index--) { + if (array[index] === value) { + return index; + } + } + return index; + } + + /** + * Gets the number of symbols in `string`. + * + * @private + * @param {string} string The string to inspect. + * @returns {number} Returns the string size. + */ + function stringSize(string) { + return hasUnicode(string) + ? unicodeSize(string) + : asciiSize(string); + } + + /** + * Converts `string` to an array. + * + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the converted array. + */ + function stringToArray(string) { + return hasUnicode(string) + ? unicodeToArray(string) + : asciiToArray(string); + } + + /** + * Used by `_.unescape` to convert HTML entities to characters. + * + * @private + * @param {string} chr The matched character to unescape. + * @returns {string} Returns the unescaped character. + */ + var unescapeHtmlChar = basePropertyOf(htmlUnescapes); + + /** + * Gets the size of a Unicode `string`. + * + * @private + * @param {string} string The string inspect. + * @returns {number} Returns the string size. + */ + function unicodeSize(string) { + var result = reUnicode.lastIndex = 0; + while (reUnicode.test(string)) { + ++result; + } + return result; + } + + /** + * Converts a Unicode `string` to an array. + * + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the converted array. + */ + function unicodeToArray(string) { + return string.match(reUnicode) || []; + } + + /** + * Splits a Unicode `string` into an array of its words. + * + * @private + * @param {string} The string to inspect. + * @returns {Array} Returns the words of `string`. + */ + function unicodeWords(string) { + return string.match(reUnicodeWord) || []; + } + + /*--------------------------------------------------------------------------*/ + + /** + * Create a new pristine `lodash` function using the `context` object. + * + * @static + * @memberOf _ + * @since 1.1.0 + * @category Util + * @param {Object} [context=root] The context object. + * @returns {Function} Returns a new `lodash` function. + * @example + * + * _.mixin({ 'foo': _.constant('foo') }); + * + * var lodash = _.runInContext(); + * lodash.mixin({ 'bar': lodash.constant('bar') }); + * + * _.isFunction(_.foo); + * // => true + * _.isFunction(_.bar); + * // => false + * + * lodash.isFunction(lodash.foo); + * // => false + * lodash.isFunction(lodash.bar); + * // => true + * + * // Create a suped-up `defer` in Node.js. + * var defer = _.runInContext({ 'setTimeout': setImmediate }).defer; + */ + var runInContext = (function runInContext(context) { + context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps)); + + /** Built-in constructor references. */ + var Array = context.Array, + Date = context.Date, + Error = context.Error, + Function = context.Function, + Math = context.Math, + Object = context.Object, + RegExp = context.RegExp, + String = context.String, + TypeError = context.TypeError; + + /** Used for built-in method references. */ + var arrayProto = Array.prototype, + funcProto = Function.prototype, + objectProto = Object.prototype; + + /** Used to detect overreaching core-js shims. */ + var coreJsData = context['__core-js_shared__']; + + /** Used to resolve the decompiled source of functions. */ + var funcToString = funcProto.toString; + + /** Used to check objects for own properties. */ + var hasOwnProperty = objectProto.hasOwnProperty; + + /** Used to generate unique IDs. */ + var idCounter = 0; + + /** Used to detect methods masquerading as native. */ + var maskSrcKey = (function() { + var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || ''); + return uid ? ('Symbol(src)_1.' + uid) : ''; + }()); + + /** + * Used to resolve the + * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring) + * of values. + */ + var nativeObjectToString = objectProto.toString; + + /** Used to infer the `Object` constructor. */ + var objectCtorString = funcToString.call(Object); + + /** Used to restore the original `_` reference in `_.noConflict`. */ + var oldDash = root._; + + /** Used to detect if a method is native. */ + var reIsNative = RegExp('^' + + funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\$&') + .replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$' + ); + + /** Built-in value references. */ + var Buffer = moduleExports ? context.Buffer : undefined, + Symbol = context.Symbol, + Uint8Array = context.Uint8Array, + allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined, + getPrototype = overArg(Object.getPrototypeOf, Object), + objectCreate = Object.create, + propertyIsEnumerable = objectProto.propertyIsEnumerable, + splice = arrayProto.splice, + spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined, + symIterator = Symbol ? Symbol.iterator : undefined, + symToStringTag = Symbol ? Symbol.toStringTag : undefined; + + var defineProperty = (function() { + try { + var func = getNative(Object, 'defineProperty'); + func({}, '', {}); + return func; + } catch (e) {} + }()); + + /** Mocked built-ins. */ + var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout, + ctxNow = Date && Date.now !== root.Date.now && Date.now, + ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout; + + /* Built-in method references for those with the same name as other `lodash` methods. */ + var nativeCeil = Math.ceil, + nativeFloor = Math.floor, + nativeGetSymbols = Object.getOwnPropertySymbols, + nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined, + nativeIsFinite = context.isFinite, + nativeJoin = arrayProto.join, + nativeKeys = overArg(Object.keys, Object), + nativeMax = Math.max, + nativeMin = Math.min, + nativeNow = Date.now, + nativeParseInt = context.parseInt, + nativeRandom = Math.random, + nativeReverse = arrayProto.reverse; + + /* Built-in method references that are verified to be native. */ + var DataView = getNative(context, 'DataView'), + Map = getNative(context, 'Map'), + Promise = getNative(context, 'Promise'), + Set = getNative(context, 'Set'), + WeakMap = getNative(context, 'WeakMap'), + nativeCreate = getNative(Object, 'create'); + + /** Used to store function metadata. */ + var metaMap = WeakMap && new WeakMap; + + /** Used to lookup unminified function names. */ + var realNames = {}; + + /** Used to detect maps, sets, and weakmaps. */ + var dataViewCtorString = toSource(DataView), + mapCtorString = toSource(Map), + promiseCtorString = toSource(Promise), + setCtorString = toSource(Set), + weakMapCtorString = toSource(WeakMap); + + /** Used to convert symbols to primitives and strings. */ + var symbolProto = Symbol ? Symbol.prototype : undefined, + symbolValueOf = symbolProto ? symbolProto.valueOf : undefined, + symbolToString = symbolProto ? symbolProto.toString : undefined; + + /*------------------------------------------------------------------------*/ + + /** + * Creates a `lodash` object which wraps `value` to enable implicit method + * chain sequences. Methods that operate on and return arrays, collections, + * and functions can be chained together. Methods that retrieve a single value + * or may return a primitive value will automatically end the chain sequence + * and return the unwrapped value. Otherwise, the value must be unwrapped + * with `_#value`. + * + * Explicit chain sequences, which must be unwrapped with `_#value`, may be + * enabled using `_.chain`. + * + * The execution of chained methods is lazy, that is, it's deferred until + * `_#value` is implicitly or explicitly called. + * + * Lazy evaluation allows several methods to support shortcut fusion. + * Shortcut fusion is an optimization to merge iteratee calls; this avoids + * the creation of intermediate arrays and can greatly reduce the number of + * iteratee executions. Sections of a chain sequence qualify for shortcut + * fusion if the section is applied to an array and iteratees accept only + * one argument. The heuristic for whether a section qualifies for shortcut + * fusion is subject to change. + * + * Chaining is supported in custom builds as long as the `_#value` method is + * directly or indirectly included in the build. + * + * In addition to lodash methods, wrappers have `Array` and `String` methods. + * + * The wrapper `Array` methods are: + * `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift` + * + * The wrapper `String` methods are: + * `replace` and `split` + * + * The wrapper methods that support shortcut fusion are: + * `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`, + * `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`, + * `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray` + * + * The chainable wrapper methods are: + * `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`, + * `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`, + * `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`, + * `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`, + * `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`, + * `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`, + * `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`, + * `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`, + * `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`, + * `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`, + * `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`, + * `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`, + * `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`, + * `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`, + * `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`, + * `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`, + * `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`, + * `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`, + * `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`, + * `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`, + * `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`, + * `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`, + * `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`, + * `zipObject`, `zipObjectDeep`, and `zipWith` + * + * The wrapper methods that are **not** chainable by default are: + * `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`, + * `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`, + * `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`, + * `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`, + * `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`, + * `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`, + * `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`, + * `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`, + * `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`, + * `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`, + * `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`, + * `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`, + * `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`, + * `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`, + * `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`, + * `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`, + * `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`, + * `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`, + * `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`, + * `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`, + * `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`, + * `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`, + * `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`, + * `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`, + * `upperFirst`, `value`, and `words` + * + * @name _ + * @constructor + * @category Seq + * @param {*} value The value to wrap in a `lodash` instance. + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * function square(n) { + * return n * n; + * } + * + * var wrapped = _([1, 2, 3]); + * + * // Returns an unwrapped value. + * wrapped.reduce(_.add); + * // => 6 + * + * // Returns a wrapped value. + * var squares = wrapped.map(square); + * + * _.isArray(squares); + * // => false + * + * _.isArray(squares.value()); + * // => true + */ + function lodash(value) { + if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) { + if (value instanceof LodashWrapper) { + return value; + } + if (hasOwnProperty.call(value, '__wrapped__')) { + return wrapperClone(value); + } + } + return new LodashWrapper(value); + } + + /** + * The base implementation of `_.create` without support for assigning + * properties to the created object. + * + * @private + * @param {Object} proto The object to inherit from. + * @returns {Object} Returns the new object. + */ + var baseCreate = (function() { + function object() {} + return function(proto) { + if (!isObject(proto)) { + return {}; + } + if (objectCreate) { + return objectCreate(proto); + } + object.prototype = proto; + var result = new object; + object.prototype = undefined; + return result; + }; + }()); + + /** + * The function whose prototype chain sequence wrappers inherit from. + * + * @private + */ + function baseLodash() { + // No operation performed. + } + + /** + * The base constructor for creating `lodash` wrapper objects. + * + * @private + * @param {*} value The value to wrap. + * @param {boolean} [chainAll] Enable explicit method chain sequences. + */ + function LodashWrapper(value, chainAll) { + this.__wrapped__ = value; + this.__actions__ = []; + this.__chain__ = !!chainAll; + this.__index__ = 0; + this.__values__ = undefined; + } + + /** + * By default, the template delimiters used by lodash are like those in + * embedded Ruby (ERB) as well as ES2015 template strings. Change the + * following template settings to use alternative delimiters. + * + * @static + * @memberOf _ + * @type {Object} + */ + lodash.templateSettings = { + + /** + * Used to detect `data` property values to be HTML-escaped. + * + * @memberOf _.templateSettings + * @type {RegExp} + */ + 'escape': reEscape, + + /** + * Used to detect code to be evaluated. + * + * @memberOf _.templateSettings + * @type {RegExp} + */ + 'evaluate': reEvaluate, + + /** + * Used to detect `data` property values to inject. + * + * @memberOf _.templateSettings + * @type {RegExp} + */ + 'interpolate': reInterpolate, + + /** + * Used to reference the data object in the template text. + * + * @memberOf _.templateSettings + * @type {string} + */ + 'variable': '', + + /** + * Used to import variables into the compiled template. + * + * @memberOf _.templateSettings + * @type {Object} + */ + 'imports': { + + /** + * A reference to the `lodash` function. + * + * @memberOf _.templateSettings.imports + * @type {Function} + */ + '_': lodash + } + }; + + // Ensure wrappers are instances of `baseLodash`. + lodash.prototype = baseLodash.prototype; + lodash.prototype.constructor = lodash; + + LodashWrapper.prototype = baseCreate(baseLodash.prototype); + LodashWrapper.prototype.constructor = LodashWrapper; + + /*------------------------------------------------------------------------*/ + + /** + * Creates a lazy wrapper object which wraps `value` to enable lazy evaluation. + * + * @private + * @constructor + * @param {*} value The value to wrap. + */ + function LazyWrapper(value) { + this.__wrapped__ = value; + this.__actions__ = []; + this.__dir__ = 1; + this.__filtered__ = false; + this.__iteratees__ = []; + this.__takeCount__ = MAX_ARRAY_LENGTH; + this.__views__ = []; + } + + /** + * Creates a clone of the lazy wrapper object. + * + * @private + * @name clone + * @memberOf LazyWrapper + * @returns {Object} Returns the cloned `LazyWrapper` object. + */ + function lazyClone() { + var result = new LazyWrapper(this.__wrapped__); + result.__actions__ = copyArray(this.__actions__); + result.__dir__ = this.__dir__; + result.__filtered__ = this.__filtered__; + result.__iteratees__ = copyArray(this.__iteratees__); + result.__takeCount__ = this.__takeCount__; + result.__views__ = copyArray(this.__views__); + return result; + } + + /** + * Reverses the direction of lazy iteration. + * + * @private + * @name reverse + * @memberOf LazyWrapper + * @returns {Object} Returns the new reversed `LazyWrapper` object. + */ + function lazyReverse() { + if (this.__filtered__) { + var result = new LazyWrapper(this); + result.__dir__ = -1; + result.__filtered__ = true; + } else { + result = this.clone(); + result.__dir__ *= -1; + } + return result; + } + + /** + * Extracts the unwrapped value from its lazy wrapper. + * + * @private + * @name value + * @memberOf LazyWrapper + * @returns {*} Returns the unwrapped value. + */ + function lazyValue() { + var array = this.__wrapped__.value(), + dir = this.__dir__, + isArr = isArray(array), + isRight = dir < 0, + arrLength = isArr ? array.length : 0, + view = getView(0, arrLength, this.__views__), + start = view.start, + end = view.end, + length = end - start, + index = isRight ? end : (start - 1), + iteratees = this.__iteratees__, + iterLength = iteratees.length, + resIndex = 0, + takeCount = nativeMin(length, this.__takeCount__); + + if (!isArr || (!isRight && arrLength == length && takeCount == length)) { + return baseWrapperValue(array, this.__actions__); + } + var result = []; + + outer: + while (length-- && resIndex < takeCount) { + index += dir; + + var iterIndex = -1, + value = array[index]; + + while (++iterIndex < iterLength) { + var data = iteratees[iterIndex], + iteratee = data.iteratee, + type = data.type, + computed = iteratee(value); + + if (type == LAZY_MAP_FLAG) { + value = computed; + } else if (!computed) { + if (type == LAZY_FILTER_FLAG) { + continue outer; + } else { + break outer; + } + } + } + result[resIndex++] = value; + } + return result; + } + + // Ensure `LazyWrapper` is an instance of `baseLodash`. + LazyWrapper.prototype = baseCreate(baseLodash.prototype); + LazyWrapper.prototype.constructor = LazyWrapper; + + /*------------------------------------------------------------------------*/ + + /** + * Creates a hash object. + * + * @private + * @constructor + * @param {Array} [entries] The key-value pairs to cache. + */ + function Hash(entries) { + var index = -1, + length = entries == null ? 0 : entries.length; + + this.clear(); + while (++index < length) { + var entry = entries[index]; + this.set(entry[0], entry[1]); + } + } + + /** + * Removes all key-value entries from the hash. + * + * @private + * @name clear + * @memberOf Hash + */ + function hashClear() { + this.__data__ = nativeCreate ? nativeCreate(null) : {}; + this.size = 0; + } + + /** + * Removes `key` and its value from the hash. + * + * @private + * @name delete + * @memberOf Hash + * @param {Object} hash The hash to modify. + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. + */ + function hashDelete(key) { + var result = this.has(key) && delete this.__data__[key]; + this.size -= result ? 1 : 0; + return result; + } + + /** + * Gets the hash value for `key`. + * + * @private + * @name get + * @memberOf Hash + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. + */ + function hashGet(key) { + var data = this.__data__; + if (nativeCreate) { + var result = data[key]; + return result === HASH_UNDEFINED ? undefined : result; + } + return hasOwnProperty.call(data, key) ? data[key] : undefined; + } + + /** + * Checks if a hash value for `key` exists. + * + * @private + * @name has + * @memberOf Hash + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ + function hashHas(key) { + var data = this.__data__; + return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key); + } + + /** + * Sets the hash `key` to `value`. + * + * @private + * @name set + * @memberOf Hash + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the hash instance. + */ + function hashSet(key, value) { + var data = this.__data__; + this.size += this.has(key) ? 0 : 1; + data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value; + return this; + } + + // Add methods to `Hash`. + Hash.prototype.clear = hashClear; + Hash.prototype['delete'] = hashDelete; + Hash.prototype.get = hashGet; + Hash.prototype.has = hashHas; + Hash.prototype.set = hashSet; + + /*------------------------------------------------------------------------*/ + + /** + * Creates an list cache object. + * + * @private + * @constructor + * @param {Array} [entries] The key-value pairs to cache. + */ + function ListCache(entries) { + var index = -1, + length = entries == null ? 0 : entries.length; + + this.clear(); + while (++index < length) { + var entry = entries[index]; + this.set(entry[0], entry[1]); + } + } + + /** + * Removes all key-value entries from the list cache. + * + * @private + * @name clear + * @memberOf ListCache + */ + function listCacheClear() { + this.__data__ = []; + this.size = 0; + } + + /** + * Removes `key` and its value from the list cache. + * + * @private + * @name delete + * @memberOf ListCache + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. + */ + function listCacheDelete(key) { + var data = this.__data__, + index = assocIndexOf(data, key); + + if (index < 0) { + return false; + } + var lastIndex = data.length - 1; + if (index == lastIndex) { + data.pop(); + } else { + splice.call(data, index, 1); + } + --this.size; + return true; + } + + /** + * Gets the list cache value for `key`. + * + * @private + * @name get + * @memberOf ListCache + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. + */ + function listCacheGet(key) { + var data = this.__data__, + index = assocIndexOf(data, key); + + return index < 0 ? undefined : data[index][1]; + } + + /** + * Checks if a list cache value for `key` exists. + * + * @private + * @name has + * @memberOf ListCache + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ + function listCacheHas(key) { + return assocIndexOf(this.__data__, key) > -1; + } + + /** + * Sets the list cache `key` to `value`. + * + * @private + * @name set + * @memberOf ListCache + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the list cache instance. + */ + function listCacheSet(key, value) { + var data = this.__data__, + index = assocIndexOf(data, key); + + if (index < 0) { + ++this.size; + data.push([key, value]); + } else { + data[index][1] = value; + } + return this; + } + + // Add methods to `ListCache`. + ListCache.prototype.clear = listCacheClear; + ListCache.prototype['delete'] = listCacheDelete; + ListCache.prototype.get = listCacheGet; + ListCache.prototype.has = listCacheHas; + ListCache.prototype.set = listCacheSet; + + /*------------------------------------------------------------------------*/ + + /** + * Creates a map cache object to store key-value pairs. + * + * @private + * @constructor + * @param {Array} [entries] The key-value pairs to cache. + */ + function MapCache(entries) { + var index = -1, + length = entries == null ? 0 : entries.length; + + this.clear(); + while (++index < length) { + var entry = entries[index]; + this.set(entry[0], entry[1]); + } + } + + /** + * Removes all key-value entries from the map. + * + * @private + * @name clear + * @memberOf MapCache + */ + function mapCacheClear() { + this.size = 0; + this.__data__ = { + 'hash': new Hash, + 'map': new (Map || ListCache), + 'string': new Hash + }; + } + + /** + * Removes `key` and its value from the map. + * + * @private + * @name delete + * @memberOf MapCache + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. + */ + function mapCacheDelete(key) { + var result = getMapData(this, key)['delete'](key); + this.size -= result ? 1 : 0; + return result; + } + + /** + * Gets the map value for `key`. + * + * @private + * @name get + * @memberOf MapCache + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. + */ + function mapCacheGet(key) { + return getMapData(this, key).get(key); + } + + /** + * Checks if a map value for `key` exists. + * + * @private + * @name has + * @memberOf MapCache + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ + function mapCacheHas(key) { + return getMapData(this, key).has(key); + } + + /** + * Sets the map `key` to `value`. + * + * @private + * @name set + * @memberOf MapCache + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the map cache instance. + */ + function mapCacheSet(key, value) { + var data = getMapData(this, key), + size = data.size; + + data.set(key, value); + this.size += data.size == size ? 0 : 1; + return this; + } + + // Add methods to `MapCache`. + MapCache.prototype.clear = mapCacheClear; + MapCache.prototype['delete'] = mapCacheDelete; + MapCache.prototype.get = mapCacheGet; + MapCache.prototype.has = mapCacheHas; + MapCache.prototype.set = mapCacheSet; + + /*------------------------------------------------------------------------*/ + + /** + * + * Creates an array cache object to store unique values. + * + * @private + * @constructor + * @param {Array} [values] The values to cache. + */ + function SetCache(values) { + var index = -1, + length = values == null ? 0 : values.length; + + this.__data__ = new MapCache; + while (++index < length) { + this.add(values[index]); + } + } + + /** + * Adds `value` to the array cache. + * + * @private + * @name add + * @memberOf SetCache + * @alias push + * @param {*} value The value to cache. + * @returns {Object} Returns the cache instance. + */ + function setCacheAdd(value) { + this.__data__.set(value, HASH_UNDEFINED); + return this; + } + + /** + * Checks if `value` is in the array cache. + * + * @private + * @name has + * @memberOf SetCache + * @param {*} value The value to search for. + * @returns {number} Returns `true` if `value` is found, else `false`. + */ + function setCacheHas(value) { + return this.__data__.has(value); + } + + // Add methods to `SetCache`. + SetCache.prototype.add = SetCache.prototype.push = setCacheAdd; + SetCache.prototype.has = setCacheHas; + + /*------------------------------------------------------------------------*/ + + /** + * Creates a stack cache object to store key-value pairs. + * + * @private + * @constructor + * @param {Array} [entries] The key-value pairs to cache. + */ + function Stack(entries) { + var data = this.__data__ = new ListCache(entries); + this.size = data.size; + } + + /** + * Removes all key-value entries from the stack. + * + * @private + * @name clear + * @memberOf Stack + */ + function stackClear() { + this.__data__ = new ListCache; + this.size = 0; + } + + /** + * Removes `key` and its value from the stack. + * + * @private + * @name delete + * @memberOf Stack + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. + */ + function stackDelete(key) { + var data = this.__data__, + result = data['delete'](key); + + this.size = data.size; + return result; + } + + /** + * Gets the stack value for `key`. + * + * @private + * @name get + * @memberOf Stack + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. + */ + function stackGet(key) { + return this.__data__.get(key); + } + + /** + * Checks if a stack value for `key` exists. + * + * @private + * @name has + * @memberOf Stack + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ + function stackHas(key) { + return this.__data__.has(key); + } + + /** + * Sets the stack `key` to `value`. + * + * @private + * @name set + * @memberOf Stack + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the stack cache instance. + */ + function stackSet(key, value) { + var data = this.__data__; + if (data instanceof ListCache) { + var pairs = data.__data__; + if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) { + pairs.push([key, value]); + this.size = ++data.size; + return this; + } + data = this.__data__ = new MapCache(pairs); + } + data.set(key, value); + this.size = data.size; + return this; + } + + // Add methods to `Stack`. + Stack.prototype.clear = stackClear; + Stack.prototype['delete'] = stackDelete; + Stack.prototype.get = stackGet; + Stack.prototype.has = stackHas; + Stack.prototype.set = stackSet; + + /*------------------------------------------------------------------------*/ + + /** + * Creates an array of the enumerable property names of the array-like `value`. + * + * @private + * @param {*} value The value to query. + * @param {boolean} inherited Specify returning inherited property names. + * @returns {Array} Returns the array of property names. + */ + function arrayLikeKeys(value, inherited) { + var isArr = isArray(value), + isArg = !isArr && isArguments(value), + isBuff = !isArr && !isArg && isBuffer(value), + isType = !isArr && !isArg && !isBuff && isTypedArray(value), + skipIndexes = isArr || isArg || isBuff || isType, + result = skipIndexes ? baseTimes(value.length, String) : [], + length = result.length; + + for (var key in value) { + if ((inherited || hasOwnProperty.call(value, key)) && + !(skipIndexes && ( + // Safari 9 has enumerable `arguments.length` in strict mode. + key == 'length' || + // Node.js 0.10 has enumerable non-index properties on buffers. + (isBuff && (key == 'offset' || key == 'parent')) || + // PhantomJS 2 has enumerable non-index properties on typed arrays. + (isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) || + // Skip index properties. + isIndex(key, length) + ))) { + result.push(key); + } + } + return result; + } + + /** + * A specialized version of `_.sample` for arrays. + * + * @private + * @param {Array} array The array to sample. + * @returns {*} Returns the random element. + */ + function arraySample(array) { + var length = array.length; + return length ? array[baseRandom(0, length - 1)] : undefined; + } + + /** + * A specialized version of `_.sampleSize` for arrays. + * + * @private + * @param {Array} array The array to sample. + * @param {number} n The number of elements to sample. + * @returns {Array} Returns the random elements. + */ + function arraySampleSize(array, n) { + return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length)); + } + + /** + * A specialized version of `_.shuffle` for arrays. + * + * @private + * @param {Array} array The array to shuffle. + * @returns {Array} Returns the new shuffled array. + */ + function arrayShuffle(array) { + return shuffleSelf(copyArray(array)); + } + + /** + * This function is like `assignValue` except that it doesn't assign + * `undefined` values. + * + * @private + * @param {Object} object The object to modify. + * @param {string} key The key of the property to assign. + * @param {*} value The value to assign. + */ + function assignMergeValue(object, key, value) { + if ((value !== undefined && !eq(object[key], value)) || + (value === undefined && !(key in object))) { + baseAssignValue(object, key, value); + } + } + + /** + * Assigns `value` to `key` of `object` if the existing value is not equivalent + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. + * + * @private + * @param {Object} object The object to modify. + * @param {string} key The key of the property to assign. + * @param {*} value The value to assign. + */ + function assignValue(object, key, value) { + var objValue = object[key]; + if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) || + (value === undefined && !(key in object))) { + baseAssignValue(object, key, value); + } + } + + /** + * Gets the index at which the `key` is found in `array` of key-value pairs. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} key The key to search for. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function assocIndexOf(array, key) { + var length = array.length; + while (length--) { + if (eq(array[length][0], key)) { + return length; + } + } + return -1; + } + + /** + * Aggregates elements of `collection` on `accumulator` with keys transformed + * by `iteratee` and values set by `setter`. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} setter The function to set `accumulator` values. + * @param {Function} iteratee The iteratee to transform keys. + * @param {Object} accumulator The initial aggregated object. + * @returns {Function} Returns `accumulator`. + */ + function baseAggregator(collection, setter, iteratee, accumulator) { + baseEach(collection, function(value, key, collection) { + setter(accumulator, value, iteratee(value), collection); + }); + return accumulator; + } + + /** + * The base implementation of `_.assign` without support for multiple sources + * or `customizer` functions. + * + * @private + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @returns {Object} Returns `object`. + */ + function baseAssign(object, source) { + return object && copyObject(source, keys(source), object); + } + + /** + * The base implementation of `_.assignIn` without support for multiple sources + * or `customizer` functions. + * + * @private + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @returns {Object} Returns `object`. + */ + function baseAssignIn(object, source) { + return object && copyObject(source, keysIn(source), object); + } + + /** + * The base implementation of `assignValue` and `assignMergeValue` without + * value checks. + * + * @private + * @param {Object} object The object to modify. + * @param {string} key The key of the property to assign. + * @param {*} value The value to assign. + */ + function baseAssignValue(object, key, value) { + if (key == '__proto__' && defineProperty) { + defineProperty(object, key, { + 'configurable': true, + 'enumerable': true, + 'value': value, + 'writable': true + }); + } else { + object[key] = value; + } + } + + /** + * The base implementation of `_.at` without support for individual paths. + * + * @private + * @param {Object} object The object to iterate over. + * @param {string[]} paths The property paths to pick. + * @returns {Array} Returns the picked elements. + */ + function baseAt(object, paths) { + var index = -1, + length = paths.length, + result = Array(length), + skip = object == null; + + while (++index < length) { + result[index] = skip ? undefined : get(object, paths[index]); + } + return result; + } + + /** + * The base implementation of `_.clamp` which doesn't coerce arguments. + * + * @private + * @param {number} number The number to clamp. + * @param {number} [lower] The lower bound. + * @param {number} upper The upper bound. + * @returns {number} Returns the clamped number. + */ + function baseClamp(number, lower, upper) { + if (number === number) { + if (upper !== undefined) { + number = number <= upper ? number : upper; + } + if (lower !== undefined) { + number = number >= lower ? number : lower; + } + } + return number; + } + + /** + * The base implementation of `_.clone` and `_.cloneDeep` which tracks + * traversed objects. + * + * @private + * @param {*} value The value to clone. + * @param {boolean} bitmask The bitmask flags. + * 1 - Deep clone + * 2 - Flatten inherited properties + * 4 - Clone symbols + * @param {Function} [customizer] The function to customize cloning. + * @param {string} [key] The key of `value`. + * @param {Object} [object] The parent object of `value`. + * @param {Object} [stack] Tracks traversed objects and their clone counterparts. + * @returns {*} Returns the cloned value. + */ + function baseClone(value, bitmask, customizer, key, object, stack) { + var result, + isDeep = bitmask & CLONE_DEEP_FLAG, + isFlat = bitmask & CLONE_FLAT_FLAG, + isFull = bitmask & CLONE_SYMBOLS_FLAG; + + if (customizer) { + result = object ? customizer(value, key, object, stack) : customizer(value); + } + if (result !== undefined) { + return result; + } + if (!isObject(value)) { + return value; + } + var isArr = isArray(value); + if (isArr) { + result = initCloneArray(value); + if (!isDeep) { + return copyArray(value, result); + } + } else { + var tag = getTag(value), + isFunc = tag == funcTag || tag == genTag; + + if (isBuffer(value)) { + return cloneBuffer(value, isDeep); + } + if (tag == objectTag || tag == argsTag || (isFunc && !object)) { + result = (isFlat || isFunc) ? {} : initCloneObject(value); + if (!isDeep) { + return isFlat + ? copySymbolsIn(value, baseAssignIn(result, value)) + : copySymbols(value, baseAssign(result, value)); + } + } else { + if (!cloneableTags[tag]) { + return object ? value : {}; + } + result = initCloneByTag(value, tag, isDeep); + } + } + // Check for circular references and return its corresponding clone. + stack || (stack = new Stack); + var stacked = stack.get(value); + if (stacked) { + return stacked; + } + stack.set(value, result); + + if (isSet(value)) { + value.forEach(function(subValue) { + result.add(baseClone(subValue, bitmask, customizer, subValue, value, stack)); + }); + + return result; + } + + if (isMap(value)) { + value.forEach(function(subValue, key) { + result.set(key, baseClone(subValue, bitmask, customizer, key, value, stack)); + }); + + return result; + } + + var keysFunc = isFull + ? (isFlat ? getAllKeysIn : getAllKeys) + : (isFlat ? keysIn : keys); + + var props = isArr ? undefined : keysFunc(value); + arrayEach(props || value, function(subValue, key) { + if (props) { + key = subValue; + subValue = value[key]; + } + // Recursively populate clone (susceptible to call stack limits). + assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack)); + }); + return result; + } + + /** + * The base implementation of `_.conforms` which doesn't clone `source`. + * + * @private + * @param {Object} source The object of property predicates to conform to. + * @returns {Function} Returns the new spec function. + */ + function baseConforms(source) { + var props = keys(source); + return function(object) { + return baseConformsTo(object, source, props); + }; + } + + /** + * The base implementation of `_.conformsTo` which accepts `props` to check. + * + * @private + * @param {Object} object The object to inspect. + * @param {Object} source The object of property predicates to conform to. + * @returns {boolean} Returns `true` if `object` conforms, else `false`. + */ + function baseConformsTo(object, source, props) { + var length = props.length; + if (object == null) { + return !length; + } + object = Object(object); + while (length--) { + var key = props[length], + predicate = source[key], + value = object[key]; + + if ((value === undefined && !(key in object)) || !predicate(value)) { + return false; + } + } + return true; + } + + /** + * The base implementation of `_.delay` and `_.defer` which accepts `args` + * to provide to `func`. + * + * @private + * @param {Function} func The function to delay. + * @param {number} wait The number of milliseconds to delay invocation. + * @param {Array} args The arguments to provide to `func`. + * @returns {number|Object} Returns the timer id or timeout object. + */ + function baseDelay(func, wait, args) { + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + return setTimeout(function() { func.apply(undefined, args); }, wait); + } + + /** + * The base implementation of methods like `_.difference` without support + * for excluding multiple arrays or iteratee shorthands. + * + * @private + * @param {Array} array The array to inspect. + * @param {Array} values The values to exclude. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of filtered values. + */ + function baseDifference(array, values, iteratee, comparator) { + var index = -1, + includes = arrayIncludes, + isCommon = true, + length = array.length, + result = [], + valuesLength = values.length; + + if (!length) { + return result; + } + if (iteratee) { + values = arrayMap(values, baseUnary(iteratee)); + } + if (comparator) { + includes = arrayIncludesWith; + isCommon = false; + } + else if (values.length >= LARGE_ARRAY_SIZE) { + includes = cacheHas; + isCommon = false; + values = new SetCache(values); + } + outer: + while (++index < length) { + var value = array[index], + computed = iteratee == null ? value : iteratee(value); + + value = (comparator || value !== 0) ? value : 0; + if (isCommon && computed === computed) { + var valuesIndex = valuesLength; + while (valuesIndex--) { + if (values[valuesIndex] === computed) { + continue outer; + } + } + result.push(value); + } + else if (!includes(values, computed, comparator)) { + result.push(value); + } + } + return result; + } + + /** + * The base implementation of `_.forEach` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array|Object} Returns `collection`. + */ + var baseEach = createBaseEach(baseForOwn); + + /** + * The base implementation of `_.forEachRight` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array|Object} Returns `collection`. + */ + var baseEachRight = createBaseEach(baseForOwnRight, true); + + /** + * The base implementation of `_.every` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if all elements pass the predicate check, + * else `false` + */ + function baseEvery(collection, predicate) { + var result = true; + baseEach(collection, function(value, index, collection) { + result = !!predicate(value, index, collection); + return result; + }); + return result; + } + + /** + * The base implementation of methods like `_.max` and `_.min` which accepts a + * `comparator` to determine the extremum value. + * + * @private + * @param {Array} array The array to iterate over. + * @param {Function} iteratee The iteratee invoked per iteration. + * @param {Function} comparator The comparator used to compare values. + * @returns {*} Returns the extremum value. + */ + function baseExtremum(array, iteratee, comparator) { + var index = -1, + length = array.length; + + while (++index < length) { + var value = array[index], + current = iteratee(value); + + if (current != null && (computed === undefined + ? (current === current && !isSymbol(current)) + : comparator(current, computed) + )) { + var computed = current, + result = value; + } + } + return result; + } + + /** + * The base implementation of `_.fill` without an iteratee call guard. + * + * @private + * @param {Array} array The array to fill. + * @param {*} value The value to fill `array` with. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns `array`. + */ + function baseFill(array, value, start, end) { + var length = array.length; + + start = toInteger(start); + if (start < 0) { + start = -start > length ? 0 : (length + start); + } + end = (end === undefined || end > length) ? length : toInteger(end); + if (end < 0) { + end += length; + } + end = start > end ? 0 : toLength(end); + while (start < end) { + array[start++] = value; + } + return array; + } + + /** + * The base implementation of `_.filter` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {Array} Returns the new filtered array. + */ + function baseFilter(collection, predicate) { + var result = []; + baseEach(collection, function(value, index, collection) { + if (predicate(value, index, collection)) { + result.push(value); + } + }); + return result; + } + + /** + * The base implementation of `_.flatten` with support for restricting flattening. + * + * @private + * @param {Array} array The array to flatten. + * @param {number} depth The maximum recursion depth. + * @param {boolean} [predicate=isFlattenable] The function invoked per iteration. + * @param {boolean} [isStrict] Restrict to values that pass `predicate` checks. + * @param {Array} [result=[]] The initial result value. + * @returns {Array} Returns the new flattened array. + */ + function baseFlatten(array, depth, predicate, isStrict, result) { + var index = -1, + length = array.length; + + predicate || (predicate = isFlattenable); + result || (result = []); + + while (++index < length) { + var value = array[index]; + if (depth > 0 && predicate(value)) { + if (depth > 1) { + // Recursively flatten arrays (susceptible to call stack limits). + baseFlatten(value, depth - 1, predicate, isStrict, result); + } else { + arrayPush(result, value); + } + } else if (!isStrict) { + result[result.length] = value; + } + } + return result; + } + + /** + * The base implementation of `baseForOwn` which iterates over `object` + * properties returned by `keysFunc` and invokes `iteratee` for each property. + * Iteratee functions may exit iteration early by explicitly returning `false`. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {Function} keysFunc The function to get the keys of `object`. + * @returns {Object} Returns `object`. + */ + var baseFor = createBaseFor(); + + /** + * This function is like `baseFor` except that it iterates over properties + * in the opposite order. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {Function} keysFunc The function to get the keys of `object`. + * @returns {Object} Returns `object`. + */ + var baseForRight = createBaseFor(true); + + /** + * The base implementation of `_.forOwn` without support for iteratee shorthands. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Object} Returns `object`. + */ + function baseForOwn(object, iteratee) { + return object && baseFor(object, iteratee, keys); + } + + /** + * The base implementation of `_.forOwnRight` without support for iteratee shorthands. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Object} Returns `object`. + */ + function baseForOwnRight(object, iteratee) { + return object && baseForRight(object, iteratee, keys); + } + + /** + * The base implementation of `_.functions` which creates an array of + * `object` function property names filtered from `props`. + * + * @private + * @param {Object} object The object to inspect. + * @param {Array} props The property names to filter. + * @returns {Array} Returns the function names. + */ + function baseFunctions(object, props) { + return arrayFilter(props, function(key) { + return isFunction(object[key]); + }); + } + + /** + * The base implementation of `_.get` without support for default values. + * + * @private + * @param {Object} object The object to query. + * @param {Array|string} path The path of the property to get. + * @returns {*} Returns the resolved value. + */ + function baseGet(object, path) { + path = castPath(path, object); + + var index = 0, + length = path.length; + + while (object != null && index < length) { + object = object[toKey(path[index++])]; + } + return (index && index == length) ? object : undefined; + } + + /** + * The base implementation of `getAllKeys` and `getAllKeysIn` which uses + * `keysFunc` and `symbolsFunc` to get the enumerable property names and + * symbols of `object`. + * + * @private + * @param {Object} object The object to query. + * @param {Function} keysFunc The function to get the keys of `object`. + * @param {Function} symbolsFunc The function to get the symbols of `object`. + * @returns {Array} Returns the array of property names and symbols. + */ + function baseGetAllKeys(object, keysFunc, symbolsFunc) { + var result = keysFunc(object); + return isArray(object) ? result : arrayPush(result, symbolsFunc(object)); + } + + /** + * The base implementation of `getTag` without fallbacks for buggy environments. + * + * @private + * @param {*} value The value to query. + * @returns {string} Returns the `toStringTag`. + */ + function baseGetTag(value) { + if (value == null) { + return value === undefined ? undefinedTag : nullTag; + } + return (symToStringTag && symToStringTag in Object(value)) + ? getRawTag(value) + : objectToString(value); + } + + /** + * The base implementation of `_.gt` which doesn't coerce arguments. + * + * @private + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is greater than `other`, + * else `false`. + */ + function baseGt(value, other) { + return value > other; + } + + /** + * The base implementation of `_.has` without support for deep paths. + * + * @private + * @param {Object} [object] The object to query. + * @param {Array|string} key The key to check. + * @returns {boolean} Returns `true` if `key` exists, else `false`. + */ + function baseHas(object, key) { + return object != null && hasOwnProperty.call(object, key); + } + + /** + * The base implementation of `_.hasIn` without support for deep paths. + * + * @private + * @param {Object} [object] The object to query. + * @param {Array|string} key The key to check. + * @returns {boolean} Returns `true` if `key` exists, else `false`. + */ + function baseHasIn(object, key) { + return object != null && key in Object(object); + } + + /** + * The base implementation of `_.inRange` which doesn't coerce arguments. + * + * @private + * @param {number} number The number to check. + * @param {number} start The start of the range. + * @param {number} end The end of the range. + * @returns {boolean} Returns `true` if `number` is in the range, else `false`. + */ + function baseInRange(number, start, end) { + return number >= nativeMin(start, end) && number < nativeMax(start, end); + } + + /** + * The base implementation of methods like `_.intersection`, without support + * for iteratee shorthands, that accepts an array of arrays to inspect. + * + * @private + * @param {Array} arrays The arrays to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of shared values. + */ + function baseIntersection(arrays, iteratee, comparator) { + var includes = comparator ? arrayIncludesWith : arrayIncludes, + length = arrays[0].length, + othLength = arrays.length, + othIndex = othLength, + caches = Array(othLength), + maxLength = Infinity, + result = []; + + while (othIndex--) { + var array = arrays[othIndex]; + if (othIndex && iteratee) { + array = arrayMap(array, baseUnary(iteratee)); + } + maxLength = nativeMin(array.length, maxLength); + caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120)) + ? new SetCache(othIndex && array) + : undefined; + } + array = arrays[0]; + + var index = -1, + seen = caches[0]; + + outer: + while (++index < length && result.length < maxLength) { + var value = array[index], + computed = iteratee ? iteratee(value) : value; + + value = (comparator || value !== 0) ? value : 0; + if (!(seen + ? cacheHas(seen, computed) + : includes(result, computed, comparator) + )) { + othIndex = othLength; + while (--othIndex) { + var cache = caches[othIndex]; + if (!(cache + ? cacheHas(cache, computed) + : includes(arrays[othIndex], computed, comparator)) + ) { + continue outer; + } + } + if (seen) { + seen.push(computed); + } + result.push(value); + } + } + return result; + } + + /** + * The base implementation of `_.invert` and `_.invertBy` which inverts + * `object` with values transformed by `iteratee` and set by `setter`. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} setter The function to set `accumulator` values. + * @param {Function} iteratee The iteratee to transform values. + * @param {Object} accumulator The initial inverted object. + * @returns {Function} Returns `accumulator`. + */ + function baseInverter(object, setter, iteratee, accumulator) { + baseForOwn(object, function(value, key, object) { + setter(accumulator, iteratee(value), key, object); + }); + return accumulator; + } + + /** + * The base implementation of `_.invoke` without support for individual + * method arguments. + * + * @private + * @param {Object} object The object to query. + * @param {Array|string} path The path of the method to invoke. + * @param {Array} args The arguments to invoke the method with. + * @returns {*} Returns the result of the invoked method. + */ + function baseInvoke(object, path, args) { + path = castPath(path, object); + object = parent(object, path); + var func = object == null ? object : object[toKey(last(path))]; + return func == null ? undefined : apply(func, object, args); + } + + /** + * The base implementation of `_.isArguments`. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an `arguments` object, + */ + function baseIsArguments(value) { + return isObjectLike(value) && baseGetTag(value) == argsTag; + } + + /** + * The base implementation of `_.isArrayBuffer` without Node.js optimizations. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. + */ + function baseIsArrayBuffer(value) { + return isObjectLike(value) && baseGetTag(value) == arrayBufferTag; + } + + /** + * The base implementation of `_.isDate` without Node.js optimizations. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a date object, else `false`. + */ + function baseIsDate(value) { + return isObjectLike(value) && baseGetTag(value) == dateTag; + } + + /** + * The base implementation of `_.isEqual` which supports partial comparisons + * and tracks traversed objects. + * + * @private + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @param {boolean} bitmask The bitmask flags. + * 1 - Unordered comparison + * 2 - Partial comparison + * @param {Function} [customizer] The function to customize comparisons. + * @param {Object} [stack] Tracks traversed `value` and `other` objects. + * @returns {boolean} Returns `true` if the values are equivalent, else `false`. + */ + function baseIsEqual(value, other, bitmask, customizer, stack) { + if (value === other) { + return true; + } + if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) { + return value !== value && other !== other; + } + return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack); + } + + /** + * A specialized version of `baseIsEqual` for arrays and objects which performs + * deep comparisons and tracks traversed objects enabling objects with circular + * references to be compared. + * + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. + * @param {Function} customizer The function to customize comparisons. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Object} [stack] Tracks traversed `object` and `other` objects. + * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. + */ + function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) { + var objIsArr = isArray(object), + othIsArr = isArray(other), + objTag = objIsArr ? arrayTag : getTag(object), + othTag = othIsArr ? arrayTag : getTag(other); + + objTag = objTag == argsTag ? objectTag : objTag; + othTag = othTag == argsTag ? objectTag : othTag; + + var objIsObj = objTag == objectTag, + othIsObj = othTag == objectTag, + isSameTag = objTag == othTag; + + if (isSameTag && isBuffer(object)) { + if (!isBuffer(other)) { + return false; + } + objIsArr = true; + objIsObj = false; + } + if (isSameTag && !objIsObj) { + stack || (stack = new Stack); + return (objIsArr || isTypedArray(object)) + ? equalArrays(object, other, bitmask, customizer, equalFunc, stack) + : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack); + } + if (!(bitmask & COMPARE_PARTIAL_FLAG)) { + var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'), + othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__'); + + if (objIsWrapped || othIsWrapped) { + var objUnwrapped = objIsWrapped ? object.value() : object, + othUnwrapped = othIsWrapped ? other.value() : other; + + stack || (stack = new Stack); + return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack); + } + } + if (!isSameTag) { + return false; + } + stack || (stack = new Stack); + return equalObjects(object, other, bitmask, customizer, equalFunc, stack); + } + + /** + * The base implementation of `_.isMap` without Node.js optimizations. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a map, else `false`. + */ + function baseIsMap(value) { + return isObjectLike(value) && getTag(value) == mapTag; + } + + /** + * The base implementation of `_.isMatch` without support for iteratee shorthands. + * + * @private + * @param {Object} object The object to inspect. + * @param {Object} source The object of property values to match. + * @param {Array} matchData The property names, values, and compare flags to match. + * @param {Function} [customizer] The function to customize comparisons. + * @returns {boolean} Returns `true` if `object` is a match, else `false`. + */ + function baseIsMatch(object, source, matchData, customizer) { + var index = matchData.length, + length = index, + noCustomizer = !customizer; + + if (object == null) { + return !length; + } + object = Object(object); + while (index--) { + var data = matchData[index]; + if ((noCustomizer && data[2]) + ? data[1] !== object[data[0]] + : !(data[0] in object) + ) { + return false; + } + } + while (++index < length) { + data = matchData[index]; + var key = data[0], + objValue = object[key], + srcValue = data[1]; + + if (noCustomizer && data[2]) { + if (objValue === undefined && !(key in object)) { + return false; + } + } else { + var stack = new Stack; + if (customizer) { + var result = customizer(objValue, srcValue, key, object, source, stack); + } + if (!(result === undefined + ? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack) + : result + )) { + return false; + } + } + } + return true; + } + + /** + * The base implementation of `_.isNative` without bad shim checks. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a native function, + * else `false`. + */ + function baseIsNative(value) { + if (!isObject(value) || isMasked(value)) { + return false; + } + var pattern = isFunction(value) ? reIsNative : reIsHostCtor; + return pattern.test(toSource(value)); + } + + /** + * The base implementation of `_.isRegExp` without Node.js optimizations. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. + */ + function baseIsRegExp(value) { + return isObjectLike(value) && baseGetTag(value) == regexpTag; + } + + /** + * The base implementation of `_.isSet` without Node.js optimizations. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a set, else `false`. + */ + function baseIsSet(value) { + return isObjectLike(value) && getTag(value) == setTag; + } + + /** + * The base implementation of `_.isTypedArray` without Node.js optimizations. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. + */ + function baseIsTypedArray(value) { + return isObjectLike(value) && + isLength(value.length) && !!typedArrayTags[baseGetTag(value)]; + } + + /** + * The base implementation of `_.iteratee`. + * + * @private + * @param {*} [value=_.identity] The value to convert to an iteratee. + * @returns {Function} Returns the iteratee. + */ + function baseIteratee(value) { + // Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9. + // See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details. + if (typeof value == 'function') { + return value; + } + if (value == null) { + return identity; + } + if (typeof value == 'object') { + return isArray(value) + ? baseMatchesProperty(value[0], value[1]) + : baseMatches(value); + } + return property(value); + } + + /** + * The base implementation of `_.keys` which doesn't treat sparse arrays as dense. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + */ + function baseKeys(object) { + if (!isPrototype(object)) { + return nativeKeys(object); + } + var result = []; + for (var key in Object(object)) { + if (hasOwnProperty.call(object, key) && key != 'constructor') { + result.push(key); + } + } + return result; + } + + /** + * The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + */ + function baseKeysIn(object) { + if (!isObject(object)) { + return nativeKeysIn(object); + } + var isProto = isPrototype(object), + result = []; + + for (var key in object) { + if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) { + result.push(key); + } + } + return result; + } + + /** + * The base implementation of `_.lt` which doesn't coerce arguments. + * + * @private + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is less than `other`, + * else `false`. + */ + function baseLt(value, other) { + return value < other; + } + + /** + * The base implementation of `_.map` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns the new mapped array. + */ + function baseMap(collection, iteratee) { + var index = -1, + result = isArrayLike(collection) ? Array(collection.length) : []; + + baseEach(collection, function(value, key, collection) { + result[++index] = iteratee(value, key, collection); + }); + return result; + } + + /** + * The base implementation of `_.matches` which doesn't clone `source`. + * + * @private + * @param {Object} source The object of property values to match. + * @returns {Function} Returns the new spec function. + */ + function baseMatches(source) { + var matchData = getMatchData(source); + if (matchData.length == 1 && matchData[0][2]) { + return matchesStrictComparable(matchData[0][0], matchData[0][1]); + } + return function(object) { + return object === source || baseIsMatch(object, source, matchData); + }; + } + + /** + * The base implementation of `_.matchesProperty` which doesn't clone `srcValue`. + * + * @private + * @param {string} path The path of the property to get. + * @param {*} srcValue The value to match. + * @returns {Function} Returns the new spec function. + */ + function baseMatchesProperty(path, srcValue) { + if (isKey(path) && isStrictComparable(srcValue)) { + return matchesStrictComparable(toKey(path), srcValue); + } + return function(object) { + var objValue = get(object, path); + return (objValue === undefined && objValue === srcValue) + ? hasIn(object, path) + : baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG); + }; + } + + /** + * The base implementation of `_.merge` without support for multiple sources. + * + * @private + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @param {number} srcIndex The index of `source`. + * @param {Function} [customizer] The function to customize merged values. + * @param {Object} [stack] Tracks traversed source values and their merged + * counterparts. + */ + function baseMerge(object, source, srcIndex, customizer, stack) { + if (object === source) { + return; + } + baseFor(source, function(srcValue, key) { + if (isObject(srcValue)) { + stack || (stack = new Stack); + baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack); + } + else { + var newValue = customizer + ? customizer(safeGet(object, key), srcValue, (key + ''), object, source, stack) + : undefined; + + if (newValue === undefined) { + newValue = srcValue; + } + assignMergeValue(object, key, newValue); + } + }, keysIn); + } + + /** + * A specialized version of `baseMerge` for arrays and objects which performs + * deep merges and tracks traversed objects enabling objects with circular + * references to be merged. + * + * @private + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @param {string} key The key of the value to merge. + * @param {number} srcIndex The index of `source`. + * @param {Function} mergeFunc The function to merge values. + * @param {Function} [customizer] The function to customize assigned values. + * @param {Object} [stack] Tracks traversed source values and their merged + * counterparts. + */ + function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) { + var objValue = safeGet(object, key), + srcValue = safeGet(source, key), + stacked = stack.get(srcValue); + + if (stacked) { + assignMergeValue(object, key, stacked); + return; + } + var newValue = customizer + ? customizer(objValue, srcValue, (key + ''), object, source, stack) + : undefined; + + var isCommon = newValue === undefined; + + if (isCommon) { + var isArr = isArray(srcValue), + isBuff = !isArr && isBuffer(srcValue), + isTyped = !isArr && !isBuff && isTypedArray(srcValue); + + newValue = srcValue; + if (isArr || isBuff || isTyped) { + if (isArray(objValue)) { + newValue = objValue; + } + else if (isArrayLikeObject(objValue)) { + newValue = copyArray(objValue); + } + else if (isBuff) { + isCommon = false; + newValue = cloneBuffer(srcValue, true); + } + else if (isTyped) { + isCommon = false; + newValue = cloneTypedArray(srcValue, true); + } + else { + newValue = []; + } + } + else if (isPlainObject(srcValue) || isArguments(srcValue)) { + newValue = objValue; + if (isArguments(objValue)) { + newValue = toPlainObject(objValue); + } + else if (!isObject(objValue) || (srcIndex && isFunction(objValue))) { + newValue = initCloneObject(srcValue); + } + } + else { + isCommon = false; + } + } + if (isCommon) { + // Recursively merge objects and arrays (susceptible to call stack limits). + stack.set(srcValue, newValue); + mergeFunc(newValue, srcValue, srcIndex, customizer, stack); + stack['delete'](srcValue); + } + assignMergeValue(object, key, newValue); + } + + /** + * The base implementation of `_.nth` which doesn't coerce arguments. + * + * @private + * @param {Array} array The array to query. + * @param {number} n The index of the element to return. + * @returns {*} Returns the nth element of `array`. + */ + function baseNth(array, n) { + var length = array.length; + if (!length) { + return; + } + n += n < 0 ? length : 0; + return isIndex(n, length) ? array[n] : undefined; + } + + /** + * The base implementation of `_.orderBy` without param guards. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by. + * @param {string[]} orders The sort orders of `iteratees`. + * @returns {Array} Returns the new sorted array. + */ + function baseOrderBy(collection, iteratees, orders) { + var index = -1; + iteratees = arrayMap(iteratees.length ? iteratees : [identity], baseUnary(getIteratee())); + + var result = baseMap(collection, function(value, key, collection) { + var criteria = arrayMap(iteratees, function(iteratee) { + return iteratee(value); + }); + return { 'criteria': criteria, 'index': ++index, 'value': value }; + }); + + return baseSortBy(result, function(object, other) { + return compareMultiple(object, other, orders); + }); + } + + /** + * The base implementation of `_.pick` without support for individual + * property identifiers. + * + * @private + * @param {Object} object The source object. + * @param {string[]} paths The property paths to pick. + * @returns {Object} Returns the new object. + */ + function basePick(object, paths) { + return basePickBy(object, paths, function(value, path) { + return hasIn(object, path); + }); + } + + /** + * The base implementation of `_.pickBy` without support for iteratee shorthands. + * + * @private + * @param {Object} object The source object. + * @param {string[]} paths The property paths to pick. + * @param {Function} predicate The function invoked per property. + * @returns {Object} Returns the new object. + */ + function basePickBy(object, paths, predicate) { + var index = -1, + length = paths.length, + result = {}; + + while (++index < length) { + var path = paths[index], + value = baseGet(object, path); + + if (predicate(value, path)) { + baseSet(result, castPath(path, object), value); + } + } + return result; + } + + /** + * A specialized version of `baseProperty` which supports deep paths. + * + * @private + * @param {Array|string} path The path of the property to get. + * @returns {Function} Returns the new accessor function. + */ + function basePropertyDeep(path) { + return function(object) { + return baseGet(object, path); + }; + } + + /** + * The base implementation of `_.pullAllBy` without support for iteratee + * shorthands. + * + * @private + * @param {Array} array The array to modify. + * @param {Array} values The values to remove. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns `array`. + */ + function basePullAll(array, values, iteratee, comparator) { + var indexOf = comparator ? baseIndexOfWith : baseIndexOf, + index = -1, + length = values.length, + seen = array; + + if (array === values) { + values = copyArray(values); + } + if (iteratee) { + seen = arrayMap(array, baseUnary(iteratee)); + } + while (++index < length) { + var fromIndex = 0, + value = values[index], + computed = iteratee ? iteratee(value) : value; + + while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) { + if (seen !== array) { + splice.call(seen, fromIndex, 1); + } + splice.call(array, fromIndex, 1); + } + } + return array; + } + + /** + * The base implementation of `_.pullAt` without support for individual + * indexes or capturing the removed elements. + * + * @private + * @param {Array} array The array to modify. + * @param {number[]} indexes The indexes of elements to remove. + * @returns {Array} Returns `array`. + */ + function basePullAt(array, indexes) { + var length = array ? indexes.length : 0, + lastIndex = length - 1; + + while (length--) { + var index = indexes[length]; + if (length == lastIndex || index !== previous) { + var previous = index; + if (isIndex(index)) { + splice.call(array, index, 1); + } else { + baseUnset(array, index); + } + } + } + return array; + } + + /** + * The base implementation of `_.random` without support for returning + * floating-point numbers. + * + * @private + * @param {number} lower The lower bound. + * @param {number} upper The upper bound. + * @returns {number} Returns the random number. + */ + function baseRandom(lower, upper) { + return lower + nativeFloor(nativeRandom() * (upper - lower + 1)); + } + + /** + * The base implementation of `_.range` and `_.rangeRight` which doesn't + * coerce arguments. + * + * @private + * @param {number} start The start of the range. + * @param {number} end The end of the range. + * @param {number} step The value to increment or decrement by. + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Array} Returns the range of numbers. + */ + function baseRange(start, end, step, fromRight) { + var index = -1, + length = nativeMax(nativeCeil((end - start) / (step || 1)), 0), + result = Array(length); + + while (length--) { + result[fromRight ? length : ++index] = start; + start += step; + } + return result; + } + + /** + * The base implementation of `_.repeat` which doesn't coerce arguments. + * + * @private + * @param {string} string The string to repeat. + * @param {number} n The number of times to repeat the string. + * @returns {string} Returns the repeated string. + */ + function baseRepeat(string, n) { + var result = ''; + if (!string || n < 1 || n > MAX_SAFE_INTEGER) { + return result; + } + // Leverage the exponentiation by squaring algorithm for a faster repeat. + // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details. + do { + if (n % 2) { + result += string; + } + n = nativeFloor(n / 2); + if (n) { + string += string; + } + } while (n); + + return result; + } + + /** + * The base implementation of `_.rest` which doesn't validate or coerce arguments. + * + * @private + * @param {Function} func The function to apply a rest parameter to. + * @param {number} [start=func.length-1] The start position of the rest parameter. + * @returns {Function} Returns the new function. + */ + function baseRest(func, start) { + return setToString(overRest(func, start, identity), func + ''); + } + + /** + * The base implementation of `_.sample`. + * + * @private + * @param {Array|Object} collection The collection to sample. + * @returns {*} Returns the random element. + */ + function baseSample(collection) { + return arraySample(values(collection)); + } + + /** + * The base implementation of `_.sampleSize` without param guards. + * + * @private + * @param {Array|Object} collection The collection to sample. + * @param {number} n The number of elements to sample. + * @returns {Array} Returns the random elements. + */ + function baseSampleSize(collection, n) { + var array = values(collection); + return shuffleSelf(array, baseClamp(n, 0, array.length)); + } + + /** + * The base implementation of `_.set`. + * + * @private + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to set. + * @param {*} value The value to set. + * @param {Function} [customizer] The function to customize path creation. + * @returns {Object} Returns `object`. + */ + function baseSet(object, path, value, customizer) { + if (!isObject(object)) { + return object; + } + path = castPath(path, object); + + var index = -1, + length = path.length, + lastIndex = length - 1, + nested = object; + + while (nested != null && ++index < length) { + var key = toKey(path[index]), + newValue = value; + + if (index != lastIndex) { + var objValue = nested[key]; + newValue = customizer ? customizer(objValue, key, nested) : undefined; + if (newValue === undefined) { + newValue = isObject(objValue) + ? objValue + : (isIndex(path[index + 1]) ? [] : {}); + } + } + assignValue(nested, key, newValue); + nested = nested[key]; + } + return object; + } + + /** + * The base implementation of `setData` without support for hot loop shorting. + * + * @private + * @param {Function} func The function to associate metadata with. + * @param {*} data The metadata. + * @returns {Function} Returns `func`. + */ + var baseSetData = !metaMap ? identity : function(func, data) { + metaMap.set(func, data); + return func; + }; + + /** + * The base implementation of `setToString` without support for hot loop shorting. + * + * @private + * @param {Function} func The function to modify. + * @param {Function} string The `toString` result. + * @returns {Function} Returns `func`. + */ + var baseSetToString = !defineProperty ? identity : function(func, string) { + return defineProperty(func, 'toString', { + 'configurable': true, + 'enumerable': false, + 'value': constant(string), + 'writable': true + }); + }; + + /** + * The base implementation of `_.shuffle`. + * + * @private + * @param {Array|Object} collection The collection to shuffle. + * @returns {Array} Returns the new shuffled array. + */ + function baseShuffle(collection) { + return shuffleSelf(values(collection)); + } + + /** + * The base implementation of `_.slice` without an iteratee call guard. + * + * @private + * @param {Array} array The array to slice. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns the slice of `array`. + */ + function baseSlice(array, start, end) { + var index = -1, + length = array.length; + + if (start < 0) { + start = -start > length ? 0 : (length + start); + } + end = end > length ? length : end; + if (end < 0) { + end += length; + } + length = start > end ? 0 : ((end - start) >>> 0); + start >>>= 0; + + var result = Array(length); + while (++index < length) { + result[index] = array[index + start]; + } + return result; + } + + /** + * The base implementation of `_.some` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if any element passes the predicate check, + * else `false`. + */ + function baseSome(collection, predicate) { + var result; + + baseEach(collection, function(value, index, collection) { + result = predicate(value, index, collection); + return !result; + }); + return !!result; + } + + /** + * The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which + * performs a binary search of `array` to determine the index at which `value` + * should be inserted into `array` in order to maintain its sort order. + * + * @private + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {boolean} [retHighest] Specify returning the highest qualified index. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + */ + function baseSortedIndex(array, value, retHighest) { + var low = 0, + high = array == null ? low : array.length; + + if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) { + while (low < high) { + var mid = (low + high) >>> 1, + computed = array[mid]; + + if (computed !== null && !isSymbol(computed) && + (retHighest ? (computed <= value) : (computed < value))) { + low = mid + 1; + } else { + high = mid; + } + } + return high; + } + return baseSortedIndexBy(array, value, identity, retHighest); + } + + /** + * The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy` + * which invokes `iteratee` for `value` and each element of `array` to compute + * their sort ranking. The iteratee is invoked with one argument; (value). + * + * @private + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {Function} iteratee The iteratee invoked per element. + * @param {boolean} [retHighest] Specify returning the highest qualified index. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + */ + function baseSortedIndexBy(array, value, iteratee, retHighest) { + value = iteratee(value); + + var low = 0, + high = array == null ? 0 : array.length, + valIsNaN = value !== value, + valIsNull = value === null, + valIsSymbol = isSymbol(value), + valIsUndefined = value === undefined; + + while (low < high) { + var mid = nativeFloor((low + high) / 2), + computed = iteratee(array[mid]), + othIsDefined = computed !== undefined, + othIsNull = computed === null, + othIsReflexive = computed === computed, + othIsSymbol = isSymbol(computed); + + if (valIsNaN) { + var setLow = retHighest || othIsReflexive; + } else if (valIsUndefined) { + setLow = othIsReflexive && (retHighest || othIsDefined); + } else if (valIsNull) { + setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull); + } else if (valIsSymbol) { + setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol); + } else if (othIsNull || othIsSymbol) { + setLow = false; + } else { + setLow = retHighest ? (computed <= value) : (computed < value); + } + if (setLow) { + low = mid + 1; + } else { + high = mid; + } + } + return nativeMin(high, MAX_ARRAY_INDEX); + } + + /** + * The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without + * support for iteratee shorthands. + * + * @private + * @param {Array} array The array to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @returns {Array} Returns the new duplicate free array. + */ + function baseSortedUniq(array, iteratee) { + var index = -1, + length = array.length, + resIndex = 0, + result = []; + + while (++index < length) { + var value = array[index], + computed = iteratee ? iteratee(value) : value; + + if (!index || !eq(computed, seen)) { + var seen = computed; + result[resIndex++] = value === 0 ? 0 : value; + } + } + return result; + } + + /** + * The base implementation of `_.toNumber` which doesn't ensure correct + * conversions of binary, hexadecimal, or octal string values. + * + * @private + * @param {*} value The value to process. + * @returns {number} Returns the number. + */ + function baseToNumber(value) { + if (typeof value == 'number') { + return value; + } + if (isSymbol(value)) { + return NAN; + } + return +value; + } + + /** + * The base implementation of `_.toString` which doesn't convert nullish + * values to empty strings. + * + * @private + * @param {*} value The value to process. + * @returns {string} Returns the string. + */ + function baseToString(value) { + // Exit early for strings to avoid a performance hit in some environments. + if (typeof value == 'string') { + return value; + } + if (isArray(value)) { + // Recursively convert values (susceptible to call stack limits). + return arrayMap(value, baseToString) + ''; + } + if (isSymbol(value)) { + return symbolToString ? symbolToString.call(value) : ''; + } + var result = (value + ''); + return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; + } + + /** + * The base implementation of `_.uniqBy` without support for iteratee shorthands. + * + * @private + * @param {Array} array The array to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new duplicate free array. + */ + function baseUniq(array, iteratee, comparator) { + var index = -1, + includes = arrayIncludes, + length = array.length, + isCommon = true, + result = [], + seen = result; + + if (comparator) { + isCommon = false; + includes = arrayIncludesWith; + } + else if (length >= LARGE_ARRAY_SIZE) { + var set = iteratee ? null : createSet(array); + if (set) { + return setToArray(set); + } + isCommon = false; + includes = cacheHas; + seen = new SetCache; + } + else { + seen = iteratee ? [] : result; + } + outer: + while (++index < length) { + var value = array[index], + computed = iteratee ? iteratee(value) : value; + + value = (comparator || value !== 0) ? value : 0; + if (isCommon && computed === computed) { + var seenIndex = seen.length; + while (seenIndex--) { + if (seen[seenIndex] === computed) { + continue outer; + } + } + if (iteratee) { + seen.push(computed); + } + result.push(value); + } + else if (!includes(seen, computed, comparator)) { + if (seen !== result) { + seen.push(computed); + } + result.push(value); + } + } + return result; + } + + /** + * The base implementation of `_.unset`. + * + * @private + * @param {Object} object The object to modify. + * @param {Array|string} path The property path to unset. + * @returns {boolean} Returns `true` if the property is deleted, else `false`. + */ + function baseUnset(object, path) { + path = castPath(path, object); + object = parent(object, path); + return object == null || delete object[toKey(last(path))]; + } + + /** + * The base implementation of `_.update`. + * + * @private + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to update. + * @param {Function} updater The function to produce the updated value. + * @param {Function} [customizer] The function to customize path creation. + * @returns {Object} Returns `object`. + */ + function baseUpdate(object, path, updater, customizer) { + return baseSet(object, path, updater(baseGet(object, path)), customizer); + } + + /** + * The base implementation of methods like `_.dropWhile` and `_.takeWhile` + * without support for iteratee shorthands. + * + * @private + * @param {Array} array The array to query. + * @param {Function} predicate The function invoked per iteration. + * @param {boolean} [isDrop] Specify dropping elements instead of taking them. + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Array} Returns the slice of `array`. + */ + function baseWhile(array, predicate, isDrop, fromRight) { + var length = array.length, + index = fromRight ? length : -1; + + while ((fromRight ? index-- : ++index < length) && + predicate(array[index], index, array)) {} + + return isDrop + ? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length)) + : baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index)); + } + + /** + * The base implementation of `wrapperValue` which returns the result of + * performing a sequence of actions on the unwrapped `value`, where each + * successive action is supplied the return value of the previous. + * + * @private + * @param {*} value The unwrapped value. + * @param {Array} actions Actions to perform to resolve the unwrapped value. + * @returns {*} Returns the resolved value. + */ + function baseWrapperValue(value, actions) { + var result = value; + if (result instanceof LazyWrapper) { + result = result.value(); + } + return arrayReduce(actions, function(result, action) { + return action.func.apply(action.thisArg, arrayPush([result], action.args)); + }, result); + } + + /** + * The base implementation of methods like `_.xor`, without support for + * iteratee shorthands, that accepts an array of arrays to inspect. + * + * @private + * @param {Array} arrays The arrays to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of values. + */ + function baseXor(arrays, iteratee, comparator) { + var length = arrays.length; + if (length < 2) { + return length ? baseUniq(arrays[0]) : []; + } + var index = -1, + result = Array(length); + + while (++index < length) { + var array = arrays[index], + othIndex = -1; + + while (++othIndex < length) { + if (othIndex != index) { + result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator); + } + } + } + return baseUniq(baseFlatten(result, 1), iteratee, comparator); + } + + /** + * This base implementation of `_.zipObject` which assigns values using `assignFunc`. + * + * @private + * @param {Array} props The property identifiers. + * @param {Array} values The property values. + * @param {Function} assignFunc The function to assign values. + * @returns {Object} Returns the new object. + */ + function baseZipObject(props, values, assignFunc) { + var index = -1, + length = props.length, + valsLength = values.length, + result = {}; + + while (++index < length) { + var value = index < valsLength ? values[index] : undefined; + assignFunc(result, props[index], value); + } + return result; + } + + /** + * Casts `value` to an empty array if it's not an array like object. + * + * @private + * @param {*} value The value to inspect. + * @returns {Array|Object} Returns the cast array-like object. + */ + function castArrayLikeObject(value) { + return isArrayLikeObject(value) ? value : []; + } + + /** + * Casts `value` to `identity` if it's not a function. + * + * @private + * @param {*} value The value to inspect. + * @returns {Function} Returns cast function. + */ + function castFunction(value) { + return typeof value == 'function' ? value : identity; + } + + /** + * Casts `value` to a path array if it's not one. + * + * @private + * @param {*} value The value to inspect. + * @param {Object} [object] The object to query keys on. + * @returns {Array} Returns the cast property path array. + */ + function castPath(value, object) { + if (isArray(value)) { + return value; + } + return isKey(value, object) ? [value] : stringToPath(toString(value)); + } + + /** + * A `baseRest` alias which can be replaced with `identity` by module + * replacement plugins. + * + * @private + * @type {Function} + * @param {Function} func The function to apply a rest parameter to. + * @returns {Function} Returns the new function. + */ + var castRest = baseRest; + + /** + * Casts `array` to a slice if it's needed. + * + * @private + * @param {Array} array The array to inspect. + * @param {number} start The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns the cast slice. + */ + function castSlice(array, start, end) { + var length = array.length; + end = end === undefined ? length : end; + return (!start && end >= length) ? array : baseSlice(array, start, end); + } + + /** + * A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout). + * + * @private + * @param {number|Object} id The timer id or timeout object of the timer to clear. + */ + var clearTimeout = ctxClearTimeout || function(id) { + return root.clearTimeout(id); + }; + + /** + * Creates a clone of `buffer`. + * + * @private + * @param {Buffer} buffer The buffer to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Buffer} Returns the cloned buffer. + */ + function cloneBuffer(buffer, isDeep) { + if (isDeep) { + return buffer.slice(); + } + var length = buffer.length, + result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length); + + buffer.copy(result); + return result; + } + + /** + * Creates a clone of `arrayBuffer`. + * + * @private + * @param {ArrayBuffer} arrayBuffer The array buffer to clone. + * @returns {ArrayBuffer} Returns the cloned array buffer. + */ + function cloneArrayBuffer(arrayBuffer) { + var result = new arrayBuffer.constructor(arrayBuffer.byteLength); + new Uint8Array(result).set(new Uint8Array(arrayBuffer)); + return result; + } + + /** + * Creates a clone of `dataView`. + * + * @private + * @param {Object} dataView The data view to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the cloned data view. + */ + function cloneDataView(dataView, isDeep) { + var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer; + return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength); + } + + /** + * Creates a clone of `regexp`. + * + * @private + * @param {Object} regexp The regexp to clone. + * @returns {Object} Returns the cloned regexp. + */ + function cloneRegExp(regexp) { + var result = new regexp.constructor(regexp.source, reFlags.exec(regexp)); + result.lastIndex = regexp.lastIndex; + return result; + } + + /** + * Creates a clone of the `symbol` object. + * + * @private + * @param {Object} symbol The symbol object to clone. + * @returns {Object} Returns the cloned symbol object. + */ + function cloneSymbol(symbol) { + return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {}; + } + + /** + * Creates a clone of `typedArray`. + * + * @private + * @param {Object} typedArray The typed array to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the cloned typed array. + */ + function cloneTypedArray(typedArray, isDeep) { + var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer; + return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length); + } + + /** + * Compares values to sort them in ascending order. + * + * @private + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {number} Returns the sort order indicator for `value`. + */ + function compareAscending(value, other) { + if (value !== other) { + var valIsDefined = value !== undefined, + valIsNull = value === null, + valIsReflexive = value === value, + valIsSymbol = isSymbol(value); + + var othIsDefined = other !== undefined, + othIsNull = other === null, + othIsReflexive = other === other, + othIsSymbol = isSymbol(other); + + if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) || + (valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) || + (valIsNull && othIsDefined && othIsReflexive) || + (!valIsDefined && othIsReflexive) || + !valIsReflexive) { + return 1; + } + if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) || + (othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) || + (othIsNull && valIsDefined && valIsReflexive) || + (!othIsDefined && valIsReflexive) || + !othIsReflexive) { + return -1; + } + } + return 0; + } + + /** + * Used by `_.orderBy` to compare multiple properties of a value to another + * and stable sort them. + * + * If `orders` is unspecified, all values are sorted in ascending order. Otherwise, + * specify an order of "desc" for descending or "asc" for ascending sort order + * of corresponding values. + * + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {boolean[]|string[]} orders The order to sort by for each property. + * @returns {number} Returns the sort order indicator for `object`. + */ + function compareMultiple(object, other, orders) { + var index = -1, + objCriteria = object.criteria, + othCriteria = other.criteria, + length = objCriteria.length, + ordersLength = orders.length; + + while (++index < length) { + var result = compareAscending(objCriteria[index], othCriteria[index]); + if (result) { + if (index >= ordersLength) { + return result; + } + var order = orders[index]; + return result * (order == 'desc' ? -1 : 1); + } + } + // Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications + // that causes it, under certain circumstances, to provide the same value for + // `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247 + // for more details. + // + // This also ensures a stable sort in V8 and other engines. + // See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details. + return object.index - other.index; + } + + /** + * Creates an array that is the composition of partially applied arguments, + * placeholders, and provided arguments into a single array of arguments. + * + * @private + * @param {Array} args The provided arguments. + * @param {Array} partials The arguments to prepend to those provided. + * @param {Array} holders The `partials` placeholder indexes. + * @params {boolean} [isCurried] Specify composing for a curried function. + * @returns {Array} Returns the new array of composed arguments. + */ + function composeArgs(args, partials, holders, isCurried) { + var argsIndex = -1, + argsLength = args.length, + holdersLength = holders.length, + leftIndex = -1, + leftLength = partials.length, + rangeLength = nativeMax(argsLength - holdersLength, 0), + result = Array(leftLength + rangeLength), + isUncurried = !isCurried; + + while (++leftIndex < leftLength) { + result[leftIndex] = partials[leftIndex]; + } + while (++argsIndex < holdersLength) { + if (isUncurried || argsIndex < argsLength) { + result[holders[argsIndex]] = args[argsIndex]; + } + } + while (rangeLength--) { + result[leftIndex++] = args[argsIndex++]; + } + return result; + } + + /** + * This function is like `composeArgs` except that the arguments composition + * is tailored for `_.partialRight`. + * + * @private + * @param {Array} args The provided arguments. + * @param {Array} partials The arguments to append to those provided. + * @param {Array} holders The `partials` placeholder indexes. + * @params {boolean} [isCurried] Specify composing for a curried function. + * @returns {Array} Returns the new array of composed arguments. + */ + function composeArgsRight(args, partials, holders, isCurried) { + var argsIndex = -1, + argsLength = args.length, + holdersIndex = -1, + holdersLength = holders.length, + rightIndex = -1, + rightLength = partials.length, + rangeLength = nativeMax(argsLength - holdersLength, 0), + result = Array(rangeLength + rightLength), + isUncurried = !isCurried; + + while (++argsIndex < rangeLength) { + result[argsIndex] = args[argsIndex]; + } + var offset = argsIndex; + while (++rightIndex < rightLength) { + result[offset + rightIndex] = partials[rightIndex]; + } + while (++holdersIndex < holdersLength) { + if (isUncurried || argsIndex < argsLength) { + result[offset + holders[holdersIndex]] = args[argsIndex++]; + } + } + return result; + } + + /** + * Copies the values of `source` to `array`. + * + * @private + * @param {Array} source The array to copy values from. + * @param {Array} [array=[]] The array to copy values to. + * @returns {Array} Returns `array`. + */ + function copyArray(source, array) { + var index = -1, + length = source.length; + + array || (array = Array(length)); + while (++index < length) { + array[index] = source[index]; + } + return array; + } + + /** + * Copies properties of `source` to `object`. + * + * @private + * @param {Object} source The object to copy properties from. + * @param {Array} props The property identifiers to copy. + * @param {Object} [object={}] The object to copy properties to. + * @param {Function} [customizer] The function to customize copied values. + * @returns {Object} Returns `object`. + */ + function copyObject(source, props, object, customizer) { + var isNew = !object; + object || (object = {}); + + var index = -1, + length = props.length; + + while (++index < length) { + var key = props[index]; + + var newValue = customizer + ? customizer(object[key], source[key], key, object, source) + : undefined; + + if (newValue === undefined) { + newValue = source[key]; + } + if (isNew) { + baseAssignValue(object, key, newValue); + } else { + assignValue(object, key, newValue); + } + } + return object; + } + + /** + * Copies own symbols of `source` to `object`. + * + * @private + * @param {Object} source The object to copy symbols from. + * @param {Object} [object={}] The object to copy symbols to. + * @returns {Object} Returns `object`. + */ + function copySymbols(source, object) { + return copyObject(source, getSymbols(source), object); + } + + /** + * Copies own and inherited symbols of `source` to `object`. + * + * @private + * @param {Object} source The object to copy symbols from. + * @param {Object} [object={}] The object to copy symbols to. + * @returns {Object} Returns `object`. + */ + function copySymbolsIn(source, object) { + return copyObject(source, getSymbolsIn(source), object); + } + + /** + * Creates a function like `_.groupBy`. + * + * @private + * @param {Function} setter The function to set accumulator values. + * @param {Function} [initializer] The accumulator object initializer. + * @returns {Function} Returns the new aggregator function. + */ + function createAggregator(setter, initializer) { + return function(collection, iteratee) { + var func = isArray(collection) ? arrayAggregator : baseAggregator, + accumulator = initializer ? initializer() : {}; + + return func(collection, setter, getIteratee(iteratee, 2), accumulator); + }; + } + + /** + * Creates a function like `_.assign`. + * + * @private + * @param {Function} assigner The function to assign values. + * @returns {Function} Returns the new assigner function. + */ + function createAssigner(assigner) { + return baseRest(function(object, sources) { + var index = -1, + length = sources.length, + customizer = length > 1 ? sources[length - 1] : undefined, + guard = length > 2 ? sources[2] : undefined; + + customizer = (assigner.length > 3 && typeof customizer == 'function') + ? (length--, customizer) + : undefined; + + if (guard && isIterateeCall(sources[0], sources[1], guard)) { + customizer = length < 3 ? undefined : customizer; + length = 1; + } + object = Object(object); + while (++index < length) { + var source = sources[index]; + if (source) { + assigner(object, source, index, customizer); + } + } + return object; + }); + } + + /** + * Creates a `baseEach` or `baseEachRight` function. + * + * @private + * @param {Function} eachFunc The function to iterate over a collection. + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Function} Returns the new base function. + */ + function createBaseEach(eachFunc, fromRight) { + return function(collection, iteratee) { + if (collection == null) { + return collection; + } + if (!isArrayLike(collection)) { + return eachFunc(collection, iteratee); + } + var length = collection.length, + index = fromRight ? length : -1, + iterable = Object(collection); + + while ((fromRight ? index-- : ++index < length)) { + if (iteratee(iterable[index], index, iterable) === false) { + break; + } + } + return collection; + }; + } + + /** + * Creates a base function for methods like `_.forIn` and `_.forOwn`. + * + * @private + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Function} Returns the new base function. + */ + function createBaseFor(fromRight) { + return function(object, iteratee, keysFunc) { + var index = -1, + iterable = Object(object), + props = keysFunc(object), + length = props.length; + + while (length--) { + var key = props[fromRight ? length : ++index]; + if (iteratee(iterable[key], key, iterable) === false) { + break; + } + } + return object; + }; + } + + /** + * Creates a function that wraps `func` to invoke it with the optional `this` + * binding of `thisArg`. + * + * @private + * @param {Function} func The function to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {*} [thisArg] The `this` binding of `func`. + * @returns {Function} Returns the new wrapped function. + */ + function createBind(func, bitmask, thisArg) { + var isBind = bitmask & WRAP_BIND_FLAG, + Ctor = createCtor(func); + + function wrapper() { + var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; + return fn.apply(isBind ? thisArg : this, arguments); + } + return wrapper; + } + + /** + * Creates a function like `_.lowerFirst`. + * + * @private + * @param {string} methodName The name of the `String` case method to use. + * @returns {Function} Returns the new case function. + */ + function createCaseFirst(methodName) { + return function(string) { + string = toString(string); + + var strSymbols = hasUnicode(string) + ? stringToArray(string) + : undefined; + + var chr = strSymbols + ? strSymbols[0] + : string.charAt(0); + + var trailing = strSymbols + ? castSlice(strSymbols, 1).join('') + : string.slice(1); + + return chr[methodName]() + trailing; + }; + } + + /** + * Creates a function like `_.camelCase`. + * + * @private + * @param {Function} callback The function to combine each word. + * @returns {Function} Returns the new compounder function. + */ + function createCompounder(callback) { + return function(string) { + return arrayReduce(words(deburr(string).replace(reApos, '')), callback, ''); + }; + } + + /** + * Creates a function that produces an instance of `Ctor` regardless of + * whether it was invoked as part of a `new` expression or by `call` or `apply`. + * + * @private + * @param {Function} Ctor The constructor to wrap. + * @returns {Function} Returns the new wrapped function. + */ + function createCtor(Ctor) { + return function() { + // Use a `switch` statement to work with class constructors. See + // http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist + // for more details. + var args = arguments; + switch (args.length) { + case 0: return new Ctor; + case 1: return new Ctor(args[0]); + case 2: return new Ctor(args[0], args[1]); + case 3: return new Ctor(args[0], args[1], args[2]); + case 4: return new Ctor(args[0], args[1], args[2], args[3]); + case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]); + case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]); + case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]); + } + var thisBinding = baseCreate(Ctor.prototype), + result = Ctor.apply(thisBinding, args); + + // Mimic the constructor's `return` behavior. + // See https://es5.github.io/#x13.2.2 for more details. + return isObject(result) ? result : thisBinding; + }; + } + + /** + * Creates a function that wraps `func` to enable currying. + * + * @private + * @param {Function} func The function to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {number} arity The arity of `func`. + * @returns {Function} Returns the new wrapped function. + */ + function createCurry(func, bitmask, arity) { + var Ctor = createCtor(func); + + function wrapper() { + var length = arguments.length, + args = Array(length), + index = length, + placeholder = getHolder(wrapper); + + while (index--) { + args[index] = arguments[index]; + } + var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder) + ? [] + : replaceHolders(args, placeholder); + + length -= holders.length; + if (length < arity) { + return createRecurry( + func, bitmask, createHybrid, wrapper.placeholder, undefined, + args, holders, undefined, undefined, arity - length); + } + var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; + return apply(fn, this, args); + } + return wrapper; + } + + /** + * Creates a `_.find` or `_.findLast` function. + * + * @private + * @param {Function} findIndexFunc The function to find the collection index. + * @returns {Function} Returns the new find function. + */ + function createFind(findIndexFunc) { + return function(collection, predicate, fromIndex) { + var iterable = Object(collection); + if (!isArrayLike(collection)) { + var iteratee = getIteratee(predicate, 3); + collection = keys(collection); + predicate = function(key) { return iteratee(iterable[key], key, iterable); }; + } + var index = findIndexFunc(collection, predicate, fromIndex); + return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined; + }; + } + + /** + * Creates a `_.flow` or `_.flowRight` function. + * + * @private + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Function} Returns the new flow function. + */ + function createFlow(fromRight) { + return flatRest(function(funcs) { + var length = funcs.length, + index = length, + prereq = LodashWrapper.prototype.thru; + + if (fromRight) { + funcs.reverse(); + } + while (index--) { + var func = funcs[index]; + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + if (prereq && !wrapper && getFuncName(func) == 'wrapper') { + var wrapper = new LodashWrapper([], true); + } + } + index = wrapper ? index : length; + while (++index < length) { + func = funcs[index]; + + var funcName = getFuncName(func), + data = funcName == 'wrapper' ? getData(func) : undefined; + + if (data && isLaziable(data[0]) && + data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) && + !data[4].length && data[9] == 1 + ) { + wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]); + } else { + wrapper = (func.length == 1 && isLaziable(func)) + ? wrapper[funcName]() + : wrapper.thru(func); + } + } + return function() { + var args = arguments, + value = args[0]; + + if (wrapper && args.length == 1 && isArray(value)) { + return wrapper.plant(value).value(); + } + var index = 0, + result = length ? funcs[index].apply(this, args) : value; + + while (++index < length) { + result = funcs[index].call(this, result); + } + return result; + }; + }); + } + + /** + * Creates a function that wraps `func` to invoke it with optional `this` + * binding of `thisArg`, partial application, and currying. + * + * @private + * @param {Function|string} func The function or method name to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {*} [thisArg] The `this` binding of `func`. + * @param {Array} [partials] The arguments to prepend to those provided to + * the new function. + * @param {Array} [holders] The `partials` placeholder indexes. + * @param {Array} [partialsRight] The arguments to append to those provided + * to the new function. + * @param {Array} [holdersRight] The `partialsRight` placeholder indexes. + * @param {Array} [argPos] The argument positions of the new function. + * @param {number} [ary] The arity cap of `func`. + * @param {number} [arity] The arity of `func`. + * @returns {Function} Returns the new wrapped function. + */ + function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) { + var isAry = bitmask & WRAP_ARY_FLAG, + isBind = bitmask & WRAP_BIND_FLAG, + isBindKey = bitmask & WRAP_BIND_KEY_FLAG, + isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG), + isFlip = bitmask & WRAP_FLIP_FLAG, + Ctor = isBindKey ? undefined : createCtor(func); + + function wrapper() { + var length = arguments.length, + args = Array(length), + index = length; + + while (index--) { + args[index] = arguments[index]; + } + if (isCurried) { + var placeholder = getHolder(wrapper), + holdersCount = countHolders(args, placeholder); + } + if (partials) { + args = composeArgs(args, partials, holders, isCurried); + } + if (partialsRight) { + args = composeArgsRight(args, partialsRight, holdersRight, isCurried); + } + length -= holdersCount; + if (isCurried && length < arity) { + var newHolders = replaceHolders(args, placeholder); + return createRecurry( + func, bitmask, createHybrid, wrapper.placeholder, thisArg, + args, newHolders, argPos, ary, arity - length + ); + } + var thisBinding = isBind ? thisArg : this, + fn = isBindKey ? thisBinding[func] : func; + + length = args.length; + if (argPos) { + args = reorder(args, argPos); + } else if (isFlip && length > 1) { + args.reverse(); + } + if (isAry && ary < length) { + args.length = ary; + } + if (this && this !== root && this instanceof wrapper) { + fn = Ctor || createCtor(fn); + } + return fn.apply(thisBinding, args); + } + return wrapper; + } + + /** + * Creates a function like `_.invertBy`. + * + * @private + * @param {Function} setter The function to set accumulator values. + * @param {Function} toIteratee The function to resolve iteratees. + * @returns {Function} Returns the new inverter function. + */ + function createInverter(setter, toIteratee) { + return function(object, iteratee) { + return baseInverter(object, setter, toIteratee(iteratee), {}); + }; + } + + /** + * Creates a function that performs a mathematical operation on two values. + * + * @private + * @param {Function} operator The function to perform the operation. + * @param {number} [defaultValue] The value used for `undefined` arguments. + * @returns {Function} Returns the new mathematical operation function. + */ + function createMathOperation(operator, defaultValue) { + return function(value, other) { + var result; + if (value === undefined && other === undefined) { + return defaultValue; + } + if (value !== undefined) { + result = value; + } + if (other !== undefined) { + if (result === undefined) { + return other; + } + if (typeof value == 'string' || typeof other == 'string') { + value = baseToString(value); + other = baseToString(other); + } else { + value = baseToNumber(value); + other = baseToNumber(other); + } + result = operator(value, other); + } + return result; + }; + } + + /** + * Creates a function like `_.over`. + * + * @private + * @param {Function} arrayFunc The function to iterate over iteratees. + * @returns {Function} Returns the new over function. + */ + function createOver(arrayFunc) { + return flatRest(function(iteratees) { + iteratees = arrayMap(iteratees, baseUnary(getIteratee())); + return baseRest(function(args) { + var thisArg = this; + return arrayFunc(iteratees, function(iteratee) { + return apply(iteratee, thisArg, args); + }); + }); + }); + } + + /** + * Creates the padding for `string` based on `length`. The `chars` string + * is truncated if the number of characters exceeds `length`. + * + * @private + * @param {number} length The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padding for `string`. + */ + function createPadding(length, chars) { + chars = chars === undefined ? ' ' : baseToString(chars); + + var charsLength = chars.length; + if (charsLength < 2) { + return charsLength ? baseRepeat(chars, length) : chars; + } + var result = baseRepeat(chars, nativeCeil(length / stringSize(chars))); + return hasUnicode(chars) + ? castSlice(stringToArray(result), 0, length).join('') + : result.slice(0, length); + } + + /** + * Creates a function that wraps `func` to invoke it with the `this` binding + * of `thisArg` and `partials` prepended to the arguments it receives. + * + * @private + * @param {Function} func The function to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {*} thisArg The `this` binding of `func`. + * @param {Array} partials The arguments to prepend to those provided to + * the new function. + * @returns {Function} Returns the new wrapped function. + */ + function createPartial(func, bitmask, thisArg, partials) { + var isBind = bitmask & WRAP_BIND_FLAG, + Ctor = createCtor(func); + + function wrapper() { + var argsIndex = -1, + argsLength = arguments.length, + leftIndex = -1, + leftLength = partials.length, + args = Array(leftLength + argsLength), + fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; + + while (++leftIndex < leftLength) { + args[leftIndex] = partials[leftIndex]; + } + while (argsLength--) { + args[leftIndex++] = arguments[++argsIndex]; + } + return apply(fn, isBind ? thisArg : this, args); + } + return wrapper; + } + + /** + * Creates a `_.range` or `_.rangeRight` function. + * + * @private + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Function} Returns the new range function. + */ + function createRange(fromRight) { + return function(start, end, step) { + if (step && typeof step != 'number' && isIterateeCall(start, end, step)) { + end = step = undefined; + } + // Ensure the sign of `-0` is preserved. + start = toFinite(start); + if (end === undefined) { + end = start; + start = 0; + } else { + end = toFinite(end); + } + step = step === undefined ? (start < end ? 1 : -1) : toFinite(step); + return baseRange(start, end, step, fromRight); + }; + } + + /** + * Creates a function that performs a relational operation on two values. + * + * @private + * @param {Function} operator The function to perform the operation. + * @returns {Function} Returns the new relational operation function. + */ + function createRelationalOperation(operator) { + return function(value, other) { + if (!(typeof value == 'string' && typeof other == 'string')) { + value = toNumber(value); + other = toNumber(other); + } + return operator(value, other); + }; + } + + /** + * Creates a function that wraps `func` to continue currying. + * + * @private + * @param {Function} func The function to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {Function} wrapFunc The function to create the `func` wrapper. + * @param {*} placeholder The placeholder value. + * @param {*} [thisArg] The `this` binding of `func`. + * @param {Array} [partials] The arguments to prepend to those provided to + * the new function. + * @param {Array} [holders] The `partials` placeholder indexes. + * @param {Array} [argPos] The argument positions of the new function. + * @param {number} [ary] The arity cap of `func`. + * @param {number} [arity] The arity of `func`. + * @returns {Function} Returns the new wrapped function. + */ + function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) { + var isCurry = bitmask & WRAP_CURRY_FLAG, + newHolders = isCurry ? holders : undefined, + newHoldersRight = isCurry ? undefined : holders, + newPartials = isCurry ? partials : undefined, + newPartialsRight = isCurry ? undefined : partials; + + bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG); + bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG); + + if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) { + bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG); + } + var newData = [ + func, bitmask, thisArg, newPartials, newHolders, newPartialsRight, + newHoldersRight, argPos, ary, arity + ]; + + var result = wrapFunc.apply(undefined, newData); + if (isLaziable(func)) { + setData(result, newData); + } + result.placeholder = placeholder; + return setWrapToString(result, func, bitmask); + } + + /** + * Creates a function like `_.round`. + * + * @private + * @param {string} methodName The name of the `Math` method to use when rounding. + * @returns {Function} Returns the new round function. + */ + function createRound(methodName) { + var func = Math[methodName]; + return function(number, precision) { + number = toNumber(number); + precision = precision == null ? 0 : nativeMin(toInteger(precision), 292); + if (precision) { + // Shift with exponential notation to avoid floating-point issues. + // See [MDN](https://mdn.io/round#Examples) for more details. + var pair = (toString(number) + 'e').split('e'), + value = func(pair[0] + 'e' + (+pair[1] + precision)); + + pair = (toString(value) + 'e').split('e'); + return +(pair[0] + 'e' + (+pair[1] - precision)); + } + return func(number); + }; + } + + /** + * Creates a set object of `values`. + * + * @private + * @param {Array} values The values to add to the set. + * @returns {Object} Returns the new set. + */ + var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop : function(values) { + return new Set(values); + }; + + /** + * Creates a `_.toPairs` or `_.toPairsIn` function. + * + * @private + * @param {Function} keysFunc The function to get the keys of a given object. + * @returns {Function} Returns the new pairs function. + */ + function createToPairs(keysFunc) { + return function(object) { + var tag = getTag(object); + if (tag == mapTag) { + return mapToArray(object); + } + if (tag == setTag) { + return setToPairs(object); + } + return baseToPairs(object, keysFunc(object)); + }; + } + + /** + * Creates a function that either curries or invokes `func` with optional + * `this` binding and partially applied arguments. + * + * @private + * @param {Function|string} func The function or method name to wrap. + * @param {number} bitmask The bitmask flags. + * 1 - `_.bind` + * 2 - `_.bindKey` + * 4 - `_.curry` or `_.curryRight` of a bound function + * 8 - `_.curry` + * 16 - `_.curryRight` + * 32 - `_.partial` + * 64 - `_.partialRight` + * 128 - `_.rearg` + * 256 - `_.ary` + * 512 - `_.flip` + * @param {*} [thisArg] The `this` binding of `func`. + * @param {Array} [partials] The arguments to be partially applied. + * @param {Array} [holders] The `partials` placeholder indexes. + * @param {Array} [argPos] The argument positions of the new function. + * @param {number} [ary] The arity cap of `func`. + * @param {number} [arity] The arity of `func`. + * @returns {Function} Returns the new wrapped function. + */ + function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) { + var isBindKey = bitmask & WRAP_BIND_KEY_FLAG; + if (!isBindKey && typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + var length = partials ? partials.length : 0; + if (!length) { + bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG); + partials = holders = undefined; + } + ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0); + arity = arity === undefined ? arity : toInteger(arity); + length -= holders ? holders.length : 0; + + if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) { + var partialsRight = partials, + holdersRight = holders; + + partials = holders = undefined; + } + var data = isBindKey ? undefined : getData(func); + + var newData = [ + func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, + argPos, ary, arity + ]; + + if (data) { + mergeData(newData, data); + } + func = newData[0]; + bitmask = newData[1]; + thisArg = newData[2]; + partials = newData[3]; + holders = newData[4]; + arity = newData[9] = newData[9] === undefined + ? (isBindKey ? 0 : func.length) + : nativeMax(newData[9] - length, 0); + + if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) { + bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG); + } + if (!bitmask || bitmask == WRAP_BIND_FLAG) { + var result = createBind(func, bitmask, thisArg); + } else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) { + result = createCurry(func, bitmask, arity); + } else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) { + result = createPartial(func, bitmask, thisArg, partials); + } else { + result = createHybrid.apply(undefined, newData); + } + var setter = data ? baseSetData : setData; + return setWrapToString(setter(result, newData), func, bitmask); + } + + /** + * Used by `_.defaults` to customize its `_.assignIn` use to assign properties + * of source objects to the destination object for all destination properties + * that resolve to `undefined`. + * + * @private + * @param {*} objValue The destination value. + * @param {*} srcValue The source value. + * @param {string} key The key of the property to assign. + * @param {Object} object The parent object of `objValue`. + * @returns {*} Returns the value to assign. + */ + function customDefaultsAssignIn(objValue, srcValue, key, object) { + if (objValue === undefined || + (eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) { + return srcValue; + } + return objValue; + } + + /** + * Used by `_.defaultsDeep` to customize its `_.merge` use to merge source + * objects into destination objects that are passed thru. + * + * @private + * @param {*} objValue The destination value. + * @param {*} srcValue The source value. + * @param {string} key The key of the property to merge. + * @param {Object} object The parent object of `objValue`. + * @param {Object} source The parent object of `srcValue`. + * @param {Object} [stack] Tracks traversed source values and their merged + * counterparts. + * @returns {*} Returns the value to assign. + */ + function customDefaultsMerge(objValue, srcValue, key, object, source, stack) { + if (isObject(objValue) && isObject(srcValue)) { + // Recursively merge objects and arrays (susceptible to call stack limits). + stack.set(srcValue, objValue); + baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack); + stack['delete'](srcValue); + } + return objValue; + } + + /** + * Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain + * objects. + * + * @private + * @param {*} value The value to inspect. + * @param {string} key The key of the property to inspect. + * @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`. + */ + function customOmitClone(value) { + return isPlainObject(value) ? undefined : value; + } + + /** + * A specialized version of `baseIsEqualDeep` for arrays with support for + * partial deep comparisons. + * + * @private + * @param {Array} array The array to compare. + * @param {Array} other The other array to compare. + * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. + * @param {Function} customizer The function to customize comparisons. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Object} stack Tracks traversed `array` and `other` objects. + * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`. + */ + function equalArrays(array, other, bitmask, customizer, equalFunc, stack) { + var isPartial = bitmask & COMPARE_PARTIAL_FLAG, + arrLength = array.length, + othLength = other.length; + + if (arrLength != othLength && !(isPartial && othLength > arrLength)) { + return false; + } + // Assume cyclic values are equal. + var stacked = stack.get(array); + if (stacked && stack.get(other)) { + return stacked == other; + } + var index = -1, + result = true, + seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined; + + stack.set(array, other); + stack.set(other, array); + + // Ignore non-index properties. + while (++index < arrLength) { + var arrValue = array[index], + othValue = other[index]; + + if (customizer) { + var compared = isPartial + ? customizer(othValue, arrValue, index, other, array, stack) + : customizer(arrValue, othValue, index, array, other, stack); + } + if (compared !== undefined) { + if (compared) { + continue; + } + result = false; + break; + } + // Recursively compare arrays (susceptible to call stack limits). + if (seen) { + if (!arraySome(other, function(othValue, othIndex) { + if (!cacheHas(seen, othIndex) && + (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) { + return seen.push(othIndex); + } + })) { + result = false; + break; + } + } else if (!( + arrValue === othValue || + equalFunc(arrValue, othValue, bitmask, customizer, stack) + )) { + result = false; + break; + } + } + stack['delete'](array); + stack['delete'](other); + return result; + } + + /** + * A specialized version of `baseIsEqualDeep` for comparing objects of + * the same `toStringTag`. + * + * **Note:** This function only supports comparing values with tags of + * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`. + * + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {string} tag The `toStringTag` of the objects to compare. + * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. + * @param {Function} customizer The function to customize comparisons. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Object} stack Tracks traversed `object` and `other` objects. + * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. + */ + function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) { + switch (tag) { + case dataViewTag: + if ((object.byteLength != other.byteLength) || + (object.byteOffset != other.byteOffset)) { + return false; + } + object = object.buffer; + other = other.buffer; + + case arrayBufferTag: + if ((object.byteLength != other.byteLength) || + !equalFunc(new Uint8Array(object), new Uint8Array(other))) { + return false; + } + return true; + + case boolTag: + case dateTag: + case numberTag: + // Coerce booleans to `1` or `0` and dates to milliseconds. + // Invalid dates are coerced to `NaN`. + return eq(+object, +other); + + case errorTag: + return object.name == other.name && object.message == other.message; + + case regexpTag: + case stringTag: + // Coerce regexes to strings and treat strings, primitives and objects, + // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring + // for more details. + return object == (other + ''); + + case mapTag: + var convert = mapToArray; + + case setTag: + var isPartial = bitmask & COMPARE_PARTIAL_FLAG; + convert || (convert = setToArray); + + if (object.size != other.size && !isPartial) { + return false; + } + // Assume cyclic values are equal. + var stacked = stack.get(object); + if (stacked) { + return stacked == other; + } + bitmask |= COMPARE_UNORDERED_FLAG; + + // Recursively compare objects (susceptible to call stack limits). + stack.set(object, other); + var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack); + stack['delete'](object); + return result; + + case symbolTag: + if (symbolValueOf) { + return symbolValueOf.call(object) == symbolValueOf.call(other); + } + } + return false; + } + + /** + * A specialized version of `baseIsEqualDeep` for objects with support for + * partial deep comparisons. + * + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. + * @param {Function} customizer The function to customize comparisons. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Object} stack Tracks traversed `object` and `other` objects. + * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. + */ + function equalObjects(object, other, bitmask, customizer, equalFunc, stack) { + var isPartial = bitmask & COMPARE_PARTIAL_FLAG, + objProps = getAllKeys(object), + objLength = objProps.length, + othProps = getAllKeys(other), + othLength = othProps.length; + + if (objLength != othLength && !isPartial) { + return false; + } + var index = objLength; + while (index--) { + var key = objProps[index]; + if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) { + return false; + } + } + // Assume cyclic values are equal. + var stacked = stack.get(object); + if (stacked && stack.get(other)) { + return stacked == other; + } + var result = true; + stack.set(object, other); + stack.set(other, object); + + var skipCtor = isPartial; + while (++index < objLength) { + key = objProps[index]; + var objValue = object[key], + othValue = other[key]; + + if (customizer) { + var compared = isPartial + ? customizer(othValue, objValue, key, other, object, stack) + : customizer(objValue, othValue, key, object, other, stack); + } + // Recursively compare objects (susceptible to call stack limits). + if (!(compared === undefined + ? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack)) + : compared + )) { + result = false; + break; + } + skipCtor || (skipCtor = key == 'constructor'); + } + if (result && !skipCtor) { + var objCtor = object.constructor, + othCtor = other.constructor; + + // Non `Object` object instances with different constructors are not equal. + if (objCtor != othCtor && + ('constructor' in object && 'constructor' in other) && + !(typeof objCtor == 'function' && objCtor instanceof objCtor && + typeof othCtor == 'function' && othCtor instanceof othCtor)) { + result = false; + } + } + stack['delete'](object); + stack['delete'](other); + return result; + } + + /** + * A specialized version of `baseRest` which flattens the rest array. + * + * @private + * @param {Function} func The function to apply a rest parameter to. + * @returns {Function} Returns the new function. + */ + function flatRest(func) { + return setToString(overRest(func, undefined, flatten), func + ''); + } + + /** + * Creates an array of own enumerable property names and symbols of `object`. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names and symbols. + */ + function getAllKeys(object) { + return baseGetAllKeys(object, keys, getSymbols); + } + + /** + * Creates an array of own and inherited enumerable property names and + * symbols of `object`. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names and symbols. + */ + function getAllKeysIn(object) { + return baseGetAllKeys(object, keysIn, getSymbolsIn); + } + + /** + * Gets metadata for `func`. + * + * @private + * @param {Function} func The function to query. + * @returns {*} Returns the metadata for `func`. + */ + var getData = !metaMap ? noop : function(func) { + return metaMap.get(func); + }; + + /** + * Gets the name of `func`. + * + * @private + * @param {Function} func The function to query. + * @returns {string} Returns the function name. + */ + function getFuncName(func) { + var result = (func.name + ''), + array = realNames[result], + length = hasOwnProperty.call(realNames, result) ? array.length : 0; + + while (length--) { + var data = array[length], + otherFunc = data.func; + if (otherFunc == null || otherFunc == func) { + return data.name; + } + } + return result; + } + + /** + * Gets the argument placeholder value for `func`. + * + * @private + * @param {Function} func The function to inspect. + * @returns {*} Returns the placeholder value. + */ + function getHolder(func) { + var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func; + return object.placeholder; + } + + /** + * Gets the appropriate "iteratee" function. If `_.iteratee` is customized, + * this function returns the custom method, otherwise it returns `baseIteratee`. + * If arguments are provided, the chosen function is invoked with them and + * its result is returned. + * + * @private + * @param {*} [value] The value to convert to an iteratee. + * @param {number} [arity] The arity of the created iteratee. + * @returns {Function} Returns the chosen function or its result. + */ + function getIteratee() { + var result = lodash.iteratee || iteratee; + result = result === iteratee ? baseIteratee : result; + return arguments.length ? result(arguments[0], arguments[1]) : result; + } + + /** + * Gets the data for `map`. + * + * @private + * @param {Object} map The map to query. + * @param {string} key The reference key. + * @returns {*} Returns the map data. + */ + function getMapData(map, key) { + var data = map.__data__; + return isKeyable(key) + ? data[typeof key == 'string' ? 'string' : 'hash'] + : data.map; + } + + /** + * Gets the property names, values, and compare flags of `object`. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the match data of `object`. + */ + function getMatchData(object) { + var result = keys(object), + length = result.length; + + while (length--) { + var key = result[length], + value = object[key]; + + result[length] = [key, value, isStrictComparable(value)]; + } + return result; + } + + /** + * Gets the native function at `key` of `object`. + * + * @private + * @param {Object} object The object to query. + * @param {string} key The key of the method to get. + * @returns {*} Returns the function if it's native, else `undefined`. + */ + function getNative(object, key) { + var value = getValue(object, key); + return baseIsNative(value) ? value : undefined; + } + + /** + * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values. + * + * @private + * @param {*} value The value to query. + * @returns {string} Returns the raw `toStringTag`. + */ + function getRawTag(value) { + var isOwn = hasOwnProperty.call(value, symToStringTag), + tag = value[symToStringTag]; + + try { + value[symToStringTag] = undefined; + var unmasked = true; + } catch (e) {} + + var result = nativeObjectToString.call(value); + if (unmasked) { + if (isOwn) { + value[symToStringTag] = tag; + } else { + delete value[symToStringTag]; + } + } + return result; + } + + /** + * Creates an array of the own enumerable symbols of `object`. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of symbols. + */ + var getSymbols = !nativeGetSymbols ? stubArray : function(object) { + if (object == null) { + return []; + } + object = Object(object); + return arrayFilter(nativeGetSymbols(object), function(symbol) { + return propertyIsEnumerable.call(object, symbol); + }); + }; + + /** + * Creates an array of the own and inherited enumerable symbols of `object`. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of symbols. + */ + var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object) { + var result = []; + while (object) { + arrayPush(result, getSymbols(object)); + object = getPrototype(object); + } + return result; + }; + + /** + * Gets the `toStringTag` of `value`. + * + * @private + * @param {*} value The value to query. + * @returns {string} Returns the `toStringTag`. + */ + var getTag = baseGetTag; + + // Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6. + if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) || + (Map && getTag(new Map) != mapTag) || + (Promise && getTag(Promise.resolve()) != promiseTag) || + (Set && getTag(new Set) != setTag) || + (WeakMap && getTag(new WeakMap) != weakMapTag)) { + getTag = function(value) { + var result = baseGetTag(value), + Ctor = result == objectTag ? value.constructor : undefined, + ctorString = Ctor ? toSource(Ctor) : ''; + + if (ctorString) { + switch (ctorString) { + case dataViewCtorString: return dataViewTag; + case mapCtorString: return mapTag; + case promiseCtorString: return promiseTag; + case setCtorString: return setTag; + case weakMapCtorString: return weakMapTag; + } + } + return result; + }; + } + + /** + * Gets the view, applying any `transforms` to the `start` and `end` positions. + * + * @private + * @param {number} start The start of the view. + * @param {number} end The end of the view. + * @param {Array} transforms The transformations to apply to the view. + * @returns {Object} Returns an object containing the `start` and `end` + * positions of the view. + */ + function getView(start, end, transforms) { + var index = -1, + length = transforms.length; + + while (++index < length) { + var data = transforms[index], + size = data.size; + + switch (data.type) { + case 'drop': start += size; break; + case 'dropRight': end -= size; break; + case 'take': end = nativeMin(end, start + size); break; + case 'takeRight': start = nativeMax(start, end - size); break; + } + } + return { 'start': start, 'end': end }; + } + + /** + * Extracts wrapper details from the `source` body comment. + * + * @private + * @param {string} source The source to inspect. + * @returns {Array} Returns the wrapper details. + */ + function getWrapDetails(source) { + var match = source.match(reWrapDetails); + return match ? match[1].split(reSplitDetails) : []; + } + + /** + * Checks if `path` exists on `object`. + * + * @private + * @param {Object} object The object to query. + * @param {Array|string} path The path to check. + * @param {Function} hasFunc The function to check properties. + * @returns {boolean} Returns `true` if `path` exists, else `false`. + */ + function hasPath(object, path, hasFunc) { + path = castPath(path, object); + + var index = -1, + length = path.length, + result = false; + + while (++index < length) { + var key = toKey(path[index]); + if (!(result = object != null && hasFunc(object, key))) { + break; + } + object = object[key]; + } + if (result || ++index != length) { + return result; + } + length = object == null ? 0 : object.length; + return !!length && isLength(length) && isIndex(key, length) && + (isArray(object) || isArguments(object)); + } + + /** + * Initializes an array clone. + * + * @private + * @param {Array} array The array to clone. + * @returns {Array} Returns the initialized clone. + */ + function initCloneArray(array) { + var length = array.length, + result = new array.constructor(length); + + // Add properties assigned by `RegExp#exec`. + if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) { + result.index = array.index; + result.input = array.input; + } + return result; + } + + /** + * Initializes an object clone. + * + * @private + * @param {Object} object The object to clone. + * @returns {Object} Returns the initialized clone. + */ + function initCloneObject(object) { + return (typeof object.constructor == 'function' && !isPrototype(object)) + ? baseCreate(getPrototype(object)) + : {}; + } + + /** + * Initializes an object clone based on its `toStringTag`. + * + * **Note:** This function only supports cloning values with tags of + * `Boolean`, `Date`, `Error`, `Map`, `Number`, `RegExp`, `Set`, or `String`. + * + * @private + * @param {Object} object The object to clone. + * @param {string} tag The `toStringTag` of the object to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the initialized clone. + */ + function initCloneByTag(object, tag, isDeep) { + var Ctor = object.constructor; + switch (tag) { + case arrayBufferTag: + return cloneArrayBuffer(object); + + case boolTag: + case dateTag: + return new Ctor(+object); + + case dataViewTag: + return cloneDataView(object, isDeep); + + case float32Tag: case float64Tag: + case int8Tag: case int16Tag: case int32Tag: + case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag: + return cloneTypedArray(object, isDeep); + + case mapTag: + return new Ctor; + + case numberTag: + case stringTag: + return new Ctor(object); + + case regexpTag: + return cloneRegExp(object); + + case setTag: + return new Ctor; + + case symbolTag: + return cloneSymbol(object); + } + } + + /** + * Inserts wrapper `details` in a comment at the top of the `source` body. + * + * @private + * @param {string} source The source to modify. + * @returns {Array} details The details to insert. + * @returns {string} Returns the modified source. + */ + function insertWrapDetails(source, details) { + var length = details.length; + if (!length) { + return source; + } + var lastIndex = length - 1; + details[lastIndex] = (length > 1 ? '& ' : '') + details[lastIndex]; + details = details.join(length > 2 ? ', ' : ' '); + return source.replace(reWrapComment, '{\n/* [wrapped with ' + details + '] */\n'); + } + + /** + * Checks if `value` is a flattenable `arguments` object or array. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is flattenable, else `false`. + */ + function isFlattenable(value) { + return isArray(value) || isArguments(value) || + !!(spreadableSymbol && value && value[spreadableSymbol]); + } + + /** + * Checks if `value` is a valid array-like index. + * + * @private + * @param {*} value The value to check. + * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index. + * @returns {boolean} Returns `true` if `value` is a valid index, else `false`. + */ + function isIndex(value, length) { + var type = typeof value; + length = length == null ? MAX_SAFE_INTEGER : length; + + return !!length && + (type == 'number' || + (type != 'symbol' && reIsUint.test(value))) && + (value > -1 && value % 1 == 0 && value < length); + } + + /** + * Checks if the given arguments are from an iteratee call. + * + * @private + * @param {*} value The potential iteratee value argument. + * @param {*} index The potential iteratee index or key argument. + * @param {*} object The potential iteratee object argument. + * @returns {boolean} Returns `true` if the arguments are from an iteratee call, + * else `false`. + */ + function isIterateeCall(value, index, object) { + if (!isObject(object)) { + return false; + } + var type = typeof index; + if (type == 'number' + ? (isArrayLike(object) && isIndex(index, object.length)) + : (type == 'string' && index in object) + ) { + return eq(object[index], value); + } + return false; + } + + /** + * Checks if `value` is a property name and not a property path. + * + * @private + * @param {*} value The value to check. + * @param {Object} [object] The object to query keys on. + * @returns {boolean} Returns `true` if `value` is a property name, else `false`. + */ + function isKey(value, object) { + if (isArray(value)) { + return false; + } + var type = typeof value; + if (type == 'number' || type == 'symbol' || type == 'boolean' || + value == null || isSymbol(value)) { + return true; + } + return reIsPlainProp.test(value) || !reIsDeepProp.test(value) || + (object != null && value in Object(object)); + } + + /** + * Checks if `value` is suitable for use as unique object key. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is suitable, else `false`. + */ + function isKeyable(value) { + var type = typeof value; + return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean') + ? (value !== '__proto__') + : (value === null); + } + + /** + * Checks if `func` has a lazy counterpart. + * + * @private + * @param {Function} func The function to check. + * @returns {boolean} Returns `true` if `func` has a lazy counterpart, + * else `false`. + */ + function isLaziable(func) { + var funcName = getFuncName(func), + other = lodash[funcName]; + + if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) { + return false; + } + if (func === other) { + return true; + } + var data = getData(other); + return !!data && func === data[0]; + } + + /** + * Checks if `func` has its source masked. + * + * @private + * @param {Function} func The function to check. + * @returns {boolean} Returns `true` if `func` is masked, else `false`. + */ + function isMasked(func) { + return !!maskSrcKey && (maskSrcKey in func); + } + + /** + * Checks if `func` is capable of being masked. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `func` is maskable, else `false`. + */ + var isMaskable = coreJsData ? isFunction : stubFalse; + + /** + * Checks if `value` is likely a prototype object. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a prototype, else `false`. + */ + function isPrototype(value) { + var Ctor = value && value.constructor, + proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto; + + return value === proto; + } + + /** + * Checks if `value` is suitable for strict equality comparisons, i.e. `===`. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` if suitable for strict + * equality comparisons, else `false`. + */ + function isStrictComparable(value) { + return value === value && !isObject(value); + } + + /** + * A specialized version of `matchesProperty` for source values suitable + * for strict equality comparisons, i.e. `===`. + * + * @private + * @param {string} key The key of the property to get. + * @param {*} srcValue The value to match. + * @returns {Function} Returns the new spec function. + */ + function matchesStrictComparable(key, srcValue) { + return function(object) { + if (object == null) { + return false; + } + return object[key] === srcValue && + (srcValue !== undefined || (key in Object(object))); + }; + } + + /** + * A specialized version of `_.memoize` which clears the memoized function's + * cache when it exceeds `MAX_MEMOIZE_SIZE`. + * + * @private + * @param {Function} func The function to have its output memoized. + * @returns {Function} Returns the new memoized function. + */ + function memoizeCapped(func) { + var result = memoize(func, function(key) { + if (cache.size === MAX_MEMOIZE_SIZE) { + cache.clear(); + } + return key; + }); + + var cache = result.cache; + return result; + } + + /** + * Merges the function metadata of `source` into `data`. + * + * Merging metadata reduces the number of wrappers used to invoke a function. + * This is possible because methods like `_.bind`, `_.curry`, and `_.partial` + * may be applied regardless of execution order. Methods like `_.ary` and + * `_.rearg` modify function arguments, making the order in which they are + * executed important, preventing the merging of metadata. However, we make + * an exception for a safe combined case where curried functions have `_.ary` + * and or `_.rearg` applied. + * + * @private + * @param {Array} data The destination metadata. + * @param {Array} source The source metadata. + * @returns {Array} Returns `data`. + */ + function mergeData(data, source) { + var bitmask = data[1], + srcBitmask = source[1], + newBitmask = bitmask | srcBitmask, + isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG); + + var isCombo = + ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) || + ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) || + ((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG)); + + // Exit early if metadata can't be merged. + if (!(isCommon || isCombo)) { + return data; + } + // Use source `thisArg` if available. + if (srcBitmask & WRAP_BIND_FLAG) { + data[2] = source[2]; + // Set when currying a bound function. + newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG; + } + // Compose partial arguments. + var value = source[3]; + if (value) { + var partials = data[3]; + data[3] = partials ? composeArgs(partials, value, source[4]) : value; + data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4]; + } + // Compose partial right arguments. + value = source[5]; + if (value) { + partials = data[5]; + data[5] = partials ? composeArgsRight(partials, value, source[6]) : value; + data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6]; + } + // Use source `argPos` if available. + value = source[7]; + if (value) { + data[7] = value; + } + // Use source `ary` if it's smaller. + if (srcBitmask & WRAP_ARY_FLAG) { + data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]); + } + // Use source `arity` if one is not provided. + if (data[9] == null) { + data[9] = source[9]; + } + // Use source `func` and merge bitmasks. + data[0] = source[0]; + data[1] = newBitmask; + + return data; + } + + /** + * This function is like + * [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) + * except that it includes inherited enumerable properties. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + */ + function nativeKeysIn(object) { + var result = []; + if (object != null) { + for (var key in Object(object)) { + result.push(key); + } + } + return result; + } + + /** + * Converts `value` to a string using `Object.prototype.toString`. + * + * @private + * @param {*} value The value to convert. + * @returns {string} Returns the converted string. + */ + function objectToString(value) { + return nativeObjectToString.call(value); + } + + /** + * A specialized version of `baseRest` which transforms the rest array. + * + * @private + * @param {Function} func The function to apply a rest parameter to. + * @param {number} [start=func.length-1] The start position of the rest parameter. + * @param {Function} transform The rest array transform. + * @returns {Function} Returns the new function. + */ + function overRest(func, start, transform) { + start = nativeMax(start === undefined ? (func.length - 1) : start, 0); + return function() { + var args = arguments, + index = -1, + length = nativeMax(args.length - start, 0), + array = Array(length); + + while (++index < length) { + array[index] = args[start + index]; + } + index = -1; + var otherArgs = Array(start + 1); + while (++index < start) { + otherArgs[index] = args[index]; + } + otherArgs[start] = transform(array); + return apply(func, this, otherArgs); + }; + } + + /** + * Gets the parent value at `path` of `object`. + * + * @private + * @param {Object} object The object to query. + * @param {Array} path The path to get the parent value of. + * @returns {*} Returns the parent value. + */ + function parent(object, path) { + return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1)); + } + + /** + * Reorder `array` according to the specified indexes where the element at + * the first index is assigned as the first element, the element at + * the second index is assigned as the second element, and so on. + * + * @private + * @param {Array} array The array to reorder. + * @param {Array} indexes The arranged array indexes. + * @returns {Array} Returns `array`. + */ + function reorder(array, indexes) { + var arrLength = array.length, + length = nativeMin(indexes.length, arrLength), + oldArray = copyArray(array); + + while (length--) { + var index = indexes[length]; + array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined; + } + return array; + } + + /** + * Sets metadata for `func`. + * + * **Note:** If this function becomes hot, i.e. is invoked a lot in a short + * period of time, it will trip its breaker and transition to an identity + * function to avoid garbage collection pauses in V8. See + * [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070) + * for more details. + * + * @private + * @param {Function} func The function to associate metadata with. + * @param {*} data The metadata. + * @returns {Function} Returns `func`. + */ + var setData = shortOut(baseSetData); + + /** + * A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout). + * + * @private + * @param {Function} func The function to delay. + * @param {number} wait The number of milliseconds to delay invocation. + * @returns {number|Object} Returns the timer id or timeout object. + */ + var setTimeout = ctxSetTimeout || function(func, wait) { + return root.setTimeout(func, wait); + }; + + /** + * Sets the `toString` method of `func` to return `string`. + * + * @private + * @param {Function} func The function to modify. + * @param {Function} string The `toString` result. + * @returns {Function} Returns `func`. + */ + var setToString = shortOut(baseSetToString); + + /** + * Sets the `toString` method of `wrapper` to mimic the source of `reference` + * with wrapper details in a comment at the top of the source body. + * + * @private + * @param {Function} wrapper The function to modify. + * @param {Function} reference The reference function. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @returns {Function} Returns `wrapper`. + */ + function setWrapToString(wrapper, reference, bitmask) { + var source = (reference + ''); + return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask))); + } + + /** + * Creates a function that'll short out and invoke `identity` instead + * of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN` + * milliseconds. + * + * @private + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new shortable function. + */ + function shortOut(func) { + var count = 0, + lastCalled = 0; + + return function() { + var stamp = nativeNow(), + remaining = HOT_SPAN - (stamp - lastCalled); + + lastCalled = stamp; + if (remaining > 0) { + if (++count >= HOT_COUNT) { + return arguments[0]; + } + } else { + count = 0; + } + return func.apply(undefined, arguments); + }; + } + + /** + * A specialized version of `_.shuffle` which mutates and sets the size of `array`. + * + * @private + * @param {Array} array The array to shuffle. + * @param {number} [size=array.length] The size of `array`. + * @returns {Array} Returns `array`. + */ + function shuffleSelf(array, size) { + var index = -1, + length = array.length, + lastIndex = length - 1; + + size = size === undefined ? length : size; + while (++index < size) { + var rand = baseRandom(index, lastIndex), + value = array[rand]; + + array[rand] = array[index]; + array[index] = value; + } + array.length = size; + return array; + } + + /** + * Converts `string` to a property path array. + * + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the property path array. + */ + var stringToPath = memoizeCapped(function(string) { + var result = []; + if (string.charCodeAt(0) === 46 /* . */) { + result.push(''); + } + string.replace(rePropName, function(match, number, quote, subString) { + result.push(quote ? subString.replace(reEscapeChar, '$1') : (number || match)); + }); + return result; + }); + + /** + * Converts `value` to a string key if it's not a string or symbol. + * + * @private + * @param {*} value The value to inspect. + * @returns {string|symbol} Returns the key. + */ + function toKey(value) { + if (typeof value == 'string' || isSymbol(value)) { + return value; + } + var result = (value + ''); + return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; + } + + /** + * Converts `func` to its source code. + * + * @private + * @param {Function} func The function to convert. + * @returns {string} Returns the source code. + */ + function toSource(func) { + if (func != null) { + try { + return funcToString.call(func); + } catch (e) {} + try { + return (func + ''); + } catch (e) {} + } + return ''; + } + + /** + * Updates wrapper `details` based on `bitmask` flags. + * + * @private + * @returns {Array} details The details to modify. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @returns {Array} Returns `details`. + */ + function updateWrapDetails(details, bitmask) { + arrayEach(wrapFlags, function(pair) { + var value = '_.' + pair[0]; + if ((bitmask & pair[1]) && !arrayIncludes(details, value)) { + details.push(value); + } + }); + return details.sort(); + } + + /** + * Creates a clone of `wrapper`. + * + * @private + * @param {Object} wrapper The wrapper to clone. + * @returns {Object} Returns the cloned wrapper. + */ + function wrapperClone(wrapper) { + if (wrapper instanceof LazyWrapper) { + return wrapper.clone(); + } + var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__); + result.__actions__ = copyArray(wrapper.__actions__); + result.__index__ = wrapper.__index__; + result.__values__ = wrapper.__values__; + return result; + } + + /*------------------------------------------------------------------------*/ + + /** + * Creates an array of elements split into groups the length of `size`. + * If `array` can't be split evenly, the final chunk will be the remaining + * elements. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to process. + * @param {number} [size=1] The length of each chunk + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the new array of chunks. + * @example + * + * _.chunk(['a', 'b', 'c', 'd'], 2); + * // => [['a', 'b'], ['c', 'd']] + * + * _.chunk(['a', 'b', 'c', 'd'], 3); + * // => [['a', 'b', 'c'], ['d']] + */ + function chunk(array, size, guard) { + if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) { + size = 1; + } else { + size = nativeMax(toInteger(size), 0); + } + var length = array == null ? 0 : array.length; + if (!length || size < 1) { + return []; + } + var index = 0, + resIndex = 0, + result = Array(nativeCeil(length / size)); + + while (index < length) { + result[resIndex++] = baseSlice(array, index, (index += size)); + } + return result; + } + + /** + * Creates an array with all falsey values removed. The values `false`, `null`, + * `0`, `""`, `undefined`, and `NaN` are falsey. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to compact. + * @returns {Array} Returns the new array of filtered values. + * @example + * + * _.compact([0, 1, false, 2, '', 3]); + * // => [1, 2, 3] + */ + function compact(array) { + var index = -1, + length = array == null ? 0 : array.length, + resIndex = 0, + result = []; + + while (++index < length) { + var value = array[index]; + if (value) { + result[resIndex++] = value; + } + } + return result; + } + + /** + * Creates a new array concatenating `array` with any additional arrays + * and/or values. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to concatenate. + * @param {...*} [values] The values to concatenate. + * @returns {Array} Returns the new concatenated array. + * @example + * + * var array = [1]; + * var other = _.concat(array, 2, [3], [[4]]); + * + * console.log(other); + * // => [1, 2, 3, [4]] + * + * console.log(array); + * // => [1] + */ + function concat() { + var length = arguments.length; + if (!length) { + return []; + } + var args = Array(length - 1), + array = arguments[0], + index = length; + + while (index--) { + args[index - 1] = arguments[index]; + } + return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1)); + } + + /** + * Creates an array of `array` values not included in the other given arrays + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. The order and references of result values are + * determined by the first array. + * + * **Note:** Unlike `_.pullAll`, this method returns a new array. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {...Array} [values] The values to exclude. + * @returns {Array} Returns the new array of filtered values. + * @see _.without, _.xor + * @example + * + * _.difference([2, 1], [2, 3]); + * // => [1] + */ + var difference = baseRest(function(array, values) { + return isArrayLikeObject(array) + ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true)) + : []; + }); + + /** + * This method is like `_.difference` except that it accepts `iteratee` which + * is invoked for each element of `array` and `values` to generate the criterion + * by which they're compared. The order and references of result values are + * determined by the first array. The iteratee is invoked with one argument: + * (value). + * + * **Note:** Unlike `_.pullAllBy`, this method returns a new array. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {...Array} [values] The values to exclude. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new array of filtered values. + * @example + * + * _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor); + * // => [1.2] + * + * // The `_.property` iteratee shorthand. + * _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x'); + * // => [{ 'x': 2 }] + */ + var differenceBy = baseRest(function(array, values) { + var iteratee = last(values); + if (isArrayLikeObject(iteratee)) { + iteratee = undefined; + } + return isArrayLikeObject(array) + ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)) + : []; + }); + + /** + * This method is like `_.difference` except that it accepts `comparator` + * which is invoked to compare elements of `array` to `values`. The order and + * references of result values are determined by the first array. The comparator + * is invoked with two arguments: (arrVal, othVal). + * + * **Note:** Unlike `_.pullAllWith`, this method returns a new array. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {...Array} [values] The values to exclude. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of filtered values. + * @example + * + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; + * + * _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual); + * // => [{ 'x': 2, 'y': 1 }] + */ + var differenceWith = baseRest(function(array, values) { + var comparator = last(values); + if (isArrayLikeObject(comparator)) { + comparator = undefined; + } + return isArrayLikeObject(array) + ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator) + : []; + }); + + /** + * Creates a slice of `array` with `n` elements dropped from the beginning. + * + * @static + * @memberOf _ + * @since 0.5.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to drop. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.drop([1, 2, 3]); + * // => [2, 3] + * + * _.drop([1, 2, 3], 2); + * // => [3] + * + * _.drop([1, 2, 3], 5); + * // => [] + * + * _.drop([1, 2, 3], 0); + * // => [1, 2, 3] + */ + function drop(array, n, guard) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + n = (guard || n === undefined) ? 1 : toInteger(n); + return baseSlice(array, n < 0 ? 0 : n, length); + } + + /** + * Creates a slice of `array` with `n` elements dropped from the end. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to drop. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.dropRight([1, 2, 3]); + * // => [1, 2] + * + * _.dropRight([1, 2, 3], 2); + * // => [1] + * + * _.dropRight([1, 2, 3], 5); + * // => [] + * + * _.dropRight([1, 2, 3], 0); + * // => [1, 2, 3] + */ + function dropRight(array, n, guard) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + n = (guard || n === undefined) ? 1 : toInteger(n); + n = length - n; + return baseSlice(array, 0, n < 0 ? 0 : n); + } + + /** + * Creates a slice of `array` excluding elements dropped from the end. + * Elements are dropped until `predicate` returns falsey. The predicate is + * invoked with three arguments: (value, index, array). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the slice of `array`. + * @example + * + * var users = [ + * { 'user': 'barney', 'active': true }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': false } + * ]; + * + * _.dropRightWhile(users, function(o) { return !o.active; }); + * // => objects for ['barney'] + * + * // The `_.matches` iteratee shorthand. + * _.dropRightWhile(users, { 'user': 'pebbles', 'active': false }); + * // => objects for ['barney', 'fred'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.dropRightWhile(users, ['active', false]); + * // => objects for ['barney'] + * + * // The `_.property` iteratee shorthand. + * _.dropRightWhile(users, 'active'); + * // => objects for ['barney', 'fred', 'pebbles'] + */ + function dropRightWhile(array, predicate) { + return (array && array.length) + ? baseWhile(array, getIteratee(predicate, 3), true, true) + : []; + } + + /** + * Creates a slice of `array` excluding elements dropped from the beginning. + * Elements are dropped until `predicate` returns falsey. The predicate is + * invoked with three arguments: (value, index, array). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the slice of `array`. + * @example + * + * var users = [ + * { 'user': 'barney', 'active': false }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': true } + * ]; + * + * _.dropWhile(users, function(o) { return !o.active; }); + * // => objects for ['pebbles'] + * + * // The `_.matches` iteratee shorthand. + * _.dropWhile(users, { 'user': 'barney', 'active': false }); + * // => objects for ['fred', 'pebbles'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.dropWhile(users, ['active', false]); + * // => objects for ['pebbles'] + * + * // The `_.property` iteratee shorthand. + * _.dropWhile(users, 'active'); + * // => objects for ['barney', 'fred', 'pebbles'] + */ + function dropWhile(array, predicate) { + return (array && array.length) + ? baseWhile(array, getIteratee(predicate, 3), true) + : []; + } + + /** + * Fills elements of `array` with `value` from `start` up to, but not + * including, `end`. + * + * **Note:** This method mutates `array`. + * + * @static + * @memberOf _ + * @since 3.2.0 + * @category Array + * @param {Array} array The array to fill. + * @param {*} value The value to fill `array` with. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns `array`. + * @example + * + * var array = [1, 2, 3]; + * + * _.fill(array, 'a'); + * console.log(array); + * // => ['a', 'a', 'a'] + * + * _.fill(Array(3), 2); + * // => [2, 2, 2] + * + * _.fill([4, 6, 8, 10], '*', 1, 3); + * // => [4, '*', '*', 10] + */ + function fill(array, value, start, end) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + if (start && typeof start != 'number' && isIterateeCall(array, value, start)) { + start = 0; + end = length; + } + return baseFill(array, value, start, end); + } + + /** + * This method is like `_.find` except that it returns the index of the first + * element `predicate` returns truthy for instead of the element itself. + * + * @static + * @memberOf _ + * @since 1.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param {number} [fromIndex=0] The index to search from. + * @returns {number} Returns the index of the found element, else `-1`. + * @example + * + * var users = [ + * { 'user': 'barney', 'active': false }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': true } + * ]; + * + * _.findIndex(users, function(o) { return o.user == 'barney'; }); + * // => 0 + * + * // The `_.matches` iteratee shorthand. + * _.findIndex(users, { 'user': 'fred', 'active': false }); + * // => 1 + * + * // The `_.matchesProperty` iteratee shorthand. + * _.findIndex(users, ['active', false]); + * // => 0 + * + * // The `_.property` iteratee shorthand. + * _.findIndex(users, 'active'); + * // => 2 + */ + function findIndex(array, predicate, fromIndex) { + var length = array == null ? 0 : array.length; + if (!length) { + return -1; + } + var index = fromIndex == null ? 0 : toInteger(fromIndex); + if (index < 0) { + index = nativeMax(length + index, 0); + } + return baseFindIndex(array, getIteratee(predicate, 3), index); + } + + /** + * This method is like `_.findIndex` except that it iterates over elements + * of `collection` from right to left. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param {number} [fromIndex=array.length-1] The index to search from. + * @returns {number} Returns the index of the found element, else `-1`. + * @example + * + * var users = [ + * { 'user': 'barney', 'active': true }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': false } + * ]; + * + * _.findLastIndex(users, function(o) { return o.user == 'pebbles'; }); + * // => 2 + * + * // The `_.matches` iteratee shorthand. + * _.findLastIndex(users, { 'user': 'barney', 'active': true }); + * // => 0 + * + * // The `_.matchesProperty` iteratee shorthand. + * _.findLastIndex(users, ['active', false]); + * // => 2 + * + * // The `_.property` iteratee shorthand. + * _.findLastIndex(users, 'active'); + * // => 0 + */ + function findLastIndex(array, predicate, fromIndex) { + var length = array == null ? 0 : array.length; + if (!length) { + return -1; + } + var index = length - 1; + if (fromIndex !== undefined) { + index = toInteger(fromIndex); + index = fromIndex < 0 + ? nativeMax(length + index, 0) + : nativeMin(index, length - 1); + } + return baseFindIndex(array, getIteratee(predicate, 3), index, true); + } + + /** + * Flattens `array` a single level deep. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to flatten. + * @returns {Array} Returns the new flattened array. + * @example + * + * _.flatten([1, [2, [3, [4]], 5]]); + * // => [1, 2, [3, [4]], 5] + */ + function flatten(array) { + var length = array == null ? 0 : array.length; + return length ? baseFlatten(array, 1) : []; + } + + /** + * Recursively flattens `array`. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to flatten. + * @returns {Array} Returns the new flattened array. + * @example + * + * _.flattenDeep([1, [2, [3, [4]], 5]]); + * // => [1, 2, 3, 4, 5] + */ + function flattenDeep(array) { + var length = array == null ? 0 : array.length; + return length ? baseFlatten(array, INFINITY) : []; + } + + /** + * Recursively flatten `array` up to `depth` times. + * + * @static + * @memberOf _ + * @since 4.4.0 + * @category Array + * @param {Array} array The array to flatten. + * @param {number} [depth=1] The maximum recursion depth. + * @returns {Array} Returns the new flattened array. + * @example + * + * var array = [1, [2, [3, [4]], 5]]; + * + * _.flattenDepth(array, 1); + * // => [1, 2, [3, [4]], 5] + * + * _.flattenDepth(array, 2); + * // => [1, 2, 3, [4], 5] + */ + function flattenDepth(array, depth) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + depth = depth === undefined ? 1 : toInteger(depth); + return baseFlatten(array, depth); + } + + /** + * The inverse of `_.toPairs`; this method returns an object composed + * from key-value `pairs`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} pairs The key-value pairs. + * @returns {Object} Returns the new object. + * @example + * + * _.fromPairs([['a', 1], ['b', 2]]); + * // => { 'a': 1, 'b': 2 } + */ + function fromPairs(pairs) { + var index = -1, + length = pairs == null ? 0 : pairs.length, + result = {}; + + while (++index < length) { + var pair = pairs[index]; + result[pair[0]] = pair[1]; + } + return result; + } + + /** + * Gets the first element of `array`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @alias first + * @category Array + * @param {Array} array The array to query. + * @returns {*} Returns the first element of `array`. + * @example + * + * _.head([1, 2, 3]); + * // => 1 + * + * _.head([]); + * // => undefined + */ + function head(array) { + return (array && array.length) ? array[0] : undefined; + } + + /** + * Gets the index at which the first occurrence of `value` is found in `array` + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. If `fromIndex` is negative, it's used as the + * offset from the end of `array`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} [fromIndex=0] The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + * @example + * + * _.indexOf([1, 2, 1, 2], 2); + * // => 1 + * + * // Search from the `fromIndex`. + * _.indexOf([1, 2, 1, 2], 2, 2); + * // => 3 + */ + function indexOf(array, value, fromIndex) { + var length = array == null ? 0 : array.length; + if (!length) { + return -1; + } + var index = fromIndex == null ? 0 : toInteger(fromIndex); + if (index < 0) { + index = nativeMax(length + index, 0); + } + return baseIndexOf(array, value, index); + } + + /** + * Gets all but the last element of `array`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to query. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.initial([1, 2, 3]); + * // => [1, 2] + */ + function initial(array) { + var length = array == null ? 0 : array.length; + return length ? baseSlice(array, 0, -1) : []; + } + + /** + * Creates an array of unique values that are included in all given arrays + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. The order and references of result values are + * determined by the first array. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @returns {Array} Returns the new array of intersecting values. + * @example + * + * _.intersection([2, 1], [2, 3]); + * // => [2] + */ + var intersection = baseRest(function(arrays) { + var mapped = arrayMap(arrays, castArrayLikeObject); + return (mapped.length && mapped[0] === arrays[0]) + ? baseIntersection(mapped) + : []; + }); + + /** + * This method is like `_.intersection` except that it accepts `iteratee` + * which is invoked for each element of each `arrays` to generate the criterion + * by which they're compared. The order and references of result values are + * determined by the first array. The iteratee is invoked with one argument: + * (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new array of intersecting values. + * @example + * + * _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor); + * // => [2.1] + * + * // The `_.property` iteratee shorthand. + * _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 1 }] + */ + var intersectionBy = baseRest(function(arrays) { + var iteratee = last(arrays), + mapped = arrayMap(arrays, castArrayLikeObject); + + if (iteratee === last(mapped)) { + iteratee = undefined; + } else { + mapped.pop(); + } + return (mapped.length && mapped[0] === arrays[0]) + ? baseIntersection(mapped, getIteratee(iteratee, 2)) + : []; + }); + + /** + * This method is like `_.intersection` except that it accepts `comparator` + * which is invoked to compare elements of `arrays`. The order and references + * of result values are determined by the first array. The comparator is + * invoked with two arguments: (arrVal, othVal). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of intersecting values. + * @example + * + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; + * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; + * + * _.intersectionWith(objects, others, _.isEqual); + * // => [{ 'x': 1, 'y': 2 }] + */ + var intersectionWith = baseRest(function(arrays) { + var comparator = last(arrays), + mapped = arrayMap(arrays, castArrayLikeObject); + + comparator = typeof comparator == 'function' ? comparator : undefined; + if (comparator) { + mapped.pop(); + } + return (mapped.length && mapped[0] === arrays[0]) + ? baseIntersection(mapped, undefined, comparator) + : []; + }); + + /** + * Converts all elements in `array` into a string separated by `separator`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to convert. + * @param {string} [separator=','] The element separator. + * @returns {string} Returns the joined string. + * @example + * + * _.join(['a', 'b', 'c'], '~'); + * // => 'a~b~c' + */ + function join(array, separator) { + return array == null ? '' : nativeJoin.call(array, separator); + } + + /** + * Gets the last element of `array`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to query. + * @returns {*} Returns the last element of `array`. + * @example + * + * _.last([1, 2, 3]); + * // => 3 + */ + function last(array) { + var length = array == null ? 0 : array.length; + return length ? array[length - 1] : undefined; + } + + /** + * This method is like `_.indexOf` except that it iterates over elements of + * `array` from right to left. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} [fromIndex=array.length-1] The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + * @example + * + * _.lastIndexOf([1, 2, 1, 2], 2); + * // => 3 + * + * // Search from the `fromIndex`. + * _.lastIndexOf([1, 2, 1, 2], 2, 2); + * // => 1 + */ + function lastIndexOf(array, value, fromIndex) { + var length = array == null ? 0 : array.length; + if (!length) { + return -1; + } + var index = length; + if (fromIndex !== undefined) { + index = toInteger(fromIndex); + index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1); + } + return value === value + ? strictLastIndexOf(array, value, index) + : baseFindIndex(array, baseIsNaN, index, true); + } + + /** + * Gets the element at index `n` of `array`. If `n` is negative, the nth + * element from the end is returned. + * + * @static + * @memberOf _ + * @since 4.11.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=0] The index of the element to return. + * @returns {*} Returns the nth element of `array`. + * @example + * + * var array = ['a', 'b', 'c', 'd']; + * + * _.nth(array, 1); + * // => 'b' + * + * _.nth(array, -2); + * // => 'c'; + */ + function nth(array, n) { + return (array && array.length) ? baseNth(array, toInteger(n)) : undefined; + } + + /** + * Removes all given values from `array` using + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. + * + * **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove` + * to remove elements from an array by predicate. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {...*} [values] The values to remove. + * @returns {Array} Returns `array`. + * @example + * + * var array = ['a', 'b', 'c', 'a', 'b', 'c']; + * + * _.pull(array, 'a', 'c'); + * console.log(array); + * // => ['b', 'b'] + */ + var pull = baseRest(pullAll); + + /** + * This method is like `_.pull` except that it accepts an array of values to remove. + * + * **Note:** Unlike `_.difference`, this method mutates `array`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {Array} values The values to remove. + * @returns {Array} Returns `array`. + * @example + * + * var array = ['a', 'b', 'c', 'a', 'b', 'c']; + * + * _.pullAll(array, ['a', 'c']); + * console.log(array); + * // => ['b', 'b'] + */ + function pullAll(array, values) { + return (array && array.length && values && values.length) + ? basePullAll(array, values) + : array; + } + + /** + * This method is like `_.pullAll` except that it accepts `iteratee` which is + * invoked for each element of `array` and `values` to generate the criterion + * by which they're compared. The iteratee is invoked with one argument: (value). + * + * **Note:** Unlike `_.differenceBy`, this method mutates `array`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {Array} values The values to remove. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns `array`. + * @example + * + * var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }]; + * + * _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x'); + * console.log(array); + * // => [{ 'x': 2 }] + */ + function pullAllBy(array, values, iteratee) { + return (array && array.length && values && values.length) + ? basePullAll(array, values, getIteratee(iteratee, 2)) + : array; + } + + /** + * This method is like `_.pullAll` except that it accepts `comparator` which + * is invoked to compare elements of `array` to `values`. The comparator is + * invoked with two arguments: (arrVal, othVal). + * + * **Note:** Unlike `_.differenceWith`, this method mutates `array`. + * + * @static + * @memberOf _ + * @since 4.6.0 + * @category Array + * @param {Array} array The array to modify. + * @param {Array} values The values to remove. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns `array`. + * @example + * + * var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }]; + * + * _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual); + * console.log(array); + * // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }] + */ + function pullAllWith(array, values, comparator) { + return (array && array.length && values && values.length) + ? basePullAll(array, values, undefined, comparator) + : array; + } + + /** + * Removes elements from `array` corresponding to `indexes` and returns an + * array of removed elements. + * + * **Note:** Unlike `_.at`, this method mutates `array`. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {...(number|number[])} [indexes] The indexes of elements to remove. + * @returns {Array} Returns the new array of removed elements. + * @example + * + * var array = ['a', 'b', 'c', 'd']; + * var pulled = _.pullAt(array, [1, 3]); + * + * console.log(array); + * // => ['a', 'c'] + * + * console.log(pulled); + * // => ['b', 'd'] + */ + var pullAt = flatRest(function(array, indexes) { + var length = array == null ? 0 : array.length, + result = baseAt(array, indexes); + + basePullAt(array, arrayMap(indexes, function(index) { + return isIndex(index, length) ? +index : index; + }).sort(compareAscending)); + + return result; + }); + + /** + * Removes all elements from `array` that `predicate` returns truthy for + * and returns an array of the removed elements. The predicate is invoked + * with three arguments: (value, index, array). + * + * **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull` + * to pull elements from an array by value. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new array of removed elements. + * @example + * + * var array = [1, 2, 3, 4]; + * var evens = _.remove(array, function(n) { + * return n % 2 == 0; + * }); + * + * console.log(array); + * // => [1, 3] + * + * console.log(evens); + * // => [2, 4] + */ + function remove(array, predicate) { + var result = []; + if (!(array && array.length)) { + return result; + } + var index = -1, + indexes = [], + length = array.length; + + predicate = getIteratee(predicate, 3); + while (++index < length) { + var value = array[index]; + if (predicate(value, index, array)) { + result.push(value); + indexes.push(index); + } + } + basePullAt(array, indexes); + return result; + } + + /** + * Reverses `array` so that the first element becomes the last, the second + * element becomes the second to last, and so on. + * + * **Note:** This method mutates `array` and is based on + * [`Array#reverse`](https://mdn.io/Array/reverse). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to modify. + * @returns {Array} Returns `array`. + * @example + * + * var array = [1, 2, 3]; + * + * _.reverse(array); + * // => [3, 2, 1] + * + * console.log(array); + * // => [3, 2, 1] + */ + function reverse(array) { + return array == null ? array : nativeReverse.call(array); + } + + /** + * Creates a slice of `array` from `start` up to, but not including, `end`. + * + * **Note:** This method is used instead of + * [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are + * returned. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to slice. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns the slice of `array`. + */ + function slice(array, start, end) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + if (end && typeof end != 'number' && isIterateeCall(array, start, end)) { + start = 0; + end = length; + } + else { + start = start == null ? 0 : toInteger(start); + end = end === undefined ? length : toInteger(end); + } + return baseSlice(array, start, end); + } + + /** + * Uses a binary search to determine the lowest index at which `value` + * should be inserted into `array` in order to maintain its sort order. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + * @example + * + * _.sortedIndex([30, 50], 40); + * // => 1 + */ + function sortedIndex(array, value) { + return baseSortedIndex(array, value); + } + + /** + * This method is like `_.sortedIndex` except that it accepts `iteratee` + * which is invoked for `value` and each element of `array` to compute their + * sort ranking. The iteratee is invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + * @example + * + * var objects = [{ 'x': 4 }, { 'x': 5 }]; + * + * _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); + * // => 0 + * + * // The `_.property` iteratee shorthand. + * _.sortedIndexBy(objects, { 'x': 4 }, 'x'); + * // => 0 + */ + function sortedIndexBy(array, value, iteratee) { + return baseSortedIndexBy(array, value, getIteratee(iteratee, 2)); + } + + /** + * This method is like `_.indexOf` except that it performs a binary + * search on a sorted `array`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @returns {number} Returns the index of the matched value, else `-1`. + * @example + * + * _.sortedIndexOf([4, 5, 5, 5, 6], 5); + * // => 1 + */ + function sortedIndexOf(array, value) { + var length = array == null ? 0 : array.length; + if (length) { + var index = baseSortedIndex(array, value); + if (index < length && eq(array[index], value)) { + return index; + } + } + return -1; + } + + /** + * This method is like `_.sortedIndex` except that it returns the highest + * index at which `value` should be inserted into `array` in order to + * maintain its sort order. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + * @example + * + * _.sortedLastIndex([4, 5, 5, 5, 6], 5); + * // => 4 + */ + function sortedLastIndex(array, value) { + return baseSortedIndex(array, value, true); + } + + /** + * This method is like `_.sortedLastIndex` except that it accepts `iteratee` + * which is invoked for `value` and each element of `array` to compute their + * sort ranking. The iteratee is invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + * @example + * + * var objects = [{ 'x': 4 }, { 'x': 5 }]; + * + * _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); + * // => 1 + * + * // The `_.property` iteratee shorthand. + * _.sortedLastIndexBy(objects, { 'x': 4 }, 'x'); + * // => 1 + */ + function sortedLastIndexBy(array, value, iteratee) { + return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true); + } + + /** + * This method is like `_.lastIndexOf` except that it performs a binary + * search on a sorted `array`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @returns {number} Returns the index of the matched value, else `-1`. + * @example + * + * _.sortedLastIndexOf([4, 5, 5, 5, 6], 5); + * // => 3 + */ + function sortedLastIndexOf(array, value) { + var length = array == null ? 0 : array.length; + if (length) { + var index = baseSortedIndex(array, value, true) - 1; + if (eq(array[index], value)) { + return index; + } + } + return -1; + } + + /** + * This method is like `_.uniq` except that it's designed and optimized + * for sorted arrays. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @returns {Array} Returns the new duplicate free array. + * @example + * + * _.sortedUniq([1, 1, 2]); + * // => [1, 2] + */ + function sortedUniq(array) { + return (array && array.length) + ? baseSortedUniq(array) + : []; + } + + /** + * This method is like `_.uniqBy` except that it's designed and optimized + * for sorted arrays. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @returns {Array} Returns the new duplicate free array. + * @example + * + * _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor); + * // => [1.1, 2.3] + */ + function sortedUniqBy(array, iteratee) { + return (array && array.length) + ? baseSortedUniq(array, getIteratee(iteratee, 2)) + : []; + } + + /** + * Gets all but the first element of `array`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to query. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.tail([1, 2, 3]); + * // => [2, 3] + */ + function tail(array) { + var length = array == null ? 0 : array.length; + return length ? baseSlice(array, 1, length) : []; + } + + /** + * Creates a slice of `array` with `n` elements taken from the beginning. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to take. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.take([1, 2, 3]); + * // => [1] + * + * _.take([1, 2, 3], 2); + * // => [1, 2] + * + * _.take([1, 2, 3], 5); + * // => [1, 2, 3] + * + * _.take([1, 2, 3], 0); + * // => [] + */ + function take(array, n, guard) { + if (!(array && array.length)) { + return []; + } + n = (guard || n === undefined) ? 1 : toInteger(n); + return baseSlice(array, 0, n < 0 ? 0 : n); + } + + /** + * Creates a slice of `array` with `n` elements taken from the end. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to take. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.takeRight([1, 2, 3]); + * // => [3] + * + * _.takeRight([1, 2, 3], 2); + * // => [2, 3] + * + * _.takeRight([1, 2, 3], 5); + * // => [1, 2, 3] + * + * _.takeRight([1, 2, 3], 0); + * // => [] + */ + function takeRight(array, n, guard) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + n = (guard || n === undefined) ? 1 : toInteger(n); + n = length - n; + return baseSlice(array, n < 0 ? 0 : n, length); + } + + /** + * Creates a slice of `array` with elements taken from the end. Elements are + * taken until `predicate` returns falsey. The predicate is invoked with + * three arguments: (value, index, array). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the slice of `array`. + * @example + * + * var users = [ + * { 'user': 'barney', 'active': true }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': false } + * ]; + * + * _.takeRightWhile(users, function(o) { return !o.active; }); + * // => objects for ['fred', 'pebbles'] + * + * // The `_.matches` iteratee shorthand. + * _.takeRightWhile(users, { 'user': 'pebbles', 'active': false }); + * // => objects for ['pebbles'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.takeRightWhile(users, ['active', false]); + * // => objects for ['fred', 'pebbles'] + * + * // The `_.property` iteratee shorthand. + * _.takeRightWhile(users, 'active'); + * // => [] + */ + function takeRightWhile(array, predicate) { + return (array && array.length) + ? baseWhile(array, getIteratee(predicate, 3), false, true) + : []; + } + + /** + * Creates a slice of `array` with elements taken from the beginning. Elements + * are taken until `predicate` returns falsey. The predicate is invoked with + * three arguments: (value, index, array). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the slice of `array`. + * @example + * + * var users = [ + * { 'user': 'barney', 'active': false }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': true } + * ]; + * + * _.takeWhile(users, function(o) { return !o.active; }); + * // => objects for ['barney', 'fred'] + * + * // The `_.matches` iteratee shorthand. + * _.takeWhile(users, { 'user': 'barney', 'active': false }); + * // => objects for ['barney'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.takeWhile(users, ['active', false]); + * // => objects for ['barney', 'fred'] + * + * // The `_.property` iteratee shorthand. + * _.takeWhile(users, 'active'); + * // => [] + */ + function takeWhile(array, predicate) { + return (array && array.length) + ? baseWhile(array, getIteratee(predicate, 3)) + : []; + } + + /** + * Creates an array of unique values, in order, from all given arrays using + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @returns {Array} Returns the new array of combined values. + * @example + * + * _.union([2], [1, 2]); + * // => [2, 1] + */ + var union = baseRest(function(arrays) { + return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true)); + }); + + /** + * This method is like `_.union` except that it accepts `iteratee` which is + * invoked for each element of each `arrays` to generate the criterion by + * which uniqueness is computed. Result values are chosen from the first + * array in which the value occurs. The iteratee is invoked with one argument: + * (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new array of combined values. + * @example + * + * _.unionBy([2.1], [1.2, 2.3], Math.floor); + * // => [2.1, 1.2] + * + * // The `_.property` iteratee shorthand. + * _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 1 }, { 'x': 2 }] + */ + var unionBy = baseRest(function(arrays) { + var iteratee = last(arrays); + if (isArrayLikeObject(iteratee)) { + iteratee = undefined; + } + return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)); + }); + + /** + * This method is like `_.union` except that it accepts `comparator` which + * is invoked to compare elements of `arrays`. Result values are chosen from + * the first array in which the value occurs. The comparator is invoked + * with two arguments: (arrVal, othVal). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of combined values. + * @example + * + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; + * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; + * + * _.unionWith(objects, others, _.isEqual); + * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] + */ + var unionWith = baseRest(function(arrays) { + var comparator = last(arrays); + comparator = typeof comparator == 'function' ? comparator : undefined; + return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator); + }); + + /** + * Creates a duplicate-free version of an array, using + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons, in which only the first occurrence of each element + * is kept. The order of result values is determined by the order they occur + * in the array. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @returns {Array} Returns the new duplicate free array. + * @example + * + * _.uniq([2, 1, 2]); + * // => [2, 1] + */ + function uniq(array) { + return (array && array.length) ? baseUniq(array) : []; + } + + /** + * This method is like `_.uniq` except that it accepts `iteratee` which is + * invoked for each element in `array` to generate the criterion by which + * uniqueness is computed. The order of result values is determined by the + * order they occur in the array. The iteratee is invoked with one argument: + * (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new duplicate free array. + * @example + * + * _.uniqBy([2.1, 1.2, 2.3], Math.floor); + * // => [2.1, 1.2] + * + * // The `_.property` iteratee shorthand. + * _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 1 }, { 'x': 2 }] + */ + function uniqBy(array, iteratee) { + return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : []; + } + + /** + * This method is like `_.uniq` except that it accepts `comparator` which + * is invoked to compare elements of `array`. The order of result values is + * determined by the order they occur in the array.The comparator is invoked + * with two arguments: (arrVal, othVal). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new duplicate free array. + * @example + * + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }]; + * + * _.uniqWith(objects, _.isEqual); + * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }] + */ + function uniqWith(array, comparator) { + comparator = typeof comparator == 'function' ? comparator : undefined; + return (array && array.length) ? baseUniq(array, undefined, comparator) : []; + } + + /** + * This method is like `_.zip` except that it accepts an array of grouped + * elements and creates an array regrouping the elements to their pre-zip + * configuration. + * + * @static + * @memberOf _ + * @since 1.2.0 + * @category Array + * @param {Array} array The array of grouped elements to process. + * @returns {Array} Returns the new array of regrouped elements. + * @example + * + * var zipped = _.zip(['a', 'b'], [1, 2], [true, false]); + * // => [['a', 1, true], ['b', 2, false]] + * + * _.unzip(zipped); + * // => [['a', 'b'], [1, 2], [true, false]] + */ + function unzip(array) { + if (!(array && array.length)) { + return []; + } + var length = 0; + array = arrayFilter(array, function(group) { + if (isArrayLikeObject(group)) { + length = nativeMax(group.length, length); + return true; + } + }); + return baseTimes(length, function(index) { + return arrayMap(array, baseProperty(index)); + }); + } + + /** + * This method is like `_.unzip` except that it accepts `iteratee` to specify + * how regrouped values should be combined. The iteratee is invoked with the + * elements of each group: (...group). + * + * @static + * @memberOf _ + * @since 3.8.0 + * @category Array + * @param {Array} array The array of grouped elements to process. + * @param {Function} [iteratee=_.identity] The function to combine + * regrouped values. + * @returns {Array} Returns the new array of regrouped elements. + * @example + * + * var zipped = _.zip([1, 2], [10, 20], [100, 200]); + * // => [[1, 10, 100], [2, 20, 200]] + * + * _.unzipWith(zipped, _.add); + * // => [3, 30, 300] + */ + function unzipWith(array, iteratee) { + if (!(array && array.length)) { + return []; + } + var result = unzip(array); + if (iteratee == null) { + return result; + } + return arrayMap(result, function(group) { + return apply(iteratee, undefined, group); + }); + } + + /** + * Creates an array excluding all given values using + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. + * + * **Note:** Unlike `_.pull`, this method returns a new array. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {...*} [values] The values to exclude. + * @returns {Array} Returns the new array of filtered values. + * @see _.difference, _.xor + * @example + * + * _.without([2, 1, 2, 3], 1, 2); + * // => [3] + */ + var without = baseRest(function(array, values) { + return isArrayLikeObject(array) + ? baseDifference(array, values) + : []; + }); + + /** + * Creates an array of unique values that is the + * [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference) + * of the given arrays. The order of result values is determined by the order + * they occur in the arrays. + * + * @static + * @memberOf _ + * @since 2.4.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @returns {Array} Returns the new array of filtered values. + * @see _.difference, _.without + * @example + * + * _.xor([2, 1], [2, 3]); + * // => [1, 3] + */ + var xor = baseRest(function(arrays) { + return baseXor(arrayFilter(arrays, isArrayLikeObject)); + }); + + /** + * This method is like `_.xor` except that it accepts `iteratee` which is + * invoked for each element of each `arrays` to generate the criterion by + * which by which they're compared. The order of result values is determined + * by the order they occur in the arrays. The iteratee is invoked with one + * argument: (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new array of filtered values. + * @example + * + * _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor); + * // => [1.2, 3.4] + * + * // The `_.property` iteratee shorthand. + * _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 2 }] + */ + var xorBy = baseRest(function(arrays) { + var iteratee = last(arrays); + if (isArrayLikeObject(iteratee)) { + iteratee = undefined; + } + return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2)); + }); + + /** + * This method is like `_.xor` except that it accepts `comparator` which is + * invoked to compare elements of `arrays`. The order of result values is + * determined by the order they occur in the arrays. The comparator is invoked + * with two arguments: (arrVal, othVal). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of filtered values. + * @example + * + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; + * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; + * + * _.xorWith(objects, others, _.isEqual); + * // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] + */ + var xorWith = baseRest(function(arrays) { + var comparator = last(arrays); + comparator = typeof comparator == 'function' ? comparator : undefined; + return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator); + }); + + /** + * Creates an array of grouped elements, the first of which contains the + * first elements of the given arrays, the second of which contains the + * second elements of the given arrays, and so on. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {...Array} [arrays] The arrays to process. + * @returns {Array} Returns the new array of grouped elements. + * @example + * + * _.zip(['a', 'b'], [1, 2], [true, false]); + * // => [['a', 1, true], ['b', 2, false]] + */ + var zip = baseRest(unzip); + + /** + * This method is like `_.fromPairs` except that it accepts two arrays, + * one of property identifiers and one of corresponding values. + * + * @static + * @memberOf _ + * @since 0.4.0 + * @category Array + * @param {Array} [props=[]] The property identifiers. + * @param {Array} [values=[]] The property values. + * @returns {Object} Returns the new object. + * @example + * + * _.zipObject(['a', 'b'], [1, 2]); + * // => { 'a': 1, 'b': 2 } + */ + function zipObject(props, values) { + return baseZipObject(props || [], values || [], assignValue); + } + + /** + * This method is like `_.zipObject` except that it supports property paths. + * + * @static + * @memberOf _ + * @since 4.1.0 + * @category Array + * @param {Array} [props=[]] The property identifiers. + * @param {Array} [values=[]] The property values. + * @returns {Object} Returns the new object. + * @example + * + * _.zipObjectDeep(['a.b[0].c', 'a.b[1].d'], [1, 2]); + * // => { 'a': { 'b': [{ 'c': 1 }, { 'd': 2 }] } } + */ + function zipObjectDeep(props, values) { + return baseZipObject(props || [], values || [], baseSet); + } + + /** + * This method is like `_.zip` except that it accepts `iteratee` to specify + * how grouped values should be combined. The iteratee is invoked with the + * elements of each group: (...group). + * + * @static + * @memberOf _ + * @since 3.8.0 + * @category Array + * @param {...Array} [arrays] The arrays to process. + * @param {Function} [iteratee=_.identity] The function to combine + * grouped values. + * @returns {Array} Returns the new array of grouped elements. + * @example + * + * _.zipWith([1, 2], [10, 20], [100, 200], function(a, b, c) { + * return a + b + c; + * }); + * // => [111, 222] + */ + var zipWith = baseRest(function(arrays) { + var length = arrays.length, + iteratee = length > 1 ? arrays[length - 1] : undefined; + + iteratee = typeof iteratee == 'function' ? (arrays.pop(), iteratee) : undefined; + return unzipWith(arrays, iteratee); + }); + + /*------------------------------------------------------------------------*/ + + /** + * Creates a `lodash` wrapper instance that wraps `value` with explicit method + * chain sequences enabled. The result of such sequences must be unwrapped + * with `_#value`. + * + * @static + * @memberOf _ + * @since 1.3.0 + * @category Seq + * @param {*} value The value to wrap. + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36 }, + * { 'user': 'fred', 'age': 40 }, + * { 'user': 'pebbles', 'age': 1 } + * ]; + * + * var youngest = _ + * .chain(users) + * .sortBy('age') + * .map(function(o) { + * return o.user + ' is ' + o.age; + * }) + * .head() + * .value(); + * // => 'pebbles is 1' + */ + function chain(value) { + var result = lodash(value); + result.__chain__ = true; + return result; + } + + /** + * This method invokes `interceptor` and returns `value`. The interceptor + * is invoked with one argument; (value). The purpose of this method is to + * "tap into" a method chain sequence in order to modify intermediate results. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Seq + * @param {*} value The value to provide to `interceptor`. + * @param {Function} interceptor The function to invoke. + * @returns {*} Returns `value`. + * @example + * + * _([1, 2, 3]) + * .tap(function(array) { + * // Mutate input array. + * array.pop(); + * }) + * .reverse() + * .value(); + * // => [2, 1] + */ + function tap(value, interceptor) { + interceptor(value); + return value; + } + + /** + * This method is like `_.tap` except that it returns the result of `interceptor`. + * The purpose of this method is to "pass thru" values replacing intermediate + * results in a method chain sequence. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Seq + * @param {*} value The value to provide to `interceptor`. + * @param {Function} interceptor The function to invoke. + * @returns {*} Returns the result of `interceptor`. + * @example + * + * _(' abc ') + * .chain() + * .trim() + * .thru(function(value) { + * return [value]; + * }) + * .value(); + * // => ['abc'] + */ + function thru(value, interceptor) { + return interceptor(value); + } + + /** + * This method is the wrapper version of `_.at`. + * + * @name at + * @memberOf _ + * @since 1.0.0 + * @category Seq + * @param {...(string|string[])} [paths] The property paths to pick. + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; + * + * _(object).at(['a[0].b.c', 'a[1]']).value(); + * // => [3, 4] + */ + var wrapperAt = flatRest(function(paths) { + var length = paths.length, + start = length ? paths[0] : 0, + value = this.__wrapped__, + interceptor = function(object) { return baseAt(object, paths); }; + + if (length > 1 || this.__actions__.length || + !(value instanceof LazyWrapper) || !isIndex(start)) { + return this.thru(interceptor); + } + value = value.slice(start, +start + (length ? 1 : 0)); + value.__actions__.push({ + 'func': thru, + 'args': [interceptor], + 'thisArg': undefined + }); + return new LodashWrapper(value, this.__chain__).thru(function(array) { + if (length && !array.length) { + array.push(undefined); + } + return array; + }); + }); + + /** + * Creates a `lodash` wrapper instance with explicit method chain sequences enabled. + * + * @name chain + * @memberOf _ + * @since 0.1.0 + * @category Seq + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36 }, + * { 'user': 'fred', 'age': 40 } + * ]; + * + * // A sequence without explicit chaining. + * _(users).head(); + * // => { 'user': 'barney', 'age': 36 } + * + * // A sequence with explicit chaining. + * _(users) + * .chain() + * .head() + * .pick('user') + * .value(); + * // => { 'user': 'barney' } + */ + function wrapperChain() { + return chain(this); + } + + /** + * Executes the chain sequence and returns the wrapped result. + * + * @name commit + * @memberOf _ + * @since 3.2.0 + * @category Seq + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * var array = [1, 2]; + * var wrapped = _(array).push(3); + * + * console.log(array); + * // => [1, 2] + * + * wrapped = wrapped.commit(); + * console.log(array); + * // => [1, 2, 3] + * + * wrapped.last(); + * // => 3 + * + * console.log(array); + * // => [1, 2, 3] + */ + function wrapperCommit() { + return new LodashWrapper(this.value(), this.__chain__); + } + + /** + * Gets the next value on a wrapped object following the + * [iterator protocol](https://mdn.io/iteration_protocols#iterator). + * + * @name next + * @memberOf _ + * @since 4.0.0 + * @category Seq + * @returns {Object} Returns the next iterator value. + * @example + * + * var wrapped = _([1, 2]); + * + * wrapped.next(); + * // => { 'done': false, 'value': 1 } + * + * wrapped.next(); + * // => { 'done': false, 'value': 2 } + * + * wrapped.next(); + * // => { 'done': true, 'value': undefined } + */ + function wrapperNext() { + if (this.__values__ === undefined) { + this.__values__ = toArray(this.value()); + } + var done = this.__index__ >= this.__values__.length, + value = done ? undefined : this.__values__[this.__index__++]; + + return { 'done': done, 'value': value }; + } + + /** + * Enables the wrapper to be iterable. + * + * @name Symbol.iterator + * @memberOf _ + * @since 4.0.0 + * @category Seq + * @returns {Object} Returns the wrapper object. + * @example + * + * var wrapped = _([1, 2]); + * + * wrapped[Symbol.iterator]() === wrapped; + * // => true + * + * Array.from(wrapped); + * // => [1, 2] + */ + function wrapperToIterator() { + return this; + } + + /** + * Creates a clone of the chain sequence planting `value` as the wrapped value. + * + * @name plant + * @memberOf _ + * @since 3.2.0 + * @category Seq + * @param {*} value The value to plant. + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * function square(n) { + * return n * n; + * } + * + * var wrapped = _([1, 2]).map(square); + * var other = wrapped.plant([3, 4]); + * + * other.value(); + * // => [9, 16] + * + * wrapped.value(); + * // => [1, 4] + */ + function wrapperPlant(value) { + var result, + parent = this; + + while (parent instanceof baseLodash) { + var clone = wrapperClone(parent); + clone.__index__ = 0; + clone.__values__ = undefined; + if (result) { + previous.__wrapped__ = clone; + } else { + result = clone; + } + var previous = clone; + parent = parent.__wrapped__; + } + previous.__wrapped__ = value; + return result; + } + + /** + * This method is the wrapper version of `_.reverse`. + * + * **Note:** This method mutates the wrapped array. + * + * @name reverse + * @memberOf _ + * @since 0.1.0 + * @category Seq + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * var array = [1, 2, 3]; + * + * _(array).reverse().value() + * // => [3, 2, 1] + * + * console.log(array); + * // => [3, 2, 1] + */ + function wrapperReverse() { + var value = this.__wrapped__; + if (value instanceof LazyWrapper) { + var wrapped = value; + if (this.__actions__.length) { + wrapped = new LazyWrapper(this); + } + wrapped = wrapped.reverse(); + wrapped.__actions__.push({ + 'func': thru, + 'args': [reverse], + 'thisArg': undefined + }); + return new LodashWrapper(wrapped, this.__chain__); + } + return this.thru(reverse); + } + + /** + * Executes the chain sequence to resolve the unwrapped value. + * + * @name value + * @memberOf _ + * @since 0.1.0 + * @alias toJSON, valueOf + * @category Seq + * @returns {*} Returns the resolved unwrapped value. + * @example + * + * _([1, 2, 3]).value(); + * // => [1, 2, 3] + */ + function wrapperValue() { + return baseWrapperValue(this.__wrapped__, this.__actions__); + } + + /*------------------------------------------------------------------------*/ + + /** + * Creates an object composed of keys generated from the results of running + * each element of `collection` thru `iteratee`. The corresponding value of + * each key is the number of times the key was returned by `iteratee`. The + * iteratee is invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 0.5.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The iteratee to transform keys. + * @returns {Object} Returns the composed aggregate object. + * @example + * + * _.countBy([6.1, 4.2, 6.3], Math.floor); + * // => { '4': 1, '6': 2 } + * + * // The `_.property` iteratee shorthand. + * _.countBy(['one', 'two', 'three'], 'length'); + * // => { '3': 2, '5': 1 } + */ + var countBy = createAggregator(function(result, value, key) { + if (hasOwnProperty.call(result, key)) { + ++result[key]; + } else { + baseAssignValue(result, key, 1); + } + }); + + /** + * Checks if `predicate` returns truthy for **all** elements of `collection`. + * Iteration is stopped once `predicate` returns falsey. The predicate is + * invoked with three arguments: (value, index|key, collection). + * + * **Note:** This method returns `true` for + * [empty collections](https://en.wikipedia.org/wiki/Empty_set) because + * [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of + * elements of empty collections. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {boolean} Returns `true` if all elements pass the predicate check, + * else `false`. + * @example + * + * _.every([true, 1, null, 'yes'], Boolean); + * // => false + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': false }, + * { 'user': 'fred', 'age': 40, 'active': false } + * ]; + * + * // The `_.matches` iteratee shorthand. + * _.every(users, { 'user': 'barney', 'active': false }); + * // => false + * + * // The `_.matchesProperty` iteratee shorthand. + * _.every(users, ['active', false]); + * // => true + * + * // The `_.property` iteratee shorthand. + * _.every(users, 'active'); + * // => false + */ + function every(collection, predicate, guard) { + var func = isArray(collection) ? arrayEvery : baseEvery; + if (guard && isIterateeCall(collection, predicate, guard)) { + predicate = undefined; + } + return func(collection, getIteratee(predicate, 3)); + } + + /** + * Iterates over elements of `collection`, returning an array of all elements + * `predicate` returns truthy for. The predicate is invoked with three + * arguments: (value, index|key, collection). + * + * **Note:** Unlike `_.remove`, this method returns a new array. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new filtered array. + * @see _.reject + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': true }, + * { 'user': 'fred', 'age': 40, 'active': false } + * ]; + * + * _.filter(users, function(o) { return !o.active; }); + * // => objects for ['fred'] + * + * // The `_.matches` iteratee shorthand. + * _.filter(users, { 'age': 36, 'active': true }); + * // => objects for ['barney'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.filter(users, ['active', false]); + * // => objects for ['fred'] + * + * // The `_.property` iteratee shorthand. + * _.filter(users, 'active'); + * // => objects for ['barney'] + */ + function filter(collection, predicate) { + var func = isArray(collection) ? arrayFilter : baseFilter; + return func(collection, getIteratee(predicate, 3)); + } + + /** + * Iterates over elements of `collection`, returning the first element + * `predicate` returns truthy for. The predicate is invoked with three + * arguments: (value, index|key, collection). + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param {number} [fromIndex=0] The index to search from. + * @returns {*} Returns the matched element, else `undefined`. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': true }, + * { 'user': 'fred', 'age': 40, 'active': false }, + * { 'user': 'pebbles', 'age': 1, 'active': true } + * ]; + * + * _.find(users, function(o) { return o.age < 40; }); + * // => object for 'barney' + * + * // The `_.matches` iteratee shorthand. + * _.find(users, { 'age': 1, 'active': true }); + * // => object for 'pebbles' + * + * // The `_.matchesProperty` iteratee shorthand. + * _.find(users, ['active', false]); + * // => object for 'fred' + * + * // The `_.property` iteratee shorthand. + * _.find(users, 'active'); + * // => object for 'barney' + */ + var find = createFind(findIndex); + + /** + * This method is like `_.find` except that it iterates over elements of + * `collection` from right to left. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Collection + * @param {Array|Object} collection The collection to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param {number} [fromIndex=collection.length-1] The index to search from. + * @returns {*} Returns the matched element, else `undefined`. + * @example + * + * _.findLast([1, 2, 3, 4], function(n) { + * return n % 2 == 1; + * }); + * // => 3 + */ + var findLast = createFind(findLastIndex); + + /** + * Creates a flattened array of values by running each element in `collection` + * thru `iteratee` and flattening the mapped results. The iteratee is invoked + * with three arguments: (value, index|key, collection). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new flattened array. + * @example + * + * function duplicate(n) { + * return [n, n]; + * } + * + * _.flatMap([1, 2], duplicate); + * // => [1, 1, 2, 2] + */ + function flatMap(collection, iteratee) { + return baseFlatten(map(collection, iteratee), 1); + } + + /** + * This method is like `_.flatMap` except that it recursively flattens the + * mapped results. + * + * @static + * @memberOf _ + * @since 4.7.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new flattened array. + * @example + * + * function duplicate(n) { + * return [[[n, n]]]; + * } + * + * _.flatMapDeep([1, 2], duplicate); + * // => [1, 1, 2, 2] + */ + function flatMapDeep(collection, iteratee) { + return baseFlatten(map(collection, iteratee), INFINITY); + } + + /** + * This method is like `_.flatMap` except that it recursively flattens the + * mapped results up to `depth` times. + * + * @static + * @memberOf _ + * @since 4.7.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {number} [depth=1] The maximum recursion depth. + * @returns {Array} Returns the new flattened array. + * @example + * + * function duplicate(n) { + * return [[[n, n]]]; + * } + * + * _.flatMapDepth([1, 2], duplicate, 2); + * // => [[1, 1], [2, 2]] + */ + function flatMapDepth(collection, iteratee, depth) { + depth = depth === undefined ? 1 : toInteger(depth); + return baseFlatten(map(collection, iteratee), depth); + } + + /** + * Iterates over elements of `collection` and invokes `iteratee` for each element. + * The iteratee is invoked with three arguments: (value, index|key, collection). + * Iteratee functions may exit iteration early by explicitly returning `false`. + * + * **Note:** As with other "Collections" methods, objects with a "length" + * property are iterated like arrays. To avoid this behavior use `_.forIn` + * or `_.forOwn` for object iteration. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @alias each + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Array|Object} Returns `collection`. + * @see _.forEachRight + * @example + * + * _.forEach([1, 2], function(value) { + * console.log(value); + * }); + * // => Logs `1` then `2`. + * + * _.forEach({ 'a': 1, 'b': 2 }, function(value, key) { + * console.log(key); + * }); + * // => Logs 'a' then 'b' (iteration order is not guaranteed). + */ + function forEach(collection, iteratee) { + var func = isArray(collection) ? arrayEach : baseEach; + return func(collection, getIteratee(iteratee, 3)); + } + + /** + * This method is like `_.forEach` except that it iterates over elements of + * `collection` from right to left. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @alias eachRight + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Array|Object} Returns `collection`. + * @see _.forEach + * @example + * + * _.forEachRight([1, 2], function(value) { + * console.log(value); + * }); + * // => Logs `2` then `1`. + */ + function forEachRight(collection, iteratee) { + var func = isArray(collection) ? arrayEachRight : baseEachRight; + return func(collection, getIteratee(iteratee, 3)); + } + + /** + * Creates an object composed of keys generated from the results of running + * each element of `collection` thru `iteratee`. The order of grouped values + * is determined by the order they occur in `collection`. The corresponding + * value of each key is an array of elements responsible for generating the + * key. The iteratee is invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The iteratee to transform keys. + * @returns {Object} Returns the composed aggregate object. + * @example + * + * _.groupBy([6.1, 4.2, 6.3], Math.floor); + * // => { '4': [4.2], '6': [6.1, 6.3] } + * + * // The `_.property` iteratee shorthand. + * _.groupBy(['one', 'two', 'three'], 'length'); + * // => { '3': ['one', 'two'], '5': ['three'] } + */ + var groupBy = createAggregator(function(result, value, key) { + if (hasOwnProperty.call(result, key)) { + result[key].push(value); + } else { + baseAssignValue(result, key, [value]); + } + }); + + /** + * Checks if `value` is in `collection`. If `collection` is a string, it's + * checked for a substring of `value`, otherwise + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * is used for equality comparisons. If `fromIndex` is negative, it's used as + * the offset from the end of `collection`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object|string} collection The collection to inspect. + * @param {*} value The value to search for. + * @param {number} [fromIndex=0] The index to search from. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. + * @returns {boolean} Returns `true` if `value` is found, else `false`. + * @example + * + * _.includes([1, 2, 3], 1); + * // => true + * + * _.includes([1, 2, 3], 1, 2); + * // => false + * + * _.includes({ 'a': 1, 'b': 2 }, 1); + * // => true + * + * _.includes('abcd', 'bc'); + * // => true + */ + function includes(collection, value, fromIndex, guard) { + collection = isArrayLike(collection) ? collection : values(collection); + fromIndex = (fromIndex && !guard) ? toInteger(fromIndex) : 0; + + var length = collection.length; + if (fromIndex < 0) { + fromIndex = nativeMax(length + fromIndex, 0); + } + return isString(collection) + ? (fromIndex <= length && collection.indexOf(value, fromIndex) > -1) + : (!!length && baseIndexOf(collection, value, fromIndex) > -1); + } + + /** + * Invokes the method at `path` of each element in `collection`, returning + * an array of the results of each invoked method. Any additional arguments + * are provided to each invoked method. If `path` is a function, it's invoked + * for, and `this` bound to, each element in `collection`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Array|Function|string} path The path of the method to invoke or + * the function invoked per iteration. + * @param {...*} [args] The arguments to invoke each method with. + * @returns {Array} Returns the array of results. + * @example + * + * _.invokeMap([[5, 1, 7], [3, 2, 1]], 'sort'); + * // => [[1, 5, 7], [1, 2, 3]] + * + * _.invokeMap([123, 456], String.prototype.split, ''); + * // => [['1', '2', '3'], ['4', '5', '6']] + */ + var invokeMap = baseRest(function(collection, path, args) { + var index = -1, + isFunc = typeof path == 'function', + result = isArrayLike(collection) ? Array(collection.length) : []; + + baseEach(collection, function(value) { + result[++index] = isFunc ? apply(path, value, args) : baseInvoke(value, path, args); + }); + return result; + }); + + /** + * Creates an object composed of keys generated from the results of running + * each element of `collection` thru `iteratee`. The corresponding value of + * each key is the last element responsible for generating the key. The + * iteratee is invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The iteratee to transform keys. + * @returns {Object} Returns the composed aggregate object. + * @example + * + * var array = [ + * { 'dir': 'left', 'code': 97 }, + * { 'dir': 'right', 'code': 100 } + * ]; + * + * _.keyBy(array, function(o) { + * return String.fromCharCode(o.code); + * }); + * // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } } + * + * _.keyBy(array, 'dir'); + * // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } } + */ + var keyBy = createAggregator(function(result, value, key) { + baseAssignValue(result, key, value); + }); + + /** + * Creates an array of values by running each element in `collection` thru + * `iteratee`. The iteratee is invoked with three arguments: + * (value, index|key, collection). + * + * Many lodash methods are guarded to work as iteratees for methods like + * `_.every`, `_.filter`, `_.map`, `_.mapValues`, `_.reject`, and `_.some`. + * + * The guarded methods are: + * `ary`, `chunk`, `curry`, `curryRight`, `drop`, `dropRight`, `every`, + * `fill`, `invert`, `parseInt`, `random`, `range`, `rangeRight`, `repeat`, + * `sampleSize`, `slice`, `some`, `sortBy`, `split`, `take`, `takeRight`, + * `template`, `trim`, `trimEnd`, `trimStart`, and `words` + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new mapped array. + * @example + * + * function square(n) { + * return n * n; + * } + * + * _.map([4, 8], square); + * // => [16, 64] + * + * _.map({ 'a': 4, 'b': 8 }, square); + * // => [16, 64] (iteration order is not guaranteed) + * + * var users = [ + * { 'user': 'barney' }, + * { 'user': 'fred' } + * ]; + * + * // The `_.property` iteratee shorthand. + * _.map(users, 'user'); + * // => ['barney', 'fred'] + */ + function map(collection, iteratee) { + var func = isArray(collection) ? arrayMap : baseMap; + return func(collection, getIteratee(iteratee, 3)); + } + + /** + * This method is like `_.sortBy` except that it allows specifying the sort + * orders of the iteratees to sort by. If `orders` is unspecified, all values + * are sorted in ascending order. Otherwise, specify an order of "desc" for + * descending or "asc" for ascending sort order of corresponding values. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Array[]|Function[]|Object[]|string[]} [iteratees=[_.identity]] + * The iteratees to sort by. + * @param {string[]} [orders] The sort orders of `iteratees`. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. + * @returns {Array} Returns the new sorted array. + * @example + * + * var users = [ + * { 'user': 'fred', 'age': 48 }, + * { 'user': 'barney', 'age': 34 }, + * { 'user': 'fred', 'age': 40 }, + * { 'user': 'barney', 'age': 36 } + * ]; + * + * // Sort by `user` in ascending order and by `age` in descending order. + * _.orderBy(users, ['user', 'age'], ['asc', 'desc']); + * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]] + */ + function orderBy(collection, iteratees, orders, guard) { + if (collection == null) { + return []; + } + if (!isArray(iteratees)) { + iteratees = iteratees == null ? [] : [iteratees]; + } + orders = guard ? undefined : orders; + if (!isArray(orders)) { + orders = orders == null ? [] : [orders]; + } + return baseOrderBy(collection, iteratees, orders); + } + + /** + * Creates an array of elements split into two groups, the first of which + * contains elements `predicate` returns truthy for, the second of which + * contains elements `predicate` returns falsey for. The predicate is + * invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the array of grouped elements. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': false }, + * { 'user': 'fred', 'age': 40, 'active': true }, + * { 'user': 'pebbles', 'age': 1, 'active': false } + * ]; + * + * _.partition(users, function(o) { return o.active; }); + * // => objects for [['fred'], ['barney', 'pebbles']] + * + * // The `_.matches` iteratee shorthand. + * _.partition(users, { 'age': 1, 'active': false }); + * // => objects for [['pebbles'], ['barney', 'fred']] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.partition(users, ['active', false]); + * // => objects for [['barney', 'pebbles'], ['fred']] + * + * // The `_.property` iteratee shorthand. + * _.partition(users, 'active'); + * // => objects for [['fred'], ['barney', 'pebbles']] + */ + var partition = createAggregator(function(result, value, key) { + result[key ? 0 : 1].push(value); + }, function() { return [[], []]; }); + + /** + * Reduces `collection` to a value which is the accumulated result of running + * each element in `collection` thru `iteratee`, where each successive + * invocation is supplied the return value of the previous. If `accumulator` + * is not given, the first element of `collection` is used as the initial + * value. The iteratee is invoked with four arguments: + * (accumulator, value, index|key, collection). + * + * Many lodash methods are guarded to work as iteratees for methods like + * `_.reduce`, `_.reduceRight`, and `_.transform`. + * + * The guarded methods are: + * `assign`, `defaults`, `defaultsDeep`, `includes`, `merge`, `orderBy`, + * and `sortBy` + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @returns {*} Returns the accumulated value. + * @see _.reduceRight + * @example + * + * _.reduce([1, 2], function(sum, n) { + * return sum + n; + * }, 0); + * // => 3 + * + * _.reduce({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { + * (result[value] || (result[value] = [])).push(key); + * return result; + * }, {}); + * // => { '1': ['a', 'c'], '2': ['b'] } (iteration order is not guaranteed) + */ + function reduce(collection, iteratee, accumulator) { + var func = isArray(collection) ? arrayReduce : baseReduce, + initAccum = arguments.length < 3; + + return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEach); + } + + /** + * This method is like `_.reduce` except that it iterates over elements of + * `collection` from right to left. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @returns {*} Returns the accumulated value. + * @see _.reduce + * @example + * + * var array = [[0, 1], [2, 3], [4, 5]]; + * + * _.reduceRight(array, function(flattened, other) { + * return flattened.concat(other); + * }, []); + * // => [4, 5, 2, 3, 0, 1] + */ + function reduceRight(collection, iteratee, accumulator) { + var func = isArray(collection) ? arrayReduceRight : baseReduce, + initAccum = arguments.length < 3; + + return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEachRight); + } + + /** + * The opposite of `_.filter`; this method returns the elements of `collection` + * that `predicate` does **not** return truthy for. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new filtered array. + * @see _.filter + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': false }, + * { 'user': 'fred', 'age': 40, 'active': true } + * ]; + * + * _.reject(users, function(o) { return !o.active; }); + * // => objects for ['fred'] + * + * // The `_.matches` iteratee shorthand. + * _.reject(users, { 'age': 40, 'active': true }); + * // => objects for ['barney'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.reject(users, ['active', false]); + * // => objects for ['fred'] + * + * // The `_.property` iteratee shorthand. + * _.reject(users, 'active'); + * // => objects for ['barney'] + */ + function reject(collection, predicate) { + var func = isArray(collection) ? arrayFilter : baseFilter; + return func(collection, negate(getIteratee(predicate, 3))); + } + + /** + * Gets a random element from `collection`. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Collection + * @param {Array|Object} collection The collection to sample. + * @returns {*} Returns the random element. + * @example + * + * _.sample([1, 2, 3, 4]); + * // => 2 + */ + function sample(collection) { + var func = isArray(collection) ? arraySample : baseSample; + return func(collection); + } + + /** + * Gets `n` random elements at unique keys from `collection` up to the + * size of `collection`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Collection + * @param {Array|Object} collection The collection to sample. + * @param {number} [n=1] The number of elements to sample. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the random elements. + * @example + * + * _.sampleSize([1, 2, 3], 2); + * // => [3, 1] + * + * _.sampleSize([1, 2, 3], 4); + * // => [2, 3, 1] + */ + function sampleSize(collection, n, guard) { + if ((guard ? isIterateeCall(collection, n, guard) : n === undefined)) { + n = 1; + } else { + n = toInteger(n); + } + var func = isArray(collection) ? arraySampleSize : baseSampleSize; + return func(collection, n); + } + + /** + * Creates an array of shuffled values, using a version of the + * [Fisher-Yates shuffle](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle). + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to shuffle. + * @returns {Array} Returns the new shuffled array. + * @example + * + * _.shuffle([1, 2, 3, 4]); + * // => [4, 1, 3, 2] + */ + function shuffle(collection) { + var func = isArray(collection) ? arrayShuffle : baseShuffle; + return func(collection); + } + + /** + * Gets the size of `collection` by returning its length for array-like + * values or the number of own enumerable string keyed properties for objects. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object|string} collection The collection to inspect. + * @returns {number} Returns the collection size. + * @example + * + * _.size([1, 2, 3]); + * // => 3 + * + * _.size({ 'a': 1, 'b': 2 }); + * // => 2 + * + * _.size('pebbles'); + * // => 7 + */ + function size(collection) { + if (collection == null) { + return 0; + } + if (isArrayLike(collection)) { + return isString(collection) ? stringSize(collection) : collection.length; + } + var tag = getTag(collection); + if (tag == mapTag || tag == setTag) { + return collection.size; + } + return baseKeys(collection).length; + } + + /** + * Checks if `predicate` returns truthy for **any** element of `collection`. + * Iteration is stopped once `predicate` returns truthy. The predicate is + * invoked with three arguments: (value, index|key, collection). + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {boolean} Returns `true` if any element passes the predicate check, + * else `false`. + * @example + * + * _.some([null, 0, 'yes', false], Boolean); + * // => true + * + * var users = [ + * { 'user': 'barney', 'active': true }, + * { 'user': 'fred', 'active': false } + * ]; + * + * // The `_.matches` iteratee shorthand. + * _.some(users, { 'user': 'barney', 'active': false }); + * // => false + * + * // The `_.matchesProperty` iteratee shorthand. + * _.some(users, ['active', false]); + * // => true + * + * // The `_.property` iteratee shorthand. + * _.some(users, 'active'); + * // => true + */ + function some(collection, predicate, guard) { + var func = isArray(collection) ? arraySome : baseSome; + if (guard && isIterateeCall(collection, predicate, guard)) { + predicate = undefined; + } + return func(collection, getIteratee(predicate, 3)); + } + + /** + * Creates an array of elements, sorted in ascending order by the results of + * running each element in a collection thru each iteratee. This method + * performs a stable sort, that is, it preserves the original sort order of + * equal elements. The iteratees are invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {...(Function|Function[])} [iteratees=[_.identity]] + * The iteratees to sort by. + * @returns {Array} Returns the new sorted array. + * @example + * + * var users = [ + * { 'user': 'fred', 'age': 48 }, + * { 'user': 'barney', 'age': 36 }, + * { 'user': 'fred', 'age': 40 }, + * { 'user': 'barney', 'age': 34 } + * ]; + * + * _.sortBy(users, [function(o) { return o.user; }]); + * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]] + * + * _.sortBy(users, ['user', 'age']); + * // => objects for [['barney', 34], ['barney', 36], ['fred', 40], ['fred', 48]] + */ + var sortBy = baseRest(function(collection, iteratees) { + if (collection == null) { + return []; + } + var length = iteratees.length; + if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) { + iteratees = []; + } else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) { + iteratees = [iteratees[0]]; + } + return baseOrderBy(collection, baseFlatten(iteratees, 1), []); + }); + + /*------------------------------------------------------------------------*/ + + /** + * Gets the timestamp of the number of milliseconds that have elapsed since + * the Unix epoch (1 January 1970 00:00:00 UTC). + * + * @static + * @memberOf _ + * @since 2.4.0 + * @category Date + * @returns {number} Returns the timestamp. + * @example + * + * _.defer(function(stamp) { + * console.log(_.now() - stamp); + * }, _.now()); + * // => Logs the number of milliseconds it took for the deferred invocation. + */ + var now = ctxNow || function() { + return root.Date.now(); + }; + + /*------------------------------------------------------------------------*/ + + /** + * The opposite of `_.before`; this method creates a function that invokes + * `func` once it's called `n` or more times. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {number} n The number of calls before `func` is invoked. + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new restricted function. + * @example + * + * var saves = ['profile', 'settings']; + * + * var done = _.after(saves.length, function() { + * console.log('done saving!'); + * }); + * + * _.forEach(saves, function(type) { + * asyncSave({ 'type': type, 'complete': done }); + * }); + * // => Logs 'done saving!' after the two async saves have completed. + */ + function after(n, func) { + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + n = toInteger(n); + return function() { + if (--n < 1) { + return func.apply(this, arguments); + } + }; + } + + /** + * Creates a function that invokes `func`, with up to `n` arguments, + * ignoring any additional arguments. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Function + * @param {Function} func The function to cap arguments for. + * @param {number} [n=func.length] The arity cap. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Function} Returns the new capped function. + * @example + * + * _.map(['6', '8', '10'], _.ary(parseInt, 1)); + * // => [6, 8, 10] + */ + function ary(func, n, guard) { + n = guard ? undefined : n; + n = (func && n == null) ? func.length : n; + return createWrap(func, WRAP_ARY_FLAG, undefined, undefined, undefined, undefined, n); + } + + /** + * Creates a function that invokes `func`, with the `this` binding and arguments + * of the created function, while it's called less than `n` times. Subsequent + * calls to the created function return the result of the last `func` invocation. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Function + * @param {number} n The number of calls at which `func` is no longer invoked. + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new restricted function. + * @example + * + * jQuery(element).on('click', _.before(5, addContactToList)); + * // => Allows adding up to 4 contacts to the list. + */ + function before(n, func) { + var result; + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + n = toInteger(n); + return function() { + if (--n > 0) { + result = func.apply(this, arguments); + } + if (n <= 1) { + func = undefined; + } + return result; + }; + } + + /** + * Creates a function that invokes `func` with the `this` binding of `thisArg` + * and `partials` prepended to the arguments it receives. + * + * The `_.bind.placeholder` value, which defaults to `_` in monolithic builds, + * may be used as a placeholder for partially applied arguments. + * + * **Note:** Unlike native `Function#bind`, this method doesn't set the "length" + * property of bound functions. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to bind. + * @param {*} thisArg The `this` binding of `func`. + * @param {...*} [partials] The arguments to be partially applied. + * @returns {Function} Returns the new bound function. + * @example + * + * function greet(greeting, punctuation) { + * return greeting + ' ' + this.user + punctuation; + * } + * + * var object = { 'user': 'fred' }; + * + * var bound = _.bind(greet, object, 'hi'); + * bound('!'); + * // => 'hi fred!' + * + * // Bound with placeholders. + * var bound = _.bind(greet, object, _, '!'); + * bound('hi'); + * // => 'hi fred!' + */ + var bind = baseRest(function(func, thisArg, partials) { + var bitmask = WRAP_BIND_FLAG; + if (partials.length) { + var holders = replaceHolders(partials, getHolder(bind)); + bitmask |= WRAP_PARTIAL_FLAG; + } + return createWrap(func, bitmask, thisArg, partials, holders); + }); + + /** + * Creates a function that invokes the method at `object[key]` with `partials` + * prepended to the arguments it receives. + * + * This method differs from `_.bind` by allowing bound functions to reference + * methods that may be redefined or don't yet exist. See + * [Peter Michaux's article](http://peter.michaux.ca/articles/lazy-function-definition-pattern) + * for more details. + * + * The `_.bindKey.placeholder` value, which defaults to `_` in monolithic + * builds, may be used as a placeholder for partially applied arguments. + * + * @static + * @memberOf _ + * @since 0.10.0 + * @category Function + * @param {Object} object The object to invoke the method on. + * @param {string} key The key of the method. + * @param {...*} [partials] The arguments to be partially applied. + * @returns {Function} Returns the new bound function. + * @example + * + * var object = { + * 'user': 'fred', + * 'greet': function(greeting, punctuation) { + * return greeting + ' ' + this.user + punctuation; + * } + * }; + * + * var bound = _.bindKey(object, 'greet', 'hi'); + * bound('!'); + * // => 'hi fred!' + * + * object.greet = function(greeting, punctuation) { + * return greeting + 'ya ' + this.user + punctuation; + * }; + * + * bound('!'); + * // => 'hiya fred!' + * + * // Bound with placeholders. + * var bound = _.bindKey(object, 'greet', _, '!'); + * bound('hi'); + * // => 'hiya fred!' + */ + var bindKey = baseRest(function(object, key, partials) { + var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG; + if (partials.length) { + var holders = replaceHolders(partials, getHolder(bindKey)); + bitmask |= WRAP_PARTIAL_FLAG; + } + return createWrap(key, bitmask, object, partials, holders); + }); + + /** + * Creates a function that accepts arguments of `func` and either invokes + * `func` returning its result, if at least `arity` number of arguments have + * been provided, or returns a function that accepts the remaining `func` + * arguments, and so on. The arity of `func` may be specified if `func.length` + * is not sufficient. + * + * The `_.curry.placeholder` value, which defaults to `_` in monolithic builds, + * may be used as a placeholder for provided arguments. + * + * **Note:** This method doesn't set the "length" property of curried functions. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Function + * @param {Function} func The function to curry. + * @param {number} [arity=func.length] The arity of `func`. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Function} Returns the new curried function. + * @example + * + * var abc = function(a, b, c) { + * return [a, b, c]; + * }; + * + * var curried = _.curry(abc); + * + * curried(1)(2)(3); + * // => [1, 2, 3] + * + * curried(1, 2)(3); + * // => [1, 2, 3] + * + * curried(1, 2, 3); + * // => [1, 2, 3] + * + * // Curried with placeholders. + * curried(1)(_, 3)(2); + * // => [1, 2, 3] + */ + function curry(func, arity, guard) { + arity = guard ? undefined : arity; + var result = createWrap(func, WRAP_CURRY_FLAG, undefined, undefined, undefined, undefined, undefined, arity); + result.placeholder = curry.placeholder; + return result; + } + + /** + * This method is like `_.curry` except that arguments are applied to `func` + * in the manner of `_.partialRight` instead of `_.partial`. + * + * The `_.curryRight.placeholder` value, which defaults to `_` in monolithic + * builds, may be used as a placeholder for provided arguments. + * + * **Note:** This method doesn't set the "length" property of curried functions. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Function + * @param {Function} func The function to curry. + * @param {number} [arity=func.length] The arity of `func`. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Function} Returns the new curried function. + * @example + * + * var abc = function(a, b, c) { + * return [a, b, c]; + * }; + * + * var curried = _.curryRight(abc); + * + * curried(3)(2)(1); + * // => [1, 2, 3] + * + * curried(2, 3)(1); + * // => [1, 2, 3] + * + * curried(1, 2, 3); + * // => [1, 2, 3] + * + * // Curried with placeholders. + * curried(3)(1, _)(2); + * // => [1, 2, 3] + */ + function curryRight(func, arity, guard) { + arity = guard ? undefined : arity; + var result = createWrap(func, WRAP_CURRY_RIGHT_FLAG, undefined, undefined, undefined, undefined, undefined, arity); + result.placeholder = curryRight.placeholder; + return result; + } + + /** + * Creates a debounced function that delays invoking `func` until after `wait` + * milliseconds have elapsed since the last time the debounced function was + * invoked. The debounced function comes with a `cancel` method to cancel + * delayed `func` invocations and a `flush` method to immediately invoke them. + * Provide `options` to indicate whether `func` should be invoked on the + * leading and/or trailing edge of the `wait` timeout. The `func` is invoked + * with the last arguments provided to the debounced function. Subsequent + * calls to the debounced function return the result of the last `func` + * invocation. + * + * **Note:** If `leading` and `trailing` options are `true`, `func` is + * invoked on the trailing edge of the timeout only if the debounced function + * is invoked more than once during the `wait` timeout. + * + * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred + * until to the next tick, similar to `setTimeout` with a timeout of `0`. + * + * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) + * for details over the differences between `_.debounce` and `_.throttle`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to debounce. + * @param {number} [wait=0] The number of milliseconds to delay. + * @param {Object} [options={}] The options object. + * @param {boolean} [options.leading=false] + * Specify invoking on the leading edge of the timeout. + * @param {number} [options.maxWait] + * The maximum time `func` is allowed to be delayed before it's invoked. + * @param {boolean} [options.trailing=true] + * Specify invoking on the trailing edge of the timeout. + * @returns {Function} Returns the new debounced function. + * @example + * + * // Avoid costly calculations while the window size is in flux. + * jQuery(window).on('resize', _.debounce(calculateLayout, 150)); + * + * // Invoke `sendMail` when clicked, debouncing subsequent calls. + * jQuery(element).on('click', _.debounce(sendMail, 300, { + * 'leading': true, + * 'trailing': false + * })); + * + * // Ensure `batchLog` is invoked once after 1 second of debounced calls. + * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 }); + * var source = new EventSource('/stream'); + * jQuery(source).on('message', debounced); + * + * // Cancel the trailing debounced invocation. + * jQuery(window).on('popstate', debounced.cancel); + */ + function debounce(func, wait, options) { + var lastArgs, + lastThis, + maxWait, + result, + timerId, + lastCallTime, + lastInvokeTime = 0, + leading = false, + maxing = false, + trailing = true; + + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + wait = toNumber(wait) || 0; + if (isObject(options)) { + leading = !!options.leading; + maxing = 'maxWait' in options; + maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait; + trailing = 'trailing' in options ? !!options.trailing : trailing; + } + + function invokeFunc(time) { + var args = lastArgs, + thisArg = lastThis; + + lastArgs = lastThis = undefined; + lastInvokeTime = time; + result = func.apply(thisArg, args); + return result; + } + + function leadingEdge(time) { + // Reset any `maxWait` timer. + lastInvokeTime = time; + // Start the timer for the trailing edge. + timerId = setTimeout(timerExpired, wait); + // Invoke the leading edge. + return leading ? invokeFunc(time) : result; + } + + function remainingWait(time) { + var timeSinceLastCall = time - lastCallTime, + timeSinceLastInvoke = time - lastInvokeTime, + timeWaiting = wait - timeSinceLastCall; + + return maxing + ? nativeMin(timeWaiting, maxWait - timeSinceLastInvoke) + : timeWaiting; + } + + function shouldInvoke(time) { + var timeSinceLastCall = time - lastCallTime, + timeSinceLastInvoke = time - lastInvokeTime; + + // Either this is the first call, activity has stopped and we're at the + // trailing edge, the system time has gone backwards and we're treating + // it as the trailing edge, or we've hit the `maxWait` limit. + return (lastCallTime === undefined || (timeSinceLastCall >= wait) || + (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait)); + } + + function timerExpired() { + var time = now(); + if (shouldInvoke(time)) { + return trailingEdge(time); + } + // Restart the timer. + timerId = setTimeout(timerExpired, remainingWait(time)); + } + + function trailingEdge(time) { + timerId = undefined; + + // Only invoke if we have `lastArgs` which means `func` has been + // debounced at least once. + if (trailing && lastArgs) { + return invokeFunc(time); + } + lastArgs = lastThis = undefined; + return result; + } + + function cancel() { + if (timerId !== undefined) { + clearTimeout(timerId); + } + lastInvokeTime = 0; + lastArgs = lastCallTime = lastThis = timerId = undefined; + } + + function flush() { + return timerId === undefined ? result : trailingEdge(now()); + } + + function debounced() { + var time = now(), + isInvoking = shouldInvoke(time); + + lastArgs = arguments; + lastThis = this; + lastCallTime = time; + + if (isInvoking) { + if (timerId === undefined) { + return leadingEdge(lastCallTime); + } + if (maxing) { + // Handle invocations in a tight loop. + timerId = setTimeout(timerExpired, wait); + return invokeFunc(lastCallTime); + } + } + if (timerId === undefined) { + timerId = setTimeout(timerExpired, wait); + } + return result; + } + debounced.cancel = cancel; + debounced.flush = flush; + return debounced; + } + + /** + * Defers invoking the `func` until the current call stack has cleared. Any + * additional arguments are provided to `func` when it's invoked. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to defer. + * @param {...*} [args] The arguments to invoke `func` with. + * @returns {number} Returns the timer id. + * @example + * + * _.defer(function(text) { + * console.log(text); + * }, 'deferred'); + * // => Logs 'deferred' after one millisecond. + */ + var defer = baseRest(function(func, args) { + return baseDelay(func, 1, args); + }); + + /** + * Invokes `func` after `wait` milliseconds. Any additional arguments are + * provided to `func` when it's invoked. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to delay. + * @param {number} wait The number of milliseconds to delay invocation. + * @param {...*} [args] The arguments to invoke `func` with. + * @returns {number} Returns the timer id. + * @example + * + * _.delay(function(text) { + * console.log(text); + * }, 1000, 'later'); + * // => Logs 'later' after one second. + */ + var delay = baseRest(function(func, wait, args) { + return baseDelay(func, toNumber(wait) || 0, args); + }); + + /** + * Creates a function that invokes `func` with arguments reversed. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Function + * @param {Function} func The function to flip arguments for. + * @returns {Function} Returns the new flipped function. + * @example + * + * var flipped = _.flip(function() { + * return _.toArray(arguments); + * }); + * + * flipped('a', 'b', 'c', 'd'); + * // => ['d', 'c', 'b', 'a'] + */ + function flip(func) { + return createWrap(func, WRAP_FLIP_FLAG); + } + + /** + * Creates a function that memoizes the result of `func`. If `resolver` is + * provided, it determines the cache key for storing the result based on the + * arguments provided to the memoized function. By default, the first argument + * provided to the memoized function is used as the map cache key. The `func` + * is invoked with the `this` binding of the memoized function. + * + * **Note:** The cache is exposed as the `cache` property on the memoized + * function. Its creation may be customized by replacing the `_.memoize.Cache` + * constructor with one whose instances implement the + * [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object) + * method interface of `clear`, `delete`, `get`, `has`, and `set`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to have its output memoized. + * @param {Function} [resolver] The function to resolve the cache key. + * @returns {Function} Returns the new memoized function. + * @example + * + * var object = { 'a': 1, 'b': 2 }; + * var other = { 'c': 3, 'd': 4 }; + * + * var values = _.memoize(_.values); + * values(object); + * // => [1, 2] + * + * values(other); + * // => [3, 4] + * + * object.a = 2; + * values(object); + * // => [1, 2] + * + * // Modify the result cache. + * values.cache.set(object, ['a', 'b']); + * values(object); + * // => ['a', 'b'] + * + * // Replace `_.memoize.Cache`. + * _.memoize.Cache = WeakMap; + */ + function memoize(func, resolver) { + if (typeof func != 'function' || (resolver != null && typeof resolver != 'function')) { + throw new TypeError(FUNC_ERROR_TEXT); + } + var memoized = function() { + var args = arguments, + key = resolver ? resolver.apply(this, args) : args[0], + cache = memoized.cache; + + if (cache.has(key)) { + return cache.get(key); + } + var result = func.apply(this, args); + memoized.cache = cache.set(key, result) || cache; + return result; + }; + memoized.cache = new (memoize.Cache || MapCache); + return memoized; + } + + // Expose `MapCache`. + memoize.Cache = MapCache; + + /** + * Creates a function that negates the result of the predicate `func`. The + * `func` predicate is invoked with the `this` binding and arguments of the + * created function. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Function + * @param {Function} predicate The predicate to negate. + * @returns {Function} Returns the new negated function. + * @example + * + * function isEven(n) { + * return n % 2 == 0; + * } + * + * _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven)); + * // => [1, 3, 5] + */ + function negate(predicate) { + if (typeof predicate != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + return function() { + var args = arguments; + switch (args.length) { + case 0: return !predicate.call(this); + case 1: return !predicate.call(this, args[0]); + case 2: return !predicate.call(this, args[0], args[1]); + case 3: return !predicate.call(this, args[0], args[1], args[2]); + } + return !predicate.apply(this, args); + }; + } + + /** + * Creates a function that is restricted to invoking `func` once. Repeat calls + * to the function return the value of the first invocation. The `func` is + * invoked with the `this` binding and arguments of the created function. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new restricted function. + * @example + * + * var initialize = _.once(createApplication); + * initialize(); + * initialize(); + * // => `createApplication` is invoked once + */ + function once(func) { + return before(2, func); + } + + /** + * Creates a function that invokes `func` with its arguments transformed. + * + * @static + * @since 4.0.0 + * @memberOf _ + * @category Function + * @param {Function} func The function to wrap. + * @param {...(Function|Function[])} [transforms=[_.identity]] + * The argument transforms. + * @returns {Function} Returns the new function. + * @example + * + * function doubled(n) { + * return n * 2; + * } + * + * function square(n) { + * return n * n; + * } + * + * var func = _.overArgs(function(x, y) { + * return [x, y]; + * }, [square, doubled]); + * + * func(9, 3); + * // => [81, 6] + * + * func(10, 5); + * // => [100, 10] + */ + var overArgs = castRest(function(func, transforms) { + transforms = (transforms.length == 1 && isArray(transforms[0])) + ? arrayMap(transforms[0], baseUnary(getIteratee())) + : arrayMap(baseFlatten(transforms, 1), baseUnary(getIteratee())); + + var funcsLength = transforms.length; + return baseRest(function(args) { + var index = -1, + length = nativeMin(args.length, funcsLength); + + while (++index < length) { + args[index] = transforms[index].call(this, args[index]); + } + return apply(func, this, args); + }); + }); + + /** + * Creates a function that invokes `func` with `partials` prepended to the + * arguments it receives. This method is like `_.bind` except it does **not** + * alter the `this` binding. + * + * The `_.partial.placeholder` value, which defaults to `_` in monolithic + * builds, may be used as a placeholder for partially applied arguments. + * + * **Note:** This method doesn't set the "length" property of partially + * applied functions. + * + * @static + * @memberOf _ + * @since 0.2.0 + * @category Function + * @param {Function} func The function to partially apply arguments to. + * @param {...*} [partials] The arguments to be partially applied. + * @returns {Function} Returns the new partially applied function. + * @example + * + * function greet(greeting, name) { + * return greeting + ' ' + name; + * } + * + * var sayHelloTo = _.partial(greet, 'hello'); + * sayHelloTo('fred'); + * // => 'hello fred' + * + * // Partially applied with placeholders. + * var greetFred = _.partial(greet, _, 'fred'); + * greetFred('hi'); + * // => 'hi fred' + */ + var partial = baseRest(function(func, partials) { + var holders = replaceHolders(partials, getHolder(partial)); + return createWrap(func, WRAP_PARTIAL_FLAG, undefined, partials, holders); + }); + + /** + * This method is like `_.partial` except that partially applied arguments + * are appended to the arguments it receives. + * + * The `_.partialRight.placeholder` value, which defaults to `_` in monolithic + * builds, may be used as a placeholder for partially applied arguments. + * + * **Note:** This method doesn't set the "length" property of partially + * applied functions. + * + * @static + * @memberOf _ + * @since 1.0.0 + * @category Function + * @param {Function} func The function to partially apply arguments to. + * @param {...*} [partials] The arguments to be partially applied. + * @returns {Function} Returns the new partially applied function. + * @example + * + * function greet(greeting, name) { + * return greeting + ' ' + name; + * } + * + * var greetFred = _.partialRight(greet, 'fred'); + * greetFred('hi'); + * // => 'hi fred' + * + * // Partially applied with placeholders. + * var sayHelloTo = _.partialRight(greet, 'hello', _); + * sayHelloTo('fred'); + * // => 'hello fred' + */ + var partialRight = baseRest(function(func, partials) { + var holders = replaceHolders(partials, getHolder(partialRight)); + return createWrap(func, WRAP_PARTIAL_RIGHT_FLAG, undefined, partials, holders); + }); + + /** + * Creates a function that invokes `func` with arguments arranged according + * to the specified `indexes` where the argument value at the first index is + * provided as the first argument, the argument value at the second index is + * provided as the second argument, and so on. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Function + * @param {Function} func The function to rearrange arguments for. + * @param {...(number|number[])} indexes The arranged argument indexes. + * @returns {Function} Returns the new function. + * @example + * + * var rearged = _.rearg(function(a, b, c) { + * return [a, b, c]; + * }, [2, 0, 1]); + * + * rearged('b', 'c', 'a') + * // => ['a', 'b', 'c'] + */ + var rearg = flatRest(function(func, indexes) { + return createWrap(func, WRAP_REARG_FLAG, undefined, undefined, undefined, indexes); + }); + + /** + * Creates a function that invokes `func` with the `this` binding of the + * created function and arguments from `start` and beyond provided as + * an array. + * + * **Note:** This method is based on the + * [rest parameter](https://mdn.io/rest_parameters). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Function + * @param {Function} func The function to apply a rest parameter to. + * @param {number} [start=func.length-1] The start position of the rest parameter. + * @returns {Function} Returns the new function. + * @example + * + * var say = _.rest(function(what, names) { + * return what + ' ' + _.initial(names).join(', ') + + * (_.size(names) > 1 ? ', & ' : '') + _.last(names); + * }); + * + * say('hello', 'fred', 'barney', 'pebbles'); + * // => 'hello fred, barney, & pebbles' + */ + function rest(func, start) { + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + start = start === undefined ? start : toInteger(start); + return baseRest(func, start); + } + + /** + * Creates a function that invokes `func` with the `this` binding of the + * create function and an array of arguments much like + * [`Function#apply`](http://www.ecma-international.org/ecma-262/7.0/#sec-function.prototype.apply). + * + * **Note:** This method is based on the + * [spread operator](https://mdn.io/spread_operator). + * + * @static + * @memberOf _ + * @since 3.2.0 + * @category Function + * @param {Function} func The function to spread arguments over. + * @param {number} [start=0] The start position of the spread. + * @returns {Function} Returns the new function. + * @example + * + * var say = _.spread(function(who, what) { + * return who + ' says ' + what; + * }); + * + * say(['fred', 'hello']); + * // => 'fred says hello' + * + * var numbers = Promise.all([ + * Promise.resolve(40), + * Promise.resolve(36) + * ]); + * + * numbers.then(_.spread(function(x, y) { + * return x + y; + * })); + * // => a Promise of 76 + */ + function spread(func, start) { + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + start = start == null ? 0 : nativeMax(toInteger(start), 0); + return baseRest(function(args) { + var array = args[start], + otherArgs = castSlice(args, 0, start); + + if (array) { + arrayPush(otherArgs, array); + } + return apply(func, this, otherArgs); + }); + } + + /** + * Creates a throttled function that only invokes `func` at most once per + * every `wait` milliseconds. The throttled function comes with a `cancel` + * method to cancel delayed `func` invocations and a `flush` method to + * immediately invoke them. Provide `options` to indicate whether `func` + * should be invoked on the leading and/or trailing edge of the `wait` + * timeout. The `func` is invoked with the last arguments provided to the + * throttled function. Subsequent calls to the throttled function return the + * result of the last `func` invocation. + * + * **Note:** If `leading` and `trailing` options are `true`, `func` is + * invoked on the trailing edge of the timeout only if the throttled function + * is invoked more than once during the `wait` timeout. + * + * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred + * until to the next tick, similar to `setTimeout` with a timeout of `0`. + * + * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) + * for details over the differences between `_.throttle` and `_.debounce`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to throttle. + * @param {number} [wait=0] The number of milliseconds to throttle invocations to. + * @param {Object} [options={}] The options object. + * @param {boolean} [options.leading=true] + * Specify invoking on the leading edge of the timeout. + * @param {boolean} [options.trailing=true] + * Specify invoking on the trailing edge of the timeout. + * @returns {Function} Returns the new throttled function. + * @example + * + * // Avoid excessively updating the position while scrolling. + * jQuery(window).on('scroll', _.throttle(updatePosition, 100)); + * + * // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes. + * var throttled = _.throttle(renewToken, 300000, { 'trailing': false }); + * jQuery(element).on('click', throttled); + * + * // Cancel the trailing throttled invocation. + * jQuery(window).on('popstate', throttled.cancel); + */ + function throttle(func, wait, options) { + var leading = true, + trailing = true; + + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + if (isObject(options)) { + leading = 'leading' in options ? !!options.leading : leading; + trailing = 'trailing' in options ? !!options.trailing : trailing; + } + return debounce(func, wait, { + 'leading': leading, + 'maxWait': wait, + 'trailing': trailing + }); + } + + /** + * Creates a function that accepts up to one argument, ignoring any + * additional arguments. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Function + * @param {Function} func The function to cap arguments for. + * @returns {Function} Returns the new capped function. + * @example + * + * _.map(['6', '8', '10'], _.unary(parseInt)); + * // => [6, 8, 10] + */ + function unary(func) { + return ary(func, 1); + } + + /** + * Creates a function that provides `value` to `wrapper` as its first + * argument. Any additional arguments provided to the function are appended + * to those provided to the `wrapper`. The wrapper is invoked with the `this` + * binding of the created function. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {*} value The value to wrap. + * @param {Function} [wrapper=identity] The wrapper function. + * @returns {Function} Returns the new function. + * @example + * + * var p = _.wrap(_.escape, function(func, text) { + * return '

' + func(text) + '

'; + * }); + * + * p('fred, barney, & pebbles'); + * // => '

fred, barney, & pebbles

' + */ + function wrap(value, wrapper) { + return partial(castFunction(wrapper), value); + } + + /*------------------------------------------------------------------------*/ + + /** + * Casts `value` as an array if it's not one. + * + * @static + * @memberOf _ + * @since 4.4.0 + * @category Lang + * @param {*} value The value to inspect. + * @returns {Array} Returns the cast array. + * @example + * + * _.castArray(1); + * // => [1] + * + * _.castArray({ 'a': 1 }); + * // => [{ 'a': 1 }] + * + * _.castArray('abc'); + * // => ['abc'] + * + * _.castArray(null); + * // => [null] + * + * _.castArray(undefined); + * // => [undefined] + * + * _.castArray(); + * // => [] + * + * var array = [1, 2, 3]; + * console.log(_.castArray(array) === array); + * // => true + */ + function castArray() { + if (!arguments.length) { + return []; + } + var value = arguments[0]; + return isArray(value) ? value : [value]; + } + + /** + * Creates a shallow clone of `value`. + * + * **Note:** This method is loosely based on the + * [structured clone algorithm](https://mdn.io/Structured_clone_algorithm) + * and supports cloning arrays, array buffers, booleans, date objects, maps, + * numbers, `Object` objects, regexes, sets, strings, symbols, and typed + * arrays. The own enumerable properties of `arguments` objects are cloned + * as plain objects. An empty object is returned for uncloneable values such + * as error objects, functions, DOM nodes, and WeakMaps. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to clone. + * @returns {*} Returns the cloned value. + * @see _.cloneDeep + * @example + * + * var objects = [{ 'a': 1 }, { 'b': 2 }]; + * + * var shallow = _.clone(objects); + * console.log(shallow[0] === objects[0]); + * // => true + */ + function clone(value) { + return baseClone(value, CLONE_SYMBOLS_FLAG); + } + + /** + * This method is like `_.clone` except that it accepts `customizer` which + * is invoked to produce the cloned value. If `customizer` returns `undefined`, + * cloning is handled by the method instead. The `customizer` is invoked with + * up to four arguments; (value [, index|key, object, stack]). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to clone. + * @param {Function} [customizer] The function to customize cloning. + * @returns {*} Returns the cloned value. + * @see _.cloneDeepWith + * @example + * + * function customizer(value) { + * if (_.isElement(value)) { + * return value.cloneNode(false); + * } + * } + * + * var el = _.cloneWith(document.body, customizer); + * + * console.log(el === document.body); + * // => false + * console.log(el.nodeName); + * // => 'BODY' + * console.log(el.childNodes.length); + * // => 0 + */ + function cloneWith(value, customizer) { + customizer = typeof customizer == 'function' ? customizer : undefined; + return baseClone(value, CLONE_SYMBOLS_FLAG, customizer); + } + + /** + * This method is like `_.clone` except that it recursively clones `value`. + * + * @static + * @memberOf _ + * @since 1.0.0 + * @category Lang + * @param {*} value The value to recursively clone. + * @returns {*} Returns the deep cloned value. + * @see _.clone + * @example + * + * var objects = [{ 'a': 1 }, { 'b': 2 }]; + * + * var deep = _.cloneDeep(objects); + * console.log(deep[0] === objects[0]); + * // => false + */ + function cloneDeep(value) { + return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG); + } + + /** + * This method is like `_.cloneWith` except that it recursively clones `value`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to recursively clone. + * @param {Function} [customizer] The function to customize cloning. + * @returns {*} Returns the deep cloned value. + * @see _.cloneWith + * @example + * + * function customizer(value) { + * if (_.isElement(value)) { + * return value.cloneNode(true); + * } + * } + * + * var el = _.cloneDeepWith(document.body, customizer); + * + * console.log(el === document.body); + * // => false + * console.log(el.nodeName); + * // => 'BODY' + * console.log(el.childNodes.length); + * // => 20 + */ + function cloneDeepWith(value, customizer) { + customizer = typeof customizer == 'function' ? customizer : undefined; + return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, customizer); + } + + /** + * Checks if `object` conforms to `source` by invoking the predicate + * properties of `source` with the corresponding property values of `object`. + * + * **Note:** This method is equivalent to `_.conforms` when `source` is + * partially applied. + * + * @static + * @memberOf _ + * @since 4.14.0 + * @category Lang + * @param {Object} object The object to inspect. + * @param {Object} source The object of property predicates to conform to. + * @returns {boolean} Returns `true` if `object` conforms, else `false`. + * @example + * + * var object = { 'a': 1, 'b': 2 }; + * + * _.conformsTo(object, { 'b': function(n) { return n > 1; } }); + * // => true + * + * _.conformsTo(object, { 'b': function(n) { return n > 2; } }); + * // => false + */ + function conformsTo(object, source) { + return source == null || baseConformsTo(object, source, keys(source)); + } + + /** + * Performs a + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * comparison between two values to determine if they are equivalent. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if the values are equivalent, else `false`. + * @example + * + * var object = { 'a': 1 }; + * var other = { 'a': 1 }; + * + * _.eq(object, object); + * // => true + * + * _.eq(object, other); + * // => false + * + * _.eq('a', 'a'); + * // => true + * + * _.eq('a', Object('a')); + * // => false + * + * _.eq(NaN, NaN); + * // => true + */ + function eq(value, other) { + return value === other || (value !== value && other !== other); + } + + /** + * Checks if `value` is greater than `other`. + * + * @static + * @memberOf _ + * @since 3.9.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is greater than `other`, + * else `false`. + * @see _.lt + * @example + * + * _.gt(3, 1); + * // => true + * + * _.gt(3, 3); + * // => false + * + * _.gt(1, 3); + * // => false + */ + var gt = createRelationalOperation(baseGt); + + /** + * Checks if `value` is greater than or equal to `other`. + * + * @static + * @memberOf _ + * @since 3.9.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is greater than or equal to + * `other`, else `false`. + * @see _.lte + * @example + * + * _.gte(3, 1); + * // => true + * + * _.gte(3, 3); + * // => true + * + * _.gte(1, 3); + * // => false + */ + var gte = createRelationalOperation(function(value, other) { + return value >= other; + }); + + /** + * Checks if `value` is likely an `arguments` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an `arguments` object, + * else `false`. + * @example + * + * _.isArguments(function() { return arguments; }()); + * // => true + * + * _.isArguments([1, 2, 3]); + * // => false + */ + var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) { + return isObjectLike(value) && hasOwnProperty.call(value, 'callee') && + !propertyIsEnumerable.call(value, 'callee'); + }; + + /** + * Checks if `value` is classified as an `Array` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an array, else `false`. + * @example + * + * _.isArray([1, 2, 3]); + * // => true + * + * _.isArray(document.body.children); + * // => false + * + * _.isArray('abc'); + * // => false + * + * _.isArray(_.noop); + * // => false + */ + var isArray = Array.isArray; + + /** + * Checks if `value` is classified as an `ArrayBuffer` object. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. + * @example + * + * _.isArrayBuffer(new ArrayBuffer(2)); + * // => true + * + * _.isArrayBuffer(new Array(2)); + * // => false + */ + var isArrayBuffer = nodeIsArrayBuffer ? baseUnary(nodeIsArrayBuffer) : baseIsArrayBuffer; + + /** + * Checks if `value` is array-like. A value is considered array-like if it's + * not a function and has a `value.length` that's an integer greater than or + * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is array-like, else `false`. + * @example + * + * _.isArrayLike([1, 2, 3]); + * // => true + * + * _.isArrayLike(document.body.children); + * // => true + * + * _.isArrayLike('abc'); + * // => true + * + * _.isArrayLike(_.noop); + * // => false + */ + function isArrayLike(value) { + return value != null && isLength(value.length) && !isFunction(value); + } + + /** + * This method is like `_.isArrayLike` except that it also checks if `value` + * is an object. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an array-like object, + * else `false`. + * @example + * + * _.isArrayLikeObject([1, 2, 3]); + * // => true + * + * _.isArrayLikeObject(document.body.children); + * // => true + * + * _.isArrayLikeObject('abc'); + * // => false + * + * _.isArrayLikeObject(_.noop); + * // => false + */ + function isArrayLikeObject(value) { + return isObjectLike(value) && isArrayLike(value); + } + + /** + * Checks if `value` is classified as a boolean primitive or object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a boolean, else `false`. + * @example + * + * _.isBoolean(false); + * // => true + * + * _.isBoolean(null); + * // => false + */ + function isBoolean(value) { + return value === true || value === false || + (isObjectLike(value) && baseGetTag(value) == boolTag); + } + + /** + * Checks if `value` is a buffer. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a buffer, else `false`. + * @example + * + * _.isBuffer(new Buffer(2)); + * // => true + * + * _.isBuffer(new Uint8Array(2)); + * // => false + */ + var isBuffer = nativeIsBuffer || stubFalse; + + /** + * Checks if `value` is classified as a `Date` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a date object, else `false`. + * @example + * + * _.isDate(new Date); + * // => true + * + * _.isDate('Mon April 23 2012'); + * // => false + */ + var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate; + + /** + * Checks if `value` is likely a DOM element. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a DOM element, else `false`. + * @example + * + * _.isElement(document.body); + * // => true + * + * _.isElement(''); + * // => false + */ + function isElement(value) { + return isObjectLike(value) && value.nodeType === 1 && !isPlainObject(value); + } + + /** + * Checks if `value` is an empty object, collection, map, or set. + * + * Objects are considered empty if they have no own enumerable string keyed + * properties. + * + * Array-like values such as `arguments` objects, arrays, buffers, strings, or + * jQuery-like collections are considered empty if they have a `length` of `0`. + * Similarly, maps and sets are considered empty if they have a `size` of `0`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is empty, else `false`. + * @example + * + * _.isEmpty(null); + * // => true + * + * _.isEmpty(true); + * // => true + * + * _.isEmpty(1); + * // => true + * + * _.isEmpty([1, 2, 3]); + * // => false + * + * _.isEmpty({ 'a': 1 }); + * // => false + */ + function isEmpty(value) { + if (value == null) { + return true; + } + if (isArrayLike(value) && + (isArray(value) || typeof value == 'string' || typeof value.splice == 'function' || + isBuffer(value) || isTypedArray(value) || isArguments(value))) { + return !value.length; + } + var tag = getTag(value); + if (tag == mapTag || tag == setTag) { + return !value.size; + } + if (isPrototype(value)) { + return !baseKeys(value).length; + } + for (var key in value) { + if (hasOwnProperty.call(value, key)) { + return false; + } + } + return true; + } + + /** + * Performs a deep comparison between two values to determine if they are + * equivalent. + * + * **Note:** This method supports comparing arrays, array buffers, booleans, + * date objects, error objects, maps, numbers, `Object` objects, regexes, + * sets, strings, symbols, and typed arrays. `Object` objects are compared + * by their own, not inherited, enumerable properties. Functions and DOM + * nodes are compared by strict equality, i.e. `===`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if the values are equivalent, else `false`. + * @example + * + * var object = { 'a': 1 }; + * var other = { 'a': 1 }; + * + * _.isEqual(object, other); + * // => true + * + * object === other; + * // => false + */ + function isEqual(value, other) { + return baseIsEqual(value, other); + } + + /** + * This method is like `_.isEqual` except that it accepts `customizer` which + * is invoked to compare values. If `customizer` returns `undefined`, comparisons + * are handled by the method instead. The `customizer` is invoked with up to + * six arguments: (objValue, othValue [, index|key, object, other, stack]). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @param {Function} [customizer] The function to customize comparisons. + * @returns {boolean} Returns `true` if the values are equivalent, else `false`. + * @example + * + * function isGreeting(value) { + * return /^h(?:i|ello)$/.test(value); + * } + * + * function customizer(objValue, othValue) { + * if (isGreeting(objValue) && isGreeting(othValue)) { + * return true; + * } + * } + * + * var array = ['hello', 'goodbye']; + * var other = ['hi', 'goodbye']; + * + * _.isEqualWith(array, other, customizer); + * // => true + */ + function isEqualWith(value, other, customizer) { + customizer = typeof customizer == 'function' ? customizer : undefined; + var result = customizer ? customizer(value, other) : undefined; + return result === undefined ? baseIsEqual(value, other, undefined, customizer) : !!result; + } + + /** + * Checks if `value` is an `Error`, `EvalError`, `RangeError`, `ReferenceError`, + * `SyntaxError`, `TypeError`, or `URIError` object. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an error object, else `false`. + * @example + * + * _.isError(new Error); + * // => true + * + * _.isError(Error); + * // => false + */ + function isError(value) { + if (!isObjectLike(value)) { + return false; + } + var tag = baseGetTag(value); + return tag == errorTag || tag == domExcTag || + (typeof value.message == 'string' && typeof value.name == 'string' && !isPlainObject(value)); + } + + /** + * Checks if `value` is a finite primitive number. + * + * **Note:** This method is based on + * [`Number.isFinite`](https://mdn.io/Number/isFinite). + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a finite number, else `false`. + * @example + * + * _.isFinite(3); + * // => true + * + * _.isFinite(Number.MIN_VALUE); + * // => true + * + * _.isFinite(Infinity); + * // => false + * + * _.isFinite('3'); + * // => false + */ + function isFinite(value) { + return typeof value == 'number' && nativeIsFinite(value); + } + + /** + * Checks if `value` is classified as a `Function` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a function, else `false`. + * @example + * + * _.isFunction(_); + * // => true + * + * _.isFunction(/abc/); + * // => false + */ + function isFunction(value) { + if (!isObject(value)) { + return false; + } + // The use of `Object#toString` avoids issues with the `typeof` operator + // in Safari 9 which returns 'object' for typed arrays and other constructors. + var tag = baseGetTag(value); + return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag; + } + + /** + * Checks if `value` is an integer. + * + * **Note:** This method is based on + * [`Number.isInteger`](https://mdn.io/Number/isInteger). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an integer, else `false`. + * @example + * + * _.isInteger(3); + * // => true + * + * _.isInteger(Number.MIN_VALUE); + * // => false + * + * _.isInteger(Infinity); + * // => false + * + * _.isInteger('3'); + * // => false + */ + function isInteger(value) { + return typeof value == 'number' && value == toInteger(value); + } + + /** + * Checks if `value` is a valid array-like length. + * + * **Note:** This method is loosely based on + * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a valid length, else `false`. + * @example + * + * _.isLength(3); + * // => true + * + * _.isLength(Number.MIN_VALUE); + * // => false + * + * _.isLength(Infinity); + * // => false + * + * _.isLength('3'); + * // => false + */ + function isLength(value) { + return typeof value == 'number' && + value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER; + } + + /** + * Checks if `value` is the + * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types) + * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an object, else `false`. + * @example + * + * _.isObject({}); + * // => true + * + * _.isObject([1, 2, 3]); + * // => true + * + * _.isObject(_.noop); + * // => true + * + * _.isObject(null); + * // => false + */ + function isObject(value) { + var type = typeof value; + return value != null && (type == 'object' || type == 'function'); + } + + /** + * Checks if `value` is object-like. A value is object-like if it's not `null` + * and has a `typeof` result of "object". + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is object-like, else `false`. + * @example + * + * _.isObjectLike({}); + * // => true + * + * _.isObjectLike([1, 2, 3]); + * // => true + * + * _.isObjectLike(_.noop); + * // => false + * + * _.isObjectLike(null); + * // => false + */ + function isObjectLike(value) { + return value != null && typeof value == 'object'; + } + + /** + * Checks if `value` is classified as a `Map` object. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a map, else `false`. + * @example + * + * _.isMap(new Map); + * // => true + * + * _.isMap(new WeakMap); + * // => false + */ + var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap; + + /** + * Performs a partial deep comparison between `object` and `source` to + * determine if `object` contains equivalent property values. + * + * **Note:** This method is equivalent to `_.matches` when `source` is + * partially applied. + * + * Partial comparisons will match empty array and empty object `source` + * values against any array or object value, respectively. See `_.isEqual` + * for a list of supported value comparisons. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Lang + * @param {Object} object The object to inspect. + * @param {Object} source The object of property values to match. + * @returns {boolean} Returns `true` if `object` is a match, else `false`. + * @example + * + * var object = { 'a': 1, 'b': 2 }; + * + * _.isMatch(object, { 'b': 2 }); + * // => true + * + * _.isMatch(object, { 'b': 1 }); + * // => false + */ + function isMatch(object, source) { + return object === source || baseIsMatch(object, source, getMatchData(source)); + } + + /** + * This method is like `_.isMatch` except that it accepts `customizer` which + * is invoked to compare values. If `customizer` returns `undefined`, comparisons + * are handled by the method instead. The `customizer` is invoked with five + * arguments: (objValue, srcValue, index|key, object, source). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {Object} object The object to inspect. + * @param {Object} source The object of property values to match. + * @param {Function} [customizer] The function to customize comparisons. + * @returns {boolean} Returns `true` if `object` is a match, else `false`. + * @example + * + * function isGreeting(value) { + * return /^h(?:i|ello)$/.test(value); + * } + * + * function customizer(objValue, srcValue) { + * if (isGreeting(objValue) && isGreeting(srcValue)) { + * return true; + * } + * } + * + * var object = { 'greeting': 'hello' }; + * var source = { 'greeting': 'hi' }; + * + * _.isMatchWith(object, source, customizer); + * // => true + */ + function isMatchWith(object, source, customizer) { + customizer = typeof customizer == 'function' ? customizer : undefined; + return baseIsMatch(object, source, getMatchData(source), customizer); + } + + /** + * Checks if `value` is `NaN`. + * + * **Note:** This method is based on + * [`Number.isNaN`](https://mdn.io/Number/isNaN) and is not the same as + * global [`isNaN`](https://mdn.io/isNaN) which returns `true` for + * `undefined` and other non-number values. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. + * @example + * + * _.isNaN(NaN); + * // => true + * + * _.isNaN(new Number(NaN)); + * // => true + * + * isNaN(undefined); + * // => true + * + * _.isNaN(undefined); + * // => false + */ + function isNaN(value) { + // An `NaN` primitive is the only value that is not equal to itself. + // Perform the `toStringTag` check first to avoid errors with some + // ActiveX objects in IE. + return isNumber(value) && value != +value; + } + + /** + * Checks if `value` is a pristine native function. + * + * **Note:** This method can't reliably detect native functions in the presence + * of the core-js package because core-js circumvents this kind of detection. + * Despite multiple requests, the core-js maintainer has made it clear: any + * attempt to fix the detection will be obstructed. As a result, we're left + * with little choice but to throw an error. Unfortunately, this also affects + * packages, like [babel-polyfill](https://www.npmjs.com/package/babel-polyfill), + * which rely on core-js. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a native function, + * else `false`. + * @example + * + * _.isNative(Array.prototype.push); + * // => true + * + * _.isNative(_); + * // => false + */ + function isNative(value) { + if (isMaskable(value)) { + throw new Error(CORE_ERROR_TEXT); + } + return baseIsNative(value); + } + + /** + * Checks if `value` is `null`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is `null`, else `false`. + * @example + * + * _.isNull(null); + * // => true + * + * _.isNull(void 0); + * // => false + */ + function isNull(value) { + return value === null; + } + + /** + * Checks if `value` is `null` or `undefined`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is nullish, else `false`. + * @example + * + * _.isNil(null); + * // => true + * + * _.isNil(void 0); + * // => true + * + * _.isNil(NaN); + * // => false + */ + function isNil(value) { + return value == null; + } + + /** + * Checks if `value` is classified as a `Number` primitive or object. + * + * **Note:** To exclude `Infinity`, `-Infinity`, and `NaN`, which are + * classified as numbers, use the `_.isFinite` method. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a number, else `false`. + * @example + * + * _.isNumber(3); + * // => true + * + * _.isNumber(Number.MIN_VALUE); + * // => true + * + * _.isNumber(Infinity); + * // => true + * + * _.isNumber('3'); + * // => false + */ + function isNumber(value) { + return typeof value == 'number' || + (isObjectLike(value) && baseGetTag(value) == numberTag); + } + + /** + * Checks if `value` is a plain object, that is, an object created by the + * `Object` constructor or one with a `[[Prototype]]` of `null`. + * + * @static + * @memberOf _ + * @since 0.8.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a plain object, else `false`. + * @example + * + * function Foo() { + * this.a = 1; + * } + * + * _.isPlainObject(new Foo); + * // => false + * + * _.isPlainObject([1, 2, 3]); + * // => false + * + * _.isPlainObject({ 'x': 0, 'y': 0 }); + * // => true + * + * _.isPlainObject(Object.create(null)); + * // => true + */ + function isPlainObject(value) { + if (!isObjectLike(value) || baseGetTag(value) != objectTag) { + return false; + } + var proto = getPrototype(value); + if (proto === null) { + return true; + } + var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor; + return typeof Ctor == 'function' && Ctor instanceof Ctor && + funcToString.call(Ctor) == objectCtorString; + } + + /** + * Checks if `value` is classified as a `RegExp` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. + * @example + * + * _.isRegExp(/abc/); + * // => true + * + * _.isRegExp('/abc/'); + * // => false + */ + var isRegExp = nodeIsRegExp ? baseUnary(nodeIsRegExp) : baseIsRegExp; + + /** + * Checks if `value` is a safe integer. An integer is safe if it's an IEEE-754 + * double precision number which isn't the result of a rounded unsafe integer. + * + * **Note:** This method is based on + * [`Number.isSafeInteger`](https://mdn.io/Number/isSafeInteger). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a safe integer, else `false`. + * @example + * + * _.isSafeInteger(3); + * // => true + * + * _.isSafeInteger(Number.MIN_VALUE); + * // => false + * + * _.isSafeInteger(Infinity); + * // => false + * + * _.isSafeInteger('3'); + * // => false + */ + function isSafeInteger(value) { + return isInteger(value) && value >= -MAX_SAFE_INTEGER && value <= MAX_SAFE_INTEGER; + } + + /** + * Checks if `value` is classified as a `Set` object. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a set, else `false`. + * @example + * + * _.isSet(new Set); + * // => true + * + * _.isSet(new WeakSet); + * // => false + */ + var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet; + + /** + * Checks if `value` is classified as a `String` primitive or object. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a string, else `false`. + * @example + * + * _.isString('abc'); + * // => true + * + * _.isString(1); + * // => false + */ + function isString(value) { + return typeof value == 'string' || + (!isArray(value) && isObjectLike(value) && baseGetTag(value) == stringTag); + } + + /** + * Checks if `value` is classified as a `Symbol` primitive or object. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a symbol, else `false`. + * @example + * + * _.isSymbol(Symbol.iterator); + * // => true + * + * _.isSymbol('abc'); + * // => false + */ + function isSymbol(value) { + return typeof value == 'symbol' || + (isObjectLike(value) && baseGetTag(value) == symbolTag); + } + + /** + * Checks if `value` is classified as a typed array. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. + * @example + * + * _.isTypedArray(new Uint8Array); + * // => true + * + * _.isTypedArray([]); + * // => false + */ + var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray; + + /** + * Checks if `value` is `undefined`. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is `undefined`, else `false`. + * @example + * + * _.isUndefined(void 0); + * // => true + * + * _.isUndefined(null); + * // => false + */ + function isUndefined(value) { + return value === undefined; + } + + /** + * Checks if `value` is classified as a `WeakMap` object. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a weak map, else `false`. + * @example + * + * _.isWeakMap(new WeakMap); + * // => true + * + * _.isWeakMap(new Map); + * // => false + */ + function isWeakMap(value) { + return isObjectLike(value) && getTag(value) == weakMapTag; + } + + /** + * Checks if `value` is classified as a `WeakSet` object. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a weak set, else `false`. + * @example + * + * _.isWeakSet(new WeakSet); + * // => true + * + * _.isWeakSet(new Set); + * // => false + */ + function isWeakSet(value) { + return isObjectLike(value) && baseGetTag(value) == weakSetTag; + } + + /** + * Checks if `value` is less than `other`. + * + * @static + * @memberOf _ + * @since 3.9.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is less than `other`, + * else `false`. + * @see _.gt + * @example + * + * _.lt(1, 3); + * // => true + * + * _.lt(3, 3); + * // => false + * + * _.lt(3, 1); + * // => false + */ + var lt = createRelationalOperation(baseLt); + + /** + * Checks if `value` is less than or equal to `other`. + * + * @static + * @memberOf _ + * @since 3.9.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is less than or equal to + * `other`, else `false`. + * @see _.gte + * @example + * + * _.lte(1, 3); + * // => true + * + * _.lte(3, 3); + * // => true + * + * _.lte(3, 1); + * // => false + */ + var lte = createRelationalOperation(function(value, other) { + return value <= other; + }); + + /** + * Converts `value` to an array. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Lang + * @param {*} value The value to convert. + * @returns {Array} Returns the converted array. + * @example + * + * _.toArray({ 'a': 1, 'b': 2 }); + * // => [1, 2] + * + * _.toArray('abc'); + * // => ['a', 'b', 'c'] + * + * _.toArray(1); + * // => [] + * + * _.toArray(null); + * // => [] + */ + function toArray(value) { + if (!value) { + return []; + } + if (isArrayLike(value)) { + return isString(value) ? stringToArray(value) : copyArray(value); + } + if (symIterator && value[symIterator]) { + return iteratorToArray(value[symIterator]()); + } + var tag = getTag(value), + func = tag == mapTag ? mapToArray : (tag == setTag ? setToArray : values); + + return func(value); + } + + /** + * Converts `value` to a finite number. + * + * @static + * @memberOf _ + * @since 4.12.0 + * @category Lang + * @param {*} value The value to convert. + * @returns {number} Returns the converted number. + * @example + * + * _.toFinite(3.2); + * // => 3.2 + * + * _.toFinite(Number.MIN_VALUE); + * // => 5e-324 + * + * _.toFinite(Infinity); + * // => 1.7976931348623157e+308 + * + * _.toFinite('3.2'); + * // => 3.2 + */ + function toFinite(value) { + if (!value) { + return value === 0 ? value : 0; + } + value = toNumber(value); + if (value === INFINITY || value === -INFINITY) { + var sign = (value < 0 ? -1 : 1); + return sign * MAX_INTEGER; + } + return value === value ? value : 0; + } + + /** + * Converts `value` to an integer. + * + * **Note:** This method is loosely based on + * [`ToInteger`](http://www.ecma-international.org/ecma-262/7.0/#sec-tointeger). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to convert. + * @returns {number} Returns the converted integer. + * @example + * + * _.toInteger(3.2); + * // => 3 + * + * _.toInteger(Number.MIN_VALUE); + * // => 0 + * + * _.toInteger(Infinity); + * // => 1.7976931348623157e+308 + * + * _.toInteger('3.2'); + * // => 3 + */ + function toInteger(value) { + var result = toFinite(value), + remainder = result % 1; + + return result === result ? (remainder ? result - remainder : result) : 0; + } + + /** + * Converts `value` to an integer suitable for use as the length of an + * array-like object. + * + * **Note:** This method is based on + * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to convert. + * @returns {number} Returns the converted integer. + * @example + * + * _.toLength(3.2); + * // => 3 + * + * _.toLength(Number.MIN_VALUE); + * // => 0 + * + * _.toLength(Infinity); + * // => 4294967295 + * + * _.toLength('3.2'); + * // => 3 + */ + function toLength(value) { + return value ? baseClamp(toInteger(value), 0, MAX_ARRAY_LENGTH) : 0; + } + + /** + * Converts `value` to a number. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to process. + * @returns {number} Returns the number. + * @example + * + * _.toNumber(3.2); + * // => 3.2 + * + * _.toNumber(Number.MIN_VALUE); + * // => 5e-324 + * + * _.toNumber(Infinity); + * // => Infinity + * + * _.toNumber('3.2'); + * // => 3.2 + */ + function toNumber(value) { + if (typeof value == 'number') { + return value; + } + if (isSymbol(value)) { + return NAN; + } + if (isObject(value)) { + var other = typeof value.valueOf == 'function' ? value.valueOf() : value; + value = isObject(other) ? (other + '') : other; + } + if (typeof value != 'string') { + return value === 0 ? value : +value; + } + value = value.replace(reTrim, ''); + var isBinary = reIsBinary.test(value); + return (isBinary || reIsOctal.test(value)) + ? freeParseInt(value.slice(2), isBinary ? 2 : 8) + : (reIsBadHex.test(value) ? NAN : +value); + } + + /** + * Converts `value` to a plain object flattening inherited enumerable string + * keyed properties of `value` to own properties of the plain object. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Lang + * @param {*} value The value to convert. + * @returns {Object} Returns the converted plain object. + * @example + * + * function Foo() { + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.assign({ 'a': 1 }, new Foo); + * // => { 'a': 1, 'b': 2 } + * + * _.assign({ 'a': 1 }, _.toPlainObject(new Foo)); + * // => { 'a': 1, 'b': 2, 'c': 3 } + */ + function toPlainObject(value) { + return copyObject(value, keysIn(value)); + } + + /** + * Converts `value` to a safe integer. A safe integer can be compared and + * represented correctly. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to convert. + * @returns {number} Returns the converted integer. + * @example + * + * _.toSafeInteger(3.2); + * // => 3 + * + * _.toSafeInteger(Number.MIN_VALUE); + * // => 0 + * + * _.toSafeInteger(Infinity); + * // => 9007199254740991 + * + * _.toSafeInteger('3.2'); + * // => 3 + */ + function toSafeInteger(value) { + return value + ? baseClamp(toInteger(value), -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER) + : (value === 0 ? value : 0); + } + + /** + * Converts `value` to a string. An empty string is returned for `null` + * and `undefined` values. The sign of `-0` is preserved. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to convert. + * @returns {string} Returns the converted string. + * @example + * + * _.toString(null); + * // => '' + * + * _.toString(-0); + * // => '-0' + * + * _.toString([1, 2, 3]); + * // => '1,2,3' + */ + function toString(value) { + return value == null ? '' : baseToString(value); + } + + /*------------------------------------------------------------------------*/ + + /** + * Assigns own enumerable string keyed properties of source objects to the + * destination object. Source objects are applied from left to right. + * Subsequent sources overwrite property assignments of previous sources. + * + * **Note:** This method mutates `object` and is loosely based on + * [`Object.assign`](https://mdn.io/Object/assign). + * + * @static + * @memberOf _ + * @since 0.10.0 + * @category Object + * @param {Object} object The destination object. + * @param {...Object} [sources] The source objects. + * @returns {Object} Returns `object`. + * @see _.assignIn + * @example + * + * function Foo() { + * this.a = 1; + * } + * + * function Bar() { + * this.c = 3; + * } + * + * Foo.prototype.b = 2; + * Bar.prototype.d = 4; + * + * _.assign({ 'a': 0 }, new Foo, new Bar); + * // => { 'a': 1, 'c': 3 } + */ + var assign = createAssigner(function(object, source) { + if (isPrototype(source) || isArrayLike(source)) { + copyObject(source, keys(source), object); + return; + } + for (var key in source) { + if (hasOwnProperty.call(source, key)) { + assignValue(object, key, source[key]); + } + } + }); + + /** + * This method is like `_.assign` except that it iterates over own and + * inherited source properties. + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @alias extend + * @category Object + * @param {Object} object The destination object. + * @param {...Object} [sources] The source objects. + * @returns {Object} Returns `object`. + * @see _.assign + * @example + * + * function Foo() { + * this.a = 1; + * } + * + * function Bar() { + * this.c = 3; + * } + * + * Foo.prototype.b = 2; + * Bar.prototype.d = 4; + * + * _.assignIn({ 'a': 0 }, new Foo, new Bar); + * // => { 'a': 1, 'b': 2, 'c': 3, 'd': 4 } + */ + var assignIn = createAssigner(function(object, source) { + copyObject(source, keysIn(source), object); + }); + + /** + * This method is like `_.assignIn` except that it accepts `customizer` + * which is invoked to produce the assigned values. If `customizer` returns + * `undefined`, assignment is handled by the method instead. The `customizer` + * is invoked with five arguments: (objValue, srcValue, key, object, source). + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @alias extendWith + * @category Object + * @param {Object} object The destination object. + * @param {...Object} sources The source objects. + * @param {Function} [customizer] The function to customize assigned values. + * @returns {Object} Returns `object`. + * @see _.assignWith + * @example + * + * function customizer(objValue, srcValue) { + * return _.isUndefined(objValue) ? srcValue : objValue; + * } + * + * var defaults = _.partialRight(_.assignInWith, customizer); + * + * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); + * // => { 'a': 1, 'b': 2 } + */ + var assignInWith = createAssigner(function(object, source, srcIndex, customizer) { + copyObject(source, keysIn(source), object, customizer); + }); + + /** + * This method is like `_.assign` except that it accepts `customizer` + * which is invoked to produce the assigned values. If `customizer` returns + * `undefined`, assignment is handled by the method instead. The `customizer` + * is invoked with five arguments: (objValue, srcValue, key, object, source). + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The destination object. + * @param {...Object} sources The source objects. + * @param {Function} [customizer] The function to customize assigned values. + * @returns {Object} Returns `object`. + * @see _.assignInWith + * @example + * + * function customizer(objValue, srcValue) { + * return _.isUndefined(objValue) ? srcValue : objValue; + * } + * + * var defaults = _.partialRight(_.assignWith, customizer); + * + * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); + * // => { 'a': 1, 'b': 2 } + */ + var assignWith = createAssigner(function(object, source, srcIndex, customizer) { + copyObject(source, keys(source), object, customizer); + }); + + /** + * Creates an array of values corresponding to `paths` of `object`. + * + * @static + * @memberOf _ + * @since 1.0.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {...(string|string[])} [paths] The property paths to pick. + * @returns {Array} Returns the picked values. + * @example + * + * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; + * + * _.at(object, ['a[0].b.c', 'a[1]']); + * // => [3, 4] + */ + var at = flatRest(baseAt); + + /** + * Creates an object that inherits from the `prototype` object. If a + * `properties` object is given, its own enumerable string keyed properties + * are assigned to the created object. + * + * @static + * @memberOf _ + * @since 2.3.0 + * @category Object + * @param {Object} prototype The object to inherit from. + * @param {Object} [properties] The properties to assign to the object. + * @returns {Object} Returns the new object. + * @example + * + * function Shape() { + * this.x = 0; + * this.y = 0; + * } + * + * function Circle() { + * Shape.call(this); + * } + * + * Circle.prototype = _.create(Shape.prototype, { + * 'constructor': Circle + * }); + * + * var circle = new Circle; + * circle instanceof Circle; + * // => true + * + * circle instanceof Shape; + * // => true + */ + function create(prototype, properties) { + var result = baseCreate(prototype); + return properties == null ? result : baseAssign(result, properties); + } + + /** + * Assigns own and inherited enumerable string keyed properties of source + * objects to the destination object for all destination properties that + * resolve to `undefined`. Source objects are applied from left to right. + * Once a property is set, additional values of the same property are ignored. + * + * **Note:** This method mutates `object`. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The destination object. + * @param {...Object} [sources] The source objects. + * @returns {Object} Returns `object`. + * @see _.defaultsDeep + * @example + * + * _.defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); + * // => { 'a': 1, 'b': 2 } + */ + var defaults = baseRest(function(object, sources) { + object = Object(object); + + var index = -1; + var length = sources.length; + var guard = length > 2 ? sources[2] : undefined; + + if (guard && isIterateeCall(sources[0], sources[1], guard)) { + length = 1; + } + + while (++index < length) { + var source = sources[index]; + var props = keysIn(source); + var propsIndex = -1; + var propsLength = props.length; + + while (++propsIndex < propsLength) { + var key = props[propsIndex]; + var value = object[key]; + + if (value === undefined || + (eq(value, objectProto[key]) && !hasOwnProperty.call(object, key))) { + object[key] = source[key]; + } + } + } + + return object; + }); + + /** + * This method is like `_.defaults` except that it recursively assigns + * default properties. + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 3.10.0 + * @category Object + * @param {Object} object The destination object. + * @param {...Object} [sources] The source objects. + * @returns {Object} Returns `object`. + * @see _.defaults + * @example + * + * _.defaultsDeep({ 'a': { 'b': 2 } }, { 'a': { 'b': 1, 'c': 3 } }); + * // => { 'a': { 'b': 2, 'c': 3 } } + */ + var defaultsDeep = baseRest(function(args) { + args.push(undefined, customDefaultsMerge); + return apply(mergeWith, undefined, args); + }); + + /** + * This method is like `_.find` except that it returns the key of the first + * element `predicate` returns truthy for instead of the element itself. + * + * @static + * @memberOf _ + * @since 1.1.0 + * @category Object + * @param {Object} object The object to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {string|undefined} Returns the key of the matched element, + * else `undefined`. + * @example + * + * var users = { + * 'barney': { 'age': 36, 'active': true }, + * 'fred': { 'age': 40, 'active': false }, + * 'pebbles': { 'age': 1, 'active': true } + * }; + * + * _.findKey(users, function(o) { return o.age < 40; }); + * // => 'barney' (iteration order is not guaranteed) + * + * // The `_.matches` iteratee shorthand. + * _.findKey(users, { 'age': 1, 'active': true }); + * // => 'pebbles' + * + * // The `_.matchesProperty` iteratee shorthand. + * _.findKey(users, ['active', false]); + * // => 'fred' + * + * // The `_.property` iteratee shorthand. + * _.findKey(users, 'active'); + * // => 'barney' + */ + function findKey(object, predicate) { + return baseFindKey(object, getIteratee(predicate, 3), baseForOwn); + } + + /** + * This method is like `_.findKey` except that it iterates over elements of + * a collection in the opposite order. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Object + * @param {Object} object The object to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {string|undefined} Returns the key of the matched element, + * else `undefined`. + * @example + * + * var users = { + * 'barney': { 'age': 36, 'active': true }, + * 'fred': { 'age': 40, 'active': false }, + * 'pebbles': { 'age': 1, 'active': true } + * }; + * + * _.findLastKey(users, function(o) { return o.age < 40; }); + * // => returns 'pebbles' assuming `_.findKey` returns 'barney' + * + * // The `_.matches` iteratee shorthand. + * _.findLastKey(users, { 'age': 36, 'active': true }); + * // => 'barney' + * + * // The `_.matchesProperty` iteratee shorthand. + * _.findLastKey(users, ['active', false]); + * // => 'fred' + * + * // The `_.property` iteratee shorthand. + * _.findLastKey(users, 'active'); + * // => 'pebbles' + */ + function findLastKey(object, predicate) { + return baseFindKey(object, getIteratee(predicate, 3), baseForOwnRight); + } + + /** + * Iterates over own and inherited enumerable string keyed properties of an + * object and invokes `iteratee` for each property. The iteratee is invoked + * with three arguments: (value, key, object). Iteratee functions may exit + * iteration early by explicitly returning `false`. + * + * @static + * @memberOf _ + * @since 0.3.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Object} Returns `object`. + * @see _.forInRight + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.forIn(new Foo, function(value, key) { + * console.log(key); + * }); + * // => Logs 'a', 'b', then 'c' (iteration order is not guaranteed). + */ + function forIn(object, iteratee) { + return object == null + ? object + : baseFor(object, getIteratee(iteratee, 3), keysIn); + } + + /** + * This method is like `_.forIn` except that it iterates over properties of + * `object` in the opposite order. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Object} Returns `object`. + * @see _.forIn + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.forInRight(new Foo, function(value, key) { + * console.log(key); + * }); + * // => Logs 'c', 'b', then 'a' assuming `_.forIn` logs 'a', 'b', then 'c'. + */ + function forInRight(object, iteratee) { + return object == null + ? object + : baseForRight(object, getIteratee(iteratee, 3), keysIn); + } + + /** + * Iterates over own enumerable string keyed properties of an object and + * invokes `iteratee` for each property. The iteratee is invoked with three + * arguments: (value, key, object). Iteratee functions may exit iteration + * early by explicitly returning `false`. + * + * @static + * @memberOf _ + * @since 0.3.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Object} Returns `object`. + * @see _.forOwnRight + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.forOwn(new Foo, function(value, key) { + * console.log(key); + * }); + * // => Logs 'a' then 'b' (iteration order is not guaranteed). + */ + function forOwn(object, iteratee) { + return object && baseForOwn(object, getIteratee(iteratee, 3)); + } + + /** + * This method is like `_.forOwn` except that it iterates over properties of + * `object` in the opposite order. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Object} Returns `object`. + * @see _.forOwn + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.forOwnRight(new Foo, function(value, key) { + * console.log(key); + * }); + * // => Logs 'b' then 'a' assuming `_.forOwn` logs 'a' then 'b'. + */ + function forOwnRight(object, iteratee) { + return object && baseForOwnRight(object, getIteratee(iteratee, 3)); + } + + /** + * Creates an array of function property names from own enumerable properties + * of `object`. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The object to inspect. + * @returns {Array} Returns the function names. + * @see _.functionsIn + * @example + * + * function Foo() { + * this.a = _.constant('a'); + * this.b = _.constant('b'); + * } + * + * Foo.prototype.c = _.constant('c'); + * + * _.functions(new Foo); + * // => ['a', 'b'] + */ + function functions(object) { + return object == null ? [] : baseFunctions(object, keys(object)); + } + + /** + * Creates an array of function property names from own and inherited + * enumerable properties of `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The object to inspect. + * @returns {Array} Returns the function names. + * @see _.functions + * @example + * + * function Foo() { + * this.a = _.constant('a'); + * this.b = _.constant('b'); + * } + * + * Foo.prototype.c = _.constant('c'); + * + * _.functionsIn(new Foo); + * // => ['a', 'b', 'c'] + */ + function functionsIn(object) { + return object == null ? [] : baseFunctions(object, keysIn(object)); + } + + /** + * Gets the value at `path` of `object`. If the resolved value is + * `undefined`, the `defaultValue` is returned in its place. + * + * @static + * @memberOf _ + * @since 3.7.0 + * @category Object + * @param {Object} object The object to query. + * @param {Array|string} path The path of the property to get. + * @param {*} [defaultValue] The value returned for `undefined` resolved values. + * @returns {*} Returns the resolved value. + * @example + * + * var object = { 'a': [{ 'b': { 'c': 3 } }] }; + * + * _.get(object, 'a[0].b.c'); + * // => 3 + * + * _.get(object, ['a', '0', 'b', 'c']); + * // => 3 + * + * _.get(object, 'a.b.c', 'default'); + * // => 'default' + */ + function get(object, path, defaultValue) { + var result = object == null ? undefined : baseGet(object, path); + return result === undefined ? defaultValue : result; + } + + /** + * Checks if `path` is a direct property of `object`. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The object to query. + * @param {Array|string} path The path to check. + * @returns {boolean} Returns `true` if `path` exists, else `false`. + * @example + * + * var object = { 'a': { 'b': 2 } }; + * var other = _.create({ 'a': _.create({ 'b': 2 }) }); + * + * _.has(object, 'a'); + * // => true + * + * _.has(object, 'a.b'); + * // => true + * + * _.has(object, ['a', 'b']); + * // => true + * + * _.has(other, 'a'); + * // => false + */ + function has(object, path) { + return object != null && hasPath(object, path, baseHas); + } + + /** + * Checks if `path` is a direct or inherited property of `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The object to query. + * @param {Array|string} path The path to check. + * @returns {boolean} Returns `true` if `path` exists, else `false`. + * @example + * + * var object = _.create({ 'a': _.create({ 'b': 2 }) }); + * + * _.hasIn(object, 'a'); + * // => true + * + * _.hasIn(object, 'a.b'); + * // => true + * + * _.hasIn(object, ['a', 'b']); + * // => true + * + * _.hasIn(object, 'b'); + * // => false + */ + function hasIn(object, path) { + return object != null && hasPath(object, path, baseHasIn); + } + + /** + * Creates an object composed of the inverted keys and values of `object`. + * If `object` contains duplicate values, subsequent values overwrite + * property assignments of previous values. + * + * @static + * @memberOf _ + * @since 0.7.0 + * @category Object + * @param {Object} object The object to invert. + * @returns {Object} Returns the new inverted object. + * @example + * + * var object = { 'a': 1, 'b': 2, 'c': 1 }; + * + * _.invert(object); + * // => { '1': 'c', '2': 'b' } + */ + var invert = createInverter(function(result, value, key) { + if (value != null && + typeof value.toString != 'function') { + value = nativeObjectToString.call(value); + } + + result[value] = key; + }, constant(identity)); + + /** + * This method is like `_.invert` except that the inverted object is generated + * from the results of running each element of `object` thru `iteratee`. The + * corresponding inverted value of each inverted key is an array of keys + * responsible for generating the inverted value. The iteratee is invoked + * with one argument: (value). + * + * @static + * @memberOf _ + * @since 4.1.0 + * @category Object + * @param {Object} object The object to invert. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Object} Returns the new inverted object. + * @example + * + * var object = { 'a': 1, 'b': 2, 'c': 1 }; + * + * _.invertBy(object); + * // => { '1': ['a', 'c'], '2': ['b'] } + * + * _.invertBy(object, function(value) { + * return 'group' + value; + * }); + * // => { 'group1': ['a', 'c'], 'group2': ['b'] } + */ + var invertBy = createInverter(function(result, value, key) { + if (value != null && + typeof value.toString != 'function') { + value = nativeObjectToString.call(value); + } + + if (hasOwnProperty.call(result, value)) { + result[value].push(key); + } else { + result[value] = [key]; + } + }, getIteratee); + + /** + * Invokes the method at `path` of `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The object to query. + * @param {Array|string} path The path of the method to invoke. + * @param {...*} [args] The arguments to invoke the method with. + * @returns {*} Returns the result of the invoked method. + * @example + * + * var object = { 'a': [{ 'b': { 'c': [1, 2, 3, 4] } }] }; + * + * _.invoke(object, 'a[0].b.c.slice', 1, 3); + * // => [2, 3] + */ + var invoke = baseRest(baseInvoke); + + /** + * Creates an array of the own enumerable property names of `object`. + * + * **Note:** Non-object values are coerced to objects. See the + * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) + * for more details. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.keys(new Foo); + * // => ['a', 'b'] (iteration order is not guaranteed) + * + * _.keys('hi'); + * // => ['0', '1'] + */ + function keys(object) { + return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object); + } + + /** + * Creates an array of the own and inherited enumerable property names of `object`. + * + * **Note:** Non-object values are coerced to objects. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.keysIn(new Foo); + * // => ['a', 'b', 'c'] (iteration order is not guaranteed) + */ + function keysIn(object) { + return isArrayLike(object) ? arrayLikeKeys(object, true) : baseKeysIn(object); + } + + /** + * The opposite of `_.mapValues`; this method creates an object with the + * same values as `object` and keys generated by running each own enumerable + * string keyed property of `object` thru `iteratee`. The iteratee is invoked + * with three arguments: (value, key, object). + * + * @static + * @memberOf _ + * @since 3.8.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Object} Returns the new mapped object. + * @see _.mapValues + * @example + * + * _.mapKeys({ 'a': 1, 'b': 2 }, function(value, key) { + * return key + value; + * }); + * // => { 'a1': 1, 'b2': 2 } + */ + function mapKeys(object, iteratee) { + var result = {}; + iteratee = getIteratee(iteratee, 3); + + baseForOwn(object, function(value, key, object) { + baseAssignValue(result, iteratee(value, key, object), value); + }); + return result; + } + + /** + * Creates an object with the same keys as `object` and values generated + * by running each own enumerable string keyed property of `object` thru + * `iteratee`. The iteratee is invoked with three arguments: + * (value, key, object). + * + * @static + * @memberOf _ + * @since 2.4.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Object} Returns the new mapped object. + * @see _.mapKeys + * @example + * + * var users = { + * 'fred': { 'user': 'fred', 'age': 40 }, + * 'pebbles': { 'user': 'pebbles', 'age': 1 } + * }; + * + * _.mapValues(users, function(o) { return o.age; }); + * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) + * + * // The `_.property` iteratee shorthand. + * _.mapValues(users, 'age'); + * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) + */ + function mapValues(object, iteratee) { + var result = {}; + iteratee = getIteratee(iteratee, 3); + + baseForOwn(object, function(value, key, object) { + baseAssignValue(result, key, iteratee(value, key, object)); + }); + return result; + } + + /** + * This method is like `_.assign` except that it recursively merges own and + * inherited enumerable string keyed properties of source objects into the + * destination object. Source properties that resolve to `undefined` are + * skipped if a destination value exists. Array and plain object properties + * are merged recursively. Other objects and value types are overridden by + * assignment. Source objects are applied from left to right. Subsequent + * sources overwrite property assignments of previous sources. + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 0.5.0 + * @category Object + * @param {Object} object The destination object. + * @param {...Object} [sources] The source objects. + * @returns {Object} Returns `object`. + * @example + * + * var object = { + * 'a': [{ 'b': 2 }, { 'd': 4 }] + * }; + * + * var other = { + * 'a': [{ 'c': 3 }, { 'e': 5 }] + * }; + * + * _.merge(object, other); + * // => { 'a': [{ 'b': 2, 'c': 3 }, { 'd': 4, 'e': 5 }] } + */ + var merge = createAssigner(function(object, source, srcIndex) { + baseMerge(object, source, srcIndex); + }); + + /** + * This method is like `_.merge` except that it accepts `customizer` which + * is invoked to produce the merged values of the destination and source + * properties. If `customizer` returns `undefined`, merging is handled by the + * method instead. The `customizer` is invoked with six arguments: + * (objValue, srcValue, key, object, source, stack). + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The destination object. + * @param {...Object} sources The source objects. + * @param {Function} customizer The function to customize assigned values. + * @returns {Object} Returns `object`. + * @example + * + * function customizer(objValue, srcValue) { + * if (_.isArray(objValue)) { + * return objValue.concat(srcValue); + * } + * } + * + * var object = { 'a': [1], 'b': [2] }; + * var other = { 'a': [3], 'b': [4] }; + * + * _.mergeWith(object, other, customizer); + * // => { 'a': [1, 3], 'b': [2, 4] } + */ + var mergeWith = createAssigner(function(object, source, srcIndex, customizer) { + baseMerge(object, source, srcIndex, customizer); + }); + + /** + * The opposite of `_.pick`; this method creates an object composed of the + * own and inherited enumerable property paths of `object` that are not omitted. + * + * **Note:** This method is considerably slower than `_.pick`. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The source object. + * @param {...(string|string[])} [paths] The property paths to omit. + * @returns {Object} Returns the new object. + * @example + * + * var object = { 'a': 1, 'b': '2', 'c': 3 }; + * + * _.omit(object, ['a', 'c']); + * // => { 'b': '2' } + */ + var omit = flatRest(function(object, paths) { + var result = {}; + if (object == null) { + return result; + } + var isDeep = false; + paths = arrayMap(paths, function(path) { + path = castPath(path, object); + isDeep || (isDeep = path.length > 1); + return path; + }); + copyObject(object, getAllKeysIn(object), result); + if (isDeep) { + result = baseClone(result, CLONE_DEEP_FLAG | CLONE_FLAT_FLAG | CLONE_SYMBOLS_FLAG, customOmitClone); + } + var length = paths.length; + while (length--) { + baseUnset(result, paths[length]); + } + return result; + }); + + /** + * The opposite of `_.pickBy`; this method creates an object composed of + * the own and inherited enumerable string keyed properties of `object` that + * `predicate` doesn't return truthy for. The predicate is invoked with two + * arguments: (value, key). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The source object. + * @param {Function} [predicate=_.identity] The function invoked per property. + * @returns {Object} Returns the new object. + * @example + * + * var object = { 'a': 1, 'b': '2', 'c': 3 }; + * + * _.omitBy(object, _.isNumber); + * // => { 'b': '2' } + */ + function omitBy(object, predicate) { + return pickBy(object, negate(getIteratee(predicate))); + } + + /** + * Creates an object composed of the picked `object` properties. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The source object. + * @param {...(string|string[])} [paths] The property paths to pick. + * @returns {Object} Returns the new object. + * @example + * + * var object = { 'a': 1, 'b': '2', 'c': 3 }; + * + * _.pick(object, ['a', 'c']); + * // => { 'a': 1, 'c': 3 } + */ + var pick = flatRest(function(object, paths) { + return object == null ? {} : basePick(object, paths); + }); + + /** + * Creates an object composed of the `object` properties `predicate` returns + * truthy for. The predicate is invoked with two arguments: (value, key). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The source object. + * @param {Function} [predicate=_.identity] The function invoked per property. + * @returns {Object} Returns the new object. + * @example + * + * var object = { 'a': 1, 'b': '2', 'c': 3 }; + * + * _.pickBy(object, _.isNumber); + * // => { 'a': 1, 'c': 3 } + */ + function pickBy(object, predicate) { + if (object == null) { + return {}; + } + var props = arrayMap(getAllKeysIn(object), function(prop) { + return [prop]; + }); + predicate = getIteratee(predicate); + return basePickBy(object, props, function(value, path) { + return predicate(value, path[0]); + }); + } + + /** + * This method is like `_.get` except that if the resolved value is a + * function it's invoked with the `this` binding of its parent object and + * its result is returned. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The object to query. + * @param {Array|string} path The path of the property to resolve. + * @param {*} [defaultValue] The value returned for `undefined` resolved values. + * @returns {*} Returns the resolved value. + * @example + * + * var object = { 'a': [{ 'b': { 'c1': 3, 'c2': _.constant(4) } }] }; + * + * _.result(object, 'a[0].b.c1'); + * // => 3 + * + * _.result(object, 'a[0].b.c2'); + * // => 4 + * + * _.result(object, 'a[0].b.c3', 'default'); + * // => 'default' + * + * _.result(object, 'a[0].b.c3', _.constant('default')); + * // => 'default' + */ + function result(object, path, defaultValue) { + path = castPath(path, object); + + var index = -1, + length = path.length; + + // Ensure the loop is entered when path is empty. + if (!length) { + length = 1; + object = undefined; + } + while (++index < length) { + var value = object == null ? undefined : object[toKey(path[index])]; + if (value === undefined) { + index = length; + value = defaultValue; + } + object = isFunction(value) ? value.call(object) : value; + } + return object; + } + + /** + * Sets the value at `path` of `object`. If a portion of `path` doesn't exist, + * it's created. Arrays are created for missing index properties while objects + * are created for all other missing properties. Use `_.setWith` to customize + * `path` creation. + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 3.7.0 + * @category Object + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to set. + * @param {*} value The value to set. + * @returns {Object} Returns `object`. + * @example + * + * var object = { 'a': [{ 'b': { 'c': 3 } }] }; + * + * _.set(object, 'a[0].b.c', 4); + * console.log(object.a[0].b.c); + * // => 4 + * + * _.set(object, ['x', '0', 'y', 'z'], 5); + * console.log(object.x[0].y.z); + * // => 5 + */ + function set(object, path, value) { + return object == null ? object : baseSet(object, path, value); + } + + /** + * This method is like `_.set` except that it accepts `customizer` which is + * invoked to produce the objects of `path`. If `customizer` returns `undefined` + * path creation is handled by the method instead. The `customizer` is invoked + * with three arguments: (nsValue, key, nsObject). + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to set. + * @param {*} value The value to set. + * @param {Function} [customizer] The function to customize assigned values. + * @returns {Object} Returns `object`. + * @example + * + * var object = {}; + * + * _.setWith(object, '[0][1]', 'a', Object); + * // => { '0': { '1': 'a' } } + */ + function setWith(object, path, value, customizer) { + customizer = typeof customizer == 'function' ? customizer : undefined; + return object == null ? object : baseSet(object, path, value, customizer); + } + + /** + * Creates an array of own enumerable string keyed-value pairs for `object` + * which can be consumed by `_.fromPairs`. If `object` is a map or set, its + * entries are returned. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @alias entries + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the key-value pairs. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.toPairs(new Foo); + * // => [['a', 1], ['b', 2]] (iteration order is not guaranteed) + */ + var toPairs = createToPairs(keys); + + /** + * Creates an array of own and inherited enumerable string keyed-value pairs + * for `object` which can be consumed by `_.fromPairs`. If `object` is a map + * or set, its entries are returned. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @alias entriesIn + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the key-value pairs. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.toPairsIn(new Foo); + * // => [['a', 1], ['b', 2], ['c', 3]] (iteration order is not guaranteed) + */ + var toPairsIn = createToPairs(keysIn); + + /** + * An alternative to `_.reduce`; this method transforms `object` to a new + * `accumulator` object which is the result of running each of its own + * enumerable string keyed properties thru `iteratee`, with each invocation + * potentially mutating the `accumulator` object. If `accumulator` is not + * provided, a new object with the same `[[Prototype]]` will be used. The + * iteratee is invoked with four arguments: (accumulator, value, key, object). + * Iteratee functions may exit iteration early by explicitly returning `false`. + * + * @static + * @memberOf _ + * @since 1.3.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {*} [accumulator] The custom accumulator value. + * @returns {*} Returns the accumulated value. + * @example + * + * _.transform([2, 3, 4], function(result, n) { + * result.push(n *= n); + * return n % 2 == 0; + * }, []); + * // => [4, 9] + * + * _.transform({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { + * (result[value] || (result[value] = [])).push(key); + * }, {}); + * // => { '1': ['a', 'c'], '2': ['b'] } + */ + function transform(object, iteratee, accumulator) { + var isArr = isArray(object), + isArrLike = isArr || isBuffer(object) || isTypedArray(object); + + iteratee = getIteratee(iteratee, 4); + if (accumulator == null) { + var Ctor = object && object.constructor; + if (isArrLike) { + accumulator = isArr ? new Ctor : []; + } + else if (isObject(object)) { + accumulator = isFunction(Ctor) ? baseCreate(getPrototype(object)) : {}; + } + else { + accumulator = {}; + } + } + (isArrLike ? arrayEach : baseForOwn)(object, function(value, index, object) { + return iteratee(accumulator, value, index, object); + }); + return accumulator; + } + + /** + * Removes the property at `path` of `object`. + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to unset. + * @returns {boolean} Returns `true` if the property is deleted, else `false`. + * @example + * + * var object = { 'a': [{ 'b': { 'c': 7 } }] }; + * _.unset(object, 'a[0].b.c'); + * // => true + * + * console.log(object); + * // => { 'a': [{ 'b': {} }] }; + * + * _.unset(object, ['a', '0', 'b', 'c']); + * // => true + * + * console.log(object); + * // => { 'a': [{ 'b': {} }] }; + */ + function unset(object, path) { + return object == null ? true : baseUnset(object, path); + } + + /** + * This method is like `_.set` except that accepts `updater` to produce the + * value to set. Use `_.updateWith` to customize `path` creation. The `updater` + * is invoked with one argument: (value). + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.6.0 + * @category Object + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to set. + * @param {Function} updater The function to produce the updated value. + * @returns {Object} Returns `object`. + * @example + * + * var object = { 'a': [{ 'b': { 'c': 3 } }] }; + * + * _.update(object, 'a[0].b.c', function(n) { return n * n; }); + * console.log(object.a[0].b.c); + * // => 9 + * + * _.update(object, 'x[0].y.z', function(n) { return n ? n + 1 : 0; }); + * console.log(object.x[0].y.z); + * // => 0 + */ + function update(object, path, updater) { + return object == null ? object : baseUpdate(object, path, castFunction(updater)); + } + + /** + * This method is like `_.update` except that it accepts `customizer` which is + * invoked to produce the objects of `path`. If `customizer` returns `undefined` + * path creation is handled by the method instead. The `customizer` is invoked + * with three arguments: (nsValue, key, nsObject). + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.6.0 + * @category Object + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to set. + * @param {Function} updater The function to produce the updated value. + * @param {Function} [customizer] The function to customize assigned values. + * @returns {Object} Returns `object`. + * @example + * + * var object = {}; + * + * _.updateWith(object, '[0][1]', _.constant('a'), Object); + * // => { '0': { '1': 'a' } } + */ + function updateWith(object, path, updater, customizer) { + customizer = typeof customizer == 'function' ? customizer : undefined; + return object == null ? object : baseUpdate(object, path, castFunction(updater), customizer); + } + + /** + * Creates an array of the own enumerable string keyed property values of `object`. + * + * **Note:** Non-object values are coerced to objects. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property values. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.values(new Foo); + * // => [1, 2] (iteration order is not guaranteed) + * + * _.values('hi'); + * // => ['h', 'i'] + */ + function values(object) { + return object == null ? [] : baseValues(object, keys(object)); + } + + /** + * Creates an array of the own and inherited enumerable string keyed property + * values of `object`. + * + * **Note:** Non-object values are coerced to objects. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property values. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.valuesIn(new Foo); + * // => [1, 2, 3] (iteration order is not guaranteed) + */ + function valuesIn(object) { + return object == null ? [] : baseValues(object, keysIn(object)); + } + + /*------------------------------------------------------------------------*/ + + /** + * Clamps `number` within the inclusive `lower` and `upper` bounds. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Number + * @param {number} number The number to clamp. + * @param {number} [lower] The lower bound. + * @param {number} upper The upper bound. + * @returns {number} Returns the clamped number. + * @example + * + * _.clamp(-10, -5, 5); + * // => -5 + * + * _.clamp(10, -5, 5); + * // => 5 + */ + function clamp(number, lower, upper) { + if (upper === undefined) { + upper = lower; + lower = undefined; + } + if (upper !== undefined) { + upper = toNumber(upper); + upper = upper === upper ? upper : 0; + } + if (lower !== undefined) { + lower = toNumber(lower); + lower = lower === lower ? lower : 0; + } + return baseClamp(toNumber(number), lower, upper); + } + + /** + * Checks if `n` is between `start` and up to, but not including, `end`. If + * `end` is not specified, it's set to `start` with `start` then set to `0`. + * If `start` is greater than `end` the params are swapped to support + * negative ranges. + * + * @static + * @memberOf _ + * @since 3.3.0 + * @category Number + * @param {number} number The number to check. + * @param {number} [start=0] The start of the range. + * @param {number} end The end of the range. + * @returns {boolean} Returns `true` if `number` is in the range, else `false`. + * @see _.range, _.rangeRight + * @example + * + * _.inRange(3, 2, 4); + * // => true + * + * _.inRange(4, 8); + * // => true + * + * _.inRange(4, 2); + * // => false + * + * _.inRange(2, 2); + * // => false + * + * _.inRange(1.2, 2); + * // => true + * + * _.inRange(5.2, 4); + * // => false + * + * _.inRange(-3, -2, -6); + * // => true + */ + function inRange(number, start, end) { + start = toFinite(start); + if (end === undefined) { + end = start; + start = 0; + } else { + end = toFinite(end); + } + number = toNumber(number); + return baseInRange(number, start, end); + } + + /** + * Produces a random number between the inclusive `lower` and `upper` bounds. + * If only one argument is provided a number between `0` and the given number + * is returned. If `floating` is `true`, or either `lower` or `upper` are + * floats, a floating-point number is returned instead of an integer. + * + * **Note:** JavaScript follows the IEEE-754 standard for resolving + * floating-point values which can produce unexpected results. + * + * @static + * @memberOf _ + * @since 0.7.0 + * @category Number + * @param {number} [lower=0] The lower bound. + * @param {number} [upper=1] The upper bound. + * @param {boolean} [floating] Specify returning a floating-point number. + * @returns {number} Returns the random number. + * @example + * + * _.random(0, 5); + * // => an integer between 0 and 5 + * + * _.random(5); + * // => also an integer between 0 and 5 + * + * _.random(5, true); + * // => a floating-point number between 0 and 5 + * + * _.random(1.2, 5.2); + * // => a floating-point number between 1.2 and 5.2 + */ + function random(lower, upper, floating) { + if (floating && typeof floating != 'boolean' && isIterateeCall(lower, upper, floating)) { + upper = floating = undefined; + } + if (floating === undefined) { + if (typeof upper == 'boolean') { + floating = upper; + upper = undefined; + } + else if (typeof lower == 'boolean') { + floating = lower; + lower = undefined; + } + } + if (lower === undefined && upper === undefined) { + lower = 0; + upper = 1; + } + else { + lower = toFinite(lower); + if (upper === undefined) { + upper = lower; + lower = 0; + } else { + upper = toFinite(upper); + } + } + if (lower > upper) { + var temp = lower; + lower = upper; + upper = temp; + } + if (floating || lower % 1 || upper % 1) { + var rand = nativeRandom(); + return nativeMin(lower + (rand * (upper - lower + freeParseFloat('1e-' + ((rand + '').length - 1)))), upper); + } + return baseRandom(lower, upper); + } + + /*------------------------------------------------------------------------*/ + + /** + * Converts `string` to [camel case](https://en.wikipedia.org/wiki/CamelCase). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the camel cased string. + * @example + * + * _.camelCase('Foo Bar'); + * // => 'fooBar' + * + * _.camelCase('--foo-bar--'); + * // => 'fooBar' + * + * _.camelCase('__FOO_BAR__'); + * // => 'fooBar' + */ + var camelCase = createCompounder(function(result, word, index) { + word = word.toLowerCase(); + return result + (index ? capitalize(word) : word); + }); + + /** + * Converts the first character of `string` to upper case and the remaining + * to lower case. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to capitalize. + * @returns {string} Returns the capitalized string. + * @example + * + * _.capitalize('FRED'); + * // => 'Fred' + */ + function capitalize(string) { + return upperFirst(toString(string).toLowerCase()); + } + + /** + * Deburrs `string` by converting + * [Latin-1 Supplement](https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)#Character_table) + * and [Latin Extended-A](https://en.wikipedia.org/wiki/Latin_Extended-A) + * letters to basic Latin letters and removing + * [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to deburr. + * @returns {string} Returns the deburred string. + * @example + * + * _.deburr('déjà vu'); + * // => 'deja vu' + */ + function deburr(string) { + string = toString(string); + return string && string.replace(reLatin, deburrLetter).replace(reComboMark, ''); + } + + /** + * Checks if `string` ends with the given target string. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to inspect. + * @param {string} [target] The string to search for. + * @param {number} [position=string.length] The position to search up to. + * @returns {boolean} Returns `true` if `string` ends with `target`, + * else `false`. + * @example + * + * _.endsWith('abc', 'c'); + * // => true + * + * _.endsWith('abc', 'b'); + * // => false + * + * _.endsWith('abc', 'b', 2); + * // => true + */ + function endsWith(string, target, position) { + string = toString(string); + target = baseToString(target); + + var length = string.length; + position = position === undefined + ? length + : baseClamp(toInteger(position), 0, length); + + var end = position; + position -= target.length; + return position >= 0 && string.slice(position, end) == target; + } + + /** + * Converts the characters "&", "<", ">", '"', and "'" in `string` to their + * corresponding HTML entities. + * + * **Note:** No other characters are escaped. To escape additional + * characters use a third-party library like [_he_](https://mths.be/he). + * + * Though the ">" character is escaped for symmetry, characters like + * ">" and "/" don't need escaping in HTML and have no special meaning + * unless they're part of a tag or unquoted attribute value. See + * [Mathias Bynens's article](https://mathiasbynens.be/notes/ambiguous-ampersands) + * (under "semi-related fun fact") for more details. + * + * When working with HTML you should always + * [quote attribute values](http://wonko.com/post/html-escaping) to reduce + * XSS vectors. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category String + * @param {string} [string=''] The string to escape. + * @returns {string} Returns the escaped string. + * @example + * + * _.escape('fred, barney, & pebbles'); + * // => 'fred, barney, & pebbles' + */ + function escape(string) { + string = toString(string); + return (string && reHasUnescapedHtml.test(string)) + ? string.replace(reUnescapedHtml, escapeHtmlChar) + : string; + } + + /** + * Escapes the `RegExp` special characters "^", "$", "\", ".", "*", "+", + * "?", "(", ")", "[", "]", "{", "}", and "|" in `string`. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to escape. + * @returns {string} Returns the escaped string. + * @example + * + * _.escapeRegExp('[lodash](https://lodash.com/)'); + * // => '\[lodash\]\(https://lodash\.com/\)' + */ + function escapeRegExp(string) { + string = toString(string); + return (string && reHasRegExpChar.test(string)) + ? string.replace(reRegExpChar, '\\$&') + : string; + } + + /** + * Converts `string` to + * [kebab case](https://en.wikipedia.org/wiki/Letter_case#Special_case_styles). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the kebab cased string. + * @example + * + * _.kebabCase('Foo Bar'); + * // => 'foo-bar' + * + * _.kebabCase('fooBar'); + * // => 'foo-bar' + * + * _.kebabCase('__FOO_BAR__'); + * // => 'foo-bar' + */ + var kebabCase = createCompounder(function(result, word, index) { + return result + (index ? '-' : '') + word.toLowerCase(); + }); + + /** + * Converts `string`, as space separated words, to lower case. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the lower cased string. + * @example + * + * _.lowerCase('--Foo-Bar--'); + * // => 'foo bar' + * + * _.lowerCase('fooBar'); + * // => 'foo bar' + * + * _.lowerCase('__FOO_BAR__'); + * // => 'foo bar' + */ + var lowerCase = createCompounder(function(result, word, index) { + return result + (index ? ' ' : '') + word.toLowerCase(); + }); + + /** + * Converts the first character of `string` to lower case. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the converted string. + * @example + * + * _.lowerFirst('Fred'); + * // => 'fred' + * + * _.lowerFirst('FRED'); + * // => 'fRED' + */ + var lowerFirst = createCaseFirst('toLowerCase'); + + /** + * Pads `string` on the left and right sides if it's shorter than `length`. + * Padding characters are truncated if they can't be evenly divided by `length`. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to pad. + * @param {number} [length=0] The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padded string. + * @example + * + * _.pad('abc', 8); + * // => ' abc ' + * + * _.pad('abc', 8, '_-'); + * // => '_-abc_-_' + * + * _.pad('abc', 3); + * // => 'abc' + */ + function pad(string, length, chars) { + string = toString(string); + length = toInteger(length); + + var strLength = length ? stringSize(string) : 0; + if (!length || strLength >= length) { + return string; + } + var mid = (length - strLength) / 2; + return ( + createPadding(nativeFloor(mid), chars) + + string + + createPadding(nativeCeil(mid), chars) + ); + } + + /** + * Pads `string` on the right side if it's shorter than `length`. Padding + * characters are truncated if they exceed `length`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category String + * @param {string} [string=''] The string to pad. + * @param {number} [length=0] The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padded string. + * @example + * + * _.padEnd('abc', 6); + * // => 'abc ' + * + * _.padEnd('abc', 6, '_-'); + * // => 'abc_-_' + * + * _.padEnd('abc', 3); + * // => 'abc' + */ + function padEnd(string, length, chars) { + string = toString(string); + length = toInteger(length); + + var strLength = length ? stringSize(string) : 0; + return (length && strLength < length) + ? (string + createPadding(length - strLength, chars)) + : string; + } + + /** + * Pads `string` on the left side if it's shorter than `length`. Padding + * characters are truncated if they exceed `length`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category String + * @param {string} [string=''] The string to pad. + * @param {number} [length=0] The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padded string. + * @example + * + * _.padStart('abc', 6); + * // => ' abc' + * + * _.padStart('abc', 6, '_-'); + * // => '_-_abc' + * + * _.padStart('abc', 3); + * // => 'abc' + */ + function padStart(string, length, chars) { + string = toString(string); + length = toInteger(length); + + var strLength = length ? stringSize(string) : 0; + return (length && strLength < length) + ? (createPadding(length - strLength, chars) + string) + : string; + } + + /** + * Converts `string` to an integer of the specified radix. If `radix` is + * `undefined` or `0`, a `radix` of `10` is used unless `value` is a + * hexadecimal, in which case a `radix` of `16` is used. + * + * **Note:** This method aligns with the + * [ES5 implementation](https://es5.github.io/#x15.1.2.2) of `parseInt`. + * + * @static + * @memberOf _ + * @since 1.1.0 + * @category String + * @param {string} string The string to convert. + * @param {number} [radix=10] The radix to interpret `value` by. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {number} Returns the converted integer. + * @example + * + * _.parseInt('08'); + * // => 8 + * + * _.map(['6', '08', '10'], _.parseInt); + * // => [6, 8, 10] + */ + function parseInt(string, radix, guard) { + if (guard || radix == null) { + radix = 0; + } else if (radix) { + radix = +radix; + } + return nativeParseInt(toString(string).replace(reTrimStart, ''), radix || 0); + } + + /** + * Repeats the given string `n` times. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to repeat. + * @param {number} [n=1] The number of times to repeat the string. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {string} Returns the repeated string. + * @example + * + * _.repeat('*', 3); + * // => '***' + * + * _.repeat('abc', 2); + * // => 'abcabc' + * + * _.repeat('abc', 0); + * // => '' + */ + function repeat(string, n, guard) { + if ((guard ? isIterateeCall(string, n, guard) : n === undefined)) { + n = 1; + } else { + n = toInteger(n); + } + return baseRepeat(toString(string), n); + } + + /** + * Replaces matches for `pattern` in `string` with `replacement`. + * + * **Note:** This method is based on + * [`String#replace`](https://mdn.io/String/replace). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category String + * @param {string} [string=''] The string to modify. + * @param {RegExp|string} pattern The pattern to replace. + * @param {Function|string} replacement The match replacement. + * @returns {string} Returns the modified string. + * @example + * + * _.replace('Hi Fred', 'Fred', 'Barney'); + * // => 'Hi Barney' + */ + function replace() { + var args = arguments, + string = toString(args[0]); + + return args.length < 3 ? string : string.replace(args[1], args[2]); + } + + /** + * Converts `string` to + * [snake case](https://en.wikipedia.org/wiki/Snake_case). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the snake cased string. + * @example + * + * _.snakeCase('Foo Bar'); + * // => 'foo_bar' + * + * _.snakeCase('fooBar'); + * // => 'foo_bar' + * + * _.snakeCase('--FOO-BAR--'); + * // => 'foo_bar' + */ + var snakeCase = createCompounder(function(result, word, index) { + return result + (index ? '_' : '') + word.toLowerCase(); + }); + + /** + * Splits `string` by `separator`. + * + * **Note:** This method is based on + * [`String#split`](https://mdn.io/String/split). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category String + * @param {string} [string=''] The string to split. + * @param {RegExp|string} separator The separator pattern to split by. + * @param {number} [limit] The length to truncate results to. + * @returns {Array} Returns the string segments. + * @example + * + * _.split('a-b-c', '-', 2); + * // => ['a', 'b'] + */ + function split(string, separator, limit) { + if (limit && typeof limit != 'number' && isIterateeCall(string, separator, limit)) { + separator = limit = undefined; + } + limit = limit === undefined ? MAX_ARRAY_LENGTH : limit >>> 0; + if (!limit) { + return []; + } + string = toString(string); + if (string && ( + typeof separator == 'string' || + (separator != null && !isRegExp(separator)) + )) { + separator = baseToString(separator); + if (!separator && hasUnicode(string)) { + return castSlice(stringToArray(string), 0, limit); + } + } + return string.split(separator, limit); + } + + /** + * Converts `string` to + * [start case](https://en.wikipedia.org/wiki/Letter_case#Stylistic_or_specialised_usage). + * + * @static + * @memberOf _ + * @since 3.1.0 + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the start cased string. + * @example + * + * _.startCase('--foo-bar--'); + * // => 'Foo Bar' + * + * _.startCase('fooBar'); + * // => 'Foo Bar' + * + * _.startCase('__FOO_BAR__'); + * // => 'FOO BAR' + */ + var startCase = createCompounder(function(result, word, index) { + return result + (index ? ' ' : '') + upperFirst(word); + }); + + /** + * Checks if `string` starts with the given target string. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to inspect. + * @param {string} [target] The string to search for. + * @param {number} [position=0] The position to search from. + * @returns {boolean} Returns `true` if `string` starts with `target`, + * else `false`. + * @example + * + * _.startsWith('abc', 'a'); + * // => true + * + * _.startsWith('abc', 'b'); + * // => false + * + * _.startsWith('abc', 'b', 1); + * // => true + */ + function startsWith(string, target, position) { + string = toString(string); + position = position == null + ? 0 + : baseClamp(toInteger(position), 0, string.length); + + target = baseToString(target); + return string.slice(position, position + target.length) == target; + } + + /** + * Creates a compiled template function that can interpolate data properties + * in "interpolate" delimiters, HTML-escape interpolated data properties in + * "escape" delimiters, and execute JavaScript in "evaluate" delimiters. Data + * properties may be accessed as free variables in the template. If a setting + * object is given, it takes precedence over `_.templateSettings` values. + * + * **Note:** In the development build `_.template` utilizes + * [sourceURLs](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl) + * for easier debugging. + * + * For more information on precompiling templates see + * [lodash's custom builds documentation](https://lodash.com/custom-builds). + * + * For more information on Chrome extension sandboxes see + * [Chrome's extensions documentation](https://developer.chrome.com/extensions/sandboxingEval). + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category String + * @param {string} [string=''] The template string. + * @param {Object} [options={}] The options object. + * @param {RegExp} [options.escape=_.templateSettings.escape] + * The HTML "escape" delimiter. + * @param {RegExp} [options.evaluate=_.templateSettings.evaluate] + * The "evaluate" delimiter. + * @param {Object} [options.imports=_.templateSettings.imports] + * An object to import into the template as free variables. + * @param {RegExp} [options.interpolate=_.templateSettings.interpolate] + * The "interpolate" delimiter. + * @param {string} [options.sourceURL='lodash.templateSources[n]'] + * The sourceURL of the compiled template. + * @param {string} [options.variable='obj'] + * The data object variable name. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Function} Returns the compiled template function. + * @example + * + * // Use the "interpolate" delimiter to create a compiled template. + * var compiled = _.template('hello <%= user %>!'); + * compiled({ 'user': 'fred' }); + * // => 'hello fred!' + * + * // Use the HTML "escape" delimiter to escape data property values. + * var compiled = _.template('<%- value %>'); + * compiled({ 'value': '