From d4d8002186720c4270b642ae07d5975431318d9e Mon Sep 17 00:00:00 2001 From: Xiaobiao Huang <31790621+catohxb@users.noreply.github.com> Date: Tue, 3 Oct 2023 10:26:49 -0700 Subject: [PATCH 1/2] Create BndStrMPoleSymplectic4RadPass --- atintegrators/BndStrMPoleSymplectic4RadPass | 429 ++++++++++++++++++++ 1 file changed, 429 insertions(+) create mode 100644 atintegrators/BndStrMPoleSymplectic4RadPass diff --git a/atintegrators/BndStrMPoleSymplectic4RadPass b/atintegrators/BndStrMPoleSymplectic4RadPass new file mode 100644 index 000000000..abb20dcb6 --- /dev/null +++ b/atintegrators/BndStrMPoleSymplectic4RadPass @@ -0,0 +1,429 @@ +#include "atelem.c" +#include "atlalib.c" +#include "atphyslib.c" +#include "driftkickrad.c" /* PB2perp */ + +#define DRIFT1 0.6756035959798286638 +#define DRIFT2 -0.1756035959798286639 +#define KICK1 1.351207191959657328 +#define KICK2 -1.702414383919314656 + +#define TWOPI 6.28318530717959 +#define CGAMMA 8.846056192e-05 /* [m]/[GeV^3] Ref[1] (4.1) */ + +/* Straight dipole w/ multipole using Symplectic Integration and rotation at + * dipole faces. + * Created by Xiaobiao Huang, 7/31/2018 + Modified to include damping by synchrotron radiation by Hung-Chun Chao, October 2023 + */ +#define SQR(X) ((X)*(X)) + +struct elem { + double Length; + double BendingAngle; + double EntranceAngle; + double ExitAngle; + double *PolynomA; + double *PolynomB; + int MaxOrder; + int NumIntSteps; + double Energy; + /* Optional fields */ + double FullGap; + double FringeInt1; + double FringeInt2; + double *R1; + double *R2; + double *T1; + double *T2; + double X0ref; + double ByError; + double RefDZ; +}; + +void E1rotation(double *r,double X0ref, double E1) +/* At Entrance Edge: + * move particles to the field edge and convert coordinates to x, dx/dz, y, + * dy/dz, then convert to x, px, y, py as integration is done with px, py */ +{ + double x0,dxdz0, dydz0, psi; + double fac; + + dxdz0 = r[1]/sqrt(SQR(1+r[4])-SQR(r[1])-SQR(r[3])); + dydz0 = r[3]/sqrt(SQR(1+r[4])-SQR(r[1])-SQR(r[3])); + x0 = r[0]; + + psi = atan(dxdz0); + r[0] = r[0]*cos(psi)/cos(E1+psi)+X0ref; + r[1] = tan(E1+psi); + r[3] = dydz0/(cos(E1)-dxdz0*sin(E1)); + r[2] += x0*sin(E1)*r[3]; + r[5] += x0*tan(E1)/(1-dxdz0*tan(E1))*sqrt(1+SQR(dxdz0)+SQR(dydz0)); + /* convert to px, py */ + fac = sqrt(1+SQR(r[1])+SQR(r[3])); + r[1] = r[1]*(1+r[4])/fac; + r[3] = r[3]*(1+r[4])/fac; +} + +void E2rotation(double *r,double X0ref, double E2) +/* At Exit Edge: + * move particles to arc edge and convert coordinates to x, px, y, py */ +{ + double x0; + double dxdz0, dydz0, psi, fac; + + dxdz0 = r[1]/sqrt(SQR(1+r[4])-SQR(r[1])-SQR(r[3])); + dydz0 = r[3]/sqrt(SQR(1+r[4])-SQR(r[1])-SQR(r[3])); + x0 = r[0]; + + psi = atan(dxdz0); + fac = sqrt(1+SQR(dxdz0)+SQR(dydz0)); + r[0] = (r[0]-X0ref)*cos(psi)/cos(E2+psi); + r[1] = tan(E2+psi); + r[3] = dydz0/(cos(E2)-dxdz0*sin(E2)); + r[2] += r[3]*(x0-X0ref)*sin(E2); + r[5] += (x0-X0ref)*tan(E2)/(1-dxdz0*tan(E2))*fac; + /* convert to px, py */ + fac = sqrt(1+SQR(r[1])+SQR(r[3])); + r[1] = r[1]*(1+r[4])/fac; + r[3] = r[3]*(1+r[4])/fac; +} + +void edgey(double* r, double inv_rho, double edge_angle) +/* Edge focusing in dipoles with hard-edge field for vertical only */ +{ + double psi = inv_rho*tan(edge_angle); + /*r[1]+=r[0]*psi;*/ + r[3]-=r[2]*psi; +} + +void edgey_fringe(double* r, double inv_rho, double edge_angle, double fint, double gap) +/* Edge focusing in dipoles with fringe field, for vertical only */ +{ + double fx = inv_rho*tan(edge_angle); + double psi_bar = edge_angle-inv_rho*gap*fint*(1+sin(edge_angle)*sin(edge_angle))/cos(edge_angle)/(1+r[4]); + double fy = inv_rho*tan(psi_bar); + /*r[1]+=r[0]*fx;*/ + r[3]-=r[2]*fy; +} + +void ladrift6(double* r, double L) +/* large angle drift, X. Huang, 7/31/2018 + * Input parameter L is the physical length + * 1/(1+delta) normalization is done internally + * Hamiltonian H = (1+\delta)-sqrt{(1+\delta)^2-p_x^2-p_y^2}, change sign for + * $\Delta z$ in AT */ +{ + double p_norm = 1./sqrt(SQR(1+r[4])-SQR(r[1])-SQR(r[3])); + double NormL = L*p_norm; + r[0]+= NormL*r[1]; + r[2]+= NormL*r[3]; + r[5]+= L*(p_norm*(1+r[4])-1.); +} + +void bndstrthinkickrad(double* r, double* A, double* B, double L, double irho, double E0, int max_order) +/***************************************************************************** +Calculate multipole kick in a straight bending magnet, This is not the usual Bends! +*created by X. Huang, 7/31/2018, patched by HC, Janurary 2023 +The reference coordinate system is straight in s. + +Note: in the US convention the transverse multipole field is written as: + + max_order+1 + ---- + \ n-1 + (B + iB )/ B rho = > (ia + b ) (x + iy) + y x / n n + ---- + n=1 + is a polynomial in (x,y) with the highest order = MaxOrder + + + Using different index notation + + max_order + ---- + \ n + (B + iB )/ B rho = > (iA + B ) (x + iy) + y x / n n + ---- + n=0 + + A,B: i=0 ... max_order + [0] - dipole, [1] - quadrupole, [2] - sextupole ... + units for A,B[i] = 1/[m]^(i+1) + Coeficients are stroed in the PolynomA, PolynomB field of the element + structure in MATLAB + + A[i] (C++,C) = PolynomA(i+1) (MATLAB) + B[i] (C++,C) = PolynomB(i+1) (MATLAB) + i = 0 .. MaxOrder +******************************************************************************/ +{ + int i; + double ReSum = B[max_order]; + double ImSum = A[max_order]; + double ReSumTemp; + double CRAD = CGAMMA*E0*E0*E0/(TWOPI*1e27); /* [m]/[GeV^3] M.Sands (4.1) */ + + /* recursively calculate the local transvrese magnetic field + Bx = ReSum, By = ImSum */ + B[0] += irho; + for(i=max_order-1;i>=0;i--) { + ReSumTemp = ReSum*r[0] - ImSum*r[2] + B[i]; + ImSum = ImSum*r[0] + ReSum*r[2] + A[i]; + ReSum = ReSumTemp; + } + B[0] -= irho; + + double x ,xpr, y, ypr, p_norm,dp_0, B2P; + /* calculate angles from momentums */ + p_norm = 1/(1+r[4]); + x = r[0]; + xpr = r[1]*p_norm; + y = r[2]; + ypr = r[3]*p_norm; + + B2P = B2perp(ImSum, ReSum +irho, irho, x , xpr, y ,ypr); + + dp_0 = r[4]; + r[4] = r[4] - CRAD*SQR(1+r[4])*B2P*(1 + x*irho + (SQR(xpr)+SQR(ypr))/2 )*L; + + /* recalculate momentums from angles after losing energy for radiation */ + p_norm = 1/(1+r[4]); + r[1] = xpr/p_norm; + r[3] = ypr/p_norm; + + r[1] -= L*(ReSum); + r[3] += L*ImSum; + //r[5] += 0; /* pathlength */ + r[5] += L*irho*r[0]; /* pathlength */ +} + +void BndStrMPoleSymplectic4RadPass(double *r, double le, double irho, double *A, + double *B, int max_order, int num_int_steps, + double entrance_angle, double exit_angle, double X0ref, + double ByError, double RefDZ, double fint1, double fint2, + double gap, double *T1, double *T2, double *R1, double *R2, + double E0, int num_particles) +{ + int c, m; + double *r6; + double SL, L1, L2, K1, K2; + bool useT1, useT2, useR1, useR2, useFringe1, useFringe2; + + SL = le/num_int_steps; + L1 = SL*DRIFT1; + L2 = SL*DRIFT2; + K1 = SL*KICK1; + K2 = SL*KICK2; + + /* mexPrintf("E0ref=%f\n",X0ref); */ + if(T1==NULL) + useT1=false; + else + useT1=true; + if(T2==NULL) + useT2=false; + else + useT2=true; + if(R1==NULL) + useR1=false; + else + useR1=true; + if(R2==NULL) + useR2=false; + else + useR2=true; + /* if either is 0 - do not calculate fringe effects */ + if( fint1==0 || gap==0) + useFringe1 = false; + else + useFringe1=true; + if( fint2==0 || gap==0) + useFringe2 = false; + else + useFringe2=true; + + for(c = 0;cLength=Length; + Elem->BendingAngle=BendingAngle; + Elem->EntranceAngle=EntranceAngle; + Elem->ExitAngle=ExitAngle; + Elem->PolynomA=PolynomA; + Elem->PolynomB=PolynomB; + Elem->MaxOrder=MaxOrder; + Elem->NumIntSteps=NumIntSteps; + Elem->Energy=Energy; + /*optional fields*/ + Elem->FullGap=Gap; + Elem->FringeInt1=Fint1; + Elem->FringeInt2=Fint2; + Elem->R1=R1; + Elem->R2=R2; + Elem->T1=T1; + Elem->T2=T2; + Elem->X0ref=X0ref; + Elem->ByError=ByError; + Elem->RefDZ=RefDZ; + } + irho = Elem->BendingAngle / Elem->Length; + flen = 2.0 / irho * sin(Elem->BendingAngle/2.0); + BndStrMPoleSymplectic4RadPass(r_in, flen, irho, Elem->PolynomA, + Elem->PolynomB, Elem->MaxOrder, Elem->NumIntSteps, + Elem->EntranceAngle, Elem->ExitAngle, Elem->X0ref, Elem->ByError, + Elem->RefDZ, Elem->FringeInt1, Elem->FringeInt2, Elem->FullGap, + Elem->T1, Elem->T2, Elem->R1, Elem->R2, Elem->Energy, num_particles); + return Elem; +} + +MODULE_DEF(BndStrMPoleSymplectic4RadPass) /* Dummy module initialisation */ + +#endif /*defined(MATLAB_MEX_FILE) || defined(PYAT)*/ + +#if defined(MATLAB_MEX_FILE) +void mexFunction( int nlhs, mxArray *plhs[], int nrhs, const mxArray *prhs[]) +{ + if (nrhs == 2) { + double irho, flen; + double Length, BendingAngle, EntranceAngle, ExitAngle, Gap, Fint1, Fint2, X0ref, ByError, RefDZ, Energy; + int MaxOrder, NumIntSteps; + double *PolynomA, *PolynomB, *R1, *R2, *T1, *T2; + double *r_in; + const mxArray *ElemData = prhs[0]; + int num_particles = mxGetN(prhs[1]); + Length=atGetDouble(ElemData,"Length"); check_error(); + BendingAngle=atGetDouble(ElemData,"BendingAngle"); check_error(); + EntranceAngle=atGetDouble(ElemData,"EntranceAngle"); check_error(); + ExitAngle=atGetDouble(ElemData,"ExitAngle"); check_error(); + PolynomA=atGetDoubleArray(ElemData,"PolynomA"); check_error(); + PolynomB=atGetDoubleArray(ElemData,"PolynomB"); check_error(); + MaxOrder=atGetLong(ElemData,"MaxOrder"); check_error(); + NumIntSteps=atGetLong(ElemData,"NumIntSteps"); check_error(); + Energy=atGetDouble(ElemData,"Energy"); check_error(); + /*optional fields*/ + Gap=atGetOptionalDouble(ElemData,"FullGap", 0); check_error(); + Fint1=atGetOptionalDouble(ElemData,"FringeInt1", 0); check_error(); + Fint2=atGetOptionalDouble(ElemData,"FringeInt2", 0); check_error(); + R1=atGetOptionalDoubleArray(ElemData,"R1"); check_error(); + R2=atGetOptionalDoubleArray(ElemData,"R2"); check_error(); + T1=atGetOptionalDoubleArray(ElemData,"T1"); check_error(); + T2=atGetOptionalDoubleArray(ElemData,"T2"); check_error(); + X0ref=atGetOptionalDouble(ElemData,"X0ref", 0); check_error(); + ByError=atGetOptionalDouble(ElemData,"ByError", 0); check_error(); + RefDZ=atGetOptionalDouble(ElemData,"RefDZ", 0); check_error(); + irho = BendingAngle/Length; + flen = 2.0/irho*sin(BendingAngle/2.0); /* field length */ + if (mxGetM(prhs[1]) != 6) mexErrMsgIdAndTxt("AT:WrongArg","Second argument must be a 6 x N matrix"); + /* ALLOCATE memory for the output array of the same size as the input */ + plhs[0] = mxDuplicateArray(prhs[1]); + r_in = mxGetDoubles(plhs[0]); + BndStrMPoleSymplectic4RadPass(r_in, flen, irho, PolynomA, PolynomB, + MaxOrder, NumIntSteps, EntranceAngle, ExitAngle, X0ref, ByError, + RefDZ, Fint1, Fint2, Gap, T1, T2, R1, R2, Energy, num_particles); + } + else if (nrhs == 0) { + /* list of required fields */ + plhs[0] = mxCreateCellMatrix(8,1); + mxSetCell(plhs[0],0,mxCreateString("Length")); + mxSetCell(plhs[0],1,mxCreateString("BendingAngle")); + mxSetCell(plhs[0],2,mxCreateString("EntranceAngle")); + mxSetCell(plhs[0],3,mxCreateString("ExitAngle")); + mxSetCell(plhs[0],4,mxCreateString("PolynomA")); + mxSetCell(plhs[0],5,mxCreateString("PolynomB")); + mxSetCell(plhs[0],6,mxCreateString("MaxOrder")); + mxSetCell(plhs[0],7,mxCreateString("NumIntSteps")); + mxSetCell(plhs[0],8,mxCreateString("Energy")); + if(nlhs>1) { /* list of optional fields */ + plhs[1] = mxCreateCellMatrix(7,1); + mxSetCell(plhs[1],0,mxCreateString("FullGap")); + mxSetCell(plhs[1],1,mxCreateString("FringeInt1")); + mxSetCell(plhs[1],2,mxCreateString("FringeInt2")); + mxSetCell(plhs[1],3,mxCreateString("T1")); + mxSetCell(plhs[1],4,mxCreateString("T2")); + mxSetCell(plhs[1],5,mxCreateString("R1")); + mxSetCell(plhs[1],6,mxCreateString("R2")); + mxSetCell(plhs[1],7,mxCreateString("X0ref")); + mxSetCell(plhs[1],8,mxCreateString("ByError")); + mxSetCell(plhs[1],9,mxCreateString("RefDZ")); + } + } + else { + mexErrMsgIdAndTxt("AT:WrongArg","Needs 0 or 2 arguments"); + } +} +#endif /*MATLAB_MEX_FILE*/ From c458682c9fc68c1e084bf10fc98eae449caeb821 Mon Sep 17 00:00:00 2001 From: Nicola Carmignani Date: Wed, 11 Oct 2023 13:48:10 +0200 Subject: [PATCH 2/2] small correction in mexFunction of BndStrMPoleSymplectic4RadPass --- atintegrators/BndStrMPoleSymplectic4RadPass | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/atintegrators/BndStrMPoleSymplectic4RadPass b/atintegrators/BndStrMPoleSymplectic4RadPass index abb20dcb6..c3984ae22 100644 --- a/atintegrators/BndStrMPoleSymplectic4RadPass +++ b/atintegrators/BndStrMPoleSymplectic4RadPass @@ -398,7 +398,7 @@ void mexFunction( int nlhs, mxArray *plhs[], int nrhs, const mxArray *prhs[]) } else if (nrhs == 0) { /* list of required fields */ - plhs[0] = mxCreateCellMatrix(8,1); + plhs[0] = mxCreateCellMatrix(9,1); mxSetCell(plhs[0],0,mxCreateString("Length")); mxSetCell(plhs[0],1,mxCreateString("BendingAngle")); mxSetCell(plhs[0],2,mxCreateString("EntranceAngle")); @@ -409,7 +409,7 @@ void mexFunction( int nlhs, mxArray *plhs[], int nrhs, const mxArray *prhs[]) mxSetCell(plhs[0],7,mxCreateString("NumIntSteps")); mxSetCell(plhs[0],8,mxCreateString("Energy")); if(nlhs>1) { /* list of optional fields */ - plhs[1] = mxCreateCellMatrix(7,1); + plhs[1] = mxCreateCellMatrix(10,1); mxSetCell(plhs[1],0,mxCreateString("FullGap")); mxSetCell(plhs[1],1,mxCreateString("FringeInt1")); mxSetCell(plhs[1],2,mxCreateString("FringeInt2"));