fesapi.wasm.mjs

var FesapiModule = (function() {
  var _scriptDir = typeof document !== 'undefined' && document.currentScript ? document.currentScript.src : undefined;
  
  return (
function(FesapiModule) {
  FesapiModule = FesapiModule || {};

var Module = typeof FesapiModule !== "undefined" ? FesapiModule : {};

var readyPromiseResolve, readyPromiseReject;

Module["ready"] = new Promise(function(resolve, reject) {
 readyPromiseResolve = resolve;
 readyPromiseReject = reject;
});

if (!Object.getOwnPropertyDescriptor(Module["ready"], "_main")) {
 Object.defineProperty(Module["ready"], "_main", {
  configurable: true,
  get: function() {
   abort("You are getting _main on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "_main", {
  configurable: true,
  set: function() {
   abort("You are setting _main on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "_sbrk")) {
 Object.defineProperty(Module["ready"], "_sbrk", {
  configurable: true,
  get: function() {
   abort("You are getting _sbrk on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "_sbrk", {
  configurable: true,
  set: function() {
   abort("You are setting _sbrk on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "_emscripten_stack_get_end")) {
 Object.defineProperty(Module["ready"], "_emscripten_stack_get_end", {
  configurable: true,
  get: function() {
   abort("You are getting _emscripten_stack_get_end on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "_emscripten_stack_get_end", {
  configurable: true,
  set: function() {
   abort("You are setting _emscripten_stack_get_end on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "_emscripten_stack_get_free")) {
 Object.defineProperty(Module["ready"], "_emscripten_stack_get_free", {
  configurable: true,
  get: function() {
   abort("You are getting _emscripten_stack_get_free on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "_emscripten_stack_get_free", {
  configurable: true,
  set: function() {
   abort("You are setting _emscripten_stack_get_free on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "_emscripten_stack_get_base")) {
 Object.defineProperty(Module["ready"], "_emscripten_stack_get_base", {
  configurable: true,
  get: function() {
   abort("You are getting _emscripten_stack_get_base on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "_emscripten_stack_get_base", {
  configurable: true,
  set: function() {
   abort("You are setting _emscripten_stack_get_base on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "_emscripten_stack_init")) {
 Object.defineProperty(Module["ready"], "_emscripten_stack_init", {
  configurable: true,
  get: function() {
   abort("You are getting _emscripten_stack_init on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "_emscripten_stack_init", {
  configurable: true,
  set: function() {
   abort("You are setting _emscripten_stack_init on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "___cxa_demangle")) {
 Object.defineProperty(Module["ready"], "___cxa_demangle", {
  configurable: true,
  get: function() {
   abort("You are getting ___cxa_demangle on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "___cxa_demangle", {
  configurable: true,
  set: function() {
   abort("You are setting ___cxa_demangle on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "_stackSave")) {
 Object.defineProperty(Module["ready"], "_stackSave", {
  configurable: true,
  get: function() {
   abort("You are getting _stackSave on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "_stackSave", {
  configurable: true,
  set: function() {
   abort("You are setting _stackSave on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "_stackRestore")) {
 Object.defineProperty(Module["ready"], "_stackRestore", {
  configurable: true,
  get: function() {
   abort("You are getting _stackRestore on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "_stackRestore", {
  configurable: true,
  set: function() {
   abort("You are setting _stackRestore on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "_stackAlloc")) {
 Object.defineProperty(Module["ready"], "_stackAlloc", {
  configurable: true,
  get: function() {
   abort("You are getting _stackAlloc on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "_stackAlloc", {
  configurable: true,
  set: function() {
   abort("You are setting _stackAlloc on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "___wasm_call_ctors")) {
 Object.defineProperty(Module["ready"], "___wasm_call_ctors", {
  configurable: true,
  get: function() {
   abort("You are getting ___wasm_call_ctors on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "___wasm_call_ctors", {
  configurable: true,
  set: function() {
   abort("You are setting ___wasm_call_ctors on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "_fflush")) {
 Object.defineProperty(Module["ready"], "_fflush", {
  configurable: true,
  get: function() {
   abort("You are getting _fflush on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "_fflush", {
  configurable: true,
  set: function() {
   abort("You are setting _fflush on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "___errno_location")) {
 Object.defineProperty(Module["ready"], "___errno_location", {
  configurable: true,
  get: function() {
   abort("You are getting ___errno_location on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "___errno_location", {
  configurable: true,
  set: function() {
   abort("You are setting ___errno_location on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "_emscripten_get_sbrk_ptr")) {
 Object.defineProperty(Module["ready"], "_emscripten_get_sbrk_ptr", {
  configurable: true,
  get: function() {
   abort("You are getting _emscripten_get_sbrk_ptr on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "_emscripten_get_sbrk_ptr", {
  configurable: true,
  set: function() {
   abort("You are setting _emscripten_get_sbrk_ptr on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "_malloc")) {
 Object.defineProperty(Module["ready"], "_malloc", {
  configurable: true,
  get: function() {
   abort("You are getting _malloc on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "_malloc", {
  configurable: true,
  set: function() {
   abort("You are setting _malloc on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "_free")) {
 Object.defineProperty(Module["ready"], "_free", {
  configurable: true,
  get: function() {
   abort("You are getting _free on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "_free", {
  configurable: true,
  set: function() {
   abort("You are setting _free on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "___cxa_is_pointer_type")) {
 Object.defineProperty(Module["ready"], "___cxa_is_pointer_type", {
  configurable: true,
  get: function() {
   abort("You are getting ___cxa_is_pointer_type on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "___cxa_is_pointer_type", {
  configurable: true,
  set: function() {
   abort("You are setting ___cxa_is_pointer_type on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "___cxa_can_catch")) {
 Object.defineProperty(Module["ready"], "___cxa_can_catch", {
  configurable: true,
  get: function() {
   abort("You are getting ___cxa_can_catch on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "___cxa_can_catch", {
  configurable: true,
  set: function() {
   abort("You are setting ___cxa_can_catch on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "_setThrew")) {
 Object.defineProperty(Module["ready"], "_setThrew", {
  configurable: true,
  get: function() {
   abort("You are getting _setThrew on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "_setThrew", {
  configurable: true,
  set: function() {
   abort("You are setting _setThrew on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "_ntohs")) {
 Object.defineProperty(Module["ready"], "_ntohs", {
  configurable: true,
  get: function() {
   abort("You are getting _ntohs on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "_ntohs", {
  configurable: true,
  set: function() {
   abort("You are setting _ntohs on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "_htons")) {
 Object.defineProperty(Module["ready"], "_htons", {
  configurable: true,
  get: function() {
   abort("You are getting _htons on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "_htons", {
  configurable: true,
  set: function() {
   abort("You are setting _htons on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "_memcpy")) {
 Object.defineProperty(Module["ready"], "_memcpy", {
  configurable: true,
  get: function() {
   abort("You are getting _memcpy on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "_memcpy", {
  configurable: true,
  set: function() {
   abort("You are setting _memcpy on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "__get_tzname")) {
 Object.defineProperty(Module["ready"], "__get_tzname", {
  configurable: true,
  get: function() {
   abort("You are getting __get_tzname on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "__get_tzname", {
  configurable: true,
  set: function() {
   abort("You are setting __get_tzname on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "__get_daylight")) {
 Object.defineProperty(Module["ready"], "__get_daylight", {
  configurable: true,
  get: function() {
   abort("You are getting __get_daylight on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "__get_daylight", {
  configurable: true,
  set: function() {
   abort("You are setting __get_daylight on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "__get_timezone")) {
 Object.defineProperty(Module["ready"], "__get_timezone", {
  configurable: true,
  get: function() {
   abort("You are getting __get_timezone on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "__get_timezone", {
  configurable: true,
  set: function() {
   abort("You are setting __get_timezone on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "___dl_seterr")) {
 Object.defineProperty(Module["ready"], "___dl_seterr", {
  configurable: true,
  get: function() {
   abort("You are getting ___dl_seterr on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "___dl_seterr", {
  configurable: true,
  set: function() {
   abort("You are setting ___dl_seterr on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "___getTypeName")) {
 Object.defineProperty(Module["ready"], "___getTypeName", {
  configurable: true,
  get: function() {
   abort("You are getting ___getTypeName on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "___getTypeName", {
  configurable: true,
  set: function() {
   abort("You are setting ___getTypeName on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "___embind_register_native_and_builtin_types")) {
 Object.defineProperty(Module["ready"], "___embind_register_native_and_builtin_types", {
  configurable: true,
  get: function() {
   abort("You are getting ___embind_register_native_and_builtin_types on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "___embind_register_native_and_builtin_types", {
  configurable: true,
  set: function() {
   abort("You are setting ___embind_register_native_and_builtin_types on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "___set_stack_limits")) {
 Object.defineProperty(Module["ready"], "___set_stack_limits", {
  configurable: true,
  get: function() {
   abort("You are getting ___set_stack_limits on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "___set_stack_limits", {
  configurable: true,
  set: function() {
   abort("You are setting ___set_stack_limits on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module["ready"], "onRuntimeInitialized")) {
 Object.defineProperty(Module["ready"], "onRuntimeInitialized", {
  configurable: true,
  get: function() {
   abort("You are getting onRuntimeInitialized on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
 Object.defineProperty(Module["ready"], "onRuntimeInitialized", {
  configurable: true,
  set: function() {
   abort("You are setting onRuntimeInitialized on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js");
  }
 });
}

var moduleOverrides = {};

var key;

for (key in Module) {
 if (Module.hasOwnProperty(key)) {
  moduleOverrides[key] = Module[key];
 }
}

var arguments_ = [];

var thisProgram = "./this.program";

var quit_ = function(status, toThrow) {
 throw toThrow;
};

var ENVIRONMENT_IS_WEB = true;

var ENVIRONMENT_IS_WORKER = false;

var ENVIRONMENT_IS_NODE = false;

var ENVIRONMENT_IS_SHELL = false;

if (Module["ENVIRONMENT"]) {
 throw new Error("Module.ENVIRONMENT has been deprecated. To force the environment, use the ENVIRONMENT compile-time option (for example, -s ENVIRONMENT=web or -s ENVIRONMENT=node)");
}

var scriptDirectory = "";

function locateFile(path) {
 if (Module["locateFile"]) {
  return Module["locateFile"](path, scriptDirectory);
 }
 return scriptDirectory + path;
}

var read_, readAsync, readBinary, setWindowTitle;

function logExceptionOnExit(e) {
 if (e instanceof ExitStatus) return;
 var toLog = e;
 if (e && typeof e === "object" && e.stack) {
  toLog = [ e, e.stack ];
 }
 err("exiting due to exception: " + toLog);
}

if (ENVIRONMENT_IS_SHELL) {
 if (typeof process === "object" && typeof require === "function" || typeof window === "object" || typeof importScripts === "function") throw new Error("not compiled for this environment (did you build to HTML and try to run it not on the web, or set ENVIRONMENT to something - like node - and run it someplace else - like on the web?)");
 if (typeof read != "undefined") {
  read_ = function shell_read(f) {
   return read(f);
  };
 }
 readBinary = function readBinary(f) {
  var data;
  if (typeof readbuffer === "function") {
   return new Uint8Array(readbuffer(f));
  }
  data = read(f, "binary");
  assert(typeof data === "object");
  return data;
 };
 readAsync = function readAsync(f, onload, onerror) {
  setTimeout(function() {
   onload(readBinary(f));
  }, 0);
 };
 if (typeof scriptArgs != "undefined") {
  arguments_ = scriptArgs;
 } else if (typeof arguments != "undefined") {
  arguments_ = arguments;
 }
 if (typeof quit === "function") {
  quit_ = function(status, toThrow) {
   logExceptionOnExit(toThrow);
   quit(status);
  };
 }
 if (typeof print !== "undefined") {
  if (typeof console === "undefined") console = {};
  console.log = print;
  console.warn = console.error = typeof printErr !== "undefined" ? printErr : print;
 }
} else if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) {
 if (ENVIRONMENT_IS_WORKER) {
  scriptDirectory = self.location.href;
 } else if (typeof document !== "undefined" && document.currentScript) {
  scriptDirectory = document.currentScript.src;
 }
 if (_scriptDir) {
  scriptDirectory = _scriptDir;
 }
 if (scriptDirectory.indexOf("blob:") !== 0) {
  scriptDirectory = scriptDirectory.substr(0, scriptDirectory.replace(/[?#].*/, "").lastIndexOf("/") + 1);
 } else {
  scriptDirectory = "";
 }
 if (!(typeof window === "object" || typeof importScripts === "function")) throw new Error("not compiled for this environment (did you build to HTML and try to run it not on the web, or set ENVIRONMENT to something - like node - and run it someplace else - like on the web?)");
 {
  read_ = function(url) {
   var xhr = new XMLHttpRequest();
   xhr.open("GET", url, false);
   xhr.send(null);
   return xhr.responseText;
  };
  if (ENVIRONMENT_IS_WORKER) {
   readBinary = function(url) {
    var xhr = new XMLHttpRequest();
    xhr.open("GET", url, false);
    xhr.responseType = "arraybuffer";
    xhr.send(null);
    return new Uint8Array(xhr.response);
   };
  }
  readAsync = function(url, onload, onerror) {
   var xhr = new XMLHttpRequest();
   xhr.open("GET", url, true);
   xhr.responseType = "arraybuffer";
   xhr.onload = function() {
    if (xhr.status == 200 || xhr.status == 0 && xhr.response) {
     onload(xhr.response);
     return;
    }
    onerror();
   };
   xhr.onerror = onerror;
   xhr.send(null);
  };
 }
 setWindowTitle = function(title) {
  document.title = title;
 };
} else {
 throw new Error("environment detection error");
}

var out = Module["print"] || console.log.bind(console);

var err = Module["printErr"] || console.warn.bind(console);

for (key in moduleOverrides) {
 if (moduleOverrides.hasOwnProperty(key)) {
  Module[key] = moduleOverrides[key];
 }
}

moduleOverrides = null;

if (Module["arguments"]) arguments_ = Module["arguments"];

if (!Object.getOwnPropertyDescriptor(Module, "arguments")) {
 Object.defineProperty(Module, "arguments", {
  configurable: true,
  get: function() {
   abort("Module.arguments has been replaced with plain arguments_ (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)");
  }
 });
}

if (Module["thisProgram"]) thisProgram = Module["thisProgram"];

if (!Object.getOwnPropertyDescriptor(Module, "thisProgram")) {
 Object.defineProperty(Module, "thisProgram", {
  configurable: true,
  get: function() {
   abort("Module.thisProgram has been replaced with plain thisProgram (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)");
  }
 });
}

if (Module["quit"]) quit_ = Module["quit"];

if (!Object.getOwnPropertyDescriptor(Module, "quit")) {
 Object.defineProperty(Module, "quit", {
  configurable: true,
  get: function() {
   abort("Module.quit has been replaced with plain quit_ (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)");
  }
 });
}

assert(typeof Module["memoryInitializerPrefixURL"] === "undefined", "Module.memoryInitializerPrefixURL option was removed, use Module.locateFile instead");

assert(typeof Module["pthreadMainPrefixURL"] === "undefined", "Module.pthreadMainPrefixURL option was removed, use Module.locateFile instead");

assert(typeof Module["cdInitializerPrefixURL"] === "undefined", "Module.cdInitializerPrefixURL option was removed, use Module.locateFile instead");

assert(typeof Module["filePackagePrefixURL"] === "undefined", "Module.filePackagePrefixURL option was removed, use Module.locateFile instead");

assert(typeof Module["read"] === "undefined", "Module.read option was removed (modify read_ in JS)");

assert(typeof Module["readAsync"] === "undefined", "Module.readAsync option was removed (modify readAsync in JS)");

assert(typeof Module["readBinary"] === "undefined", "Module.readBinary option was removed (modify readBinary in JS)");

assert(typeof Module["setWindowTitle"] === "undefined", "Module.setWindowTitle option was removed (modify setWindowTitle in JS)");

assert(typeof Module["TOTAL_MEMORY"] === "undefined", "Module.TOTAL_MEMORY has been renamed Module.INITIAL_MEMORY");

if (!Object.getOwnPropertyDescriptor(Module, "read")) {
 Object.defineProperty(Module, "read", {
  configurable: true,
  get: function() {
   abort("Module.read has been replaced with plain read_ (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module, "readAsync")) {
 Object.defineProperty(Module, "readAsync", {
  configurable: true,
  get: function() {
   abort("Module.readAsync has been replaced with plain readAsync (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module, "readBinary")) {
 Object.defineProperty(Module, "readBinary", {
  configurable: true,
  get: function() {
   abort("Module.readBinary has been replaced with plain readBinary (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)");
  }
 });
}

if (!Object.getOwnPropertyDescriptor(Module, "setWindowTitle")) {
 Object.defineProperty(Module, "setWindowTitle", {
  configurable: true,
  get: function() {
   abort("Module.setWindowTitle has been replaced with plain setWindowTitle (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)");
  }
 });
}

var IDBFS = "IDBFS is no longer included by default; build with -lidbfs.js";

var PROXYFS = "PROXYFS is no longer included by default; build with -lproxyfs.js";

var WORKERFS = "WORKERFS is no longer included by default; build with -lworkerfs.js";

var NODEFS = "NODEFS is no longer included by default; build with -lnodefs.js";

assert(!ENVIRONMENT_IS_WORKER, "worker environment detected but not enabled at build time.  Add 'worker' to `-s ENVIRONMENT` to enable.");

assert(!ENVIRONMENT_IS_NODE, "node environment detected but not enabled at build time.  Add 'node' to `-s ENVIRONMENT` to enable.");

assert(!ENVIRONMENT_IS_SHELL, "shell environment detected but not enabled at build time.  Add 'shell' to `-s ENVIRONMENT` to enable.");

var STACK_ALIGN = 16;

var POINTER_SIZE = 4;

function getNativeTypeSize(type) {
 switch (type) {
 case "i1":
 case "i8":
  return 1;

 case "i16":
  return 2;

 case "i32":
  return 4;

 case "i64":
  return 8;

 case "float":
  return 4;

 case "double":
  return 8;

 default:
  {
   if (type[type.length - 1] === "*") {
    return POINTER_SIZE;
   } else if (type[0] === "i") {
    var bits = Number(type.substr(1));
    assert(bits % 8 === 0, "getNativeTypeSize invalid bits " + bits + ", type " + type);
    return bits / 8;
   } else {
    return 0;
   }
  }
 }
}

function warnOnce(text) {
 if (!warnOnce.shown) warnOnce.shown = {};
 if (!warnOnce.shown[text]) {
  warnOnce.shown[text] = 1;
  err(text);
 }
}

function convertJsFunctionToWasm(func, sig) {
 if (typeof WebAssembly.Function === "function") {
  var typeNames = {
   "i": "i32",
   "j": "i64",
   "f": "f32",
   "d": "f64"
  };
  var type = {
   parameters: [],
   results: sig[0] == "v" ? [] : [ typeNames[sig[0]] ]
  };
  for (var i = 1; i < sig.length; ++i) {
   type.parameters.push(typeNames[sig[i]]);
  }
  return new WebAssembly.Function(type, func);
 }
 var typeSection = [ 1, 0, 1, 96 ];
 var sigRet = sig.slice(0, 1);
 var sigParam = sig.slice(1);
 var typeCodes = {
  "i": 127,
  "j": 126,
  "f": 125,
  "d": 124
 };
 typeSection.push(sigParam.length);
 for (var i = 0; i < sigParam.length; ++i) {
  typeSection.push(typeCodes[sigParam[i]]);
 }
 if (sigRet == "v") {
  typeSection.push(0);
 } else {
  typeSection = typeSection.concat([ 1, typeCodes[sigRet] ]);
 }
 typeSection[1] = typeSection.length - 2;
 var bytes = new Uint8Array([ 0, 97, 115, 109, 1, 0, 0, 0 ].concat(typeSection, [ 2, 7, 1, 1, 101, 1, 102, 0, 0, 7, 5, 1, 1, 102, 0, 0 ]));
 var module = new WebAssembly.Module(bytes);
 var instance = new WebAssembly.Instance(module, {
  "e": {
   "f": func
  }
 });
 var wrappedFunc = instance.exports["f"];
 return wrappedFunc;
}

var freeTableIndexes = [];

var functionsInTableMap;

function getEmptyTableSlot() {
 if (freeTableIndexes.length) {
  return freeTableIndexes.pop();
 }
 try {
  wasmTable.grow(1);
 } catch (err) {
  if (!(err instanceof RangeError)) {
   throw err;
  }
  throw "Unable to grow wasm table. Set ALLOW_TABLE_GROWTH.";
 }
 return wasmTable.length - 1;
}

function updateTableMap(offset, count) {
 for (var i = offset; i < offset + count; i++) {
  var item = getWasmTableEntry(i);
  if (item) {
   functionsInTableMap.set(item, i);
  }
 }
}

function addFunction(func, sig) {
 assert(typeof func !== "undefined");
 if (!functionsInTableMap) {
  functionsInTableMap = new WeakMap();
  updateTableMap(0, wasmTable.length);
 }
 if (functionsInTableMap.has(func)) {
  return functionsInTableMap.get(func);
 }
 for (var i = 0; i < wasmTable.length; i++) {
  assert(getWasmTableEntry(i) != func, "function in Table but not functionsInTableMap");
 }
 var ret = getEmptyTableSlot();
 try {
  setWasmTableEntry(ret, func);
 } catch (err) {
  if (!(err instanceof TypeError)) {
   throw err;
  }
  assert(typeof sig !== "undefined", "Missing signature argument to addFunction: " + func);
  var wrapped = convertJsFunctionToWasm(func, sig);
  setWasmTableEntry(ret, wrapped);
 }
 functionsInTableMap.set(func, ret);
 return ret;
}

function removeFunction(index) {
 functionsInTableMap.delete(getWasmTableEntry(index));
 freeTableIndexes.push(index);
}

var tempRet0 = 0;

var setTempRet0 = function(value) {
 tempRet0 = value;
};

var getTempRet0 = function() {
 return tempRet0;
};

var wasmBinary;

if (Module["wasmBinary"]) wasmBinary = Module["wasmBinary"];

if (!Object.getOwnPropertyDescriptor(Module, "wasmBinary")) {
 Object.defineProperty(Module, "wasmBinary", {
  configurable: true,
  get: function() {
   abort("Module.wasmBinary has been replaced with plain wasmBinary (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)");
  }
 });
}

var noExitRuntime = Module["noExitRuntime"] || true;

if (!Object.getOwnPropertyDescriptor(Module, "noExitRuntime")) {
 Object.defineProperty(Module, "noExitRuntime", {
  configurable: true,
  get: function() {
   abort("Module.noExitRuntime has been replaced with plain noExitRuntime (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)");
  }
 });
}

if (typeof WebAssembly !== "object") {
 abort("no native wasm support detected");
}

function setValue(ptr, value, type, noSafe) {
 type = type || "i8";
 if (type.charAt(type.length - 1) === "*") type = "i32";
 if (noSafe) {
  switch (type) {
  case "i1":
   HEAP8[ptr >> 0] = value;
   break;

  case "i8":
   HEAP8[ptr >> 0] = value;
   break;

  case "i16":
   HEAP16[ptr >> 1] = value;
   break;

  case "i32":
   HEAP32[ptr >> 2] = value;
   break;

  case "i64":
   HEAP64[ptr >> 3] = BigInt(value);
   break;

  case "float":
   HEAPF32[ptr >> 2] = value;
   break;

  case "double":
   HEAPF64[ptr >> 3] = value;
   break;

  default:
   abort("invalid type for setValue: " + type);
  }
 } else {
  switch (type) {
  case "i1":
   SAFE_HEAP_STORE(ptr | 0, value | 0, 1);
   break;

  case "i8":
   SAFE_HEAP_STORE(ptr | 0, value | 0, 1);
   break;

  case "i16":
   SAFE_HEAP_STORE(ptr | 0, value | 0, 2);
   break;

  case "i32":
   SAFE_HEAP_STORE(ptr | 0, value | 0, 4);
   break;

  case "i64":
   SAFE_HEAP_STORE(ptr | 0, value | 0, 8);
   break;

  case "float":
   SAFE_HEAP_STORE_D(ptr | 0, Math.fround(value), 4);
   break;

  case "double":
   SAFE_HEAP_STORE_D(ptr | 0, +value, 8);
   break;

  default:
   abort("invalid type for setValue: " + type);
  }
 }
}

function getValue(ptr, type, noSafe) {
 type = type || "i8";
 if (type.charAt(type.length - 1) === "*") type = "i32";
 if (noSafe) {
  switch (type) {
  case "i1":
   return HEAP8[ptr >> 0];

  case "i8":
   return HEAP8[ptr >> 0];

  case "i16":
   return HEAP16[ptr >> 1];

  case "i32":
   return HEAP32[ptr >> 2];

  case "i64":
   return Number(HEAP64[ptr >> 3]);

  case "float":
   return HEAPF32[ptr >> 2];

  case "double":
   return Number(HEAPF64[ptr >> 3]);

  default:
   abort("invalid type for getValue: " + type);
  }
 } else {
  switch (type) {
  case "i1":
   return SAFE_HEAP_LOAD(ptr | 0, 1, 0) | 0;

  case "i8":
   return SAFE_HEAP_LOAD(ptr | 0, 1, 0) | 0;

  case "i16":
   return SAFE_HEAP_LOAD(ptr | 0, 2, 0) | 0;

  case "i32":
   return SAFE_HEAP_LOAD(ptr | 0, 4, 0) | 0;

  case "i64":
   return SAFE_HEAP_LOAD(ptr | 0, 8, 0) | 0;

  case "float":
   return Math.fround(SAFE_HEAP_LOAD_D(ptr | 0, 4, 0));

  case "double":
   return +SAFE_HEAP_LOAD_D(ptr | 0, 8, 0);

  default:
   abort("invalid type for getValue: " + type);
  }
 }
 return null;
}

function getSafeHeapType(bytes, isFloat) {
 switch (bytes) {
 case 1:
  return "i8";

 case 2:
  return "i16";

 case 4:
  return isFloat ? "float" : "i32";

 case 8:
  return isFloat ? "double" : "i64";

 default:
  assert(0);
 }
}

function SAFE_HEAP_STORE(dest, value, bytes, isFloat) {
 if (dest <= 0) abort("segmentation fault storing " + bytes + " bytes to address " + dest);
 if (dest % bytes !== 0) abort("alignment error storing to address " + dest + ", which was expected to be aligned to a multiple of " + bytes);
 if (runtimeInitialized) {
  var brk = _sbrk() >>> 0;
  if (dest + bytes > brk) abort("segmentation fault, exceeded the top of the available dynamic heap when storing " + bytes + " bytes to address " + dest + ". DYNAMICTOP=" + brk);
  assert(brk >= _emscripten_stack_get_base());
  assert(brk <= HEAP8.length);
 }
 setValue(dest, value, getSafeHeapType(bytes, isFloat), 1);
 return value;
}

function SAFE_HEAP_STORE_D(dest, value, bytes) {
 return SAFE_HEAP_STORE(dest, value, bytes, true);
}

function SAFE_HEAP_LOAD(dest, bytes, unsigned, isFloat) {
 if (dest <= 0) abort("segmentation fault loading " + bytes + " bytes from address " + dest);
 if (dest % bytes !== 0) abort("alignment error loading from address " + dest + ", which was expected to be aligned to a multiple of " + bytes);
 if (runtimeInitialized) {
  var brk = _sbrk() >>> 0;
  if (dest + bytes > brk) abort("segmentation fault, exceeded the top of the available dynamic heap when loading " + bytes + " bytes from address " + dest + ". DYNAMICTOP=" + brk);
  assert(brk >= _emscripten_stack_get_base());
  assert(brk <= HEAP8.length);
 }
 var type = getSafeHeapType(bytes, isFloat);
 var ret = getValue(dest, type, 1);
 if (unsigned) ret = unSign(ret, parseInt(type.substr(1), 10));
 return ret;
}

function SAFE_HEAP_LOAD_D(dest, bytes, unsigned) {
 return SAFE_HEAP_LOAD(dest, bytes, unsigned, true);
}

function SAFE_FT_MASK(value, mask) {
 var ret = value & mask;
 if (ret !== value) {
  abort("Function table mask error: function pointer is " + value + " which is masked by " + mask + ", the likely cause of this is that the function pointer is being called by the wrong type.");
 }
 return ret;
}

function segfault() {
 abort("segmentation fault");
}

function alignfault() {
 abort("alignment fault");
}

var wasmMemory;

var ABORT = false;

var EXITSTATUS;

function assert(condition, text) {
 if (!condition) {
  abort("Assertion failed: " + text);
 }
}

function getCFunc(ident) {
 var func = Module["_" + ident];
 assert(func, "Cannot call unknown function " + ident + ", make sure it is exported");
 return func;
}

function ccall(ident, returnType, argTypes, args, opts) {
 var toC = {
  "string": function(str) {
   var ret = 0;
   if (str !== null && str !== undefined && str !== 0) {
    var len = (str.length << 2) + 1;
    ret = stackAlloc(len);
    stringToUTF8(str, ret, len);
   }
   return ret;
  },
  "array": function(arr) {
   var ret = stackAlloc(arr.length);
   writeArrayToMemory(arr, ret);
   return ret;
  }
 };
 function convertReturnValue(ret) {
  if (returnType === "string") return UTF8ToString(ret);
  if (returnType === "boolean") return Boolean(ret);
  return ret;
 }
 var func = getCFunc(ident);
 var cArgs = [];
 var stack = 0;
 assert(returnType !== "array", 'Return type should not be "array".');
 if (args) {
  for (var i = 0; i < args.length; i++) {
   var converter = toC[argTypes[i]];
   if (converter) {
    if (stack === 0) stack = stackSave();
    cArgs[i] = converter(args[i]);
   } else {
    cArgs[i] = args[i];
   }
  }
 }
 var ret = func.apply(null, cArgs);
 function onDone(ret) {
  if (stack !== 0) stackRestore(stack);
  return convertReturnValue(ret);
 }
 ret = onDone(ret);
 return ret;
}

function cwrap(ident, returnType, argTypes, opts) {
 return function() {
  return ccall(ident, returnType, argTypes, arguments, opts);
 };
}

var ALLOC_NORMAL = 0;

var ALLOC_STACK = 1;

function allocate(slab, allocator) {
 var ret;
 assert(typeof allocator === "number", "allocate no longer takes a type argument");
 assert(typeof slab !== "number", "allocate no longer takes a number as arg0");
 if (allocator == ALLOC_STACK) {
  ret = stackAlloc(slab.length);
 } else {
  ret = _malloc(slab.length);
 }
 if (slab.subarray || slab.slice) {
  HEAPU8.set(slab, ret);
 } else {
  HEAPU8.set(new Uint8Array(slab), ret);
 }
 return ret;
}

var UTF8Decoder = typeof TextDecoder !== "undefined" ? new TextDecoder("utf8") : undefined;

function UTF8ArrayToString(heap, idx, maxBytesToRead) {
 var endIdx = idx + maxBytesToRead;
 var endPtr = idx;
 while (heap[endPtr] && !(endPtr >= endIdx)) ++endPtr;
 if (endPtr - idx > 16 && heap.subarray && UTF8Decoder) {
  return UTF8Decoder.decode(heap.subarray(idx, endPtr));
 } else {
  var str = "";
  while (idx < endPtr) {
   var u0 = heap[idx++];
   if (!(u0 & 128)) {
    str += String.fromCharCode(u0);
    continue;
   }
   var u1 = heap[idx++] & 63;
   if ((u0 & 224) == 192) {
    str += String.fromCharCode((u0 & 31) << 6 | u1);
    continue;
   }
   var u2 = heap[idx++] & 63;
   if ((u0 & 240) == 224) {
    u0 = (u0 & 15) << 12 | u1 << 6 | u2;
   } else {
    if ((u0 & 248) != 240) warnOnce("Invalid UTF-8 leading byte 0x" + u0.toString(16) + " encountered when deserializing a UTF-8 string in wasm memory to a JS string!");
    u0 = (u0 & 7) << 18 | u1 << 12 | u2 << 6 | heap[idx++] & 63;
   }
   if (u0 < 65536) {
    str += String.fromCharCode(u0);
   } else {
    var ch = u0 - 65536;
    str += String.fromCharCode(55296 | ch >> 10, 56320 | ch & 1023);
   }
  }
 }
 return str;
}

function UTF8ToString(ptr, maxBytesToRead) {
 return ptr ? UTF8ArrayToString(HEAPU8, ptr, maxBytesToRead) : "";
}

function stringToUTF8Array(str, heap, outIdx, maxBytesToWrite) {
 if (!(maxBytesToWrite > 0)) return 0;
 var startIdx = outIdx;
 var endIdx = outIdx + maxBytesToWrite - 1;
 for (var i = 0; i < str.length; ++i) {
  var u = str.charCodeAt(i);
  if (u >= 55296 && u <= 57343) {
   var u1 = str.charCodeAt(++i);
   u = 65536 + ((u & 1023) << 10) | u1 & 1023;
  }
  if (u <= 127) {
   if (outIdx >= endIdx) break;
   heap[outIdx++] = u;
  } else if (u <= 2047) {
   if (outIdx + 1 >= endIdx) break;
   heap[outIdx++] = 192 | u >> 6;
   heap[outIdx++] = 128 | u & 63;
  } else if (u <= 65535) {
   if (outIdx + 2 >= endIdx) break;
   heap[outIdx++] = 224 | u >> 12;
   heap[outIdx++] = 128 | u >> 6 & 63;
   heap[outIdx++] = 128 | u & 63;
  } else {
   if (outIdx + 3 >= endIdx) break;
   if (u > 1114111) warnOnce("Invalid Unicode code point 0x" + u.toString(16) + " encountered when serializing a JS string to a UTF-8 string in wasm memory! (Valid unicode code points should be in range 0-0x10FFFF).");
   heap[outIdx++] = 240 | u >> 18;
   heap[outIdx++] = 128 | u >> 12 & 63;
   heap[outIdx++] = 128 | u >> 6 & 63;
   heap[outIdx++] = 128 | u & 63;
  }
 }
 heap[outIdx] = 0;
 return outIdx - startIdx;
}

function stringToUTF8(str, outPtr, maxBytesToWrite) {
 assert(typeof maxBytesToWrite == "number", "stringToUTF8(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!");
 return stringToUTF8Array(str, HEAPU8, outPtr, maxBytesToWrite);
}

function lengthBytesUTF8(str) {
 var len = 0;
 for (var i = 0; i < str.length; ++i) {
  var u = str.charCodeAt(i);
  if (u >= 55296 && u <= 57343) u = 65536 + ((u & 1023) << 10) | str.charCodeAt(++i) & 1023;
  if (u <= 127) ++len; else if (u <= 2047) len += 2; else if (u <= 65535) len += 3; else len += 4;
 }
 return len;
}

function AsciiToString(ptr) {
 var str = "";
 while (1) {
  var ch = SAFE_HEAP_LOAD(ptr++ | 0, 1, 1) >>> 0;
  if (!ch) return str;
  str += String.fromCharCode(ch);
 }
}

function stringToAscii(str, outPtr) {
 return writeAsciiToMemory(str, outPtr, false);
}

var UTF16Decoder = typeof TextDecoder !== "undefined" ? new TextDecoder("utf-16le") : undefined;

function UTF16ToString(ptr, maxBytesToRead) {
 assert(ptr % 2 == 0, "Pointer passed to UTF16ToString must be aligned to two bytes!");
 var endPtr = ptr;
 var idx = endPtr >> 1;
 var maxIdx = idx + maxBytesToRead / 2;
 while (!(idx >= maxIdx) && SAFE_HEAP_LOAD(idx * 2, 2, 1)) ++idx;
 endPtr = idx << 1;
 if (endPtr - ptr > 32 && UTF16Decoder) {
  return UTF16Decoder.decode(HEAPU8.subarray(ptr, endPtr));
 } else {
  var str = "";
  for (var i = 0; !(i >= maxBytesToRead / 2); ++i) {
   var codeUnit = SAFE_HEAP_LOAD(ptr + i * 2 | 0, 2, 0) | 0;
   if (codeUnit == 0) break;
   str += String.fromCharCode(codeUnit);
  }
  return str;
 }
}

function stringToUTF16(str, outPtr, maxBytesToWrite) {
 assert(outPtr % 2 == 0, "Pointer passed to stringToUTF16 must be aligned to two bytes!");
 assert(typeof maxBytesToWrite == "number", "stringToUTF16(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!");
 if (maxBytesToWrite === undefined) {
  maxBytesToWrite = 2147483647;
 }
 if (maxBytesToWrite < 2) return 0;
 maxBytesToWrite -= 2;
 var startPtr = outPtr;
 var numCharsToWrite = maxBytesToWrite < str.length * 2 ? maxBytesToWrite / 2 : str.length;
 for (var i = 0; i < numCharsToWrite; ++i) {
  var codeUnit = str.charCodeAt(i);
  SAFE_HEAP_STORE(outPtr | 0, codeUnit | 0, 2);
  outPtr += 2;
 }
 SAFE_HEAP_STORE(outPtr | 0, 0 | 0, 2);
 return outPtr - startPtr;
}

function lengthBytesUTF16(str) {
 return str.length * 2;
}

function UTF32ToString(ptr, maxBytesToRead) {
 assert(ptr % 4 == 0, "Pointer passed to UTF32ToString must be aligned to four bytes!");
 var i = 0;
 var str = "";
 while (!(i >= maxBytesToRead / 4)) {
  var utf32 = SAFE_HEAP_LOAD(ptr + i * 4 | 0, 4, 0) | 0;
  if (utf32 == 0) break;
  ++i;
  if (utf32 >= 65536) {
   var ch = utf32 - 65536;
   str += String.fromCharCode(55296 | ch >> 10, 56320 | ch & 1023);
  } else {
   str += String.fromCharCode(utf32);
  }
 }
 return str;
}

function stringToUTF32(str, outPtr, maxBytesToWrite) {
 assert(outPtr % 4 == 0, "Pointer passed to stringToUTF32 must be aligned to four bytes!");
 assert(typeof maxBytesToWrite == "number", "stringToUTF32(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!");
 if (maxBytesToWrite === undefined) {
  maxBytesToWrite = 2147483647;
 }
 if (maxBytesToWrite < 4) return 0;
 var startPtr = outPtr;
 var endPtr = startPtr + maxBytesToWrite - 4;
 for (var i = 0; i < str.length; ++i) {
  var codeUnit = str.charCodeAt(i);
  if (codeUnit >= 55296 && codeUnit <= 57343) {
   var trailSurrogate = str.charCodeAt(++i);
   codeUnit = 65536 + ((codeUnit & 1023) << 10) | trailSurrogate & 1023;
  }
  SAFE_HEAP_STORE(outPtr | 0, codeUnit | 0, 4);
  outPtr += 4;
  if (outPtr + 4 > endPtr) break;
 }
 SAFE_HEAP_STORE(outPtr | 0, 0 | 0, 4);
 return outPtr - startPtr;
}

function lengthBytesUTF32(str) {
 var len = 0;
 for (var i = 0; i < str.length; ++i) {
  var codeUnit = str.charCodeAt(i);
  if (codeUnit >= 55296 && codeUnit <= 57343) ++i;
  len += 4;
 }
 return len;
}

function allocateUTF8(str) {
 var size = lengthBytesUTF8(str) + 1;
 var ret = _malloc(size);
 if (ret) stringToUTF8Array(str, HEAP8, ret, size);
 return ret;
}

function allocateUTF8OnStack(str) {
 var size = lengthBytesUTF8(str) + 1;
 var ret = stackAlloc(size);
 stringToUTF8Array(str, HEAP8, ret, size);
 return ret;
}

function writeStringToMemory(string, buffer, dontAddNull) {
 warnOnce("writeStringToMemory is deprecated and should not be called! Use stringToUTF8() instead!");
 var lastChar, end;
 if (dontAddNull) {
  end = buffer + lengthBytesUTF8(string);
  lastChar = SAFE_HEAP_LOAD(end, 1, 0);
 }
 stringToUTF8(string, buffer, Infinity);
 if (dontAddNull) SAFE_HEAP_STORE(end, lastChar, 1);
}

function writeArrayToMemory(array, buffer) {
 assert(array.length >= 0, "writeArrayToMemory array must have a length (should be an array or typed array)");
 HEAP8.set(array, buffer);
}

function writeAsciiToMemory(str, buffer, dontAddNull) {
 for (var i = 0; i < str.length; ++i) {
  assert(str.charCodeAt(i) === (str.charCodeAt(i) & 255));
  SAFE_HEAP_STORE(buffer++ | 0, str.charCodeAt(i) | 0, 1);
 }
 if (!dontAddNull) SAFE_HEAP_STORE(buffer | 0, 0 | 0, 1);
}

function alignUp(x, multiple) {
 if (x % multiple > 0) {
  x += multiple - x % multiple;
 }
 return x;
}

var HEAP, buffer, HEAP8, HEAPU8, HEAP16, HEAPU16, HEAP32, HEAPU32, HEAPF32, HEAPF64;

var HEAP64, HEAPU64;

function updateGlobalBufferAndViews(buf) {
 buffer = buf;
 Module["HEAP8"] = HEAP8 = new Int8Array(buf);
 Module["HEAP16"] = HEAP16 = new Int16Array(buf);
 Module["HEAP32"] = HEAP32 = new Int32Array(buf);
 Module["HEAPU8"] = HEAPU8 = new Uint8Array(buf);
 Module["HEAPU16"] = HEAPU16 = new Uint16Array(buf);
 Module["HEAPU32"] = HEAPU32 = new Uint32Array(buf);
 Module["HEAPF32"] = HEAPF32 = new Float32Array(buf);
 Module["HEAPF64"] = HEAPF64 = new Float64Array(buf);
 Module["HEAP64"] = HEAP64 = new BigInt64Array(buf);
 Module["HEAPU64"] = HEAPU64 = new BigUint64Array(buf);
}

var TOTAL_STACK = 5242880;

if (Module["TOTAL_STACK"]) assert(TOTAL_STACK === Module["TOTAL_STACK"], "the stack size can no longer be determined at runtime");

var INITIAL_MEMORY = Module["INITIAL_MEMORY"] || 134217728;

if (!Object.getOwnPropertyDescriptor(Module, "INITIAL_MEMORY")) {
 Object.defineProperty(Module, "INITIAL_MEMORY", {
  configurable: true,
  get: function() {
   abort("Module.INITIAL_MEMORY has been replaced with plain INITIAL_MEMORY (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)");
  }
 });
}

assert(INITIAL_MEMORY >= TOTAL_STACK, "INITIAL_MEMORY should be larger than TOTAL_STACK, was " + INITIAL_MEMORY + "! (TOTAL_STACK=" + TOTAL_STACK + ")");

assert(typeof Int32Array !== "undefined" && typeof Float64Array !== "undefined" && Int32Array.prototype.subarray !== undefined && Int32Array.prototype.set !== undefined, "JS engine does not provide full typed array support");

assert(!Module["wasmMemory"], "Use of `wasmMemory` detected.  Use -s IMPORTED_MEMORY to define wasmMemory externally");

assert(INITIAL_MEMORY == 134217728, "Detected runtime INITIAL_MEMORY setting.  Use -s IMPORTED_MEMORY to define wasmMemory dynamically");

var wasmTable;

function writeStackCookie() {
 var max = _emscripten_stack_get_end();
 assert((max & 3) == 0);
 SAFE_HEAP_STORE(max + 4 | 0, 34821223 | 0, 4);
 SAFE_HEAP_STORE(max + 8 | 0, 2310721022 | 0, 4);
}

function checkStackCookie() {
 if (ABORT) return;
 var max = _emscripten_stack_get_end();
 var cookie1 = SAFE_HEAP_LOAD(max + 4 | 0, 4, 1) >>> 0;
 var cookie2 = SAFE_HEAP_LOAD(max + 8 | 0, 4, 1) >>> 0;
 if (cookie1 != 34821223 || cookie2 != 2310721022) {
  abort("Stack overflow! Stack cookie has been overwritten, expected hex dwords 0x89BACDFE and 0x2135467, but received 0x" + cookie2.toString(16) + " 0x" + cookie1.toString(16));
 }
}

(function() {
 var h16 = new Int16Array(1);
 var h8 = new Int8Array(h16.buffer);
 h16[0] = 25459;
 if (h8[0] !== 115 || h8[1] !== 99) throw "Runtime error: expected the system to be little-endian! (Run with -s SUPPORT_BIG_ENDIAN=1 to bypass)";
})();

var __ATPRERUN__ = [];

var __ATINIT__ = [];

var __ATEXIT__ = [];

var __ATPOSTRUN__ = [];

var runtimeInitialized = false;

var runtimeExited = false;

var runtimeKeepaliveCounter = 0;

function keepRuntimeAlive() {
 return noExitRuntime || runtimeKeepaliveCounter > 0;
}

function preRun() {
 if (Module["preRun"]) {
  if (typeof Module["preRun"] == "function") Module["preRun"] = [ Module["preRun"] ];
  while (Module["preRun"].length) {
   addOnPreRun(Module["preRun"].shift());
  }
 }
 callRuntimeCallbacks(__ATPRERUN__);
}

function initRuntime() {
 checkStackCookie();
 assert(!runtimeInitialized);
 runtimeInitialized = true;
 ___set_stack_limits(_emscripten_stack_get_base(), _emscripten_stack_get_end());
 if (!Module["noFSInit"] && !FS.init.initialized) FS.init();
 FS.ignorePermissions = false;
 TTY.init();
 SOCKFS.root = FS.mount(SOCKFS, {}, null);
 callRuntimeCallbacks(__ATINIT__);
}

function exitRuntime() {
 checkStackCookie();
 runtimeExited = true;
}

function postRun() {
 checkStackCookie();
 if (Module["postRun"]) {
  if (typeof Module["postRun"] == "function") Module["postRun"] = [ Module["postRun"] ];
  while (Module["postRun"].length) {
   addOnPostRun(Module["postRun"].shift());
  }
 }
 callRuntimeCallbacks(__ATPOSTRUN__);
}

function addOnPreRun(cb) {
 __ATPRERUN__.unshift(cb);
}

function addOnInit(cb) {
 __ATINIT__.unshift(cb);
}

function addOnExit(cb) {}

function addOnPostRun(cb) {
 __ATPOSTRUN__.unshift(cb);
}

assert(Math.imul, "This browser does not support Math.imul(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill");

assert(Math.fround, "This browser does not support Math.fround(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill");

assert(Math.clz32, "This browser does not support Math.clz32(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill");

assert(Math.trunc, "This browser does not support Math.trunc(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill");

var runDependencies = 0;

var runDependencyWatcher = null;

var dependenciesFulfilled = null;

var runDependencyTracking = {};

function getUniqueRunDependency(id) {
 var orig = id;
 while (1) {
  if (!runDependencyTracking[id]) return id;
  id = orig + Math.random();
 }
}

function addRunDependency(id) {
 runDependencies++;
 if (Module["monitorRunDependencies"]) {
  Module["monitorRunDependencies"](runDependencies);
 }
 if (id) {
  assert(!runDependencyTracking[id]);
  runDependencyTracking[id] = 1;
  if (runDependencyWatcher === null && typeof setInterval !== "undefined") {
   runDependencyWatcher = setInterval(function() {
    if (ABORT) {
     clearInterval(runDependencyWatcher);
     runDependencyWatcher = null;
     return;
    }
    var shown = false;
    for (var dep in runDependencyTracking) {
     if (!shown) {
      shown = true;
      err("still waiting on run dependencies:");
     }
     err("dependency: " + dep);
    }
    if (shown) {
     err("(end of list)");
    }
   }, 1e4);
  }
 } else {
  err("warning: run dependency added without ID");
 }
}

function removeRunDependency(id) {
 runDependencies--;
 if (Module["monitorRunDependencies"]) {
  Module["monitorRunDependencies"](runDependencies);
 }
 if (id) {
  assert(runDependencyTracking[id]);
  delete runDependencyTracking[id];
 } else {
  err("warning: run dependency removed without ID");
 }
 if (runDependencies == 0) {
  if (runDependencyWatcher !== null) {
   clearInterval(runDependencyWatcher);
   runDependencyWatcher = null;
  }
  if (dependenciesFulfilled) {
   var callback = dependenciesFulfilled;
   dependenciesFulfilled = null;
   callback();
  }
 }
}

Module["preloadedImages"] = {};

Module["preloadedAudios"] = {};

function abort(what) {
 {
  if (Module["onAbort"]) {
   Module["onAbort"](what);
  }
 }
 what = "Aborted(" + what + ")";
 err(what);
 ABORT = true;
 EXITSTATUS = 1;
 var e = new WebAssembly.RuntimeError(what);
 readyPromiseReject(e);
 throw e;
}

var dataURIPrefix = "data:application/octet-stream;base64,";

function isDataURI(filename) {
 return filename.startsWith(dataURIPrefix);
}

function isFileURI(filename) {
 return filename.startsWith("file://");
}

function createExportWrapper(name, fixedasm) {
 return function() {
  var displayName = name;
  var asm = fixedasm;
  if (!fixedasm) {
   asm = Module["asm"];
  }
  assert(runtimeInitialized, "native function `" + displayName + "` called before runtime initialization");
  assert(!runtimeExited, "native function `" + displayName + "` called after runtime exit (use NO_EXIT_RUNTIME to keep it alive after main() exits)");
  if (!asm[name]) {
   assert(asm[name], "exported native function `" + displayName + "` not found");
  }
  return asm[name].apply(null, arguments);
 };
}

var wasmBinaryFile;

wasmBinaryFile = "fesapi.wasm.wasm";

if (!isDataURI(wasmBinaryFile)) {
 wasmBinaryFile = locateFile(wasmBinaryFile);
}

function getBinary(file) {
 try {
  if (file == wasmBinaryFile && wasmBinary) {
   return new Uint8Array(wasmBinary);
  }
  if (readBinary) {
   return readBinary(file);
  } else {
   throw "both async and sync fetching of the wasm failed";
  }
 } catch (err) {
  abort(err);
 }
}

function getBinaryPromise() {
 if (!wasmBinary && (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER)) {
  if (typeof fetch === "function") {
   return fetch(wasmBinaryFile, {
    credentials: "same-origin"
   }).then(function(response) {
    if (!response["ok"]) {
     throw "failed to load wasm binary file at '" + wasmBinaryFile + "'";
    }
    return response["arrayBuffer"]();
   }).catch(function() {
    return getBinary(wasmBinaryFile);
   });
  }
 }
 return Promise.resolve().then(function() {
  return getBinary(wasmBinaryFile);
 });
}

function createWasm() {
 var info = {
  "env": asmLibraryArg,
  "wasi_snapshot_preview1": asmLibraryArg
 };
 function receiveInstance(instance, module) {
  var exports = instance.exports;
  Module["asm"] = exports;
  wasmMemory = Module["asm"]["memory"];
  assert(wasmMemory, "memory not found in wasm exports");
  updateGlobalBufferAndViews(wasmMemory.buffer);
  wasmTable = Module["asm"]["__indirect_function_table"];
  assert(wasmTable, "table not found in wasm exports");
  addOnInit(Module["asm"]["__wasm_call_ctors"]);
  removeRunDependency("wasm-instantiate");
 }
 addRunDependency("wasm-instantiate");
 var trueModule = Module;
 function receiveInstantiationResult(result) {
  assert(Module === trueModule, "the Module object should not be replaced during async compilation - perhaps the order of HTML elements is wrong?");
  trueModule = null;
  receiveInstance(result["instance"]);
 }
 function instantiateArrayBuffer(receiver) {
  return getBinaryPromise().then(function(binary) {
   return WebAssembly.instantiate(binary, info);
  }).then(function(instance) {
   return instance;
  }).then(receiver, function(reason) {
   err("failed to asynchronously prepare wasm: " + reason);
   if (isFileURI(wasmBinaryFile)) {
    err("warning: Loading from a file URI (" + wasmBinaryFile + ") is not supported in most browsers. See https://emscripten.org/docs/getting_started/FAQ.html#how-do-i-run-a-local-webserver-for-testing-why-does-my-program-stall-in-downloading-or-preparing");
   }
   abort(reason);
  });
 }
 function instantiateAsync() {
  if (!wasmBinary && typeof WebAssembly.instantiateStreaming === "function" && !isDataURI(wasmBinaryFile) && typeof fetch === "function") {
   return fetch(wasmBinaryFile, {
    credentials: "same-origin"
   }).then(function(response) {
    var result = WebAssembly.instantiateStreaming(response, info);
    return result.then(receiveInstantiationResult, function(reason) {
     err("wasm streaming compile failed: " + reason);
     err("falling back to ArrayBuffer instantiation");
     return instantiateArrayBuffer(receiveInstantiationResult);
    });
   });
  } else {
   return instantiateArrayBuffer(receiveInstantiationResult);
  }
 }
 if (Module["instantiateWasm"]) {
  try {
   var exports = Module["instantiateWasm"](info, receiveInstance);
   return exports;
  } catch (e) {
   err("Module.instantiateWasm callback failed with error: " + e);
   return false;
  }
 }
 instantiateAsync().catch(readyPromiseReject);
 return {};
}

var tempDouble;

var tempI64;

var ASM_CONSTS = {};

function callRuntimeCallbacks(callbacks) {
 while (callbacks.length > 0) {
  var callback = callbacks.shift();
  if (typeof callback == "function") {
   callback(Module);
   continue;
  }
  var func = callback.func;
  if (typeof func === "number") {
   if (callback.arg === undefined) {
    getWasmTableEntry(func)();
   } else {
    getWasmTableEntry(func)(callback.arg);
   }
  } else {
   func(callback.arg === undefined ? null : callback.arg);
  }
 }
}

function withStackSave(f) {
 var stack = stackSave();
 var ret = f();
 stackRestore(stack);
 return ret;
}

function demangle(func) {
 demangle.recursionGuard = (demangle.recursionGuard | 0) + 1;
 if (demangle.recursionGuard > 1) return func;
 var __cxa_demangle_func = Module["___cxa_demangle"] || Module["__cxa_demangle"];
 assert(__cxa_demangle_func);
 return withStackSave(function() {
  try {
   var s = func;
   if (s.startsWith("__Z")) s = s.substr(1);
   var len = lengthBytesUTF8(s) + 1;
   var buf = stackAlloc(len);
   stringToUTF8(s, buf, len);
   var status = stackAlloc(4);
   var ret = __cxa_demangle_func(buf, 0, 0, status);
   if ((SAFE_HEAP_LOAD(status | 0, 4, 0) | 0) === 0 && ret) {
    return UTF8ToString(ret);
   }
  } catch (e) {} finally {
   _free(ret);
   if (demangle.recursionGuard < 2) --demangle.recursionGuard;
  }
  return func;
 });
}

function demangleAll(text) {
 var regex = /\b_Z[\w\d_]+/g;
 return text.replace(regex, function(x) {
  var y = demangle(x);
  return x === y ? x : y + " [" + x + "]";
 });
}

function getWasmTableEntry(funcPtr) {
 return wasmTable.get(funcPtr);
}

function handleException(e) {
 if (e instanceof ExitStatus || e == "unwind") {
  return EXITSTATUS;
 }
 quit_(1, e);
}

function jsStackTrace() {
 var error = new Error();
 if (!error.stack) {
  try {
   throw new Error();
  } catch (e) {
   error = e;
  }
  if (!error.stack) {
   return "(no stack trace available)";
  }
 }
 return error.stack.toString();
}

function setWasmTableEntry(idx, func) {
 wasmTable.set(idx, func);
}

function stackTrace() {
 var js = jsStackTrace();
 if (Module["extraStackTrace"]) js += "\n" + Module["extraStackTrace"]();
 return demangleAll(js);
}

function unSign(value, bits) {
 if (value >= 0) {
  return value;
 }
 return bits <= 32 ? 2 * Math.abs(1 << bits - 1) + value : Math.pow(2, bits) + value;
}

function ___assert_fail(condition, filename, line, func) {
 abort("Assertion failed: " + UTF8ToString(condition) + ", at: " + [ filename ? UTF8ToString(filename) : "unknown filename", line, func ? UTF8ToString(func) : "unknown function" ]);
}

function ___cxa_allocate_exception(size) {
 return _malloc(size + 16) + 16;
}

function _atexit(func, arg) {}

function ___cxa_atexit(a0, a1) {
 return _atexit(a0, a1);
}

function ExceptionInfo(excPtr) {
 this.excPtr = excPtr;
 this.ptr = excPtr - 16;
 this.set_type = function(type) {
  SAFE_HEAP_STORE(this.ptr + 4 | 0, type | 0, 4);
 };
 this.get_type = function() {
  return SAFE_HEAP_LOAD(this.ptr + 4 | 0, 4, 0) | 0;
 };
 this.set_destructor = function(destructor) {
  SAFE_HEAP_STORE(this.ptr + 8 | 0, destructor | 0, 4);
 };
 this.get_destructor = function() {
  return SAFE_HEAP_LOAD(this.ptr + 8 | 0, 4, 0) | 0;
 };
 this.set_refcount = function(refcount) {
  SAFE_HEAP_STORE(this.ptr | 0, refcount | 0, 4);
 };
 this.set_caught = function(caught) {
  caught = caught ? 1 : 0;
  SAFE_HEAP_STORE(this.ptr + 12 | 0, caught | 0, 1);
 };
 this.get_caught = function() {
  return (SAFE_HEAP_LOAD(this.ptr + 12 | 0, 1, 0) | 0) != 0;
 };
 this.set_rethrown = function(rethrown) {
  rethrown = rethrown ? 1 : 0;
  SAFE_HEAP_STORE(this.ptr + 13 | 0, rethrown | 0, 1);
 };
 this.get_rethrown = function() {
  return (SAFE_HEAP_LOAD(this.ptr + 13 | 0, 1, 0) | 0) != 0;
 };
 this.init = function(type, destructor) {
  this.set_type(type);
  this.set_destructor(destructor);
  this.set_refcount(0);
  this.set_caught(false);
  this.set_rethrown(false);
 };
 this.add_ref = function() {
  var value = SAFE_HEAP_LOAD(this.ptr | 0, 4, 0) | 0;
  SAFE_HEAP_STORE(this.ptr | 0, value + 1 | 0, 4);
 };
 this.release_ref = function() {
  var prev = SAFE_HEAP_LOAD(this.ptr | 0, 4, 0) | 0;
  SAFE_HEAP_STORE(this.ptr | 0, prev - 1 | 0, 4);
  assert(prev > 0);
  return prev === 1;
 };
}

function CatchInfo(ptr) {
 this.free = function() {
  _free(this.ptr);
  this.ptr = 0;
 };
 this.set_base_ptr = function(basePtr) {
  SAFE_HEAP_STORE(this.ptr | 0, basePtr | 0, 4);
 };
 this.get_base_ptr = function() {
  return SAFE_HEAP_LOAD(this.ptr | 0, 4, 0) | 0;
 };
 this.set_adjusted_ptr = function(adjustedPtr) {
  SAFE_HEAP_STORE(this.ptr + 4 | 0, adjustedPtr | 0, 4);
 };
 this.get_adjusted_ptr_addr = function() {
  return this.ptr + 4;
 };
 this.get_adjusted_ptr = function() {
  return SAFE_HEAP_LOAD(this.ptr + 4 | 0, 4, 0) | 0;
 };
 this.get_exception_ptr = function() {
  var isPointer = ___cxa_is_pointer_type(this.get_exception_info().get_type());
  if (isPointer) {
   return SAFE_HEAP_LOAD(this.get_base_ptr() | 0, 4, 0) | 0;
  }
  var adjusted = this.get_adjusted_ptr();
  if (adjusted !== 0) return adjusted;
  return this.get_base_ptr();
 };
 this.get_exception_info = function() {
  return new ExceptionInfo(this.get_base_ptr());
 };
 if (ptr === undefined) {
  this.ptr = _malloc(8);
  this.set_adjusted_ptr(0);
 } else {
  this.ptr = ptr;
 }
}

var exceptionCaught = [];

function exception_addRef(info) {
 err("addref " + info.excPtr);
 info.add_ref();
}

var uncaughtExceptionCount = 0;

function ___cxa_begin_catch(ptr) {
 var catchInfo = new CatchInfo(ptr);
 var info = catchInfo.get_exception_info();
 if (!info.get_caught()) {
  info.set_caught(true);
  uncaughtExceptionCount--;
 }
 info.set_rethrown(false);
 exceptionCaught.push(catchInfo);
 err("cxa_begin_catch " + [ ptr, "stack", exceptionCaught ]);
 exception_addRef(info);
 return catchInfo.get_exception_ptr();
}

var exceptionLast = 0;

function ___cxa_free_exception(ptr) {
 try {
  return _free(new ExceptionInfo(ptr).ptr);
 } catch (e) {
  err("exception during cxa_free_exception: " + e);
 }
}

function exception_decRef(info) {
 err("decref " + info.excPtr);
 if (info.release_ref() && !info.get_rethrown()) {
  var destructor = info.get_destructor();
  if (destructor) {
   getWasmTableEntry(destructor)(info.excPtr);
  }
  ___cxa_free_exception(info.excPtr);
  err("decref freeing exception " + [ info.excPtr, exceptionLast, "stack", exceptionCaught ]);
 }
}

function ___cxa_end_catch() {
 _setThrew(0);
 assert(exceptionCaught.length > 0);
 var catchInfo = exceptionCaught.pop();
 err("cxa_end_catch popped " + [ catchInfo, exceptionLast, "stack", exceptionCaught ]);
 exception_decRef(catchInfo.get_exception_info());
 catchInfo.free();
 exceptionLast = 0;
}

function ___resumeException(catchInfoPtr) {
 var catchInfo = new CatchInfo(catchInfoPtr);
 var ptr = catchInfo.get_base_ptr();
 out("Resuming exception " + [ ptr, exceptionLast ]);
 if (!exceptionLast) {
  exceptionLast = ptr;
 }
 catchInfo.free();
 throw ptr;
}

function ___cxa_find_matching_catch_2() {
 var thrown = exceptionLast;
 if (!thrown) {
  setTempRet0(0);
  return 0 | 0;
 }
 var info = new ExceptionInfo(thrown);
 var thrownType = info.get_type();
 var catchInfo = new CatchInfo();
 catchInfo.set_base_ptr(thrown);
 catchInfo.set_adjusted_ptr(thrown);
 if (!thrownType) {
  setTempRet0(0);
  return catchInfo.ptr | 0;
 }
 var typeArray = Array.prototype.slice.call(arguments);
 out("can_catch on " + [ thrown ]);
 for (var i = 0; i < typeArray.length; i++) {
  var caughtType = typeArray[i];
  if (caughtType === 0 || caughtType === thrownType) {
   break;
  }
  if (___cxa_can_catch(caughtType, thrownType, catchInfo.get_adjusted_ptr_addr())) {
   out("  can_catch found " + [ catchInfo.get_adjusted_ptr(), caughtType ]);
   setTempRet0(caughtType);
   return catchInfo.ptr | 0;
  }
 }
 setTempRet0(thrownType);
 return catchInfo.ptr | 0;
}

function ___cxa_find_matching_catch_3() {
 var thrown = exceptionLast;
 if (!thrown) {
  setTempRet0(0);
  return 0 | 0;
 }
 var info = new ExceptionInfo(thrown);
 var thrownType = info.get_type();
 var catchInfo = new CatchInfo();
 catchInfo.set_base_ptr(thrown);
 catchInfo.set_adjusted_ptr(thrown);
 if (!thrownType) {
  setTempRet0(0);
  return catchInfo.ptr | 0;
 }
 var typeArray = Array.prototype.slice.call(arguments);
 out("can_catch on " + [ thrown ]);
 for (var i = 0; i < typeArray.length; i++) {
  var caughtType = typeArray[i];
  if (caughtType === 0 || caughtType === thrownType) {
   break;
  }
  if (___cxa_can_catch(caughtType, thrownType, catchInfo.get_adjusted_ptr_addr())) {
   out("  can_catch found " + [ catchInfo.get_adjusted_ptr(), caughtType ]);
   setTempRet0(caughtType);
   return catchInfo.ptr | 0;
  }
 }
 setTempRet0(thrownType);
 return catchInfo.ptr | 0;
}

function ___cxa_rethrow() {
 var catchInfo = exceptionCaught.pop();
 if (!catchInfo) {
  abort("no exception to throw");
 }
 var info = catchInfo.get_exception_info();
 var ptr = catchInfo.get_base_ptr();
 if (!info.get_rethrown()) {
  exceptionCaught.push(catchInfo);
  info.set_rethrown(true);
  info.set_caught(false);
  uncaughtExceptionCount++;
 } else {
  catchInfo.free();
 }
 err("Compiled code RE-throwing an exception, popped " + [ ptr, exceptionLast, "stack", exceptionCaught ]);
 exceptionLast = ptr;
 throw ptr;
}

function ___cxa_throw(ptr, type, destructor) {
 err("Compiled code throwing an exception, " + [ ptr, type, destructor ]);
 var info = new ExceptionInfo(ptr);
 info.init(type, destructor);
 exceptionLast = ptr;
 uncaughtExceptionCount++;
 throw ptr;
}

function ___cxa_uncaught_exceptions() {
 return uncaughtExceptionCount;
}

function _gmtime_r(time, tmPtr) {
 var date = new Date((SAFE_HEAP_LOAD(time | 0, 4, 0) | 0) * 1e3);
 SAFE_HEAP_STORE(tmPtr | 0, date.getUTCSeconds() | 0, 4);
 SAFE_HEAP_STORE(tmPtr + 4 | 0, date.getUTCMinutes() | 0, 4);
 SAFE_HEAP_STORE(tmPtr + 8 | 0, date.getUTCHours() | 0, 4);
 SAFE_HEAP_STORE(tmPtr + 12 | 0, date.getUTCDate() | 0, 4);
 SAFE_HEAP_STORE(tmPtr + 16 | 0, date.getUTCMonth() | 0, 4);
 SAFE_HEAP_STORE(tmPtr + 20 | 0, date.getUTCFullYear() - 1900 | 0, 4);
 SAFE_HEAP_STORE(tmPtr + 24 | 0, date.getUTCDay() | 0, 4);
 SAFE_HEAP_STORE(tmPtr + 36 | 0, 0 | 0, 4);
 SAFE_HEAP_STORE(tmPtr + 32 | 0, 0 | 0, 4);
 var start = Date.UTC(date.getUTCFullYear(), 0, 1, 0, 0, 0, 0);
 var yday = (date.getTime() - start) / (1e3 * 60 * 60 * 24) | 0;
 SAFE_HEAP_STORE(tmPtr + 28 | 0, yday | 0, 4);
 if (!_gmtime_r.GMTString) _gmtime_r.GMTString = allocateUTF8("GMT");
 SAFE_HEAP_STORE(tmPtr + 40 | 0, _gmtime_r.GMTString | 0, 4);
 return tmPtr;
}

function ___gmtime_r(a0, a1) {
 return _gmtime_r(a0, a1);
}

function ___handle_stack_overflow() {
 abort("stack overflow");
}

function _tzset_impl() {
 var currentYear = new Date().getFullYear();
 var winter = new Date(currentYear, 0, 1);
 var summer = new Date(currentYear, 6, 1);
 var winterOffset = winter.getTimezoneOffset();
 var summerOffset = summer.getTimezoneOffset();
 var stdTimezoneOffset = Math.max(winterOffset, summerOffset);
 SAFE_HEAP_STORE(__get_timezone() | 0, stdTimezoneOffset * 60 | 0, 4);
 SAFE_HEAP_STORE(__get_daylight() | 0, Number(winterOffset != summerOffset) | 0, 4);
 function extractZone(date) {
  var match = date.toTimeString().match(/\(([A-Za-z ]+)\)$/);
  return match ? match[1] : "GMT";
 }
 var winterName = extractZone(winter);
 var summerName = extractZone(summer);
 var winterNamePtr = allocateUTF8(winterName);
 var summerNamePtr = allocateUTF8(summerName);
 if (summerOffset < winterOffset) {
  SAFE_HEAP_STORE(__get_tzname() | 0, winterNamePtr | 0, 4);
  SAFE_HEAP_STORE(__get_tzname() + 4 | 0, summerNamePtr | 0, 4);
 } else {
  SAFE_HEAP_STORE(__get_tzname() | 0, summerNamePtr | 0, 4);
  SAFE_HEAP_STORE(__get_tzname() + 4 | 0, winterNamePtr | 0, 4);
 }
}

function _tzset() {
 if (_tzset.called) return;
 _tzset.called = true;
 _tzset_impl();
}

function _localtime_r(time, tmPtr) {
 _tzset();
 var date = new Date((SAFE_HEAP_LOAD(time | 0, 4, 0) | 0) * 1e3);
 SAFE_HEAP_STORE(tmPtr | 0, date.getSeconds() | 0, 4);
 SAFE_HEAP_STORE(tmPtr + 4 | 0, date.getMinutes() | 0, 4);
 SAFE_HEAP_STORE(tmPtr + 8 | 0, date.getHours() | 0, 4);
 SAFE_HEAP_STORE(tmPtr + 12 | 0, date.getDate() | 0, 4);
 SAFE_HEAP_STORE(tmPtr + 16 | 0, date.getMonth() | 0, 4);
 SAFE_HEAP_STORE(tmPtr + 20 | 0, date.getFullYear() - 1900 | 0, 4);
 SAFE_HEAP_STORE(tmPtr + 24 | 0, date.getDay() | 0, 4);
 var start = new Date(date.getFullYear(), 0, 1);
 var yday = (date.getTime() - start.getTime()) / (1e3 * 60 * 60 * 24) | 0;
 SAFE_HEAP_STORE(tmPtr + 28 | 0, yday | 0, 4);
 SAFE_HEAP_STORE(tmPtr + 36 | 0, -(date.getTimezoneOffset() * 60) | 0, 4);
 var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset();
 var winterOffset = start.getTimezoneOffset();
 var dst = (summerOffset != winterOffset && date.getTimezoneOffset() == Math.min(winterOffset, summerOffset)) | 0;
 SAFE_HEAP_STORE(tmPtr + 32 | 0, dst | 0, 4);
 var zonePtr = SAFE_HEAP_LOAD(__get_tzname() + (dst ? 4 : 0) | 0, 4, 0) | 0;
 SAFE_HEAP_STORE(tmPtr + 40 | 0, zonePtr | 0, 4);
 return tmPtr;
}

function ___localtime_r(a0, a1) {
 return _localtime_r(a0, a1);
}

var PATH = {
 splitPath: function(filename) {
  var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
  return splitPathRe.exec(filename).slice(1);
 },
 normalizeArray: function(parts, allowAboveRoot) {
  var up = 0;
  for (var i = parts.length - 1; i >= 0; i--) {
   var last = parts[i];
   if (last === ".") {
    parts.splice(i, 1);
   } else if (last === "..") {
    parts.splice(i, 1);
    up++;
   } else if (up) {
    parts.splice(i, 1);
    up--;
   }
  }
  if (allowAboveRoot) {
   for (;up; up--) {
    parts.unshift("..");
   }
  }
  return parts;
 },
 normalize: function(path) {
  var isAbsolute = path.charAt(0) === "/", trailingSlash = path.substr(-1) === "/";
  path = PATH.normalizeArray(path.split("/").filter(function(p) {
   return !!p;
  }), !isAbsolute).join("/");
  if (!path && !isAbsolute) {
   path = ".";
  }
  if (path && trailingSlash) {
   path += "/";
  }
  return (isAbsolute ? "/" : "") + path;
 },
 dirname: function(path) {
  var result = PATH.splitPath(path), root = result[0], dir = result[1];
  if (!root && !dir) {
   return ".";
  }
  if (dir) {
   dir = dir.substr(0, dir.length - 1);
  }
  return root + dir;
 },
 basename: function(path) {
  if (path === "/") return "/";
  path = PATH.normalize(path);
  path = path.replace(/\/$/, "");
  var lastSlash = path.lastIndexOf("/");
  if (lastSlash === -1) return path;
  return path.substr(lastSlash + 1);
 },
 extname: function(path) {
  return PATH.splitPath(path)[3];
 },
 join: function() {
  var paths = Array.prototype.slice.call(arguments, 0);
  return PATH.normalize(paths.join("/"));
 },
 join2: function(l, r) {
  return PATH.normalize(l + "/" + r);
 }
};

function getRandomDevice() {
 if (typeof crypto === "object" && typeof crypto["getRandomValues"] === "function") {
  var randomBuffer = new Uint8Array(1);
  return function() {
   crypto.getRandomValues(randomBuffer);
   return randomBuffer[0];
  };
 } else return function() {
  abort("no cryptographic support found for randomDevice. consider polyfilling it if you want to use something insecure like Math.random(), e.g. put this in a --pre-js: var crypto = { getRandomValues: function(array) { for (var i = 0; i < array.length; i++) array[i] = (Math.random()*256)|0 } };");
 };
}

var PATH_FS = {
 resolve: function() {
  var resolvedPath = "", resolvedAbsolute = false;
  for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) {
   var path = i >= 0 ? arguments[i] : FS.cwd();
   if (typeof path !== "string") {
    throw new TypeError("Arguments to path.resolve must be strings");
   } else if (!path) {
    return "";
   }
   resolvedPath = path + "/" + resolvedPath;
   resolvedAbsolute = path.charAt(0) === "/";
  }
  resolvedPath = PATH.normalizeArray(resolvedPath.split("/").filter(function(p) {
   return !!p;
  }), !resolvedAbsolute).join("/");
  return (resolvedAbsolute ? "/" : "") + resolvedPath || ".";
 },
 relative: function(from, to) {
  from = PATH_FS.resolve(from).substr(1);
  to = PATH_FS.resolve(to).substr(1);
  function trim(arr) {
   var start = 0;
   for (;start < arr.length; start++) {
    if (arr[start] !== "") break;
   }
   var end = arr.length - 1;
   for (;end >= 0; end--) {
    if (arr[end] !== "") break;
   }
   if (start > end) return [];
   return arr.slice(start, end - start + 1);
  }
  var fromParts = trim(from.split("/"));
  var toParts = trim(to.split("/"));
  var length = Math.min(fromParts.length, toParts.length);
  var samePartsLength = length;
  for (var i = 0; i < length; i++) {
   if (fromParts[i] !== toParts[i]) {
    samePartsLength = i;
    break;
   }
  }
  var outputParts = [];
  for (var i = samePartsLength; i < fromParts.length; i++) {
   outputParts.push("..");
  }
  outputParts = outputParts.concat(toParts.slice(samePartsLength));
  return outputParts.join("/");
 }
};

var TTY = {
 ttys: [],
 init: function() {},
 shutdown: function() {},
 register: function(dev, ops) {
  TTY.ttys[dev] = {
   input: [],
   output: [],
   ops: ops
  };
  FS.registerDevice(dev, TTY.stream_ops);
 },
 stream_ops: {
  open: function(stream) {
   var tty = TTY.ttys[stream.node.rdev];
   if (!tty) {
    throw new FS.ErrnoError(43);
   }
   stream.tty = tty;
   stream.seekable = false;
  },
  close: function(stream) {
   stream.tty.ops.flush(stream.tty);
  },
  flush: function(stream) {
   stream.tty.ops.flush(stream.tty);
  },
  read: function(stream, buffer, offset, length, pos) {
   if (!stream.tty || !stream.tty.ops.get_char) {
    throw new FS.ErrnoError(60);
   }
   var bytesRead = 0;
   for (var i = 0; i < length; i++) {
    var result;
    try {
     result = stream.tty.ops.get_char(stream.tty);
    } catch (e) {
     throw new FS.ErrnoError(29);
    }
    if (result === undefined && bytesRead === 0) {
     throw new FS.ErrnoError(6);
    }
    if (result === null || result === undefined) break;
    bytesRead++;
    buffer[offset + i] = result;
   }
   if (bytesRead) {
    stream.node.timestamp = Date.now();
   }
   return bytesRead;
  },
  write: function(stream, buffer, offset, length, pos) {
   if (!stream.tty || !stream.tty.ops.put_char) {
    throw new FS.ErrnoError(60);
   }
   try {
    for (var i = 0; i < length; i++) {
     stream.tty.ops.put_char(stream.tty, buffer[offset + i]);
    }
   } catch (e) {
    throw new FS.ErrnoError(29);
   }
   if (length) {
    stream.node.timestamp = Date.now();
   }
   return i;
  }
 },
 default_tty_ops: {
  get_char: function(tty) {
   if (!tty.input.length) {
    var result = null;
    if (typeof window != "undefined" && typeof window.prompt == "function") {
     result = window.prompt("Input: ");
     if (result !== null) {
      result += "\n";
     }
    } else if (typeof readline == "function") {
     result = readline();
     if (result !== null) {
      result += "\n";
     }
    }
    if (!result) {
     return null;
    }
    tty.input = intArrayFromString(result, true);
   }
   return tty.input.shift();
  },
  put_char: function(tty, val) {
   if (val === null || val === 10) {
    out(UTF8ArrayToString(tty.output, 0));
    tty.output = [];
   } else {
    if (val != 0) tty.output.push(val);
   }
  },
  flush: function(tty) {
   if (tty.output && tty.output.length > 0) {
    out(UTF8ArrayToString(tty.output, 0));
    tty.output = [];
   }
  }
 },
 default_tty1_ops: {
  put_char: function(tty, val) {
   if (val === null || val === 10) {
    err(UTF8ArrayToString(tty.output, 0));
    tty.output = [];
   } else {
    if (val != 0) tty.output.push(val);
   }
  },
  flush: function(tty) {
   if (tty.output && tty.output.length > 0) {
    err(UTF8ArrayToString(tty.output, 0));
    tty.output = [];
   }
  }
 }
};

function zeroMemory(address, size) {
 HEAPU8.fill(0, address, address + size);
}

function alignMemory(size, alignment) {
 assert(alignment, "alignment argument is required");
 return Math.ceil(size / alignment) * alignment;
}

function mmapAlloc(size) {
 abort("internal error: mmapAlloc called but `memalign` native symbol not exported");
}

var MEMFS = {
 ops_table: null,
 mount: function(mount) {
  return MEMFS.createNode(null, "/", 16384 | 511, 0);
 },
 createNode: function(parent, name, mode, dev) {
  if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
   throw new FS.ErrnoError(63);
  }
  if (!MEMFS.ops_table) {
   MEMFS.ops_table = {
    dir: {
     node: {
      getattr: MEMFS.node_ops.getattr,
      setattr: MEMFS.node_ops.setattr,
      lookup: MEMFS.node_ops.lookup,
      mknod: MEMFS.node_ops.mknod,
      rename: MEMFS.node_ops.rename,
      unlink: MEMFS.node_ops.unlink,
      rmdir: MEMFS.node_ops.rmdir,
      readdir: MEMFS.node_ops.readdir,
      symlink: MEMFS.node_ops.symlink
     },
     stream: {
      llseek: MEMFS.stream_ops.llseek
     }
    },
    file: {
     node: {
      getattr: MEMFS.node_ops.getattr,
      setattr: MEMFS.node_ops.setattr
     },
     stream: {
      llseek: MEMFS.stream_ops.llseek,
      read: MEMFS.stream_ops.read,
      write: MEMFS.stream_ops.write,
      allocate: MEMFS.stream_ops.allocate,
      mmap: MEMFS.stream_ops.mmap,
      msync: MEMFS.stream_ops.msync
     }
    },
    link: {
     node: {
      getattr: MEMFS.node_ops.getattr,
      setattr: MEMFS.node_ops.setattr,
      readlink: MEMFS.node_ops.readlink
     },
     stream: {}
    },
    chrdev: {
     node: {
      getattr: MEMFS.node_ops.getattr,
      setattr: MEMFS.node_ops.setattr
     },
     stream: FS.chrdev_stream_ops
    }
   };
  }
  var node = FS.createNode(parent, name, mode, dev);
  if (FS.isDir(node.mode)) {
   node.node_ops = MEMFS.ops_table.dir.node;
   node.stream_ops = MEMFS.ops_table.dir.stream;
   node.contents = {};
  } else if (FS.isFile(node.mode)) {
   node.node_ops = MEMFS.ops_table.file.node;
   node.stream_ops = MEMFS.ops_table.file.stream;
   node.usedBytes = 0;
   node.contents = null;
  } else if (FS.isLink(node.mode)) {
   node.node_ops = MEMFS.ops_table.link.node;
   node.stream_ops = MEMFS.ops_table.link.stream;
  } else if (FS.isChrdev(node.mode)) {
   node.node_ops = MEMFS.ops_table.chrdev.node;
   node.stream_ops = MEMFS.ops_table.chrdev.stream;
  }
  node.timestamp = Date.now();
  if (parent) {
   parent.contents[name] = node;
   parent.timestamp = node.timestamp;
  }
  return node;
 },
 getFileDataAsTypedArray: function(node) {
  if (!node.contents) return new Uint8Array(0);
  if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes);
  return new Uint8Array(node.contents);
 },
 expandFileStorage: function(node, newCapacity) {
  var prevCapacity = node.contents ? node.contents.length : 0;
  if (prevCapacity >= newCapacity) return;
  var CAPACITY_DOUBLING_MAX = 1024 * 1024;
  newCapacity = Math.max(newCapacity, prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2 : 1.125) >>> 0);
  if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256);
  var oldContents = node.contents;
  node.contents = new Uint8Array(newCapacity);
  if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0);
 },
 resizeFileStorage: function(node, newSize) {
  if (node.usedBytes == newSize) return;
  if (newSize == 0) {
   node.contents = null;
   node.usedBytes = 0;
  } else {
   var oldContents = node.contents;
   node.contents = new Uint8Array(newSize);
   if (oldContents) {
    node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes)));
   }
   node.usedBytes = newSize;
  }
 },
 node_ops: {
  getattr: function(node) {
   var attr = {};
   attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
   attr.ino = node.id;
   attr.mode = node.mode;
   attr.nlink = 1;
   attr.uid = 0;
   attr.gid = 0;
   attr.rdev = node.rdev;
   if (FS.isDir(node.mode)) {
    attr.size = 4096;
   } else if (FS.isFile(node.mode)) {
    attr.size = node.usedBytes;
   } else if (FS.isLink(node.mode)) {
    attr.size = node.link.length;
   } else {
    attr.size = 0;
   }
   attr.atime = new Date(node.timestamp);
   attr.mtime = new Date(node.timestamp);
   attr.ctime = new Date(node.timestamp);
   attr.blksize = 4096;
   attr.blocks = Math.ceil(attr.size / attr.blksize);
   return attr;
  },
  setattr: function(node, attr) {
   if (attr.mode !== undefined) {
    node.mode = attr.mode;
   }
   if (attr.timestamp !== undefined) {
    node.timestamp = attr.timestamp;
   }
   if (attr.size !== undefined) {
    MEMFS.resizeFileStorage(node, attr.size);
   }
  },
  lookup: function(parent, name) {
   throw FS.genericErrors[44];
  },
  mknod: function(parent, name, mode, dev) {
   return MEMFS.createNode(parent, name, mode, dev);
  },
  rename: function(old_node, new_dir, new_name) {
   if (FS.isDir(old_node.mode)) {
    var new_node;
    try {
     new_node = FS.lookupNode(new_dir, new_name);
    } catch (e) {}
    if (new_node) {
     for (var i in new_node.contents) {
      throw new FS.ErrnoError(55);
     }
    }
   }
   delete old_node.parent.contents[old_node.name];
   old_node.parent.timestamp = Date.now();
   old_node.name = new_name;
   new_dir.contents[new_name] = old_node;
   new_dir.timestamp = old_node.parent.timestamp;
   old_node.parent = new_dir;
  },
  unlink: function(parent, name) {
   delete parent.contents[name];
   parent.timestamp = Date.now();
  },
  rmdir: function(parent, name) {
   var node = FS.lookupNode(parent, name);
   for (var i in node.contents) {
    throw new FS.ErrnoError(55);
   }
   delete parent.contents[name];
   parent.timestamp = Date.now();
  },
  readdir: function(node) {
   var entries = [ ".", ".." ];
   for (var key in node.contents) {
    if (!node.contents.hasOwnProperty(key)) {
     continue;
    }
    entries.push(key);
   }
   return entries;
  },
  symlink: function(parent, newname, oldpath) {
   var node = MEMFS.createNode(parent, newname, 511 | 40960, 0);
   node.link = oldpath;
   return node;
  },
  readlink: function(node) {
   if (!FS.isLink(node.mode)) {
    throw new FS.ErrnoError(28);
   }
   return node.link;
  }
 },
 stream_ops: {
  read: function(stream, buffer, offset, length, position) {
   var contents = stream.node.contents;
   if (position >= stream.node.usedBytes) return 0;
   var size = Math.min(stream.node.usedBytes - position, length);
   assert(size >= 0);
   if (size > 8 && contents.subarray) {
    buffer.set(contents.subarray(position, position + size), offset);
   } else {
    for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i];
   }
   return size;
  },
  write: function(stream, buffer, offset, length, position, canOwn) {
   assert(!(buffer instanceof ArrayBuffer));
   if (!length) return 0;
   var node = stream.node;
   node.timestamp = Date.now();
   if (buffer.subarray && (!node.contents || node.contents.subarray)) {
    if (canOwn) {
     assert(position === 0, "canOwn must imply no weird position inside the file");
     node.contents = buffer.subarray(offset, offset + length);
     node.usedBytes = length;
     return length;
    } else if (node.usedBytes === 0 && position === 0) {
     node.contents = buffer.slice(offset, offset + length);
     node.usedBytes = length;
     return length;
    } else if (position + length <= node.usedBytes) {
     node.contents.set(buffer.subarray(offset, offset + length), position);
     return length;
    }
   }
   MEMFS.expandFileStorage(node, position + length);
   if (node.contents.subarray && buffer.subarray) {
    node.contents.set(buffer.subarray(offset, offset + length), position);
   } else {
    for (var i = 0; i < length; i++) {
     node.contents[position + i] = buffer[offset + i];
    }
   }
   node.usedBytes = Math.max(node.usedBytes, position + length);
   return length;
  },
  llseek: function(stream, offset, whence) {
   var position = offset;
   if (whence === 1) {
    position += stream.position;
   } else if (whence === 2) {
    if (FS.isFile(stream.node.mode)) {
     position += stream.node.usedBytes;
    }
   }
   if (position < 0) {
    throw new FS.ErrnoError(28);
   }
   return position;
  },
  allocate: function(stream, offset, length) {
   MEMFS.expandFileStorage(stream.node, offset + length);
   stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length);
  },
  mmap: function(stream, address, length, position, prot, flags) {
   if (address !== 0) {
    throw new FS.ErrnoError(28);
   }
   if (!FS.isFile(stream.node.mode)) {
    throw new FS.ErrnoError(43);
   }
   var ptr;
   var allocated;
   var contents = stream.node.contents;
   if (!(flags & 2) && contents.buffer === buffer) {
    allocated = false;
    ptr = contents.byteOffset;
   } else {
    if (position > 0 || position + length < contents.length) {
     if (contents.subarray) {
      contents = contents.subarray(position, position + length);
     } else {
      contents = Array.prototype.slice.call(contents, position, position + length);
     }
    }
    allocated = true;
    ptr = mmapAlloc(length);
    if (!ptr) {
     throw new FS.ErrnoError(48);
    }
    HEAP8.set(contents, ptr);
   }
   return {
    ptr: ptr,
    allocated: allocated
   };
  },
  msync: function(stream, buffer, offset, length, mmapFlags) {
   if (!FS.isFile(stream.node.mode)) {
    throw new FS.ErrnoError(43);
   }
   if (mmapFlags & 2) {
    return 0;
   }
   var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
   return 0;
  }
 }
};

function asyncLoad(url, onload, onerror, noRunDep) {
 var dep = !noRunDep ? getUniqueRunDependency("al " + url) : "";
 readAsync(url, function(arrayBuffer) {
  assert(arrayBuffer, 'Loading data file "' + url + '" failed (no arrayBuffer).');
  onload(new Uint8Array(arrayBuffer));
  if (dep) removeRunDependency(dep);
 }, function(event) {
  if (onerror) {
   onerror();
  } else {
   throw 'Loading data file "' + url + '" failed.';
  }
 });
 if (dep) addRunDependency(dep);
}

var ERRNO_MESSAGES = {
 0: "Success",
 1: "Arg list too long",
 2: "Permission denied",
 3: "Address already in use",
 4: "Address not available",
 5: "Address family not supported by protocol family",
 6: "No more processes",
 7: "Socket already connected",
 8: "Bad file number",
 9: "Trying to read unreadable message",
 10: "Mount device busy",
 11: "Operation canceled",
 12: "No children",
 13: "Connection aborted",
 14: "Connection refused",
 15: "Connection reset by peer",
 16: "File locking deadlock error",
 17: "Destination address required",
 18: "Math arg out of domain of func",
 19: "Quota exceeded",
 20: "File exists",
 21: "Bad address",
 22: "File too large",
 23: "Host is unreachable",
 24: "Identifier removed",
 25: "Illegal byte sequence",
 26: "Connection already in progress",
 27: "Interrupted system call",
 28: "Invalid argument",
 29: "I/O error",
 30: "Socket is already connected",
 31: "Is a directory",
 32: "Too many symbolic links",
 33: "Too many open files",
 34: "Too many links",
 35: "Message too long",
 36: "Multihop attempted",
 37: "File or path name too long",
 38: "Network interface is not configured",
 39: "Connection reset by network",
 40: "Network is unreachable",
 41: "Too many open files in system",
 42: "No buffer space available",
 43: "No such device",
 44: "No such file or directory",
 45: "Exec format error",
 46: "No record locks available",
 47: "The link has been severed",
 48: "Not enough core",
 49: "No message of desired type",
 50: "Protocol not available",
 51: "No space left on device",
 52: "Function not implemented",
 53: "Socket is not connected",
 54: "Not a directory",
 55: "Directory not empty",
 56: "State not recoverable",
 57: "Socket operation on non-socket",
 59: "Not a typewriter",
 60: "No such device or address",
 61: "Value too large for defined data type",
 62: "Previous owner died",
 63: "Not super-user",
 64: "Broken pipe",
 65: "Protocol error",
 66: "Unknown protocol",
 67: "Protocol wrong type for socket",
 68: "Math result not representable",
 69: "Read only file system",
 70: "Illegal seek",
 71: "No such process",
 72: "Stale file handle",
 73: "Connection timed out",
 74: "Text file busy",
 75: "Cross-device link",
 100: "Device not a stream",
 101: "Bad font file fmt",
 102: "Invalid slot",
 103: "Invalid request code",
 104: "No anode",
 105: "Block device required",
 106: "Channel number out of range",
 107: "Level 3 halted",
 108: "Level 3 reset",
 109: "Link number out of range",
 110: "Protocol driver not attached",
 111: "No CSI structure available",
 112: "Level 2 halted",
 113: "Invalid exchange",
 114: "Invalid request descriptor",
 115: "Exchange full",
 116: "No data (for no delay io)",
 117: "Timer expired",
 118: "Out of streams resources",
 119: "Machine is not on the network",
 120: "Package not installed",
 121: "The object is remote",
 122: "Advertise error",
 123: "Srmount error",
 124: "Communication error on send",
 125: "Cross mount point (not really error)",
 126: "Given log. name not unique",
 127: "f.d. invalid for this operation",
 128: "Remote address changed",
 129: "Can   access a needed shared lib",
 130: "Accessing a corrupted shared lib",
 131: ".lib section in a.out corrupted",
 132: "Attempting to link in too many libs",
 133: "Attempting to exec a shared library",
 135: "Streams pipe error",
 136: "Too many users",
 137: "Socket type not supported",
 138: "Not supported",
 139: "Protocol family not supported",
 140: "Can't send after socket shutdown",
 141: "Too many references",
 142: "Host is down",
 148: "No medium (in tape drive)",
 156: "Level 2 not synchronized"
};

var ERRNO_CODES = {};

var FS = {
 root: null,
 mounts: [],
 devices: {},
 streams: [],
 nextInode: 1,
 nameTable: null,
 currentPath: "/",
 initialized: false,
 ignorePermissions: true,
 ErrnoError: null,
 genericErrors: {},
 filesystems: null,
 syncFSRequests: 0,
 lookupPath: function(path, opts) {
  path = PATH_FS.resolve(FS.cwd(), path);
  opts = opts || {};
  if (!path) return {
   path: "",
   node: null
  };
  var defaults = {
   follow_mount: true,
   recurse_count: 0
  };
  for (var key in defaults) {
   if (opts[key] === undefined) {
    opts[key] = defaults[key];
   }
  }
  if (opts.recurse_count > 8) {
   throw new FS.ErrnoError(32);
  }
  var parts = PATH.normalizeArray(path.split("/").filter(function(p) {
   return !!p;
  }), false);
  var current = FS.root;
  var current_path = "/";
  for (var i = 0; i < parts.length; i++) {
   var islast = i === parts.length - 1;
   if (islast && opts.parent) {
    break;
   }
   current = FS.lookupNode(current, parts[i]);
   current_path = PATH.join2(current_path, parts[i]);
   if (FS.isMountpoint(current)) {
    if (!islast || islast && opts.follow_mount) {
     current = current.mounted.root;
    }
   }
   if (!islast || opts.follow) {
    var count = 0;
    while (FS.isLink(current.mode)) {
     var link = FS.readlink(current_path);
     current_path = PATH_FS.resolve(PATH.dirname(current_path), link);
     var lookup = FS.lookupPath(current_path, {
      recurse_count: opts.recurse_count
     });
     current = lookup.node;
     if (count++ > 40) {
      throw new FS.ErrnoError(32);
     }
    }
   }
  }
  return {
   path: current_path,
   node: current
  };
 },
 getPath: function(node) {
  var path;
  while (true) {
   if (FS.isRoot(node)) {
    var mount = node.mount.mountpoint;
    if (!path) return mount;
    return mount[mount.length - 1] !== "/" ? mount + "/" + path : mount + path;
   }
   path = path ? node.name + "/" + path : node.name;
   node = node.parent;
  }
 },
 hashName: function(parentid, name) {
  var hash = 0;
  for (var i = 0; i < name.length; i++) {
   hash = (hash << 5) - hash + name.charCodeAt(i) | 0;
  }
  return (parentid + hash >>> 0) % FS.nameTable.length;
 },
 hashAddNode: function(node) {
  var hash = FS.hashName(node.parent.id, node.name);
  node.name_next = FS.nameTable[hash];
  FS.nameTable[hash] = node;
 },
 hashRemoveNode: function(node) {
  var hash = FS.hashName(node.parent.id, node.name);
  if (FS.nameTable[hash] === node) {
   FS.nameTable[hash] = node.name_next;
  } else {
   var current = FS.nameTable[hash];
   while (current) {
    if (current.name_next === node) {
     current.name_next = node.name_next;
     break;
    }
    current = current.name_next;
   }
  }
 },
 lookupNode: function(parent, name) {
  var errCode = FS.mayLookup(parent);
  if (errCode) {
   throw new FS.ErrnoError(errCode, parent);
  }
  var hash = FS.hashName(parent.id, name);
  for (var node = FS.nameTable[hash]; node; node = node.name_next) {
   var nodeName = node.name;
   if (node.parent.id === parent.id && nodeName === name) {
    return node;
   }
  }
  return FS.lookup(parent, name);
 },
 createNode: function(parent, name, mode, rdev) {
  assert(typeof parent === "object");
  var node = new FS.FSNode(parent, name, mode, rdev);
  FS.hashAddNode(node);
  return node;
 },
 destroyNode: function(node) {
  FS.hashRemoveNode(node);
 },
 isRoot: function(node) {
  return node === node.parent;
 },
 isMountpoint: function(node) {
  return !!node.mounted;
 },
 isFile: function(mode) {
  return (mode & 61440) === 32768;
 },
 isDir: function(mode) {
  return (mode & 61440) === 16384;
 },
 isLink: function(mode) {
  return (mode & 61440) === 40960;
 },
 isChrdev: function(mode) {
  return (mode & 61440) === 8192;
 },
 isBlkdev: function(mode) {
  return (mode & 61440) === 24576;
 },
 isFIFO: function(mode) {
  return (mode & 61440) === 4096;
 },
 isSocket: function(mode) {
  return (mode & 49152) === 49152;
 },
 flagModes: {
  "r": 0,
  "r+": 2,
  "w": 577,
  "w+": 578,
  "a": 1089,
  "a+": 1090
 },
 modeStringToFlags: function(str) {
  var flags = FS.flagModes[str];
  if (typeof flags === "undefined") {
   throw new Error("Unknown file open mode: " + str);
  }
  return flags;
 },
 flagsToPermissionString: function(flag) {
  var perms = [ "r", "w", "rw" ][flag & 3];
  if (flag & 512) {
   perms += "w";
  }
  return perms;
 },
 nodePermissions: function(node, perms) {
  if (FS.ignorePermissions) {
   return 0;
  }
  if (perms.includes("r") && !(node.mode & 292)) {
   return 2;
  } else if (perms.includes("w") && !(node.mode & 146)) {
   return 2;
  } else if (perms.includes("x") && !(node.mode & 73)) {
   return 2;
  }
  return 0;
 },
 mayLookup: function(dir) {
  var errCode = FS.nodePermissions(dir, "x");
  if (errCode) return errCode;
  if (!dir.node_ops.lookup) return 2;
  return 0;
 },
 mayCreate: function(dir, name) {
  try {
   var node = FS.lookupNode(dir, name);
   return 20;
  } catch (e) {}
  return FS.nodePermissions(dir, "wx");
 },
 mayDelete: function(dir, name, isdir) {
  var node;
  try {
   node = FS.lookupNode(dir, name);
  } catch (e) {
   return e.errno;
  }
  var errCode = FS.nodePermissions(dir, "wx");
  if (errCode) {
   return errCode;
  }
  if (isdir) {
   if (!FS.isDir(node.mode)) {
    return 54;
   }
   if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
    return 10;
   }
  } else {
   if (FS.isDir(node.mode)) {
    return 31;
   }
  }
  return 0;
 },
 mayOpen: function(node, flags) {
  if (!node) {
   return 44;
  }
  if (FS.isLink(node.mode)) {
   return 32;
  } else if (FS.isDir(node.mode)) {
   if (FS.flagsToPermissionString(flags) !== "r" || flags & 512) {
    return 31;
   }
  }
  return FS.nodePermissions(node, FS.flagsToPermissionString(flags));
 },
 MAX_OPEN_FDS: 4096,
 nextfd: function(fd_start, fd_end) {
  fd_start = fd_start || 0;
  fd_end = fd_end || FS.MAX_OPEN_FDS;
  for (var fd = fd_start; fd <= fd_end; fd++) {
   if (!FS.streams[fd]) {
    return fd;
   }
  }
  throw new FS.ErrnoError(33);
 },
 getStream: function(fd) {
  return FS.streams[fd];
 },
 createStream: function(stream, fd_start, fd_end) {
  if (!FS.FSStream) {
   FS.FSStream = function() {};
   FS.FSStream.prototype = {
    object: {
     get: function() {
      return this.node;
     },
     set: function(val) {
      this.node = val;
     }
    },
    isRead: {
     get: function() {
      return (this.flags & 2097155) !== 1;
     }
    },
    isWrite: {
     get: function() {
      return (this.flags & 2097155) !== 0;
     }
    },
    isAppend: {
     get: function() {
      return this.flags & 1024;
     }
    }
   };
  }
  var newStream = new FS.FSStream();
  for (var p in stream) {
   newStream[p] = stream[p];
  }
  stream = newStream;
  var fd = FS.nextfd(fd_start, fd_end);
  stream.fd = fd;
  FS.streams[fd] = stream;
  return stream;
 },
 closeStream: function(fd) {
  FS.streams[fd] = null;
 },
 chrdev_stream_ops: {
  open: function(stream) {
   var device = FS.getDevice(stream.node.rdev);
   stream.stream_ops = device.stream_ops;
   if (stream.stream_ops.open) {
    stream.stream_ops.open(stream);
   }
  },
  llseek: function() {
   throw new FS.ErrnoError(70);
  }
 },
 major: function(dev) {
  return dev >> 8;
 },
 minor: function(dev) {
  return dev & 255;
 },
 makedev: function(ma, mi) {
  return ma << 8 | mi;
 },
 registerDevice: function(dev, ops) {
  FS.devices[dev] = {
   stream_ops: ops
  };
 },
 getDevice: function(dev) {
  return FS.devices[dev];
 },
 getMounts: function(mount) {
  var mounts = [];
  var check = [ mount ];
  while (check.length) {
   var m = check.pop();
   mounts.push(m);
   check.push.apply(check, m.mounts);
  }
  return mounts;
 },
 syncfs: function(populate, callback) {
  if (typeof populate === "function") {
   callback = populate;
   populate = false;
  }
  FS.syncFSRequests++;
  if (FS.syncFSRequests > 1) {
   err("warning: " + FS.syncFSRequests + " FS.syncfs operations in flight at once, probably just doing extra work");
  }
  var mounts = FS.getMounts(FS.root.mount);
  var completed = 0;
  function doCallback(errCode) {
   assert(FS.syncFSRequests > 0);
   FS.syncFSRequests--;
   return callback(errCode);
  }
  function done(errCode) {
   if (errCode) {
    if (!done.errored) {
     done.errored = true;
     return doCallback(errCode);
    }
    return;
   }
   if (++completed >= mounts.length) {
    doCallback(null);
   }
  }
  mounts.forEach(function(mount) {
   if (!mount.type.syncfs) {
    return done(null);
   }
   mount.type.syncfs(mount, populate, done);
  });
 },
 mount: function(type, opts, mountpoint) {
  if (typeof type === "string") {
   throw type;
  }
  var root = mountpoint === "/";
  var pseudo = !mountpoint;
  var node;
  if (root && FS.root) {
   throw new FS.ErrnoError(10);
  } else if (!root && !pseudo) {
   var lookup = FS.lookupPath(mountpoint, {
    follow_mount: false
   });
   mountpoint = lookup.path;
   node = lookup.node;
   if (FS.isMountpoint(node)) {
    throw new FS.ErrnoError(10);
   }
   if (!FS.isDir(node.mode)) {
    throw new FS.ErrnoError(54);
   }
  }
  var mount = {
   type: type,
   opts: opts,
   mountpoint: mountpoint,
   mounts: []
  };
  var mountRoot = type.mount(mount);
  mountRoot.mount = mount;
  mount.root = mountRoot;
  if (root) {
   FS.root = mountRoot;
  } else if (node) {
   node.mounted = mount;
   if (node.mount) {
    node.mount.mounts.push(mount);
   }
  }
  return mountRoot;
 },
 unmount: function(mountpoint) {
  var lookup = FS.lookupPath(mountpoint, {
   follow_mount: false
  });
  if (!FS.isMountpoint(lookup.node)) {
   throw new FS.ErrnoError(28);
  }
  var node = lookup.node;
  var mount = node.mounted;
  var mounts = FS.getMounts(mount);
  Object.keys(FS.nameTable).forEach(function(hash) {
   var current = FS.nameTable[hash];
   while (current) {
    var next = current.name_next;
    if (mounts.includes(current.mount)) {
     FS.destroyNode(current);
    }
    current = next;
   }
  });
  node.mounted = null;
  var idx = node.mount.mounts.indexOf(mount);
  assert(idx !== -1);
  node.mount.mounts.splice(idx, 1);
 },
 lookup: function(parent, name) {
  return parent.node_ops.lookup(parent, name);
 },
 mknod: function(path, mode, dev) {
  var lookup = FS.lookupPath(path, {
   parent: true
  });
  var parent = lookup.node;
  var name = PATH.basename(path);
  if (!name || name === "." || name === "..") {
   throw new FS.ErrnoError(28);
  }
  var errCode = FS.mayCreate(parent, name);
  if (errCode) {
   throw new FS.ErrnoError(errCode);
  }
  if (!parent.node_ops.mknod) {
   throw new FS.ErrnoError(63);
  }
  return parent.node_ops.mknod(parent, name, mode, dev);
 },
 create: function(path, mode) {
  mode = mode !== undefined ? mode : 438;
  mode &= 4095;
  mode |= 32768;
  return FS.mknod(path, mode, 0);
 },
 mkdir: function(path, mode) {
  mode = mode !== undefined ? mode : 511;
  mode &= 511 | 512;
  mode |= 16384;
  return FS.mknod(path, mode, 0);
 },
 mkdirTree: function(path, mode) {
  var dirs = path.split("/");
  var d = "";
  for (var i = 0; i < dirs.length; ++i) {
   if (!dirs[i]) continue;
   d += "/" + dirs[i];
   try {
    FS.mkdir(d, mode);
   } catch (e) {
    if (e.errno != 20) throw e;
   }
  }
 },
 mkdev: function(path, mode, dev) {
  if (typeof dev === "undefined") {
   dev = mode;
   mode = 438;
  }
  mode |= 8192;
  return FS.mknod(path, mode, dev);
 },
 symlink: function(oldpath, newpath) {
  if (!PATH_FS.resolve(oldpath)) {
   throw new FS.ErrnoError(44);
  }
  var lookup = FS.lookupPath(newpath, {
   parent: true
  });
  var parent = lookup.node;
  if (!parent) {
   throw new FS.ErrnoError(44);
  }
  var newname = PATH.basename(newpath);
  var errCode = FS.mayCreate(parent, newname);
  if (errCode) {
   throw new FS.ErrnoError(errCode);
  }
  if (!parent.node_ops.symlink) {
   throw new FS.ErrnoError(63);
  }
  return parent.node_ops.symlink(parent, newname, oldpath);
 },
 rename: function(old_path, new_path) {
  var old_dirname = PATH.dirname(old_path);
  var new_dirname = PATH.dirname(new_path);
  var old_name = PATH.basename(old_path);
  var new_name = PATH.basename(new_path);
  var lookup, old_dir, new_dir;
  lookup = FS.lookupPath(old_path, {
   parent: true
  });
  old_dir = lookup.node;
  lookup = FS.lookupPath(new_path, {
   parent: true
  });
  new_dir = lookup.node;
  if (!old_dir || !new_dir) throw new FS.ErrnoError(44);
  if (old_dir.mount !== new_dir.mount) {
   throw new FS.ErrnoError(75);
  }
  var old_node = FS.lookupNode(old_dir, old_name);
  var relative = PATH_FS.relative(old_path, new_dirname);
  if (relative.charAt(0) !== ".") {
   throw new FS.ErrnoError(28);
  }
  relative = PATH_FS.relative(new_path, old_dirname);
  if (relative.charAt(0) !== ".") {
   throw new FS.ErrnoError(55);
  }
  var new_node;
  try {
   new_node = FS.lookupNode(new_dir, new_name);
  } catch (e) {}
  if (old_node === new_node) {
   return;
  }
  var isdir = FS.isDir(old_node.mode);
  var errCode = FS.mayDelete(old_dir, old_name, isdir);
  if (errCode) {
   throw new FS.ErrnoError(errCode);
  }
  errCode = new_node ? FS.mayDelete(new_dir, new_name, isdir) : FS.mayCreate(new_dir, new_name);
  if (errCode) {
   throw new FS.ErrnoError(errCode);
  }
  if (!old_dir.node_ops.rename) {
   throw new FS.ErrnoError(63);
  }
  if (FS.isMountpoint(old_node) || new_node && FS.isMountpoint(new_node)) {
   throw new FS.ErrnoError(10);
  }
  if (new_dir !== old_dir) {
   errCode = FS.nodePermissions(old_dir, "w");
   if (errCode) {
    throw new FS.ErrnoError(errCode);
   }
  }
  FS.hashRemoveNode(old_node);
  try {
   old_dir.node_ops.rename(old_node, new_dir, new_name);
  } catch (e) {
   throw e;
  } finally {
   FS.hashAddNode(old_node);
  }
 },
 rmdir: function(path) {
  var lookup = FS.lookupPath(path, {
   parent: true
  });
  var parent = lookup.node;
  var name = PATH.basename(path);
  var node = FS.lookupNode(parent, name);
  var errCode = FS.mayDelete(parent, name, true);
  if (errCode) {
   throw new FS.ErrnoError(errCode);
  }
  if (!parent.node_ops.rmdir) {
   throw new FS.ErrnoError(63);
  }
  if (FS.isMountpoint(node)) {
   throw new FS.ErrnoError(10);
  }
  parent.node_ops.rmdir(parent, name);
  FS.destroyNode(node);
 },
 readdir: function(path) {
  var lookup = FS.lookupPath(path, {
   follow: true
  });
  var node = lookup.node;
  if (!node.node_ops.readdir) {
   throw new FS.ErrnoError(54);
  }
  return node.node_ops.readdir(node);
 },
 unlink: function(path) {
  var lookup = FS.lookupPath(path, {
   parent: true
  });
  var parent = lookup.node;
  var name = PATH.basename(path);
  var node = FS.lookupNode(parent, name);
  var errCode = FS.mayDelete(parent, name, false);
  if (errCode) {
   throw new FS.ErrnoError(errCode);
  }
  if (!parent.node_ops.unlink) {
   throw new FS.ErrnoError(63);
  }
  if (FS.isMountpoint(node)) {
   throw new FS.ErrnoError(10);
  }
  parent.node_ops.unlink(parent, name);
  FS.destroyNode(node);
 },
 readlink: function(path) {
  var lookup = FS.lookupPath(path);
  var link = lookup.node;
  if (!link) {
   throw new FS.ErrnoError(44);
  }
  if (!link.node_ops.readlink) {
   throw new FS.ErrnoError(28);
  }
  return PATH_FS.resolve(FS.getPath(link.parent), link.node_ops.readlink(link));
 },
 stat: function(path, dontFollow) {
  var lookup = FS.lookupPath(path, {
   follow: !dontFollow
  });
  var node = lookup.node;
  if (!node) {
   throw new FS.ErrnoError(44);
  }
  if (!node.node_ops.getattr) {
   throw new FS.ErrnoError(63);
  }
  return node.node_ops.getattr(node);
 },
 lstat: function(path) {
  return FS.stat(path, true);
 },
 chmod: function(path, mode, dontFollow) {
  var node;
  if (typeof path === "string") {
   var lookup = FS.lookupPath(path, {
    follow: !dontFollow
   });
   node = lookup.node;
  } else {
   node = path;
  }
  if (!node.node_ops.setattr) {
   throw new FS.ErrnoError(63);
  }
  node.node_ops.setattr(node, {
   mode: mode & 4095 | node.mode & ~4095,
   timestamp: Date.now()
  });
 },
 lchmod: function(path, mode) {
  FS.chmod(path, mode, true);
 },
 fchmod: function(fd, mode) {
  var stream = FS.getStream(fd);
  if (!stream) {
   throw new FS.ErrnoError(8);
  }
  FS.chmod(stream.node, mode);
 },
 chown: function(path, uid, gid, dontFollow) {
  var node;
  if (typeof path === "string") {
   var lookup = FS.lookupPath(path, {
    follow: !dontFollow
   });
   node = lookup.node;
  } else {
   node = path;
  }
  if (!node.node_ops.setattr) {
   throw new FS.ErrnoError(63);
  }
  node.node_ops.setattr(node, {
   timestamp: Date.now()
  });
 },
 lchown: function(path, uid, gid) {
  FS.chown(path, uid, gid, true);
 },
 fchown: function(fd, uid, gid) {
  var stream = FS.getStream(fd);
  if (!stream) {
   throw new FS.ErrnoError(8);
  }
  FS.chown(stream.node, uid, gid);
 },
 truncate: function(path, len) {
  if (len < 0) {
   throw new FS.ErrnoError(28);
  }
  var node;
  if (typeof path === "string") {
   var lookup = FS.lookupPath(path, {
    follow: true
   });
   node = lookup.node;
  } else {
   node = path;
  }
  if (!node.node_ops.setattr) {
   throw new FS.ErrnoError(63);
  }
  if (FS.isDir(node.mode)) {
   throw new FS.ErrnoError(31);
  }
  if (!FS.isFile(node.mode)) {
   throw new FS.ErrnoError(28);
  }
  var errCode = FS.nodePermissions(node, "w");
  if (errCode) {
   throw new FS.ErrnoError(errCode);
  }
  node.node_ops.setattr(node, {
   size: len,
   timestamp: Date.now()
  });
 },
 ftruncate: function(fd, len) {
  var stream = FS.getStream(fd);
  if (!stream) {
   throw new FS.ErrnoError(8);
  }
  if ((stream.flags & 2097155) === 0) {
   throw new FS.ErrnoError(28);
  }
  FS.truncate(stream.node, len);
 },
 utime: function(path, atime, mtime) {
  var lookup = FS.lookupPath(path, {
   follow: true
  });
  var node = lookup.node;
  node.node_ops.setattr(node, {
   timestamp: Math.max(atime, mtime)
  });
 },
 open: function(path, flags, mode, fd_start, fd_end) {
  if (path === "") {
   throw new FS.ErrnoError(44);
  }
  flags = typeof flags === "string" ? FS.modeStringToFlags(flags) : flags;
  mode = typeof mode === "undefined" ? 438 : mode;
  if (flags & 64) {
   mode = mode & 4095 | 32768;
  } else {
   mode = 0;
  }
  var node;
  if (typeof path === "object") {
   node = path;
  } else {
   path = PATH.normalize(path);
   try {
    var lookup = FS.lookupPath(path, {
     follow: !(flags & 131072)
    });
    node = lookup.node;
   } catch (e) {}
  }
  var created = false;
  if (flags & 64) {
   if (node) {
    if (flags & 128) {
     throw new FS.ErrnoError(20);
    }
   } else {
    node = FS.mknod(path, mode, 0);
    created = true;
   }
  }
  if (!node) {
   throw new FS.ErrnoError(44);
  }
  if (FS.isChrdev(node.mode)) {
   flags &= ~512;
  }
  if (flags & 65536 && !FS.isDir(node.mode)) {
   throw new FS.ErrnoError(54);
  }
  if (!created) {
   var errCode = FS.mayOpen(node, flags);
   if (errCode) {
    throw new FS.ErrnoError(errCode);
   }
  }
  if (flags & 512) {
   FS.truncate(node, 0);
  }
  flags &= ~(128 | 512 | 131072);
  var stream = FS.createStream({
   node: node,
   path: FS.getPath(node),
   id: node.id,
   flags: flags,
   mode: node.mode,
   seekable: true,
   position: 0,
   stream_ops: node.stream_ops,
   node_ops: node.node_ops,
   ungotten: [],
   error: false
  }, fd_start, fd_end);
  if (stream.stream_ops.open) {
   stream.stream_ops.open(stream);
  }
  if (Module["logReadFiles"] && !(flags & 1)) {
   if (!FS.readFiles) FS.readFiles = {};
   if (!(path in FS.readFiles)) {
    FS.readFiles[path] = 1;
   }
  }
  return stream;
 },
 close: function(stream) {
  if (FS.isClosed(stream)) {
   throw new FS.ErrnoError(8);
  }
  if (stream.getdents) stream.getdents = null;
  try {
   if (stream.stream_ops.close) {
    stream.stream_ops.close(stream);
   }
  } catch (e) {
   throw e;
  } finally {
   FS.closeStream(stream.fd);
  }
  stream.fd = null;
 },
 isClosed: function(stream) {
  return stream.fd === null;
 },
 llseek: function(stream, offset, whence) {
  if (FS.isClosed(stream)) {
   throw new FS.ErrnoError(8);
  }
  if (!stream.seekable || !stream.stream_ops.llseek) {
   throw new FS.ErrnoError(70);
  }
  if (whence != 0 && whence != 1 && whence != 2) {
   throw new FS.ErrnoError(28);
  }
  stream.position = stream.stream_ops.llseek(stream, offset, whence);
  stream.ungotten = [];
  return stream.position;
 },
 read: function(stream, buffer, offset, length, position) {
  if (length < 0 || position < 0) {
   throw new FS.ErrnoError(28);
  }
  if (FS.isClosed(stream)) {
   throw new FS.ErrnoError(8);
  }
  if ((stream.flags & 2097155) === 1) {
   throw new FS.ErrnoError(8);
  }
  if (FS.isDir(stream.node.mode)) {
   throw new FS.ErrnoError(31);
  }
  if (!stream.stream_ops.read) {
   throw new FS.ErrnoError(28);
  }
  var seeking = typeof position !== "undefined";
  if (!seeking) {
   position = stream.position;
  } else if (!stream.seekable) {
   throw new FS.ErrnoError(70);
  }
  var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position);
  if (!seeking) stream.position += bytesRead;
  return bytesRead;
 },
 write: function(stream, buffer, offset, length, position, canOwn) {
  if (length < 0 || position < 0) {
   throw new FS.ErrnoError(28);
  }
  if (FS.isClosed(stream)) {
   throw new FS.ErrnoError(8);
  }
  if ((stream.flags & 2097155) === 0) {
   throw new FS.ErrnoError(8);
  }
  if (FS.isDir(stream.node.mode)) {
   throw new FS.ErrnoError(31);
  }
  if (!stream.stream_ops.write) {
   throw new FS.ErrnoError(28);
  }
  if (stream.seekable && stream.flags & 1024) {
   FS.llseek(stream, 0, 2);
  }
  var seeking = typeof position !== "undefined";
  if (!seeking) {
   position = stream.position;
  } else if (!stream.seekable) {
   throw new FS.ErrnoError(70);
  }
  var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn);
  if (!seeking) stream.position += bytesWritten;
  return bytesWritten;
 },
 allocate: function(stream, offset, length) {
  if (FS.isClosed(stream)) {
   throw new FS.ErrnoError(8);
  }
  if (offset < 0 || length <= 0) {
   throw new FS.ErrnoError(28);
  }
  if ((stream.flags & 2097155) === 0) {
   throw new FS.ErrnoError(8);
  }
  if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) {
   throw new FS.ErrnoError(43);
  }
  if (!stream.stream_ops.allocate) {
   throw new FS.ErrnoError(138);
  }
  stream.stream_ops.allocate(stream, offset, length);
 },
 mmap: function(stream, address, length, position, prot, flags) {
  if ((prot & 2) !== 0 && (flags & 2) === 0 && (stream.flags & 2097155) !== 2) {
   throw new FS.ErrnoError(2);
  }
  if ((stream.flags & 2097155) === 1) {
   throw new FS.ErrnoError(2);
  }
  if (!stream.stream_ops.mmap) {
   throw new FS.ErrnoError(43);
  }
  return stream.stream_ops.mmap(stream, address, length, position, prot, flags);
 },
 msync: function(stream, buffer, offset, length, mmapFlags) {
  if (!stream || !stream.stream_ops.msync) {
   return 0;
  }
  return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags);
 },
 munmap: function(stream) {
  return 0;
 },
 ioctl: function(stream, cmd, arg) {
  if (!stream.stream_ops.ioctl) {
   throw new FS.ErrnoError(59);
  }
  return stream.stream_ops.ioctl(stream, cmd, arg);
 },
 readFile: function(path, opts) {
  opts = opts || {};
  opts.flags = opts.flags || 0;
  opts.encoding = opts.encoding || "binary";
  if (opts.encoding !== "utf8" && opts.encoding !== "binary") {
   throw new Error('Invalid encoding type "' + opts.encoding + '"');
  }
  var ret;
  var stream = FS.open(path, opts.flags);
  var stat = FS.stat(path);
  var length = stat.size;
  var buf = new Uint8Array(length);
  FS.read(stream, buf, 0, length, 0);
  if (opts.encoding === "utf8") {
   ret = UTF8ArrayToString(buf, 0);
  } else if (opts.encoding === "binary") {
   ret = buf;
  }
  FS.close(stream);
  return ret;
 },
 writeFile: function(path, data, opts) {
  opts = opts || {};
  opts.flags = opts.flags || 577;
  var stream = FS.open(path, opts.flags, opts.mode);
  if (typeof data === "string") {
   var buf = new Uint8Array(lengthBytesUTF8(data) + 1);
   var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
   FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn);
  } else if (ArrayBuffer.isView(data)) {
   FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn);
  } else {
   throw new Error("Unsupported data type");
  }
  FS.close(stream);
 },
 cwd: function() {
  return FS.currentPath;
 },
 chdir: function(path) {
  var lookup = FS.lookupPath(path, {
   follow: true
  });
  if (lookup.node === null) {
   throw new FS.ErrnoError(44);
  }
  if (!FS.isDir(lookup.node.mode)) {
   throw new FS.ErrnoError(54);
  }
  var errCode = FS.nodePermissions(lookup.node, "x");
  if (errCode) {
   throw new FS.ErrnoError(errCode);
  }
  FS.currentPath = lookup.path;
 },
 createDefaultDirectories: function() {
  FS.mkdir("/tmp");
  FS.mkdir("/home");
  FS.mkdir("/home/web_user");
 },
 createDefaultDevices: function() {
  FS.mkdir("/dev");
  FS.registerDevice(FS.makedev(1, 3), {
   read: function() {
    return 0;
   },
   write: function(stream, buffer, offset, length, pos) {
    return length;
   }
  });
  FS.mkdev("/dev/null", FS.makedev(1, 3));
  TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
  TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
  FS.mkdev("/dev/tty", FS.makedev(5, 0));
  FS.mkdev("/dev/tty1", FS.makedev(6, 0));
  var random_device = getRandomDevice();
  FS.createDevice("/dev", "random", random_device);
  FS.createDevice("/dev", "urandom", random_device);
  FS.mkdir("/dev/shm");
  FS.mkdir("/dev/shm/tmp");
 },
 createSpecialDirectories: function() {
  FS.mkdir("/proc");
  var proc_self = FS.mkdir("/proc/self");
  FS.mkdir("/proc/self/fd");
  FS.mount({
   mount: function() {
    var node = FS.createNode(proc_self, "fd", 16384 | 511, 73);
    node.node_ops = {
     lookup: function(parent, name) {
      var fd = +name;
      var stream = FS.getStream(fd);
      if (!stream) throw new FS.ErrnoError(8);
      var ret = {
       parent: null,
       mount: {
        mountpoint: "fake"
       },
       node_ops: {
        readlink: function() {
         return stream.path;
        }
       }
      };
      ret.parent = ret;
      return ret;
     }
    };
    return node;
   }
  }, {}, "/proc/self/fd");
 },
 createStandardStreams: function() {
  if (Module["stdin"]) {
   FS.createDevice("/dev", "stdin", Module["stdin"]);
  } else {
   FS.symlink("/dev/tty", "/dev/stdin");
  }
  if (Module["stdout"]) {
   FS.createDevice("/dev", "stdout", null, Module["stdout"]);
  } else {
   FS.symlink("/dev/tty", "/dev/stdout");
  }
  if (Module["stderr"]) {
   FS.createDevice("/dev", "stderr", null, Module["stderr"]);
  } else {
   FS.symlink("/dev/tty1", "/dev/stderr");
  }
  var stdin = FS.open("/dev/stdin", 0);
  var stdout = FS.open("/dev/stdout", 1);
  var stderr = FS.open("/dev/stderr", 1);
  assert(stdin.fd === 0, "invalid handle for stdin (" + stdin.fd + ")");
  assert(stdout.fd === 1, "invalid handle for stdout (" + stdout.fd + ")");
  assert(stderr.fd === 2, "invalid handle for stderr (" + stderr.fd + ")");
 },
 ensureErrnoError: function() {
  if (FS.ErrnoError) return;
  FS.ErrnoError = function ErrnoError(errno, node) {
   this.node = node;
   this.setErrno = function(errno) {
    this.errno = errno;
    for (var key in ERRNO_CODES) {
     if (ERRNO_CODES[key] === errno) {
      this.code = key;
      break;
     }
    }
   };
   this.setErrno(errno);
   this.message = ERRNO_MESSAGES[errno];
   if (this.stack) {
    Object.defineProperty(this, "stack", {
     value: new Error().stack,
     writable: true
    });
    this.stack = demangleAll(this.stack);
   }
  };
  FS.ErrnoError.prototype = new Error();
  FS.ErrnoError.prototype.constructor = FS.ErrnoError;
  [ 44 ].forEach(function(code) {
   FS.genericErrors[code] = new FS.ErrnoError(code);
   FS.genericErrors[code].stack = "<generic error, no stack>";
  });
 },
 staticInit: function() {
  FS.ensureErrnoError();
  FS.nameTable = new Array(4096);
  FS.mount(MEMFS, {}, "/");
  FS.createDefaultDirectories();
  FS.createDefaultDevices();
  FS.createSpecialDirectories();
  FS.filesystems = {
   "MEMFS": MEMFS
  };
 },
 init: function(input, output, error) {
  assert(!FS.init.initialized, "FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)");
  FS.init.initialized = true;
  FS.ensureErrnoError();
  Module["stdin"] = input || Module["stdin"];
  Module["stdout"] = output || Module["stdout"];
  Module["stderr"] = error || Module["stderr"];
  FS.createStandardStreams();
 },
 quit: function() {
  FS.init.initialized = false;
  var fflush = Module["_fflush"];
  if (fflush) fflush(0);
  for (var i = 0; i < FS.streams.length; i++) {
   var stream = FS.streams[i];
   if (!stream) {
    continue;
   }
   FS.close(stream);
  }
 },
 getMode: function(canRead, canWrite) {
  var mode = 0;
  if (canRead) mode |= 292 | 73;
  if (canWrite) mode |= 146;
  return mode;
 },
 findObject: function(path, dontResolveLastLink) {
  var ret = FS.analyzePath(path, dontResolveLastLink);
  if (ret.exists) {
   return ret.object;
  } else {
   return null;
  }
 },
 analyzePath: function(path, dontResolveLastLink) {
  try {
   var lookup = FS.lookupPath(path, {
    follow: !dontResolveLastLink
   });
   path = lookup.path;
  } catch (e) {}
  var ret = {
   isRoot: false,
   exists: false,
   error: 0,
   name: null,
   path: null,
   object: null,
   parentExists: false,
   parentPath: null,
   parentObject: null
  };
  try {
   var lookup = FS.lookupPath(path, {
    parent: true
   });
   ret.parentExists = true;
   ret.parentPath = lookup.path;
   ret.parentObject = lookup.node;
   ret.name = PATH.basename(path);
   lookup = FS.lookupPath(path, {
    follow: !dontResolveLastLink
   });
   ret.exists = true;
   ret.path = lookup.path;
   ret.object = lookup.node;
   ret.name = lookup.node.name;
   ret.isRoot = lookup.path === "/";
  } catch (e) {
   ret.error = e.errno;
  }
  return ret;
 },
 createPath: function(parent, path, canRead, canWrite) {
  parent = typeof parent === "string" ? parent : FS.getPath(parent);
  var parts = path.split("/").reverse();
  while (parts.length) {
   var part = parts.pop();
   if (!part) continue;
   var current = PATH.join2(parent, part);
   try {
    FS.mkdir(current);
   } catch (e) {}
   parent = current;
  }
  return current;
 },
 createFile: function(parent, name, properties, canRead, canWrite) {
  var path = PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name);
  var mode = FS.getMode(canRead, canWrite);
  return FS.create(path, mode);
 },
 createDataFile: function(parent, name, data, canRead, canWrite, canOwn) {
  var path = name ? PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name) : parent;
  var mode = FS.getMode(canRead, canWrite);
  var node = FS.create(path, mode);
  if (data) {
   if (typeof data === "string") {
    var arr = new Array(data.length);
    for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i);
    data = arr;
   }
   FS.chmod(node, mode | 146);
   var stream = FS.open(node, 577);
   FS.write(stream, data, 0, data.length, 0, canOwn);
   FS.close(stream);
   FS.chmod(node, mode);
  }
  return node;
 },
 createDevice: function(parent, name, input, output) {
  var path = PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name);
  var mode = FS.getMode(!!input, !!output);
  if (!FS.createDevice.major) FS.createDevice.major = 64;
  var dev = FS.makedev(FS.createDevice.major++, 0);
  FS.registerDevice(dev, {
   open: function(stream) {
    stream.seekable = false;
   },
   close: function(stream) {
    if (output && output.buffer && output.buffer.length) {
     output(10);
    }
   },
   read: function(stream, buffer, offset, length, pos) {
    var bytesRead = 0;
    for (var i = 0; i < length; i++) {
     var result;
     try {
      result = input();
     } catch (e) {
      throw new FS.ErrnoError(29);
     }
     if (result === undefined && bytesRead === 0) {
      throw new FS.ErrnoError(6);
     }
     if (result === null || result === undefined) break;
     bytesRead++;
     buffer[offset + i] = result;
    }
    if (bytesRead) {
     stream.node.timestamp = Date.now();
    }
    return bytesRead;
   },
   write: function(stream, buffer, offset, length, pos) {
    for (var i = 0; i < length; i++) {
     try {
      output(buffer[offset + i]);
     } catch (e) {
      throw new FS.ErrnoError(29);
     }
    }
    if (length) {
     stream.node.timestamp = Date.now();
    }
    return i;
   }
  });
  return FS.mkdev(path, mode, dev);
 },
 forceLoadFile: function(obj) {
  if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true;
  if (typeof XMLHttpRequest !== "undefined") {
   throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.");
  } else if (read_) {
   try {
    obj.contents = intArrayFromString(read_(obj.url), true);
    obj.usedBytes = obj.contents.length;
   } catch (e) {
    throw new FS.ErrnoError(29);
   }
  } else {
   throw new Error("Cannot load without read() or XMLHttpRequest.");
  }
 },
 createLazyFile: function(parent, name, url, canRead, canWrite) {
  function LazyUint8Array() {
   this.lengthKnown = false;
   this.chunks = [];
  }
  LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) {
   if (idx > this.length - 1 || idx < 0) {
    return undefined;
   }
   var chunkOffset = idx % this.chunkSize;
   var chunkNum = idx / this.chunkSize | 0;
   return this.getter(chunkNum)[chunkOffset];
  };
  LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) {
   this.getter = getter;
  };
  LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() {
   var xhr = new XMLHttpRequest();
   xhr.open("HEAD", url, false);
   xhr.send(null);
   if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
   var datalength = Number(xhr.getResponseHeader("Content-length"));
   var header;
   var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes";
   var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip";
   var chunkSize = 1024 * 1024;
   if (!hasByteServing) chunkSize = datalength;
   var doXHR = function(from, to) {
    if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!");
    if (to > datalength - 1) throw new Error("only " + datalength + " bytes available! programmer error!");
    var xhr = new XMLHttpRequest();
    xhr.open("GET", url, false);
    if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
    if (typeof Uint8Array != "undefined") xhr.responseType = "arraybuffer";
    if (xhr.overrideMimeType) {
     xhr.overrideMimeType("text/plain; charset=x-user-defined");
    }
    xhr.send(null);
    if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
    if (xhr.response !== undefined) {
     return new Uint8Array(xhr.response || []);
    } else {
     return intArrayFromString(xhr.responseText || "", true);
    }
   };
   var lazyArray = this;
   lazyArray.setDataGetter(function(chunkNum) {
    var start = chunkNum * chunkSize;
    var end = (chunkNum + 1) * chunkSize - 1;
    end = Math.min(end, datalength - 1);
    if (typeof lazyArray.chunks[chunkNum] === "undefined") {
     lazyArray.chunks[chunkNum] = doXHR(start, end);
    }
    if (typeof lazyArray.chunks[chunkNum] === "undefined") throw new Error("doXHR failed!");
    return lazyArray.chunks[chunkNum];
   });
   if (usesGzip || !datalength) {
    chunkSize = datalength = 1;
    datalength = this.getter(0).length;
    chunkSize = datalength;
    out("LazyFiles on gzip forces download of the whole file when length is accessed");
   }
   this._length = datalength;
   this._chunkSize = chunkSize;
   this.lengthKnown = true;
  };
  if (typeof XMLHttpRequest !== "undefined") {
   if (!ENVIRONMENT_IS_WORKER) throw "Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc";
   var lazyArray = new LazyUint8Array();
   Object.defineProperties(lazyArray, {
    length: {
     get: function() {
      if (!this.lengthKnown) {
       this.cacheLength();
      }
      return this._length;
     }
    },
    chunkSize: {
     get: function() {
      if (!this.lengthKnown) {
       this.cacheLength();
      }
      return this._chunkSize;
     }
    }
   });
   var properties = {
    isDevice: false,
    contents: lazyArray
   };
  } else {
   var properties = {
    isDevice: false,
    url: url
   };
  }
  var node = FS.createFile(parent, name, properties, canRead, canWrite);
  if (properties.contents) {
   node.contents = properties.contents;
  } else if (properties.url) {
   node.contents = null;
   node.url = properties.url;
  }
  Object.defineProperties(node, {
   usedBytes: {
    get: function() {
     return this.contents.length;
    }
   }
  });
  var stream_ops = {};
  var keys = Object.keys(node.stream_ops);
  keys.forEach(function(key) {
   var fn = node.stream_ops[key];
   stream_ops[key] = function forceLoadLazyFile() {
    FS.forceLoadFile(node);
    return fn.apply(null, arguments);
   };
  });
  stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) {
   FS.forceLoadFile(node);
   var contents = stream.node.contents;
   if (position >= contents.length) return 0;
   var size = Math.min(contents.length - position, length);
   assert(size >= 0);
   if (contents.slice) {
    for (var i = 0; i < size; i++) {
     buffer[offset + i] = contents[position + i];
    }
   } else {
    for (var i = 0; i < size; i++) {
     buffer[offset + i] = contents.get(position + i);
    }
   }
   return size;
  };
  node.stream_ops = stream_ops;
  return node;
 },
 createPreloadedFile: function(parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) {
  Browser.init();
  var fullname = name ? PATH_FS.resolve(PATH.join2(parent, name)) : parent;
  var dep = getUniqueRunDependency("cp " + fullname);
  function processData(byteArray) {
   function finish(byteArray) {
    if (preFinish) preFinish();
    if (!dontCreateFile) {
     FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn);
    }
    if (onload) onload();
    removeRunDependency(dep);
   }
   var handled = false;
   Module["preloadPlugins"].forEach(function(plugin) {
    if (handled) return;
    if (plugin["canHandle"](fullname)) {
     plugin["handle"](byteArray, fullname, finish, function() {
      if (onerror) onerror();
      removeRunDependency(dep);
     });
     handled = true;
    }
   });
   if (!handled) finish(byteArray);
  }
  addRunDependency(dep);
  if (typeof url == "string") {
   asyncLoad(url, function(byteArray) {
    processData(byteArray);
   }, onerror);
  } else {
   processData(url);
  }
 },
 indexedDB: function() {
  return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
 },
 DB_NAME: function() {
  return "EM_FS_" + window.location.pathname;
 },
 DB_VERSION: 20,
 DB_STORE_NAME: "FILE_DATA",
 saveFilesToDB: function(paths, onload, onerror) {
  onload = onload || function() {};
  onerror = onerror || function() {};
  var indexedDB = FS.indexedDB();
  try {
   var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
  } catch (e) {
   return onerror(e);
  }
  openRequest.onupgradeneeded = function openRequest_onupgradeneeded() {
   out("creating db");
   var db = openRequest.result;
   db.createObjectStore(FS.DB_STORE_NAME);
  };
  openRequest.onsuccess = function openRequest_onsuccess() {
   var db = openRequest.result;
   var transaction = db.transaction([ FS.DB_STORE_NAME ], "readwrite");
   var files = transaction.objectStore(FS.DB_STORE_NAME);
   var ok = 0, fail = 0, total = paths.length;
   function finish() {
    if (fail == 0) onload(); else onerror();
   }
   paths.forEach(function(path) {
    var putRequest = files.put(FS.analyzePath(path).object.contents, path);
    putRequest.onsuccess = function putRequest_onsuccess() {
     ok++;
     if (ok + fail == total) finish();
    };
    putRequest.onerror = function putRequest_onerror() {
     fail++;
     if (ok + fail == total) finish();
    };
   });
   transaction.onerror = onerror;
  };
  openRequest.onerror = onerror;
 },
 loadFilesFromDB: function(paths, onload, onerror) {
  onload = onload || function() {};
  onerror = onerror || function() {};
  var indexedDB = FS.indexedDB();
  try {
   var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
  } catch (e) {
   return onerror(e);
  }
  openRequest.onupgradeneeded = onerror;
  openRequest.onsuccess = function openRequest_onsuccess() {
   var db = openRequest.result;
   try {
    var transaction = db.transaction([ FS.DB_STORE_NAME ], "readonly");
   } catch (e) {
    onerror(e);
    return;
   }
   var files = transaction.objectStore(FS.DB_STORE_NAME);
   var ok = 0, fail = 0, total = paths.length;
   function finish() {
    if (fail == 0) onload(); else onerror();
   }
   paths.forEach(function(path) {
    var getRequest = files.get(path);
    getRequest.onsuccess = function getRequest_onsuccess() {
     if (FS.analyzePath(path).exists) {
      FS.unlink(path);
     }
     FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true);
     ok++;
     if (ok + fail == total) finish();
    };
    getRequest.onerror = function getRequest_onerror() {
     fail++;
     if (ok + fail == total) finish();
    };
   });
   transaction.onerror = onerror;
  };
  openRequest.onerror = onerror;
 },
 absolutePath: function() {
  abort("FS.absolutePath has been removed; use PATH_FS.resolve instead");
 },
 createFolder: function() {
  abort("FS.createFolder has been removed; use FS.mkdir instead");
 },
 createLink: function() {
  abort("FS.createLink has been removed; use FS.symlink instead");
 },
 joinPath: function() {
  abort("FS.joinPath has been removed; use PATH.join instead");
 },
 mmapAlloc: function() {
  abort("FS.mmapAlloc has been replaced by the top level function mmapAlloc");
 },
 standardizePath: function() {
  abort("FS.standardizePath has been removed; use PATH.normalize instead");
 }
};

var SYSCALLS = {
 mappings: {},
 DEFAULT_POLLMASK: 5,
 calculateAt: function(dirfd, path, allowEmpty) {
  if (path[0] === "/") {
   return path;
  }
  var dir;
  if (dirfd === -100) {
   dir = FS.cwd();
  } else {
   var dirstream = FS.getStream(dirfd);
   if (!dirstream) throw new FS.ErrnoError(8);
   dir = dirstream.path;
  }
  if (path.length == 0) {
   if (!allowEmpty) {
    throw new FS.ErrnoError(44);
   }
   return dir;
  }
  return PATH.join2(dir, path);
 },
 doStat: function(func, path, buf) {
  try {
   var stat = func(path);
  } catch (e) {
   if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) {
    return -54;
   }
   throw e;
  }
  SAFE_HEAP_STORE(buf | 0, stat.dev | 0, 4);
  SAFE_HEAP_STORE(buf + 4 | 0, 0 | 0, 4);
  SAFE_HEAP_STORE(buf + 8 | 0, stat.ino | 0, 4);
  SAFE_HEAP_STORE(buf + 12 | 0, stat.mode | 0, 4);
  SAFE_HEAP_STORE(buf + 16 | 0, stat.nlink | 0, 4);
  SAFE_HEAP_STORE(buf + 20 | 0, stat.uid | 0, 4);
  SAFE_HEAP_STORE(buf + 24 | 0, stat.gid | 0, 4);
  SAFE_HEAP_STORE(buf + 28 | 0, stat.rdev | 0, 4);
  SAFE_HEAP_STORE(buf + 32 | 0, 0 | 0, 4);
  SAFE_HEAP_STORE(buf + 40 | 0, stat.size | 0, 8);
  SAFE_HEAP_STORE(buf + 48 | 0, 4096 | 0, 4);
  SAFE_HEAP_STORE(buf + 52 | 0, stat.blocks | 0, 4);
  SAFE_HEAP_STORE(buf + 56 | 0, stat.atime.getTime() / 1e3 | 0 | 0, 4);
  SAFE_HEAP_STORE(buf + 60 | 0, 0 | 0, 4);
  SAFE_HEAP_STORE(buf + 64 | 0, stat.mtime.getTime() / 1e3 | 0 | 0, 4);
  SAFE_HEAP_STORE(buf + 68 | 0, 0 | 0, 4);
  SAFE_HEAP_STORE(buf + 72 | 0, stat.ctime.getTime() / 1e3 | 0 | 0, 4);
  SAFE_HEAP_STORE(buf + 76 | 0, 0 | 0, 4);
  SAFE_HEAP_STORE(buf + 80 | 0, stat.ino | 0, 8);
  return 0;
 },
 doMsync: function(addr, stream, len, flags, offset) {
  var buffer = HEAPU8.slice(addr, addr + len);
  FS.msync(stream, buffer, offset, len, flags);
 },
 doMkdir: function(path, mode) {
  path = PATH.normalize(path);
  if (path[path.length - 1] === "/") path = path.substr(0, path.length - 1);
  FS.mkdir(path, mode, 0);
  return 0;
 },
 doMknod: function(path, mode, dev) {
  switch (mode & 61440) {
  case 32768:
  case 8192:
  case 24576:
  case 4096:
  case 49152:
   break;

  default:
   return -28;
  }
  FS.mknod(path, mode, dev);
  return 0;
 },
 doReadlink: function(path, buf, bufsize) {
  if (bufsize <= 0) return -28;
  var ret = FS.readlink(path);
  var len = Math.min(bufsize, lengthBytesUTF8(ret));
  var endChar = SAFE_HEAP_LOAD(buf + len, 1, 0);
  stringToUTF8(ret, buf, bufsize + 1);
  SAFE_HEAP_STORE(buf + len, endChar, 1);
  return len;
 },
 doAccess: function(path, amode) {
  if (amode & ~7) {
   return -28;
  }
  var lookup = FS.lookupPath(path, {
   follow: true
  });
  var node = lookup.node;
  if (!node) {
   return -44;
  }
  var perms = "";
  if (amode & 4) perms += "r";
  if (amode & 2) perms += "w";
  if (amode & 1) perms += "x";
  if (perms && FS.nodePermissions(node, perms)) {
   return -2;
  }
  return 0;
 },
 doDup: function(path, flags, suggestFD) {
  var suggest = FS.getStream(suggestFD);
  if (suggest) FS.close(suggest);
  return FS.open(path, flags, 0, suggestFD, suggestFD).fd;
 },
 doReadv: function(stream, iov, iovcnt, offset) {
  var ret = 0;
  for (var i = 0; i < iovcnt; i++) {
   var ptr = SAFE_HEAP_LOAD(iov + i * 8 | 0, 4, 0) | 0;
   var len = SAFE_HEAP_LOAD(iov + (i * 8 + 4) | 0, 4, 0) | 0;
   var curr = FS.read(stream, HEAP8, ptr, len, offset);
   if (curr < 0) return -1;
   ret += curr;
   if (curr < len) break;
  }
  return ret;
 },
 doWritev: function(stream, iov, iovcnt, offset) {
  var ret = 0;
  for (var i = 0; i < iovcnt; i++) {
   var ptr = SAFE_HEAP_LOAD(iov + i * 8 | 0, 4, 0) | 0;
   var len = SAFE_HEAP_LOAD(iov + (i * 8 + 4) | 0, 4, 0) | 0;
   var curr = FS.write(stream, HEAP8, ptr, len, offset);
   if (curr < 0) return -1;
   ret += curr;
  }
  return ret;
 },
 varargs: undefined,
 get: function() {
  assert(SYSCALLS.varargs != undefined);
  SYSCALLS.varargs += 4;
  var ret = SAFE_HEAP_LOAD(SYSCALLS.varargs - 4 | 0, 4, 0) | 0;
  return ret;
 },
 getStr: function(ptr) {
  var ret = UTF8ToString(ptr);
  return ret;
 },
 getStreamFromFD: function(fd) {
  var stream = FS.getStream(fd);
  if (!stream) throw new FS.ErrnoError(8);
  return stream;
 },
 get64: function(low, high) {
  if (low >= 0) assert(high === 0); else assert(high === -1);
  return low;
 }
};

function ___syscall__newselect(nfds, readfds, writefds, exceptfds, timeout) {
 try {
  assert(nfds <= 64, "nfds must be less than or equal to 64");
  assert(!exceptfds, "exceptfds not supported");
  var total = 0;
  var srcReadLow = readfds ? SAFE_HEAP_LOAD(readfds | 0, 4, 0) | 0 : 0, srcReadHigh = readfds ? SAFE_HEAP_LOAD(readfds + 4 | 0, 4, 0) | 0 : 0;
  var srcWriteLow = writefds ? SAFE_HEAP_LOAD(writefds | 0, 4, 0) | 0 : 0, srcWriteHigh = writefds ? SAFE_HEAP_LOAD(writefds + 4 | 0, 4, 0) | 0 : 0;
  var srcExceptLow = exceptfds ? SAFE_HEAP_LOAD(exceptfds | 0, 4, 0) | 0 : 0, srcExceptHigh = exceptfds ? SAFE_HEAP_LOAD(exceptfds + 4 | 0, 4, 0) | 0 : 0;
  var dstReadLow = 0, dstReadHigh = 0;
  var dstWriteLow = 0, dstWriteHigh = 0;
  var dstExceptLow = 0, dstExceptHigh = 0;
  var allLow = (readfds ? SAFE_HEAP_LOAD(readfds | 0, 4, 0) | 0 : 0) | (writefds ? SAFE_HEAP_LOAD(writefds | 0, 4, 0) | 0 : 0) | (exceptfds ? SAFE_HEAP_LOAD(exceptfds | 0, 4, 0) | 0 : 0);
  var allHigh = (readfds ? SAFE_HEAP_LOAD(readfds + 4 | 0, 4, 0) | 0 : 0) | (writefds ? SAFE_HEAP_LOAD(writefds + 4 | 0, 4, 0) | 0 : 0) | (exceptfds ? SAFE_HEAP_LOAD(exceptfds + 4 | 0, 4, 0) | 0 : 0);
  var check = function(fd, low, high, val) {
   return fd < 32 ? low & val : high & val;
  };
  for (var fd = 0; fd < nfds; fd++) {
   var mask = 1 << fd % 32;
   if (!check(fd, allLow, allHigh, mask)) {
    continue;
   }
   var stream = FS.getStream(fd);
   if (!stream) throw new FS.ErrnoError(8);
   var flags = SYSCALLS.DEFAULT_POLLMASK;
   if (stream.stream_ops.poll) {
    flags = stream.stream_ops.poll(stream);
   }
   if (flags & 1 && check(fd, srcReadLow, srcReadHigh, mask)) {
    fd < 32 ? dstReadLow = dstReadLow | mask : dstReadHigh = dstReadHigh | mask;
    total++;
   }
   if (flags & 4 && check(fd, srcWriteLow, srcWriteHigh, mask)) {
    fd < 32 ? dstWriteLow = dstWriteLow | mask : dstWriteHigh = dstWriteHigh | mask;
    total++;
   }
   if (flags & 2 && check(fd, srcExceptLow, srcExceptHigh, mask)) {
    fd < 32 ? dstExceptLow = dstExceptLow | mask : dstExceptHigh = dstExceptHigh | mask;
    total++;
   }
  }
  if (readfds) {
   SAFE_HEAP_STORE(readfds | 0, dstReadLow | 0, 4);
   SAFE_HEAP_STORE(readfds + 4 | 0, dstReadHigh | 0, 4);
  }
  if (writefds) {
   SAFE_HEAP_STORE(writefds | 0, dstWriteLow | 0, 4);
   SAFE_HEAP_STORE(writefds + 4 | 0, dstWriteHigh | 0, 4);
  }
  if (exceptfds) {
   SAFE_HEAP_STORE(exceptfds | 0, dstExceptLow | 0, 4);
   SAFE_HEAP_STORE(exceptfds + 4 | 0, dstExceptHigh | 0, 4);
  }
  return total;
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return -e.errno;
 }
}

var SOCKFS = {
 mount: function(mount) {
  Module["websocket"] = Module["websocket"] && "object" === typeof Module["websocket"] ? Module["websocket"] : {};
  Module["websocket"]._callbacks = {};
  Module["websocket"]["on"] = function(event, callback) {
   if ("function" === typeof callback) {
    this._callbacks[event] = callback;
   }
   return this;
  };
  Module["websocket"].emit = function(event, param) {
   if ("function" === typeof this._callbacks[event]) {
    this._callbacks[event].call(this, param);
   }
  };
  return FS.createNode(null, "/", 16384 | 511, 0);
 },
 createSocket: function(family, type, protocol) {
  type &= ~526336;
  var streaming = type == 1;
  if (protocol) {
   assert(streaming == (protocol == 6));
  }
  var sock = {
   family: family,
   type: type,
   protocol: protocol,
   server: null,
   error: null,
   peers: {},
   pending: [],
   recv_queue: [],
   sock_ops: SOCKFS.websocket_sock_ops
  };
  var name = SOCKFS.nextname();
  var node = FS.createNode(SOCKFS.root, name, 49152, 0);
  node.sock = sock;
  var stream = FS.createStream({
   path: name,
   node: node,
   flags: 2,
   seekable: false,
   stream_ops: SOCKFS.stream_ops
  });
  sock.stream = stream;
  return sock;
 },
 getSocket: function(fd) {
  var stream = FS.getStream(fd);
  if (!stream || !FS.isSocket(stream.node.mode)) {
   return null;
  }
  return stream.node.sock;
 },
 stream_ops: {
  poll: function(stream) {
   var sock = stream.node.sock;
   return sock.sock_ops.poll(sock);
  },
  ioctl: function(stream, request, varargs) {
   var sock = stream.node.sock;
   return sock.sock_ops.ioctl(sock, request, varargs);
  },
  read: function(stream, buffer, offset, length, position) {
   var sock = stream.node.sock;
   var msg = sock.sock_ops.recvmsg(sock, length);
   if (!msg) {
    return 0;
   }
   buffer.set(msg.buffer, offset);
   return msg.buffer.length;
  },
  write: function(stream, buffer, offset, length, position) {
   var sock = stream.node.sock;
   return sock.sock_ops.sendmsg(sock, buffer, offset, length);
  },
  close: function(stream) {
   var sock = stream.node.sock;
   sock.sock_ops.close(sock);
  }
 },
 nextname: function() {
  if (!SOCKFS.nextname.current) {
   SOCKFS.nextname.current = 0;
  }
  return "socket[" + SOCKFS.nextname.current++ + "]";
 },
 websocket_sock_ops: {
  createPeer: function(sock, addr, port) {
   var ws;
   if (typeof addr === "object") {
    ws = addr;
    addr = null;
    port = null;
   }
   if (ws) {
    if (ws._socket) {
     addr = ws._socket.remoteAddress;
     port = ws._socket.remotePort;
    } else {
     var result = /ws[s]?:\/\/([^:]+):(\d+)/.exec(ws.url);
     if (!result) {
      throw new Error("WebSocket URL must be in the format ws(s)://address:port");
     }
     addr = result[1];
     port = parseInt(result[2], 10);
    }
   } else {
    try {
     var runtimeConfig = Module["websocket"] && "object" === typeof Module["websocket"];
     var url = "ws:#".replace("#", "//");
     if (runtimeConfig) {
      if ("string" === typeof Module["websocket"]["url"]) {
       url = Module["websocket"]["url"];
      }
     }
     if (url === "ws://" || url === "wss://") {
      var parts = addr.split("/");
      url = url + parts[0] + ":" + port + "/" + parts.slice(1).join("/");
     }
     var subProtocols = "binary";
     if (runtimeConfig) {
      if ("string" === typeof Module["websocket"]["subprotocol"]) {
       subProtocols = Module["websocket"]["subprotocol"];
      }
     }
     var opts = undefined;
     if (subProtocols !== "null") {
      subProtocols = subProtocols.replace(/^ +| +$/g, "").split(/ *, */);
      opts = ENVIRONMENT_IS_NODE ? {
       "protocol": subProtocols.toString()
      } : subProtocols;
     }
     if (runtimeConfig && null === Module["websocket"]["subprotocol"]) {
      subProtocols = "null";
      opts = undefined;
     }
     var WebSocketConstructor;
     {
      WebSocketConstructor = WebSocket;
     }
     ws = new WebSocketConstructor(url, opts);
     ws.binaryType = "arraybuffer";
    } catch (e) {
     throw new FS.ErrnoError(23);
    }
   }
   var peer = {
    addr: addr,
    port: port,
    socket: ws,
    dgram_send_queue: []
   };
   SOCKFS.websocket_sock_ops.addPeer(sock, peer);
   SOCKFS.websocket_sock_ops.handlePeerEvents(sock, peer);
   if (sock.type === 2 && typeof sock.sport !== "undefined") {
    peer.dgram_send_queue.push(new Uint8Array([ 255, 255, 255, 255, "p".charCodeAt(0), "o".charCodeAt(0), "r".charCodeAt(0), "t".charCodeAt(0), (sock.sport & 65280) >> 8, sock.sport & 255 ]));
   }
   return peer;
  },
  getPeer: function(sock, addr, port) {
   return sock.peers[addr + ":" + port];
  },
  addPeer: function(sock, peer) {
   sock.peers[peer.addr + ":" + peer.port] = peer;
  },
  removePeer: function(sock, peer) {
   delete sock.peers[peer.addr + ":" + peer.port];
  },
  handlePeerEvents: function(sock, peer) {
   var first = true;
   var handleOpen = function() {
    Module["websocket"].emit("open", sock.stream.fd);
    try {
     var queued = peer.dgram_send_queue.shift();
     while (queued) {
      peer.socket.send(queued);
      queued = peer.dgram_send_queue.shift();
     }
    } catch (e) {
     peer.socket.close();
    }
   };
   function handleMessage(data) {
    if (typeof data === "string") {
     var encoder = new TextEncoder();
     data = encoder.encode(data);
    } else {
     assert(data.byteLength !== undefined);
     if (data.byteLength == 0) {
      return;
     } else {
      data = new Uint8Array(data);
     }
    }
    var wasfirst = first;
    first = false;
    if (wasfirst && data.length === 10 && data[0] === 255 && data[1] === 255 && data[2] === 255 && data[3] === 255 && data[4] === "p".charCodeAt(0) && data[5] === "o".charCodeAt(0) && data[6] === "r".charCodeAt(0) && data[7] === "t".charCodeAt(0)) {
     var newport = data[8] << 8 | data[9];
     SOCKFS.websocket_sock_ops.removePeer(sock, peer);
     peer.port = newport;
     SOCKFS.websocket_sock_ops.addPeer(sock, peer);
     return;
    }
    sock.recv_queue.push({
     addr: peer.addr,
     port: peer.port,
     data: data
    });
    Module["websocket"].emit("message", sock.stream.fd);
   }
   if (ENVIRONMENT_IS_NODE) {
    peer.socket.on("open", handleOpen);
    peer.socket.on("message", function(data, flags) {
     if (!flags.binary) {
      return;
     }
     handleMessage(new Uint8Array(data).buffer);
    });
    peer.socket.on("close", function() {
     Module["websocket"].emit("close", sock.stream.fd);
    });
    peer.socket.on("error", function(error) {
     sock.error = 14;
     Module["websocket"].emit("error", [ sock.stream.fd, sock.error, "ECONNREFUSED: Connection refused" ]);
    });
   } else {
    peer.socket.onopen = handleOpen;
    peer.socket.onclose = function() {
     Module["websocket"].emit("close", sock.stream.fd);
    };
    peer.socket.onmessage = function peer_socket_onmessage(event) {
     handleMessage(event.data);
    };
    peer.socket.onerror = function(error) {
     sock.error = 14;
     Module["websocket"].emit("error", [ sock.stream.fd, sock.error, "ECONNREFUSED: Connection refused" ]);
    };
   }
  },
  poll: function(sock) {
   if (sock.type === 1 && sock.server) {
    return sock.pending.length ? 64 | 1 : 0;
   }
   var mask = 0;
   var dest = sock.type === 1 ? SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport) : null;
   if (sock.recv_queue.length || !dest || dest && dest.socket.readyState === dest.socket.CLOSING || dest && dest.socket.readyState === dest.socket.CLOSED) {
    mask |= 64 | 1;
   }
   if (!dest || dest && dest.socket.readyState === dest.socket.OPEN) {
    mask |= 4;
   }
   if (dest && dest.socket.readyState === dest.socket.CLOSING || dest && dest.socket.readyState === dest.socket.CLOSED) {
    mask |= 16;
   }
   return mask;
  },
  ioctl: function(sock, request, arg) {
   switch (request) {
   case 21531:
    var bytes = 0;
    if (sock.recv_queue.length) {
     bytes = sock.recv_queue[0].data.length;
    }
    SAFE_HEAP_STORE(arg | 0, bytes | 0, 4);
    return 0;

   default:
    return 28;
   }
  },
  close: function(sock) {
   if (sock.server) {
    try {
     sock.server.close();
    } catch (e) {}
    sock.server = null;
   }
   var peers = Object.keys(sock.peers);
   for (var i = 0; i < peers.length; i++) {
    var peer = sock.peers[peers[i]];
    try {
     peer.socket.close();
    } catch (e) {}
    SOCKFS.websocket_sock_ops.removePeer(sock, peer);
   }
   return 0;
  },
  bind: function(sock, addr, port) {
   if (typeof sock.saddr !== "undefined" || typeof sock.sport !== "undefined") {
    throw new FS.ErrnoError(28);
   }
   sock.saddr = addr;
   sock.sport = port;
   if (sock.type === 2) {
    if (sock.server) {
     sock.server.close();
     sock.server = null;
    }
    try {
     sock.sock_ops.listen(sock, 0);
    } catch (e) {
     if (!(e instanceof FS.ErrnoError)) throw e;
     if (e.errno !== 138) throw e;
    }
   }
  },
  connect: function(sock, addr, port) {
   if (sock.server) {
    throw new FS.ErrnoError(138);
   }
   if (typeof sock.daddr !== "undefined" && typeof sock.dport !== "undefined") {
    var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport);
    if (dest) {
     if (dest.socket.readyState === dest.socket.CONNECTING) {
      throw new FS.ErrnoError(7);
     } else {
      throw new FS.ErrnoError(30);
     }
    }
   }
   var peer = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port);
   sock.daddr = peer.addr;
   sock.dport = peer.port;
   throw new FS.ErrnoError(26);
  },
  listen: function(sock, backlog) {
   if (!ENVIRONMENT_IS_NODE) {
    throw new FS.ErrnoError(138);
   }
  },
  accept: function(listensock) {
   if (!listensock.server) {
    throw new FS.ErrnoError(28);
   }
   var newsock = listensock.pending.shift();
   newsock.stream.flags = listensock.stream.flags;
   return newsock;
  },
  getname: function(sock, peer) {
   var addr, port;
   if (peer) {
    if (sock.daddr === undefined || sock.dport === undefined) {
     throw new FS.ErrnoError(53);
    }
    addr = sock.daddr;
    port = sock.dport;
   } else {
    addr = sock.saddr || 0;
    port = sock.sport || 0;
   }
   return {
    addr: addr,
    port: port
   };
  },
  sendmsg: function(sock, buffer, offset, length, addr, port) {
   if (sock.type === 2) {
    if (addr === undefined || port === undefined) {
     addr = sock.daddr;
     port = sock.dport;
    }
    if (addr === undefined || port === undefined) {
     throw new FS.ErrnoError(17);
    }
   } else {
    addr = sock.daddr;
    port = sock.dport;
   }
   var dest = SOCKFS.websocket_sock_ops.getPeer(sock, addr, port);
   if (sock.type === 1) {
    if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
     throw new FS.ErrnoError(53);
    } else if (dest.socket.readyState === dest.socket.CONNECTING) {
     throw new FS.ErrnoError(6);
    }
   }
   if (ArrayBuffer.isView(buffer)) {
    offset += buffer.byteOffset;
    buffer = buffer.buffer;
   }
   var data;
   data = buffer.slice(offset, offset + length);
   if (sock.type === 2) {
    if (!dest || dest.socket.readyState !== dest.socket.OPEN) {
     if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
      dest = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port);
     }
     dest.dgram_send_queue.push(data);
     return length;
    }
   }
   try {
    dest.socket.send(data);
    return length;
   } catch (e) {
    throw new FS.ErrnoError(28);
   }
  },
  recvmsg: function(sock, length) {
   if (sock.type === 1 && sock.server) {
    throw new FS.ErrnoError(53);
   }
   var queued = sock.recv_queue.shift();
   if (!queued) {
    if (sock.type === 1) {
     var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport);
     if (!dest) {
      throw new FS.ErrnoError(53);
     } else if (dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
      return null;
     } else {
      throw new FS.ErrnoError(6);
     }
    } else {
     throw new FS.ErrnoError(6);
    }
   }
   var queuedLength = queued.data.byteLength || queued.data.length;
   var queuedOffset = queued.data.byteOffset || 0;
   var queuedBuffer = queued.data.buffer || queued.data;
   var bytesRead = Math.min(length, queuedLength);
   var res = {
    buffer: new Uint8Array(queuedBuffer, queuedOffset, bytesRead),
    addr: queued.addr,
    port: queued.port
   };
   if (sock.type === 1 && bytesRead < queuedLength) {
    var bytesRemaining = queuedLength - bytesRead;
    queued.data = new Uint8Array(queuedBuffer, queuedOffset + bytesRead, bytesRemaining);
    sock.recv_queue.unshift(queued);
   }
   return res;
  }
 }
};

function getSocketFromFD(fd) {
 var socket = SOCKFS.getSocket(fd);
 if (!socket) throw new FS.ErrnoError(8);
 return socket;
}

function setErrNo(value) {
 SAFE_HEAP_STORE(___errno_location() | 0, value | 0, 4);
 return value;
}

var Sockets = {
 BUFFER_SIZE: 10240,
 MAX_BUFFER_SIZE: 10485760,
 nextFd: 1,
 fds: {},
 nextport: 1,
 maxport: 65535,
 peer: null,
 connections: {},
 portmap: {},
 localAddr: 4261412874,
 addrPool: [ 33554442, 50331658, 67108874, 83886090, 100663306, 117440522, 134217738, 150994954, 167772170, 184549386, 201326602, 218103818, 234881034 ]
};

function inetPton4(str) {
 var b = str.split(".");
 for (var i = 0; i < 4; i++) {
  var tmp = Number(b[i]);
  if (isNaN(tmp)) return null;
  b[i] = tmp;
 }
 return (b[0] | b[1] << 8 | b[2] << 16 | b[3] << 24) >>> 0;
}

function jstoi_q(str) {
 return parseInt(str);
}

function inetPton6(str) {
 var words;
 var w, offset, z, i;
 var valid6regx = /^((?=.*::)(?!.*::.+::)(::)?([\dA-F]{1,4}:(:|\b)|){5}|([\dA-F]{1,4}:){6})((([\dA-F]{1,4}((?!\3)::|:\b|$))|(?!\2\3)){2}|(((2[0-4]|1\d|[1-9])?\d|25[0-5])\.?\b){4})$/i;
 var parts = [];
 if (!valid6regx.test(str)) {
  return null;
 }
 if (str === "::") {
  return [ 0, 0, 0, 0, 0, 0, 0, 0 ];
 }
 if (str.startsWith("::")) {
  str = str.replace("::", "Z:");
 } else {
  str = str.replace("::", ":Z:");
 }
 if (str.indexOf(".") > 0) {
  str = str.replace(new RegExp("[.]", "g"), ":");
  words = str.split(":");
  words[words.length - 4] = jstoi_q(words[words.length - 4]) + jstoi_q(words[words.length - 3]) * 256;
  words[words.length - 3] = jstoi_q(words[words.length - 2]) + jstoi_q(words[words.length - 1]) * 256;
  words = words.slice(0, words.length - 2);
 } else {
  words = str.split(":");
 }
 offset = 0;
 z = 0;
 for (w = 0; w < words.length; w++) {
  if (typeof words[w] === "string") {
   if (words[w] === "Z") {
    for (z = 0; z < 8 - words.length + 1; z++) {
     parts[w + z] = 0;
    }
    offset = z - 1;
   } else {
    parts[w + offset] = _htons(parseInt(words[w], 16));
   }
  } else {
   parts[w + offset] = words[w];
  }
 }
 return [ parts[1] << 16 | parts[0], parts[3] << 16 | parts[2], parts[5] << 16 | parts[4], parts[7] << 16 | parts[6] ];
}

function writeSockaddr(sa, family, addr, port, addrlen) {
 switch (family) {
 case 2:
  addr = inetPton4(addr);
  zeroMemory(sa, 16);
  if (addrlen) {
   SAFE_HEAP_STORE(addrlen | 0, 16 | 0, 4);
  }
  SAFE_HEAP_STORE(sa | 0, family | 0, 2);
  SAFE_HEAP_STORE(sa + 4 | 0, addr | 0, 4);
  SAFE_HEAP_STORE(sa + 2 | 0, _htons(port) | 0, 2);
  break;

 case 10:
  addr = inetPton6(addr);
  zeroMemory(sa, 28);
  if (addrlen) {
   SAFE_HEAP_STORE(addrlen | 0, 28 | 0, 4);
  }
  SAFE_HEAP_STORE(sa | 0, family | 0, 4);
  SAFE_HEAP_STORE(sa + 8 | 0, addr[0] | 0, 4);
  SAFE_HEAP_STORE(sa + 12 | 0, addr[1] | 0, 4);
  SAFE_HEAP_STORE(sa + 16 | 0, addr[2] | 0, 4);
  SAFE_HEAP_STORE(sa + 20 | 0, addr[3] | 0, 4);
  SAFE_HEAP_STORE(sa + 2 | 0, _htons(port) | 0, 2);
  break;

 default:
  return 5;
 }
 return 0;
}

var DNS = {
 address_map: {
  id: 1,
  addrs: {},
  names: {}
 },
 lookup_name: function(name) {
  var res = inetPton4(name);
  if (res !== null) {
   return name;
  }
  res = inetPton6(name);
  if (res !== null) {
   return name;
  }
  var addr;
  if (DNS.address_map.addrs[name]) {
   addr = DNS.address_map.addrs[name];
  } else {
   var id = DNS.address_map.id++;
   assert(id < 65535, "exceeded max address mappings of 65535");
   addr = "172.29." + (id & 255) + "." + (id & 65280);
   DNS.address_map.names[addr] = name;
   DNS.address_map.addrs[name] = addr;
  }
  return addr;
 },
 lookup_addr: function(addr) {
  if (DNS.address_map.names[addr]) {
   return DNS.address_map.names[addr];
  }
  return null;
 }
};

function ___syscall_accept4(fd, addr, addrlen, flags) {
 try {
  var sock = getSocketFromFD(fd);
  var newsock = sock.sock_ops.accept(sock);
  if (addr) {
   var errno = writeSockaddr(addr, newsock.family, DNS.lookup_name(newsock.daddr), newsock.dport, addrlen);
   assert(!errno);
  }
  return newsock.stream.fd;
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return -e.errno;
 }
}

function ___syscall_access(path, amode) {
 try {
  path = SYSCALLS.getStr(path);
  return SYSCALLS.doAccess(path, amode);
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return -e.errno;
 }
}

function inetNtop4(addr) {
 return (addr & 255) + "." + (addr >> 8 & 255) + "." + (addr >> 16 & 255) + "." + (addr >> 24 & 255);
}

function inetNtop6(ints) {
 var str = "";
 var word = 0;
 var longest = 0;
 var lastzero = 0;
 var zstart = 0;
 var len = 0;
 var i = 0;
 var parts = [ ints[0] & 65535, ints[0] >> 16, ints[1] & 65535, ints[1] >> 16, ints[2] & 65535, ints[2] >> 16, ints[3] & 65535, ints[3] >> 16 ];
 var hasipv4 = true;
 var v4part = "";
 for (i = 0; i < 5; i++) {
  if (parts[i] !== 0) {
   hasipv4 = false;
   break;
  }
 }
 if (hasipv4) {
  v4part = inetNtop4(parts[6] | parts[7] << 16);
  if (parts[5] === -1) {
   str = "::ffff:";
   str += v4part;
   return str;
  }
  if (parts[5] === 0) {
   str = "::";
   if (v4part === "0.0.0.0") v4part = "";
   if (v4part === "0.0.0.1") v4part = "1";
   str += v4part;
   return str;
  }
 }
 for (word = 0; word < 8; word++) {
  if (parts[word] === 0) {
   if (word - lastzero > 1) {
    len = 0;
   }
   lastzero = word;
   len++;
  }
  if (len > longest) {
   longest = len;
   zstart = word - longest + 1;
  }
 }
 for (word = 0; word < 8; word++) {
  if (longest > 1) {
   if (parts[word] === 0 && word >= zstart && word < zstart + longest) {
    if (word === zstart) {
     str += ":";
     if (zstart === 0) str += ":";
    }
    continue;
   }
  }
  str += Number(_ntohs(parts[word] & 65535)).toString(16);
  str += word < 7 ? ":" : "";
 }
 return str;
}

function readSockaddr(sa, salen) {
 var family = SAFE_HEAP_LOAD(sa | 0, 2, 0) | 0;
 var port = _ntohs(SAFE_HEAP_LOAD(sa + 2 | 0, 2, 1) >>> 0);
 var addr;
 switch (family) {
 case 2:
  if (salen !== 16) {
   return {
    errno: 28
   };
  }
  addr = SAFE_HEAP_LOAD(sa + 4 | 0, 4, 0) | 0;
  addr = inetNtop4(addr);
  break;

 case 10:
  if (salen !== 28) {
   return {
    errno: 28
   };
  }
  addr = [ SAFE_HEAP_LOAD(sa + 8 | 0, 4, 0) | 0, SAFE_HEAP_LOAD(sa + 12 | 0, 4, 0) | 0, SAFE_HEAP_LOAD(sa + 16 | 0, 4, 0) | 0, SAFE_HEAP_LOAD(sa + 20 | 0, 4, 0) | 0 ];
  addr = inetNtop6(addr);
  break;

 default:
  return {
   errno: 5
  };
 }
 return {
  family: family,
  addr: addr,
  port: port
 };
}

function getSocketAddress(addrp, addrlen, allowNull) {
 if (allowNull && addrp === 0) return null;
 var info = readSockaddr(addrp, addrlen);
 if (info.errno) throw new FS.ErrnoError(info.errno);
 info.addr = DNS.lookup_addr(info.addr) || info.addr;
 return info;
}

function ___syscall_bind(fd, addr, addrlen) {
 try {
  var sock = getSocketFromFD(fd);
  var info = getSocketAddress(addr, addrlen);
  sock.sock_ops.bind(sock, info.addr, info.port);
  return 0;
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return -e.errno;
 }
}

function ___syscall_connect(fd, addr, addrlen) {
 try {
  var sock = getSocketFromFD(fd);
  var info = getSocketAddress(addr, addrlen);
  sock.sock_ops.connect(sock, info.addr, info.port);
  return 0;
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return -e.errno;
 }
}

function ___syscall_fcntl64(fd, cmd, varargs) {
 SYSCALLS.varargs = varargs;
 try {
  var stream = SYSCALLS.getStreamFromFD(fd);
  switch (cmd) {
  case 0:
   {
    var arg = SYSCALLS.get();
    if (arg < 0) {
     return -28;
    }
    var newStream;
    newStream = FS.open(stream.path, stream.flags, 0, arg);
    return newStream.fd;
   }

  case 1:
  case 2:
   return 0;

  case 3:
   return stream.flags;

  case 4:
   {
    var arg = SYSCALLS.get();
    stream.flags |= arg;
    return 0;
   }

  case 5:
   {
    var arg = SYSCALLS.get();
    var offset = 0;
    SAFE_HEAP_STORE(arg + offset | 0, 2 | 0, 2);
    return 0;
   }

  case 6:
  case 7:
   return 0;

  case 16:
  case 8:
   return -28;

  case 9:
   setErrNo(28);
   return -1;

  default:
   {
    return -28;
   }
  }
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return -e.errno;
 }
}

function ___syscall_fstat64(fd, buf) {
 try {
  var stream = SYSCALLS.getStreamFromFD(fd);
  return SYSCALLS.doStat(FS.stat, stream.path, buf);
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return -e.errno;
 }
}

function ___syscall_fstatat64(dirfd, path, buf, flags) {
 try {
  path = SYSCALLS.getStr(path);
  var nofollow = flags & 256;
  var allowEmpty = flags & 4096;
  flags = flags & ~4352;
  assert(!flags, flags);
  path = SYSCALLS.calculateAt(dirfd, path, allowEmpty);
  return SYSCALLS.doStat(nofollow ? FS.lstat : FS.stat, path, buf);
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return -e.errno;
 }
}

function ___syscall_ftruncate64(fd, low, high) {
 try {
  var length = SYSCALLS.get64(low, high);
  FS.ftruncate(fd, length);
  return 0;
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return -e.errno;
 }
}

function ___syscall_getcwd(buf, size) {
 try {
  if (size === 0) return -28;
  var cwd = FS.cwd();
  var cwdLengthInBytes = lengthBytesUTF8(cwd);
  if (size < cwdLengthInBytes + 1) return -68;
  stringToUTF8(cwd, buf, size);
  return buf;
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return -e.errno;
 }
}

function ___syscall_getdents64(fd, dirp, count) {
 try {
  var stream = SYSCALLS.getStreamFromFD(fd);
  if (!stream.getdents) {
   stream.getdents = FS.readdir(stream.path);
  }
  var struct_size = 280;
  var pos = 0;
  var off = FS.llseek(stream, 0, 1);
  var idx = Math.floor(off / struct_size);
  while (idx < stream.getdents.length && pos + struct_size <= count) {
   var id;
   var type;
   var name = stream.getdents[idx];
   if (name === ".") {
    id = stream.id;
    type = 4;
   } else if (name === "..") {
    var lookup = FS.lookupPath(stream.path, {
     parent: true
    });
    id = lookup.node.id;
    type = 4;
   } else {
    var child = FS.lookupNode(stream, name);
    id = child.id;
    type = FS.isChrdev(child.mode) ? 2 : FS.isDir(child.mode) ? 4 : FS.isLink(child.mode) ? 10 : 8;
   }
   assert(id);
   SAFE_HEAP_STORE(dirp + pos | 0, id | 0, 8);
   SAFE_HEAP_STORE(dirp + pos + 8 | 0, (idx + 1) * struct_size | 0, 8);
   SAFE_HEAP_STORE(dirp + pos + 16 | 0, 280 | 0, 2);
   SAFE_HEAP_STORE(dirp + pos + 18 | 0, type | 0, 1);
   stringToUTF8(name, dirp + pos + 19, 256);
   pos += struct_size;
   idx += 1;
  }
  FS.llseek(stream, idx * struct_size, 0);
  return pos;
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return -e.errno;
 }
}

function ___syscall_getsockopt(fd, level, optname, optval, optlen) {
 try {
  var sock = getSocketFromFD(fd);
  if (level === 1) {
   if (optname === 4) {
    SAFE_HEAP_STORE(optval | 0, sock.error | 0, 4);
    SAFE_HEAP_STORE(optlen | 0, 4 | 0, 4);
    sock.error = null;
    return 0;
   }
  }
  return -50;
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return -e.errno;
 }
}

function ___syscall_ioctl(fd, op, varargs) {
 SYSCALLS.varargs = varargs;
 try {
  var stream = SYSCALLS.getStreamFromFD(fd);
  switch (op) {
  case 21509:
  case 21505:
   {
    if (!stream.tty) return -59;
    return 0;
   }

  case 21510:
  case 21511:
  case 21512:
  case 21506:
  case 21507:
  case 21508:
   {
    if (!stream.tty) return -59;
    return 0;
   }

  case 21519:
   {
    if (!stream.tty) return -59;
    var argp = SYSCALLS.get();
    SAFE_HEAP_STORE(argp | 0, 0 | 0, 4);
    return 0;
   }

  case 21520:
   {
    if (!stream.tty) return -59;
    return -28;
   }

  case 21531:
   {
    var argp = SYSCALLS.get();
    return FS.ioctl(stream, op, argp);
   }

  case 21523:
   {
    if (!stream.tty) return -59;
    return 0;
   }

  case 21524:
   {
    if (!stream.tty) return -59;
    return 0;
   }

  default:
   abort("bad ioctl syscall " + op);
  }
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return -e.errno;
 }
}

function ___syscall_lstat64(path, buf) {
 try {
  path = SYSCALLS.getStr(path);
  return SYSCALLS.doStat(FS.lstat, path, buf);
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return -e.errno;
 }
}

function ___syscall_open(path, flags, varargs) {
 SYSCALLS.varargs = varargs;
 try {
  var pathname = SYSCALLS.getStr(path);
  var mode = varargs ? SYSCALLS.get() : 0;
  var stream = FS.open(pathname, flags, mode);
  return stream.fd;
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return -e.errno;
 }
}

function ___syscall_poll(fds, nfds, timeout) {
 try {
  var nonzero = 0;
  for (var i = 0; i < nfds; i++) {
   var pollfd = fds + 8 * i;
   var fd = SAFE_HEAP_LOAD(pollfd | 0, 4, 0) | 0;
   var events = SAFE_HEAP_LOAD(pollfd + 4 | 0, 2, 0) | 0;
   var mask = 32;
   var stream = FS.getStream(fd);
   if (stream) {
    mask = SYSCALLS.DEFAULT_POLLMASK;
    if (stream.stream_ops.poll) {
     mask = stream.stream_ops.poll(stream);
    }
   }
   mask &= events | 8 | 16;
   if (mask) nonzero++;
   SAFE_HEAP_STORE(pollfd + 6 | 0, mask | 0, 2);
  }
  return nonzero;
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return -e.errno;
 }
}

function ___syscall_readlink(path, buf, bufsize) {
 try {
  path = SYSCALLS.getStr(path);
  return SYSCALLS.doReadlink(path, buf, bufsize);
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return -e.errno;
 }
}

function ___syscall_recvfrom(fd, buf, len, flags, addr, addrlen) {
 try {
  var sock = getSocketFromFD(fd);
  var msg = sock.sock_ops.recvmsg(sock, len);
  if (!msg) return 0;
  if (addr) {
   var errno = writeSockaddr(addr, sock.family, DNS.lookup_name(msg.addr), msg.port, addrlen);
   assert(!errno);
  }
  HEAPU8.set(msg.buffer, buf);
  return msg.buffer.byteLength;
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return -e.errno;
 }
}

function ___syscall_sendto(fd, message, length, flags, addr, addr_len) {
 try {
  var sock = getSocketFromFD(fd);
  var dest = getSocketAddress(addr, addr_len, true);
  if (!dest) {
   return FS.write(sock.stream, HEAP8, message, length);
  } else {
   return sock.sock_ops.sendmsg(sock, HEAP8, message, length, dest.addr, dest.port);
  }
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return -e.errno;
 }
}

function ___syscall_socket(domain, type, protocol) {
 try {
  var sock = SOCKFS.createSocket(domain, type, protocol);
  assert(sock.stream.fd < 64);
  return sock.stream.fd;
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return -e.errno;
 }
}

function ___syscall_stat64(path, buf) {
 try {
  path = SYSCALLS.getStr(path);
  return SYSCALLS.doStat(FS.stat, path, buf);
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return -e.errno;
 }
}

function __dlopen_js(filename, flag) {
 abort("To use dlopen, you need to use Emscripten's linking support, see https://github.com/emscripten-core/emscripten/wiki/Linking");
}

function __dlsym_js(handle, symbol) {
 abort("To use dlopen, you need to use Emscripten's linking support, see https://github.com/emscripten-core/emscripten/wiki/Linking");
}

function _embind_repr(v) {
 if (v === null) {
  return "null";
 }
 var t = typeof v;
 if (t === "object" || t === "array" || t === "function") {
  return v.toString();
 } else {
  return "" + v;
 }
}

function embind_init_charCodes() {
 var codes = new Array(256);
 for (var i = 0; i < 256; ++i) {
  codes[i] = String.fromCharCode(i);
 }
 embind_charCodes = codes;
}

var embind_charCodes = undefined;

function readLatin1String(ptr) {
 var ret = "";
 var c = ptr;
 while (SAFE_HEAP_LOAD(c, 1, 1)) {
  ret += embind_charCodes[SAFE_HEAP_LOAD(c++, 1, 1)];
 }
 return ret;
}

var awaitingDependencies = {};

var registeredTypes = {};

var typeDependencies = {};

var char_0 = 48;

var char_9 = 57;

function makeLegalFunctionName(name) {
 if (undefined === name) {
  return "_unknown";
 }
 name = name.replace(/[^a-zA-Z0-9_]/g, "$");
 var f = name.charCodeAt(0);
 if (f >= char_0 && f <= char_9) {
  return "_" + name;
 } else {
  return name;
 }
}

function createNamedFunction(name, body) {
 name = makeLegalFunctionName(name);
 return new Function("body", "return function " + name + "() {\n" + '    "use strict";' + "    return body.apply(this, arguments);\n" + "};\n")(body);
}

function extendError(baseErrorType, errorName) {
 var errorClass = createNamedFunction(errorName, function(message) {
  this.name = errorName;
  this.message = message;
  var stack = new Error(message).stack;
  if (stack !== undefined) {
   this.stack = this.toString() + "\n" + stack.replace(/^Error(:[^\n]*)?\n/, "");
  }
 });
 errorClass.prototype = Object.create(baseErrorType.prototype);
 errorClass.prototype.constructor = errorClass;
 errorClass.prototype.toString = function() {
  if (this.message === undefined) {
   return this.name;
  } else {
   return this.name + ": " + this.message;
  }
 };
 return errorClass;
}

var BindingError = undefined;

function throwBindingError(message) {
 throw new BindingError(message);
}

var InternalError = undefined;

function throwInternalError(message) {
 throw new InternalError(message);
}

function whenDependentTypesAreResolved(myTypes, dependentTypes, getTypeConverters) {
 myTypes.forEach(function(type) {
  typeDependencies[type] = dependentTypes;
 });
 function onComplete(typeConverters) {
  var myTypeConverters = getTypeConverters(typeConverters);
  if (myTypeConverters.length !== myTypes.length) {
   throwInternalError("Mismatched type converter count");
  }
  for (var i = 0; i < myTypes.length; ++i) {
   registerType(myTypes[i], myTypeConverters[i]);
  }
 }
 var typeConverters = new Array(dependentTypes.length);
 var unregisteredTypes = [];
 var registered = 0;
 dependentTypes.forEach(function(dt, i) {
  if (registeredTypes.hasOwnProperty(dt)) {
   typeConverters[i] = registeredTypes[dt];
  } else {
   unregisteredTypes.push(dt);
   if (!awaitingDependencies.hasOwnProperty(dt)) {
    awaitingDependencies[dt] = [];
   }
   awaitingDependencies[dt].push(function() {
    typeConverters[i] = registeredTypes[dt];
    ++registered;
    if (registered === unregisteredTypes.length) {
     onComplete(typeConverters);
    }
   });
  }
 });
 if (0 === unregisteredTypes.length) {
  onComplete(typeConverters);
 }
}

function registerType(rawType, registeredInstance, options) {
 options = options || {};
 if (!("argPackAdvance" in registeredInstance)) {
  throw new TypeError("registerType registeredInstance requires argPackAdvance");
 }
 var name = registeredInstance.name;
 if (!rawType) {
  throwBindingError('type "' + name + '" must have a positive integer typeid pointer');
 }
 if (registeredTypes.hasOwnProperty(rawType)) {
  if (options.ignoreDuplicateRegistrations) {
   return;
  } else {
   throwBindingError("Cannot register type '" + name + "' twice");
  }
 }
 registeredTypes[rawType] = registeredInstance;
 delete typeDependencies[rawType];
 if (awaitingDependencies.hasOwnProperty(rawType)) {
  var callbacks = awaitingDependencies[rawType];
  delete awaitingDependencies[rawType];
  callbacks.forEach(function(cb) {
   cb();
  });
 }
}

function integerReadValueFromPointer(name, shift, signed) {
 switch (shift) {
 case 0:
  return signed ? function readS8FromPointer(pointer) {
   return SAFE_HEAP_LOAD(pointer, 1, 0);
  } : function readU8FromPointer(pointer) {
   return SAFE_HEAP_LOAD(pointer, 1, 1);
  };

 case 1:
  return signed ? function readS16FromPointer(pointer) {
   return SAFE_HEAP_LOAD((pointer >> 1) * 2, 2, 0);
  } : function readU16FromPointer(pointer) {
   return SAFE_HEAP_LOAD((pointer >> 1) * 2, 2, 1);
  };

 case 2:
  return signed ? function readS32FromPointer(pointer) {
   return SAFE_HEAP_LOAD((pointer >> 2) * 4, 4, 0);
  } : function readU32FromPointer(pointer) {
   return SAFE_HEAP_LOAD((pointer >> 2) * 4, 4, 1);
  };

 case 3:
  return signed ? function readS64FromPointer(pointer) {
   return HEAP64[pointer >> 3];
  } : function readU64FromPointer(pointer) {
   return HEAPU64[pointer >> 3];
  };

 default:
  throw new TypeError("Unknown integer type: " + name);
 }
}

function __embind_register_bigint(primitiveType, name, size, minRange, maxRange) {
 name = readLatin1String(name);
 var shift = getShiftFromSize(size);
 var isUnsignedType = name.indexOf("u") != -1;
 if (isUnsignedType) {
  maxRange = (BigInt(1) << BigInt(64)) - BigInt(1);
 }
 registerType(primitiveType, {
  name: name,
  "fromWireType": function(value) {
   return value;
  },
  "toWireType": function(destructors, value) {
   if (typeof value !== "bigint") {
    throw new TypeError('Cannot convert "' + _embind_repr(value) + '" to ' + this.name);
   }
   if (value < minRange || value > maxRange) {
    throw new TypeError('Passing a number "' + _embind_repr(value) + '" from JS side to C/C++ side to an argument of type "' + name + '", which is outside the valid range [' + minRange + ", " + maxRange + "]!");
   }
   return value;
  },
  "argPackAdvance": 8,
  "readValueFromPointer": integerReadValueFromPointer(name, shift, !isUnsignedType),
  destructorFunction: null
 });
}

function getShiftFromSize(size) {
 switch (size) {
 case 1:
  return 0;

 case 2:
  return 1;

 case 4:
  return 2;

 case 8:
  return 3;

 default:
  throw new TypeError("Unknown type size: " + size);
 }
}

function __embind_register_bool(rawType, name, size, trueValue, falseValue) {
 var shift = getShiftFromSize(size);
 name = readLatin1String(name);
 registerType(rawType, {
  name: name,
  "fromWireType": function(wt) {
   return !!wt;
  },
  "toWireType": function(destructors, o) {
   return o ? trueValue : falseValue;
  },
  "argPackAdvance": 8,
  "readValueFromPointer": function(pointer) {
   var heap;
   if (size === 1) {
    heap = HEAP8;
   } else if (size === 2) {
    heap = HEAP16;
   } else if (size === 4) {
    heap = HEAP32;
   } else {
    throw new TypeError("Unknown boolean type size: " + name);
   }
   return this["fromWireType"](heap[pointer >> shift]);
  },
  destructorFunction: null
 });
}

function ClassHandle_isAliasOf(other) {
 if (!(this instanceof ClassHandle)) {
  return false;
 }
 if (!(other instanceof ClassHandle)) {
  return false;
 }
 var leftClass = this.$$.ptrType.registeredClass;
 var left = this.$$.ptr;
 var rightClass = other.$$.ptrType.registeredClass;
 var right = other.$$.ptr;
 while (leftClass.baseClass) {
  left = leftClass.upcast(left);
  leftClass = leftClass.baseClass;
 }
 while (rightClass.baseClass) {
  right = rightClass.upcast(right);
  rightClass = rightClass.baseClass;
 }
 return leftClass === rightClass && left === right;
}

function shallowCopyInternalPointer(o) {
 return {
  count: o.count,
  deleteScheduled: o.deleteScheduled,
  preservePointerOnDelete: o.preservePointerOnDelete,
  ptr: o.ptr,
  ptrType: o.ptrType,
  smartPtr: o.smartPtr,
  smartPtrType: o.smartPtrType
 };
}

function throwInstanceAlreadyDeleted(obj) {
 function getInstanceTypeName(handle) {
  return handle.$$.ptrType.registeredClass.name;
 }
 throwBindingError(getInstanceTypeName(obj) + " instance already deleted");
}

var finalizationGroup = false;

function detachFinalizer(handle) {}

function runDestructor($$) {
 if ($$.smartPtr) {
  $$.smartPtrType.rawDestructor($$.smartPtr);
 } else {
  $$.ptrType.registeredClass.rawDestructor($$.ptr);
 }
}

function releaseClassHandle($$) {
 $$.count.value -= 1;
 var toDelete = 0 === $$.count.value;
 if (toDelete) {
  runDestructor($$);
 }
}

function attachFinalizer(handle) {
 if ("undefined" === typeof FinalizationGroup) {
  attachFinalizer = function(handle) {
   return handle;
  };
  return handle;
 }
 finalizationGroup = new FinalizationGroup(function(iter) {
  for (var result = iter.next(); !result.done; result = iter.next()) {
   var $$ = result.value;
   if (!$$.ptr) {
    console.warn("object already deleted: " + $$.ptr);
   } else {
    releaseClassHandle($$);
   }
  }
 });
 attachFinalizer = function(handle) {
  finalizationGroup.register(handle, handle.$$, handle.$$);
  return handle;
 };
 detachFinalizer = function(handle) {
  finalizationGroup.unregister(handle.$$);
 };
 return attachFinalizer(handle);
}

function ClassHandle_clone() {
 if (!this.$$.ptr) {
  throwInstanceAlreadyDeleted(this);
 }
 if (this.$$.preservePointerOnDelete) {
  this.$$.count.value += 1;
  return this;
 } else {
  var clone = attachFinalizer(Object.create(Object.getPrototypeOf(this), {
   $$: {
    value: shallowCopyInternalPointer(this.$$)
   }
  }));
  clone.$$.count.value += 1;
  clone.$$.deleteScheduled = false;
  return clone;
 }
}

function ClassHandle_delete() {
 if (!this.$$.ptr) {
  throwInstanceAlreadyDeleted(this);
 }
 if (this.$$.deleteScheduled && !this.$$.preservePointerOnDelete) {
  throwBindingError("Object already scheduled for deletion");
 }
 detachFinalizer(this);
 releaseClassHandle(this.$$);
 if (!this.$$.preservePointerOnDelete) {
  this.$$.smartPtr = undefined;
  this.$$.ptr = undefined;
 }
}

function ClassHandle_isDeleted() {
 return !this.$$.ptr;
}

var delayFunction = undefined;

var deletionQueue = [];

function flushPendingDeletes() {
 while (deletionQueue.length) {
  var obj = deletionQueue.pop();
  obj.$$.deleteScheduled = false;
  obj["delete"]();
 }
}

function ClassHandle_deleteLater() {
 if (!this.$$.ptr) {
  throwInstanceAlreadyDeleted(this);
 }
 if (this.$$.deleteScheduled && !this.$$.preservePointerOnDelete) {
  throwBindingError("Object already scheduled for deletion");
 }
 deletionQueue.push(this);
 if (deletionQueue.length === 1 && delayFunction) {
  delayFunction(flushPendingDeletes);
 }
 this.$$.deleteScheduled = true;
 return this;
}

function init_ClassHandle() {
 ClassHandle.prototype["isAliasOf"] = ClassHandle_isAliasOf;
 ClassHandle.prototype["clone"] = ClassHandle_clone;
 ClassHandle.prototype["delete"] = ClassHandle_delete;
 ClassHandle.prototype["isDeleted"] = ClassHandle_isDeleted;
 ClassHandle.prototype["deleteLater"] = ClassHandle_deleteLater;
}

function ClassHandle() {}

var registeredPointers = {};

function ensureOverloadTable(proto, methodName, humanName) {
 if (undefined === proto[methodName].overloadTable) {
  var prevFunc = proto[methodName];
  proto[methodName] = function() {
   if (!proto[methodName].overloadTable.hasOwnProperty(arguments.length)) {
    throwBindingError("Function '" + humanName + "' called with an invalid number of arguments (" + arguments.length + ") - expects one of (" + proto[methodName].overloadTable + ")!");
   }
   return proto[methodName].overloadTable[arguments.length].apply(this, arguments);
  };
  proto[methodName].overloadTable = [];
  proto[methodName].overloadTable[prevFunc.argCount] = prevFunc;
 }
}

function exposePublicSymbol(name, value, numArguments) {
 if (Module.hasOwnProperty(name)) {
  if (undefined === numArguments || undefined !== Module[name].overloadTable && undefined !== Module[name].overloadTable[numArguments]) {
   throwBindingError("Cannot register public name '" + name + "' twice");
  }
  ensureOverloadTable(Module, name, name);
  if (Module.hasOwnProperty(numArguments)) {
   throwBindingError("Cannot register multiple overloads of a function with the same number of arguments (" + numArguments + ")!");
  }
  Module[name].overloadTable[numArguments] = value;
 } else {
  Module[name] = value;
  if (undefined !== numArguments) {
   Module[name].numArguments = numArguments;
  }
 }
}

function RegisteredClass(name, constructor, instancePrototype, rawDestructor, baseClass, getActualType, upcast, downcast) {
 this.name = name;
 this.constructor = constructor;
 this.instancePrototype = instancePrototype;
 this.rawDestructor = rawDestructor;
 this.baseClass = baseClass;
 this.getActualType = getActualType;
 this.upcast = upcast;
 this.downcast = downcast;
 this.pureVirtualFunctions = [];
}

function upcastPointer(ptr, ptrClass, desiredClass) {
 while (ptrClass !== desiredClass) {
  if (!ptrClass.upcast) {
   throwBindingError("Expected null or instance of " + desiredClass.name + ", got an instance of " + ptrClass.name);
  }
  ptr = ptrClass.upcast(ptr);
  ptrClass = ptrClass.baseClass;
 }
 return ptr;
}

function constNoSmartPtrRawPointerToWireType(destructors, handle) {
 if (handle === null) {
  if (this.isReference) {
   throwBindingError("null is not a valid " + this.name);
  }
  return 0;
 }
 if (!handle.$$) {
  throwBindingError('Cannot pass "' + _embind_repr(handle) + '" as a ' + this.name);
 }
 if (!handle.$$.ptr) {
  throwBindingError("Cannot pass deleted object as a pointer of type " + this.name);
 }
 var handleClass = handle.$$.ptrType.registeredClass;
 var ptr = upcastPointer(handle.$$.ptr, handleClass, this.registeredClass);
 return ptr;
}

function genericPointerToWireType(destructors, handle) {
 var ptr;
 if (handle === null) {
  if (this.isReference) {
   throwBindingError("null is not a valid " + this.name);
  }
  if (this.isSmartPointer) {
   ptr = this.rawConstructor();
   if (destructors !== null) {
    destructors.push(this.rawDestructor, ptr);
   }
   return ptr;
  } else {
   return 0;
  }
 }
 if (!handle.$$) {
  throwBindingError('Cannot pass "' + _embind_repr(handle) + '" as a ' + this.name);
 }
 if (!handle.$$.ptr) {
  throwBindingError("Cannot pass deleted object as a pointer of type " + this.name);
 }
 if (!this.isConst && handle.$$.ptrType.isConst) {
  throwBindingError("Cannot convert argument of type " + (handle.$$.smartPtrType ? handle.$$.smartPtrType.name : handle.$$.ptrType.name) + " to parameter type " + this.name);
 }
 var handleClass = handle.$$.ptrType.registeredClass;
 ptr = upcastPointer(handle.$$.ptr, handleClass, this.registeredClass);
 if (this.isSmartPointer) {
  if (undefined === handle.$$.smartPtr) {
   throwBindingError("Passing raw pointer to smart pointer is illegal");
  }
  switch (this.sharingPolicy) {
  case 0:
   if (handle.$$.smartPtrType === this) {
    ptr = handle.$$.smartPtr;
   } else {
    throwBindingError("Cannot convert argument of type " + (handle.$$.smartPtrType ? handle.$$.smartPtrType.name : handle.$$.ptrType.name) + " to parameter type " + this.name);
   }
   break;

  case 1:
   ptr = handle.$$.smartPtr;
   break;

  case 2:
   if (handle.$$.smartPtrType === this) {
    ptr = handle.$$.smartPtr;
   } else {
    var clonedHandle = handle["clone"]();
    ptr = this.rawShare(ptr, Emval.toHandle(function() {
     clonedHandle["delete"]();
    }));
    if (destructors !== null) {
     destructors.push(this.rawDestructor, ptr);
    }
   }
   break;

  default:
   throwBindingError("Unsupporting sharing policy");
  }
 }
 return ptr;
}

function nonConstNoSmartPtrRawPointerToWireType(destructors, handle) {
 if (handle === null) {
  if (this.isReference) {
   throwBindingError("null is not a valid " + this.name);
  }
  return 0;
 }
 if (!handle.$$) {
  throwBindingError('Cannot pass "' + _embind_repr(handle) + '" as a ' + this.name);
 }
 if (!handle.$$.ptr) {
  throwBindingError("Cannot pass deleted object as a pointer of type " + this.name);
 }
 if (handle.$$.ptrType.isConst) {
  throwBindingError("Cannot convert argument of type " + handle.$$.ptrType.name + " to parameter type " + this.name);
 }
 var handleClass = handle.$$.ptrType.registeredClass;
 var ptr = upcastPointer(handle.$$.ptr, handleClass, this.registeredClass);
 return ptr;
}

function simpleReadValueFromPointer(pointer) {
 return this["fromWireType"](SAFE_HEAP_LOAD((pointer >> 2) * 4, 4, 1));
}

function RegisteredPointer_getPointee(ptr) {
 if (this.rawGetPointee) {
  ptr = this.rawGetPointee(ptr);
 }
 return ptr;
}

function RegisteredPointer_destructor(ptr) {
 if (this.rawDestructor) {
  this.rawDestructor(ptr);
 }
}

function RegisteredPointer_deleteObject(handle) {
 if (handle !== null) {
  handle["delete"]();
 }
}

function downcastPointer(ptr, ptrClass, desiredClass) {
 if (ptrClass === desiredClass) {
  return ptr;
 }
 if (undefined === desiredClass.baseClass) {
  return null;
 }
 var rv = downcastPointer(ptr, ptrClass, desiredClass.baseClass);
 if (rv === null) {
  return null;
 }
 return desiredClass.downcast(rv);
}

function getInheritedInstanceCount() {
 return Object.keys(registeredInstances).length;
}

function getLiveInheritedInstances() {
 var rv = [];
 for (var k in registeredInstances) {
  if (registeredInstances.hasOwnProperty(k)) {
   rv.push(registeredInstances[k]);
  }
 }
 return rv;
}

function setDelayFunction(fn) {
 delayFunction = fn;
 if (deletionQueue.length && delayFunction) {
  delayFunction(flushPendingDeletes);
 }
}

function init_embind() {
 Module["getInheritedInstanceCount"] = getInheritedInstanceCount;
 Module["getLiveInheritedInstances"] = getLiveInheritedInstances;
 Module["flushPendingDeletes"] = flushPendingDeletes;
 Module["setDelayFunction"] = setDelayFunction;
}

var registeredInstances = {};

function getBasestPointer(class_, ptr) {
 if (ptr === undefined) {
  throwBindingError("ptr should not be undefined");
 }
 while (class_.baseClass) {
  ptr = class_.upcast(ptr);
  class_ = class_.baseClass;
 }
 return ptr;
}

function getInheritedInstance(class_, ptr) {
 ptr = getBasestPointer(class_, ptr);
 return registeredInstances[ptr];
}

function makeClassHandle(prototype, record) {
 if (!record.ptrType || !record.ptr) {
  throwInternalError("makeClassHandle requires ptr and ptrType");
 }
 var hasSmartPtrType = !!record.smartPtrType;
 var hasSmartPtr = !!record.smartPtr;
 if (hasSmartPtrType !== hasSmartPtr) {
  throwInternalError("Both smartPtrType and smartPtr must be specified");
 }
 record.count = {
  value: 1
 };
 return attachFinalizer(Object.create(prototype, {
  $$: {
   value: record
  }
 }));
}

function RegisteredPointer_fromWireType(ptr) {
 var rawPointer = this.getPointee(ptr);
 if (!rawPointer) {
  this.destructor(ptr);
  return null;
 }
 var registeredInstance = getInheritedInstance(this.registeredClass, rawPointer);
 if (undefined !== registeredInstance) {
  if (0 === registeredInstance.$$.count.value) {
   registeredInstance.$$.ptr = rawPointer;
   registeredInstance.$$.smartPtr = ptr;
   return registeredInstance["clone"]();
  } else {
   var rv = registeredInstance["clone"]();
   this.destructor(ptr);
   return rv;
  }
 }
 function makeDefaultHandle() {
  if (this.isSmartPointer) {
   return makeClassHandle(this.registeredClass.instancePrototype, {
    ptrType: this.pointeeType,
    ptr: rawPointer,
    smartPtrType: this,
    smartPtr: ptr
   });
  } else {
   return makeClassHandle(this.registeredClass.instancePrototype, {
    ptrType: this,
    ptr: ptr
   });
  }
 }
 var actualType = this.registeredClass.getActualType(rawPointer);
 var registeredPointerRecord = registeredPointers[actualType];
 if (!registeredPointerRecord) {
  return makeDefaultHandle.call(this);
 }
 var toType;
 if (this.isConst) {
  toType = registeredPointerRecord.constPointerType;
 } else {
  toType = registeredPointerRecord.pointerType;
 }
 var dp = downcastPointer(rawPointer, this.registeredClass, toType.registeredClass);
 if (dp === null) {
  return makeDefaultHandle.call(this);
 }
 if (this.isSmartPointer) {
  return makeClassHandle(toType.registeredClass.instancePrototype, {
   ptrType: toType,
   ptr: dp,
   smartPtrType: this,
   smartPtr: ptr
  });
 } else {
  return makeClassHandle(toType.registeredClass.instancePrototype, {
   ptrType: toType,
   ptr: dp
  });
 }
}

function init_RegisteredPointer() {
 RegisteredPointer.prototype.getPointee = RegisteredPointer_getPointee;
 RegisteredPointer.prototype.destructor = RegisteredPointer_destructor;
 RegisteredPointer.prototype["argPackAdvance"] = 8;
 RegisteredPointer.prototype["readValueFromPointer"] = simpleReadValueFromPointer;
 RegisteredPointer.prototype["deleteObject"] = RegisteredPointer_deleteObject;
 RegisteredPointer.prototype["fromWireType"] = RegisteredPointer_fromWireType;
}

function RegisteredPointer(name, registeredClass, isReference, isConst, isSmartPointer, pointeeType, sharingPolicy, rawGetPointee, rawConstructor, rawShare, rawDestructor) {
 this.name = name;
 this.registeredClass = registeredClass;
 this.isReference = isReference;
 this.isConst = isConst;
 this.isSmartPointer = isSmartPointer;
 this.pointeeType = pointeeType;
 this.sharingPolicy = sharingPolicy;
 this.rawGetPointee = rawGetPointee;
 this.rawConstructor = rawConstructor;
 this.rawShare = rawShare;
 this.rawDestructor = rawDestructor;
 if (!isSmartPointer && registeredClass.baseClass === undefined) {
  if (isConst) {
   this["toWireType"] = constNoSmartPtrRawPointerToWireType;
   this.destructorFunction = null;
  } else {
   this["toWireType"] = nonConstNoSmartPtrRawPointerToWireType;
   this.destructorFunction = null;
  }
 } else {
  this["toWireType"] = genericPointerToWireType;
 }
}

function replacePublicSymbol(name, value, numArguments) {
 if (!Module.hasOwnProperty(name)) {
  throwInternalError("Replacing nonexistant public symbol");
 }
 if (undefined !== Module[name].overloadTable && undefined !== numArguments) {
  Module[name].overloadTable[numArguments] = value;
 } else {
  Module[name] = value;
  Module[name].argCount = numArguments;
 }
}

function embind__requireFunction(signature, rawFunction) {
 signature = readLatin1String(signature);
 function makeDynCaller() {
  return getWasmTableEntry(rawFunction);
 }
 var fp = makeDynCaller();
 if (typeof fp !== "function") {
  throwBindingError("unknown function pointer with signature " + signature + ": " + rawFunction);
 }
 return fp;
}

var UnboundTypeError = undefined;

function getTypeName(type) {
 var ptr = ___getTypeName(type);
 var rv = readLatin1String(ptr);
 _free(ptr);
 return rv;
}

function throwUnboundTypeError(message, types) {
 var unboundTypes = [];
 var seen = {};
 function visit(type) {
  if (seen[type]) {
   return;
  }
  if (registeredTypes[type]) {
   return;
  }
  if (typeDependencies[type]) {
   typeDependencies[type].forEach(visit);
   return;
  }
  unboundTypes.push(type);
  seen[type] = true;
 }
 types.forEach(visit);
 throw new UnboundTypeError(message + ": " + unboundTypes.map(getTypeName).join([ ", " ]));
}

function __embind_register_class(rawType, rawPointerType, rawConstPointerType, baseClassRawType, getActualTypeSignature, getActualType, upcastSignature, upcast, downcastSignature, downcast, name, destructorSignature, rawDestructor) {
 name = readLatin1String(name);
 getActualType = embind__requireFunction(getActualTypeSignature, getActualType);
 if (upcast) {
  upcast = embind__requireFunction(upcastSignature, upcast);
 }
 if (downcast) {
  downcast = embind__requireFunction(downcastSignature, downcast);
 }
 rawDestructor = embind__requireFunction(destructorSignature, rawDestructor);
 var legalFunctionName = makeLegalFunctionName(name);
 exposePublicSymbol(legalFunctionName, function() {
  throwUnboundTypeError("Cannot construct " + name + " due to unbound types", [ baseClassRawType ]);
 });
 whenDependentTypesAreResolved([ rawType, rawPointerType, rawConstPointerType ], baseClassRawType ? [ baseClassRawType ] : [], function(base) {
  base = base[0];
  var baseClass;
  var basePrototype;
  if (baseClassRawType) {
   baseClass = base.registeredClass;
   basePrototype = baseClass.instancePrototype;
  } else {
   basePrototype = ClassHandle.prototype;
  }
  var constructor = createNamedFunction(legalFunctionName, function() {
   if (Object.getPrototypeOf(this) !== instancePrototype) {
    throw new BindingError("Use 'new' to construct " + name);
   }
   if (undefined === registeredClass.constructor_body) {
    throw new BindingError(name + " has no accessible constructor");
   }
   var body = registeredClass.constructor_body[arguments.length];
   if (undefined === body) {
    throw new BindingError("Tried to invoke ctor of " + name + " with invalid number of parameters (" + arguments.length + ") - expected (" + Object.keys(registeredClass.constructor_body).toString() + ") parameters instead!");
   }
   return body.apply(this, arguments);
  });
  var instancePrototype = Object.create(basePrototype, {
   constructor: {
    value: constructor
   }
  });
  constructor.prototype = instancePrototype;
  var registeredClass = new RegisteredClass(name, constructor, instancePrototype, rawDestructor, baseClass, getActualType, upcast, downcast);
  var referenceConverter = new RegisteredPointer(name, registeredClass, true, false, false);
  var pointerConverter = new RegisteredPointer(name + "*", registeredClass, false, false, false);
  var constPointerConverter = new RegisteredPointer(name + " const*", registeredClass, false, true, false);
  registeredPointers[rawType] = {
   pointerType: pointerConverter,
   constPointerType: constPointerConverter
  };
  replacePublicSymbol(legalFunctionName, constructor);
  return [ referenceConverter, pointerConverter, constPointerConverter ];
 });
}

function heap32VectorToArray(count, firstElement) {
 var array = [];
 for (var i = 0; i < count; i++) {
  array.push(SAFE_HEAP_LOAD(((firstElement >> 2) + i) * 4, 4, 0));
 }
 return array;
}

function runDestructors(destructors) {
 while (destructors.length) {
  var ptr = destructors.pop();
  var del = destructors.pop();
  del(ptr);
 }
}

function __embind_register_class_constructor(rawClassType, argCount, rawArgTypesAddr, invokerSignature, invoker, rawConstructor) {
 assert(argCount > 0);
 var rawArgTypes = heap32VectorToArray(argCount, rawArgTypesAddr);
 invoker = embind__requireFunction(invokerSignature, invoker);
 var args = [ rawConstructor ];
 var destructors = [];
 whenDependentTypesAreResolved([], [ rawClassType ], function(classType) {
  classType = classType[0];
  var humanName = "constructor " + classType.name;
  if (undefined === classType.registeredClass.constructor_body) {
   classType.registeredClass.constructor_body = [];
  }
  if (undefined !== classType.registeredClass.constructor_body[argCount - 1]) {
   throw new BindingError("Cannot register multiple constructors with identical number of parameters (" + (argCount - 1) + ") for class '" + classType.name + "'! Overload resolution is currently only performed using the parameter count, not actual type info!");
  }
  classType.registeredClass.constructor_body[argCount - 1] = function unboundTypeHandler() {
   throwUnboundTypeError("Cannot construct " + classType.name + " due to unbound types", rawArgTypes);
  };
  whenDependentTypesAreResolved([], rawArgTypes, function(argTypes) {
   argTypes.splice(1, 0, null);
   classType.registeredClass.constructor_body[argCount - 1] = craftInvokerFunction(humanName, argTypes, null, invoker, rawConstructor);
   return [];
  });
  return [];
 });
}

function new_(constructor, argumentList) {
 if (!(constructor instanceof Function)) {
  throw new TypeError("new_ called with constructor type " + typeof constructor + " which is not a function");
 }
 var dummy = createNamedFunction(constructor.name || "unknownFunctionName", function() {});
 dummy.prototype = constructor.prototype;
 var obj = new dummy();
 var r = constructor.apply(obj, argumentList);
 return r instanceof Object ? r : obj;
}

function craftInvokerFunction(humanName, argTypes, classType, cppInvokerFunc, cppTargetFunc) {
 var argCount = argTypes.length;
 if (argCount < 2) {
  throwBindingError("argTypes array size mismatch! Must at least get return value and 'this' types!");
 }
 var isClassMethodFunc = argTypes[1] !== null && classType !== null;
 var needsDestructorStack = false;
 for (var i = 1; i < argTypes.length; ++i) {
  if (argTypes[i] !== null && argTypes[i].destructorFunction === undefined) {
   needsDestructorStack = true;
   break;
  }
 }
 var returns = argTypes[0].name !== "void";
 var argsList = "";
 var argsListWired = "";
 for (var i = 0; i < argCount - 2; ++i) {
  argsList += (i !== 0 ? ", " : "") + "arg" + i;
  argsListWired += (i !== 0 ? ", " : "") + "arg" + i + "Wired";
 }
 var invokerFnBody = "return function " + makeLegalFunctionName(humanName) + "(" + argsList + ") {\n" + "if (arguments.length !== " + (argCount - 2) + ") {\n" + "throwBindingError('function " + humanName + " called with ' + arguments.length + ' arguments, expected " + (argCount - 2) + " args!');\n" + "}\n";
 if (needsDestructorStack) {
  invokerFnBody += "var destructors = [];\n";
 }
 var dtorStack = needsDestructorStack ? "destructors" : "null";
 var args1 = [ "throwBindingError", "invoker", "fn", "runDestructors", "retType", "classParam" ];
 var args2 = [ throwBindingError, cppInvokerFunc, cppTargetFunc, runDestructors, argTypes[0], argTypes[1] ];
 if (isClassMethodFunc) {
  invokerFnBody += "var thisWired = classParam.toWireType(" + dtorStack + ", this);\n";
 }
 for (var i = 0; i < argCount - 2; ++i) {
  invokerFnBody += "var arg" + i + "Wired = argType" + i + ".toWireType(" + dtorStack + ", arg" + i + "); // " + argTypes[i + 2].name + "\n";
  args1.push("argType" + i);
  args2.push(argTypes[i + 2]);
 }
 if (isClassMethodFunc) {
  argsListWired = "thisWired" + (argsListWired.length > 0 ? ", " : "") + argsListWired;
 }
 invokerFnBody += (returns ? "var rv = " : "") + "invoker(fn" + (argsListWired.length > 0 ? ", " : "") + argsListWired + ");\n";
 if (needsDestructorStack) {
  invokerFnBody += "runDestructors(destructors);\n";
 } else {
  for (var i = isClassMethodFunc ? 1 : 2; i < argTypes.length; ++i) {
   var paramName = i === 1 ? "thisWired" : "arg" + (i - 2) + "Wired";
   if (argTypes[i].destructorFunction !== null) {
    invokerFnBody += paramName + "_dtor(" + paramName + "); // " + argTypes[i].name + "\n";
    args1.push(paramName + "_dtor");
    args2.push(argTypes[i].destructorFunction);
   }
  }
 }
 if (returns) {
  invokerFnBody += "var ret = retType.fromWireType(rv);\n" + "return ret;\n";
 } else {}
 invokerFnBody += "}\n";
 args1.push(invokerFnBody);
 var invokerFunction = new_(Function, args1).apply(null, args2);
 return invokerFunction;
}

function __embind_register_class_function(rawClassType, methodName, argCount, rawArgTypesAddr, invokerSignature, rawInvoker, context, isPureVirtual) {
 var rawArgTypes = heap32VectorToArray(argCount, rawArgTypesAddr);
 methodName = readLatin1String(methodName);
 rawInvoker = embind__requireFunction(invokerSignature, rawInvoker);
 whenDependentTypesAreResolved([], [ rawClassType ], function(classType) {
  classType = classType[0];
  var humanName = classType.name + "." + methodName;
  if (methodName.startsWith("@@")) {
   methodName = Symbol[methodName.substring(2)];
  }
  if (isPureVirtual) {
   classType.registeredClass.pureVirtualFunctions.push(methodName);
  }
  function unboundTypesHandler() {
   throwUnboundTypeError("Cannot call " + humanName + " due to unbound types", rawArgTypes);
  }
  var proto = classType.registeredClass.instancePrototype;
  var method = proto[methodName];
  if (undefined === method || undefined === method.overloadTable && method.className !== classType.name && method.argCount === argCount - 2) {
   unboundTypesHandler.argCount = argCount - 2;
   unboundTypesHandler.className = classType.name;
   proto[methodName] = unboundTypesHandler;
  } else {
   ensureOverloadTable(proto, methodName, humanName);
   proto[methodName].overloadTable[argCount - 2] = unboundTypesHandler;
  }
  whenDependentTypesAreResolved([], rawArgTypes, function(argTypes) {
   var memberFunction = craftInvokerFunction(humanName, argTypes, classType, rawInvoker, context);
   if (undefined === proto[methodName].overloadTable) {
    memberFunction.argCount = argCount - 2;
    proto[methodName] = memberFunction;
   } else {
    proto[methodName].overloadTable[argCount - 2] = memberFunction;
   }
   return [];
  });
  return [];
 });
}

var emval_free_list = [];

var emval_handle_array = [ {}, {
 value: undefined
}, {
 value: null
}, {
 value: true
}, {
 value: false
} ];

function __emval_decref(handle) {
 if (handle > 4 && 0 === --emval_handle_array[handle].refcount) {
  emval_handle_array[handle] = undefined;
  emval_free_list.push(handle);
 }
}

function count_emval_handles() {
 var count = 0;
 for (var i = 5; i < emval_handle_array.length; ++i) {
  if (emval_handle_array[i] !== undefined) {
   ++count;
  }
 }
 return count;
}

function get_first_emval() {
 for (var i = 5; i < emval_handle_array.length; ++i) {
  if (emval_handle_array[i] !== undefined) {
   return emval_handle_array[i];
  }
 }
 return null;
}

function init_emval() {
 Module["count_emval_handles"] = count_emval_handles;
 Module["get_first_emval"] = get_first_emval;
}

var Emval = {
 toValue: function(handle) {
  if (!handle) {
   throwBindingError("Cannot use deleted val. handle = " + handle);
  }
  return emval_handle_array[handle].value;
 },
 toHandle: function(value) {
  switch (value) {
  case undefined:
   {
    return 1;
   }

  case null:
   {
    return 2;
   }

  case true:
   {
    return 3;
   }

  case false:
   {
    return 4;
   }

  default:
   {
    var handle = emval_free_list.length ? emval_free_list.pop() : emval_handle_array.length;
    emval_handle_array[handle] = {
     refcount: 1,
     value: value
    };
    return handle;
   }
  }
 }
};

function __embind_register_emval(rawType, name) {
 name = readLatin1String(name);
 registerType(rawType, {
  name: name,
  "fromWireType": function(handle) {
   var rv = Emval.toValue(handle);
   __emval_decref(handle);
   return rv;
  },
  "toWireType": function(destructors, value) {
   return Emval.toHandle(value);
  },
  "argPackAdvance": 8,
  "readValueFromPointer": simpleReadValueFromPointer,
  destructorFunction: null
 });
}

function enumReadValueFromPointer(name, shift, signed) {
 switch (shift) {
 case 0:
  return function(pointer) {
   var heap = signed ? HEAP8 : HEAPU8;
   return this["fromWireType"](heap[pointer]);
  };

 case 1:
  return function(pointer) {
   var heap = signed ? HEAP16 : HEAPU16;
   return this["fromWireType"](heap[pointer >> 1]);
  };

 case 2:
  return function(pointer) {
   var heap = signed ? HEAP32 : HEAPU32;
   return this["fromWireType"](heap[pointer >> 2]);
  };

 default:
  throw new TypeError("Unknown integer type: " + name);
 }
}

function __embind_register_enum(rawType, name, size, isSigned) {
 var shift = getShiftFromSize(size);
 name = readLatin1String(name);
 function ctor() {}
 ctor.values = {};
 registerType(rawType, {
  name: name,
  constructor: ctor,
  "fromWireType": function(c) {
   return this.constructor.values[c];
  },
  "toWireType": function(destructors, c) {
   return c.value;
  },
  "argPackAdvance": 8,
  "readValueFromPointer": enumReadValueFromPointer(name, shift, isSigned),
  destructorFunction: null
 });
 exposePublicSymbol(name, ctor);
}

function requireRegisteredType(rawType, humanName) {
 var impl = registeredTypes[rawType];
 if (undefined === impl) {
  throwBindingError(humanName + " has unknown type " + getTypeName(rawType));
 }
 return impl;
}

function __embind_register_enum_value(rawEnumType, name, enumValue) {
 var enumType = requireRegisteredType(rawEnumType, "enum");
 name = readLatin1String(name);
 var Enum = enumType.constructor;
 var Value = Object.create(enumType.constructor.prototype, {
  value: {
   value: enumValue
  },
  constructor: {
   value: createNamedFunction(enumType.name + "_" + name, function() {})
  }
 });
 Enum.values[enumValue] = Value;
 Enum[name] = Value;
}

function floatReadValueFromPointer(name, shift) {
 switch (shift) {
 case 2:
  return function(pointer) {
   return this["fromWireType"](SAFE_HEAP_LOAD_D((pointer >> 2) * 4, 4, 0));
  };

 case 3:
  return function(pointer) {
   return this["fromWireType"](SAFE_HEAP_LOAD_D((pointer >> 3) * 8, 8, 0));
  };

 default:
  throw new TypeError("Unknown float type: " + name);
 }
}

function __embind_register_float(rawType, name, size) {
 var shift = getShiftFromSize(size);
 name = readLatin1String(name);
 registerType(rawType, {
  name: name,
  "fromWireType": function(value) {
   return value;
  },
  "toWireType": function(destructors, value) {
   if (typeof value !== "number" && typeof value !== "boolean") {
    throw new TypeError('Cannot convert "' + _embind_repr(value) + '" to ' + this.name);
   }
   return value;
  },
  "argPackAdvance": 8,
  "readValueFromPointer": floatReadValueFromPointer(name, shift),
  destructorFunction: null
 });
}

function __embind_register_function(name, argCount, rawArgTypesAddr, signature, rawInvoker, fn) {
 var argTypes = heap32VectorToArray(argCount, rawArgTypesAddr);
 name = readLatin1String(name);
 rawInvoker = embind__requireFunction(signature, rawInvoker);
 exposePublicSymbol(name, function() {
  throwUnboundTypeError("Cannot call " + name + " due to unbound types", argTypes);
 }, argCount - 1);
 whenDependentTypesAreResolved([], argTypes, function(argTypes) {
  var invokerArgsArray = [ argTypes[0], null ].concat(argTypes.slice(1));
  replacePublicSymbol(name, craftInvokerFunction(name, invokerArgsArray, null, rawInvoker, fn), argCount - 1);
  return [];
 });
}

function __embind_register_integer(primitiveType, name, size, minRange, maxRange) {
 name = readLatin1String(name);
 if (maxRange === -1) {
  maxRange = 4294967295;
 }
 var shift = getShiftFromSize(size);
 var fromWireType = function(value) {
  return value;
 };
 if (minRange === 0) {
  var bitshift = 32 - 8 * size;
  fromWireType = function(value) {
   return value << bitshift >>> bitshift;
  };
 }
 var isUnsignedType = name.includes("unsigned");
 registerType(primitiveType, {
  name: name,
  "fromWireType": fromWireType,
  "toWireType": function(destructors, value) {
   if (typeof value !== "number" && typeof value !== "boolean") {
    throw new TypeError('Cannot convert "' + _embind_repr(value) + '" to ' + this.name);
   }
   if (value < minRange || value > maxRange) {
    throw new TypeError('Passing a number "' + _embind_repr(value) + '" from JS side to C/C++ side to an argument of type "' + name + '", which is outside the valid range [' + minRange + ", " + maxRange + "]!");
   }
   return isUnsignedType ? value >>> 0 : value | 0;
  },
  "argPackAdvance": 8,
  "readValueFromPointer": integerReadValueFromPointer(name, shift, minRange !== 0),
  destructorFunction: null
 });
}

function __embind_register_memory_view(rawType, dataTypeIndex, name) {
 var typeMapping = [ Int8Array, Uint8Array, Int16Array, Uint16Array, Int32Array, Uint32Array, Float32Array, Float64Array, BigInt64Array, BigUint64Array ];
 var TA = typeMapping[dataTypeIndex];
 function decodeMemoryView(handle) {
  handle = handle >> 2;
  var heap = HEAPU32;
  var size = heap[handle];
  var data = heap[handle + 1];
  return new TA(buffer, data, size);
 }
 name = readLatin1String(name);
 registerType(rawType, {
  name: name,
  "fromWireType": decodeMemoryView,
  "argPackAdvance": 8,
  "readValueFromPointer": decodeMemoryView
 }, {
  ignoreDuplicateRegistrations: true
 });
}

function __embind_register_std_string(rawType, name) {
 name = readLatin1String(name);
 var stdStringIsUTF8 = name === "std::string";
 registerType(rawType, {
  name: name,
  "fromWireType": function(value) {
   var length = SAFE_HEAP_LOAD((value >> 2) * 4, 4, 1);
   var str;
   if (stdStringIsUTF8) {
    var decodeStartPtr = value + 4;
    for (var i = 0; i <= length; ++i) {
     var currentBytePtr = value + 4 + i;
     if (i == length || SAFE_HEAP_LOAD(currentBytePtr, 1, 1) == 0) {
      var maxRead = currentBytePtr - decodeStartPtr;
      var stringSegment = UTF8ToString(decodeStartPtr, maxRead);
      if (str === undefined) {
       str = stringSegment;
      } else {
       str += String.fromCharCode(0);
       str += stringSegment;
      }
      decodeStartPtr = currentBytePtr + 1;
     }
    }
   } else {
    var a = new Array(length);
    for (var i = 0; i < length; ++i) {
     a[i] = String.fromCharCode(SAFE_HEAP_LOAD(value + 4 + i, 1, 1));
    }
    str = a.join("");
   }
   _free(value);
   return str;
  },
  "toWireType": function(destructors, value) {
   if (value instanceof ArrayBuffer) {
    value = new Uint8Array(value);
   }
   var getLength;
   var valueIsOfTypeString = typeof value === "string";
   if (!(valueIsOfTypeString || value instanceof Uint8Array || value instanceof Uint8ClampedArray || value instanceof Int8Array)) {
    throwBindingError("Cannot pass non-string to std::string");
   }
   if (stdStringIsUTF8 && valueIsOfTypeString) {
    getLength = function() {
     return lengthBytesUTF8(value);
    };
   } else {
    getLength = function() {
     return value.length;
    };
   }
   var length = getLength();
   var ptr = _malloc(4 + length + 1);
   SAFE_HEAP_STORE((ptr >> 2) * 4, length, 4);
   if (stdStringIsUTF8 && valueIsOfTypeString) {
    stringToUTF8(value, ptr + 4, length + 1);
   } else {
    if (valueIsOfTypeString) {
     for (var i = 0; i < length; ++i) {
      var charCode = value.charCodeAt(i);
      if (charCode > 255) {
       _free(ptr);
       throwBindingError("String has UTF-16 code units that do not fit in 8 bits");
      }
      SAFE_HEAP_STORE(ptr + 4 + i, charCode, 1);
     }
    } else {
     for (var i = 0; i < length; ++i) {
      SAFE_HEAP_STORE(ptr + 4 + i, value[i], 1);
     }
    }
   }
   if (destructors !== null) {
    destructors.push(_free, ptr);
   }
   return ptr;
  },
  "argPackAdvance": 8,
  "readValueFromPointer": simpleReadValueFromPointer,
  destructorFunction: function(ptr) {
   _free(ptr);
  }
 });
}

function __embind_register_std_wstring(rawType, charSize, name) {
 name = readLatin1String(name);
 var decodeString, encodeString, getHeap, lengthBytesUTF, shift;
 if (charSize === 2) {
  decodeString = UTF16ToString;
  encodeString = stringToUTF16;
  lengthBytesUTF = lengthBytesUTF16;
  getHeap = function() {
   return HEAPU16;
  };
  shift = 1;
 } else if (charSize === 4) {
  decodeString = UTF32ToString;
  encodeString = stringToUTF32;
  lengthBytesUTF = lengthBytesUTF32;
  getHeap = function() {
   return HEAPU32;
  };
  shift = 2;
 }
 registerType(rawType, {
  name: name,
  "fromWireType": function(value) {
   var length = SAFE_HEAP_LOAD((value >> 2) * 4, 4, 1);
   var HEAP = getHeap();
   var str;
   var decodeStartPtr = value + 4;
   for (var i = 0; i <= length; ++i) {
    var currentBytePtr = value + 4 + i * charSize;
    if (i == length || HEAP[currentBytePtr >> shift] == 0) {
     var maxReadBytes = currentBytePtr - decodeStartPtr;
     var stringSegment = decodeString(decodeStartPtr, maxReadBytes);
     if (str === undefined) {
      str = stringSegment;
     } else {
      str += String.fromCharCode(0);
      str += stringSegment;
     }
     decodeStartPtr = currentBytePtr + charSize;
    }
   }
   _free(value);
   return str;
  },
  "toWireType": function(destructors, value) {
   if (!(typeof value === "string")) {
    throwBindingError("Cannot pass non-string to C++ string type " + name);
   }
   var length = lengthBytesUTF(value);
   var ptr = _malloc(4 + length + charSize);
   SAFE_HEAP_STORE((ptr >> 2) * 4, length >> shift, 4);
   encodeString(value, ptr + 4, length + charSize);
   if (destructors !== null) {
    destructors.push(_free, ptr);
   }
   return ptr;
  },
  "argPackAdvance": 8,
  "readValueFromPointer": simpleReadValueFromPointer,
  destructorFunction: function(ptr) {
   _free(ptr);
  }
 });
}

function __embind_register_void(rawType, name) {
 name = readLatin1String(name);
 registerType(rawType, {
  isVoid: true,
  name: name,
  "argPackAdvance": 0,
  "fromWireType": function() {
   return undefined;
  },
  "toWireType": function(destructors, o) {
   return undefined;
  }
 });
}

function __emval_incref(handle) {
 if (handle > 4) {
  emval_handle_array[handle].refcount += 1;
 }
}

function __emval_take_value(type, argv) {
 type = requireRegisteredType(type, "_emval_take_value");
 var v = type["readValueFromPointer"](argv);
 return Emval.toHandle(v);
}

function _abort() {
 abort("native code called abort()");
}

var _emscripten_get_now;

_emscripten_get_now = function() {
 return performance.now();
};

var _emscripten_get_now_is_monotonic = true;

function _clock_gettime(clk_id, tp) {
 var now;
 if (clk_id === 0) {
  now = Date.now();
 } else if ((clk_id === 1 || clk_id === 4) && _emscripten_get_now_is_monotonic) {
  now = _emscripten_get_now();
 } else {
  setErrNo(28);
  return -1;
 }
 SAFE_HEAP_STORE(tp | 0, now / 1e3 | 0 | 0, 4);
 SAFE_HEAP_STORE(tp + 4 | 0, now % 1e3 * 1e3 * 1e3 | 0 | 0, 4);
 return 0;
}

function _difftime(time1, time0) {
 return time1 - time0;
}

function abortOnCannotGrowMemory(requestedSize) {
 abort("Cannot enlarge memory arrays to size " + requestedSize + " bytes (OOM). Either (1) compile with  -s INITIAL_MEMORY=X  with X higher than the current value " + HEAP8.length + ", (2) compile with  -s ALLOW_MEMORY_GROWTH=1  which allows increasing the size at runtime, or (3) if you want malloc to return NULL (0) instead of this abort, compile with  -s ABORTING_MALLOC=0 ");
}

function _emscripten_resize_heap(requestedSize) {
 var oldSize = HEAPU8.length;
 requestedSize = requestedSize >>> 0;
 abortOnCannotGrowMemory(requestedSize);
}

var ENV = {};

function getExecutableName() {
 return thisProgram || "./this.program";
}

function getEnvStrings() {
 if (!getEnvStrings.strings) {
  var lang = (typeof navigator === "object" && navigator.languages && navigator.languages[0] || "C").replace("-", "_") + ".UTF-8";
  var env = {
   "USER": "web_user",
   "LOGNAME": "web_user",
   "PATH": "/",
   "PWD": "/",
   "HOME": "/home/web_user",
   "LANG": lang,
   "_": getExecutableName()
  };
  for (var x in ENV) {
   if (ENV[x] === undefined) delete env[x]; else env[x] = ENV[x];
  }
  var strings = [];
  for (var x in env) {
   strings.push(x + "=" + env[x]);
  }
  getEnvStrings.strings = strings;
 }
 return getEnvStrings.strings;
}

function _environ_get(__environ, environ_buf) {
 var bufSize = 0;
 getEnvStrings().forEach(function(string, i) {
  var ptr = environ_buf + bufSize;
  SAFE_HEAP_STORE(__environ + i * 4 | 0, ptr | 0, 4);
  writeAsciiToMemory(string, ptr);
  bufSize += string.length + 1;
 });
 return 0;
}

function _environ_sizes_get(penviron_count, penviron_buf_size) {
 var strings = getEnvStrings();
 SAFE_HEAP_STORE(penviron_count | 0, strings.length | 0, 4);
 var bufSize = 0;
 strings.forEach(function(string) {
  bufSize += string.length + 1;
 });
 SAFE_HEAP_STORE(penviron_buf_size | 0, bufSize | 0, 4);
 return 0;
}

function _exit(status) {
 exit(status);
}

function _fd_close(fd) {
 try {
  var stream = SYSCALLS.getStreamFromFD(fd);
  FS.close(stream);
  return 0;
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return e.errno;
 }
}

function _fd_pread(fd, iov, iovcnt, offset_bigint, pnum) {
 try {
  var offset_low = Number(offset_bigint & BigInt(4294967295)) | 0, offset_high = Number(offset_bigint >> BigInt(32)) | 0;
  assert(!offset_high, "offsets over 2^32 not yet supported");
  var stream = SYSCALLS.getStreamFromFD(fd);
  var num = SYSCALLS.doReadv(stream, iov, iovcnt, offset_low);
  SAFE_HEAP_STORE(pnum | 0, num | 0, 4);
  return 0;
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return e.errno;
 }
}

function _fd_pwrite(fd, iov, iovcnt, offset_bigint, pnum) {
 try {
  var offset_low = Number(offset_bigint & BigInt(4294967295)) | 0, offset_high = Number(offset_bigint >> BigInt(32)) | 0;
  var stream = SYSCALLS.getStreamFromFD(fd);
  assert(!offset_high, "offsets over 2^32 not yet supported");
  var num = SYSCALLS.doWritev(stream, iov, iovcnt, offset_low);
  SAFE_HEAP_STORE(pnum | 0, num | 0, 4);
  return 0;
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return e.errno;
 }
}

function _fd_read(fd, iov, iovcnt, pnum) {
 try {
  var stream = SYSCALLS.getStreamFromFD(fd);
  var num = SYSCALLS.doReadv(stream, iov, iovcnt);
  SAFE_HEAP_STORE(pnum | 0, num | 0, 4);
  return 0;
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return e.errno;
 }
}

function _fd_seek(fd, offset_bigint, whence, newOffset) {
 try {
  var offset_low = Number(offset_bigint & BigInt(4294967295)) | 0, offset_high = Number(offset_bigint >> BigInt(32)) | 0;
  var stream = SYSCALLS.getStreamFromFD(fd);
  var HIGH_OFFSET = 4294967296;
  var offset = offset_high * HIGH_OFFSET + (offset_low >>> 0);
  var DOUBLE_LIMIT = 9007199254740992;
  if (offset <= -DOUBLE_LIMIT || offset >= DOUBLE_LIMIT) {
   return -61;
  }
  FS.llseek(stream, offset, whence);
  SAFE_HEAP_STORE(newOffset | 0, stream.position | 0, 8);
  if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null;
  return 0;
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return e.errno;
 }
}

function _fd_write(fd, iov, iovcnt, pnum) {
 try {
  var stream = SYSCALLS.getStreamFromFD(fd);
  var num = SYSCALLS.doWritev(stream, iov, iovcnt);
  SAFE_HEAP_STORE(pnum | 0, num | 0, 4);
  return 0;
 } catch (e) {
  if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) throw e;
  return e.errno;
 }
}

function _getTempRet0() {
 return getTempRet0();
}

function getHostByName(name) {
 var ret = _malloc(20);
 var nameBuf = _malloc(name.length + 1);
 stringToUTF8(name, nameBuf, name.length + 1);
 SAFE_HEAP_STORE(ret | 0, nameBuf | 0, 4);
 var aliasesBuf = _malloc(4);
 SAFE_HEAP_STORE(aliasesBuf | 0, 0 | 0, 4);
 SAFE_HEAP_STORE(ret + 4 | 0, aliasesBuf | 0, 4);
 var afinet = 2;
 SAFE_HEAP_STORE(ret + 8 | 0, afinet | 0, 4);
 SAFE_HEAP_STORE(ret + 12 | 0, 4 | 0, 4);
 var addrListBuf = _malloc(12);
 SAFE_HEAP_STORE(addrListBuf | 0, addrListBuf + 8 | 0, 4);
 SAFE_HEAP_STORE(addrListBuf + 4 | 0, 0 | 0, 4);
 SAFE_HEAP_STORE(addrListBuf + 8 | 0, inetPton4(DNS.lookup_name(name)) | 0, 4);
 SAFE_HEAP_STORE(ret + 16 | 0, addrListBuf | 0, 4);
 return ret;
}

function _gethostbyname(name) {
 return getHostByName(UTF8ToString(name));
}

function _gethostbyname_r(name, ret, buf, buflen, out, err) {
 var data = _gethostbyname(name);
 _memcpy(ret, data, 20);
 _free(data);
 SAFE_HEAP_STORE(err | 0, 0 | 0, 4);
 SAFE_HEAP_STORE(out | 0, ret | 0, 4);
 return 0;
}

function _gettimeofday(ptr) {
 var now = Date.now();
 SAFE_HEAP_STORE(ptr | 0, now / 1e3 | 0 | 0, 4);
 SAFE_HEAP_STORE(ptr + 4 | 0, now % 1e3 * 1e3 | 0 | 0, 4);
 return 0;
}

function _mktime(tmPtr) {
 _tzset();
 var date = new Date((SAFE_HEAP_LOAD(tmPtr + 20 | 0, 4, 0) | 0) + 1900, SAFE_HEAP_LOAD(tmPtr + 16 | 0, 4, 0) | 0, SAFE_HEAP_LOAD(tmPtr + 12 | 0, 4, 0) | 0, SAFE_HEAP_LOAD(tmPtr + 8 | 0, 4, 0) | 0, SAFE_HEAP_LOAD(tmPtr + 4 | 0, 4, 0) | 0, SAFE_HEAP_LOAD(tmPtr | 0, 4, 0) | 0, 0);
 var dst = SAFE_HEAP_LOAD(tmPtr + 32 | 0, 4, 0) | 0;
 var guessedOffset = date.getTimezoneOffset();
 var start = new Date(date.getFullYear(), 0, 1);
 var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset();
 var winterOffset = start.getTimezoneOffset();
 var dstOffset = Math.min(winterOffset, summerOffset);
 if (dst < 0) {
  SAFE_HEAP_STORE(tmPtr + 32 | 0, Number(summerOffset != winterOffset && dstOffset == guessedOffset) | 0, 4);
 } else if (dst > 0 != (dstOffset == guessedOffset)) {
  var nonDstOffset = Math.max(winterOffset, summerOffset);
  var trueOffset = dst > 0 ? dstOffset : nonDstOffset;
  date.setTime(date.getTime() + (trueOffset - guessedOffset) * 6e4);
 }
 SAFE_HEAP_STORE(tmPtr + 24 | 0, date.getDay() | 0, 4);
 var yday = (date.getTime() - start.getTime()) / (1e3 * 60 * 60 * 24) | 0;
 SAFE_HEAP_STORE(tmPtr + 28 | 0, yday | 0, 4);
 SAFE_HEAP_STORE(tmPtr | 0, date.getSeconds() | 0, 4);
 SAFE_HEAP_STORE(tmPtr + 4 | 0, date.getMinutes() | 0, 4);
 SAFE_HEAP_STORE(tmPtr + 8 | 0, date.getHours() | 0, 4);
 SAFE_HEAP_STORE(tmPtr + 12 | 0, date.getDate() | 0, 4);
 SAFE_HEAP_STORE(tmPtr + 16 | 0, date.getMonth() | 0, 4);
 return date.getTime() / 1e3 | 0;
}

function __isLeapYear(year) {
 return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0);
}

function __arraySum(array, index) {
 var sum = 0;
 for (var i = 0; i <= index; sum += array[i++]) {}
 return sum;
}

var __MONTH_DAYS_LEAP = [ 31, 29, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31 ];

var __MONTH_DAYS_REGULAR = [ 31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31 ];

function __addDays(date, days) {
 var newDate = new Date(date.getTime());
 while (days > 0) {
  var leap = __isLeapYear(newDate.getFullYear());
  var currentMonth = newDate.getMonth();
  var daysInCurrentMonth = (leap ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR)[currentMonth];
  if (days > daysInCurrentMonth - newDate.getDate()) {
   days -= daysInCurrentMonth - newDate.getDate() + 1;
   newDate.setDate(1);
   if (currentMonth < 11) {
    newDate.setMonth(currentMonth + 1);
   } else {
    newDate.setMonth(0);
    newDate.setFullYear(newDate.getFullYear() + 1);
   }
  } else {
   newDate.setDate(newDate.getDate() + days);
   return newDate;
  }
 }
 return newDate;
}

function _strftime(s, maxsize, format, tm) {
 var tm_zone = SAFE_HEAP_LOAD(tm + 40 | 0, 4, 0) | 0;
 var date = {
  tm_sec: SAFE_HEAP_LOAD(tm | 0, 4, 0) | 0,
  tm_min: SAFE_HEAP_LOAD(tm + 4 | 0, 4, 0) | 0,
  tm_hour: SAFE_HEAP_LOAD(tm + 8 | 0, 4, 0) | 0,
  tm_mday: SAFE_HEAP_LOAD(tm + 12 | 0, 4, 0) | 0,
  tm_mon: SAFE_HEAP_LOAD(tm + 16 | 0, 4, 0) | 0,
  tm_year: SAFE_HEAP_LOAD(tm + 20 | 0, 4, 0) | 0,
  tm_wday: SAFE_HEAP_LOAD(tm + 24 | 0, 4, 0) | 0,
  tm_yday: SAFE_HEAP_LOAD(tm + 28 | 0, 4, 0) | 0,
  tm_isdst: SAFE_HEAP_LOAD(tm + 32 | 0, 4, 0) | 0,
  tm_gmtoff: SAFE_HEAP_LOAD(tm + 36 | 0, 4, 0) | 0,
  tm_zone: tm_zone ? UTF8ToString(tm_zone) : ""
 };
 var pattern = UTF8ToString(format);
 var EXPANSION_RULES_1 = {
  "%c": "%a %b %d %H:%M:%S %Y",
  "%D": "%m/%d/%y",
  "%F": "%Y-%m-%d",
  "%h": "%b",
  "%r": "%I:%M:%S %p",
  "%R": "%H:%M",
  "%T": "%H:%M:%S",
  "%x": "%m/%d/%y",
  "%X": "%H:%M:%S",
  "%Ec": "%c",
  "%EC": "%C",
  "%Ex": "%m/%d/%y",
  "%EX": "%H:%M:%S",
  "%Ey": "%y",
  "%EY": "%Y",
  "%Od": "%d",
  "%Oe": "%e",
  "%OH": "%H",
  "%OI": "%I",
  "%Om": "%m",
  "%OM": "%M",
  "%OS": "%S",
  "%Ou": "%u",
  "%OU": "%U",
  "%OV": "%V",
  "%Ow": "%w",
  "%OW": "%W",
  "%Oy": "%y"
 };
 for (var rule in EXPANSION_RULES_1) {
  pattern = pattern.replace(new RegExp(rule, "g"), EXPANSION_RULES_1[rule]);
 }
 var WEEKDAYS = [ "Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday" ];
 var MONTHS = [ "January", "February", "March", "April", "May", "June", "July", "August", "September", "October", "November", "December" ];
 function leadingSomething(value, digits, character) {
  var str = typeof value === "number" ? value.toString() : value || "";
  while (str.length < digits) {
   str = character[0] + str;
  }
  return str;
 }
 function leadingNulls(value, digits) {
  return leadingSomething(value, digits, "0");
 }
 function compareByDay(date1, date2) {
  function sgn(value) {
   return value < 0 ? -1 : value > 0 ? 1 : 0;
  }
  var compare;
  if ((compare = sgn(date1.getFullYear() - date2.getFullYear())) === 0) {
   if ((compare = sgn(date1.getMonth() - date2.getMonth())) === 0) {
    compare = sgn(date1.getDate() - date2.getDate());
   }
  }
  return compare;
 }
 function getFirstWeekStartDate(janFourth) {
  switch (janFourth.getDay()) {
  case 0:
   return new Date(janFourth.getFullYear() - 1, 11, 29);

  case 1:
   return janFourth;

  case 2:
   return new Date(janFourth.getFullYear(), 0, 3);

  case 3:
   return new Date(janFourth.getFullYear(), 0, 2);

  case 4:
   return new Date(janFourth.getFullYear(), 0, 1);

  case 5:
   return new Date(janFourth.getFullYear() - 1, 11, 31);

  case 6:
   return new Date(janFourth.getFullYear() - 1, 11, 30);
  }
 }
 function getWeekBasedYear(date) {
  var thisDate = __addDays(new Date(date.tm_year + 1900, 0, 1), date.tm_yday);
  var janFourthThisYear = new Date(thisDate.getFullYear(), 0, 4);
  var janFourthNextYear = new Date(thisDate.getFullYear() + 1, 0, 4);
  var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear);
  var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear);
  if (compareByDay(firstWeekStartThisYear, thisDate) <= 0) {
   if (compareByDay(firstWeekStartNextYear, thisDate) <= 0) {
    return thisDate.getFullYear() + 1;
   } else {
    return thisDate.getFullYear();
   }
  } else {
   return thisDate.getFullYear() - 1;
  }
 }
 var EXPANSION_RULES_2 = {
  "%a": function(date) {
   return WEEKDAYS[date.tm_wday].substring(0, 3);
  },
  "%A": function(date) {
   return WEEKDAYS[date.tm_wday];
  },
  "%b": function(date) {
   return MONTHS[date.tm_mon].substring(0, 3);
  },
  "%B": function(date) {
   return MONTHS[date.tm_mon];
  },
  "%C": function(date) {
   var year = date.tm_year + 1900;
   return leadingNulls(year / 100 | 0, 2);
  },
  "%d": function(date) {
   return leadingNulls(date.tm_mday, 2);
  },
  "%e": function(date) {
   return leadingSomething(date.tm_mday, 2, " ");
  },
  "%g": function(date) {
   return getWeekBasedYear(date).toString().substring(2);
  },
  "%G": function(date) {
   return getWeekBasedYear(date);
  },
  "%H": function(date) {
   return leadingNulls(date.tm_hour, 2);
  },
  "%I": function(date) {
   var twelveHour = date.tm_hour;
   if (twelveHour == 0) twelveHour = 12; else if (twelveHour > 12) twelveHour -= 12;
   return leadingNulls(twelveHour, 2);
  },
  "%j": function(date) {
   return leadingNulls(date.tm_mday + __arraySum(__isLeapYear(date.tm_year + 1900) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, date.tm_mon - 1), 3);
  },
  "%m": function(date) {
   return leadingNulls(date.tm_mon + 1, 2);
  },
  "%M": function(date) {
   return leadingNulls(date.tm_min, 2);
  },
  "%n": function() {
   return "\n";
  },
  "%p": function(date) {
   if (date.tm_hour >= 0 && date.tm_hour < 12) {
    return "AM";
   } else {
    return "PM";
   }
  },
  "%S": function(date) {
   return leadingNulls(date.tm_sec, 2);
  },
  "%t": function() {
   return "\t";
  },
  "%u": function(date) {
   return date.tm_wday || 7;
  },
  "%U": function(date) {
   var janFirst = new Date(date.tm_year + 1900, 0, 1);
   var firstSunday = janFirst.getDay() === 0 ? janFirst : __addDays(janFirst, 7 - janFirst.getDay());
   var endDate = new Date(date.tm_year + 1900, date.tm_mon, date.tm_mday);
   if (compareByDay(firstSunday, endDate) < 0) {
    var februaryFirstUntilEndMonth = __arraySum(__isLeapYear(endDate.getFullYear()) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, endDate.getMonth() - 1) - 31;
    var firstSundayUntilEndJanuary = 31 - firstSunday.getDate();
    var days = firstSundayUntilEndJanuary + februaryFirstUntilEndMonth + endDate.getDate();
    return leadingNulls(Math.ceil(days / 7), 2);
   }
   return compareByDay(firstSunday, janFirst) === 0 ? "01" : "00";
  },
  "%V": function(date) {
   var janFourthThisYear = new Date(date.tm_year + 1900, 0, 4);
   var janFourthNextYear = new Date(date.tm_year + 1901, 0, 4);
   var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear);
   var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear);
   var endDate = __addDays(new Date(date.tm_year + 1900, 0, 1), date.tm_yday);
   if (compareByDay(endDate, firstWeekStartThisYear) < 0) {
    return "53";
   }
   if (compareByDay(firstWeekStartNextYear, endDate) <= 0) {
    return "01";
   }
   var daysDifference;
   if (firstWeekStartThisYear.getFullYear() < date.tm_year + 1900) {
    daysDifference = date.tm_yday + 32 - firstWeekStartThisYear.getDate();
   } else {
    daysDifference = date.tm_yday + 1 - firstWeekStartThisYear.getDate();
   }
   return leadingNulls(Math.ceil(daysDifference / 7), 2);
  },
  "%w": function(date) {
   return date.tm_wday;
  },
  "%W": function(date) {
   var janFirst = new Date(date.tm_year, 0, 1);
   var firstMonday = janFirst.getDay() === 1 ? janFirst : __addDays(janFirst, janFirst.getDay() === 0 ? 1 : 7 - janFirst.getDay() + 1);
   var endDate = new Date(date.tm_year + 1900, date.tm_mon, date.tm_mday);
   if (compareByDay(firstMonday, endDate) < 0) {
    var februaryFirstUntilEndMonth = __arraySum(__isLeapYear(endDate.getFullYear()) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, endDate.getMonth() - 1) - 31;
    var firstMondayUntilEndJanuary = 31 - firstMonday.getDate();
    var days = firstMondayUntilEndJanuary + februaryFirstUntilEndMonth + endDate.getDate();
    return leadingNulls(Math.ceil(days / 7), 2);
   }
   return compareByDay(firstMonday, janFirst) === 0 ? "01" : "00";
  },
  "%y": function(date) {
   return (date.tm_year + 1900).toString().substring(2);
  },
  "%Y": function(date) {
   return date.tm_year + 1900;
  },
  "%z": function(date) {
   var off = date.tm_gmtoff;
   var ahead = off >= 0;
   off = Math.abs(off) / 60;
   off = off / 60 * 100 + off % 60;
   return (ahead ? "+" : "-") + String("0000" + off).slice(-4);
  },
  "%Z": function(date) {
   return date.tm_zone;
  },
  "%%": function() {
   return "%";
  }
 };
 for (var rule in EXPANSION_RULES_2) {
  if (pattern.includes(rule)) {
   pattern = pattern.replace(new RegExp(rule, "g"), EXPANSION_RULES_2[rule](date));
  }
 }
 var bytes = intArrayFromString(pattern, false);
 if (bytes.length > maxsize) {
  return 0;
 }
 writeArrayToMemory(bytes, s);
 return bytes.length - 1;
}

function _strftime_l(s, maxsize, format, tm) {
 return _strftime(s, maxsize, format, tm);
}

function _time(ptr) {
 var ret = Date.now() / 1e3 | 0;
 if (ptr) {
  SAFE_HEAP_STORE(ptr | 0, ret | 0, 4);
 }
 return ret;
}

function _timegm(tmPtr) {
 _tzset();
 var time = Date.UTC((SAFE_HEAP_LOAD(tmPtr + 20 | 0, 4, 0) | 0) + 1900, SAFE_HEAP_LOAD(tmPtr + 16 | 0, 4, 0) | 0, SAFE_HEAP_LOAD(tmPtr + 12 | 0, 4, 0) | 0, SAFE_HEAP_LOAD(tmPtr + 8 | 0, 4, 0) | 0, SAFE_HEAP_LOAD(tmPtr + 4 | 0, 4, 0) | 0, SAFE_HEAP_LOAD(tmPtr | 0, 4, 0) | 0, 0);
 var date = new Date(time);
 SAFE_HEAP_STORE(tmPtr + 24 | 0, date.getUTCDay() | 0, 4);
 var start = Date.UTC(date.getUTCFullYear(), 0, 1, 0, 0, 0, 0);
 var yday = (date.getTime() - start) / (1e3 * 60 * 60 * 24) | 0;
 SAFE_HEAP_STORE(tmPtr + 28 | 0, yday | 0, 4);
 return date.getTime() / 1e3 | 0;
}

var FSNode = function(parent, name, mode, rdev) {
 if (!parent) {
  parent = this;
 }
 this.parent = parent;
 this.mount = parent.mount;
 this.mounted = null;
 this.id = FS.nextInode++;
 this.name = name;
 this.mode = mode;
 this.node_ops = {};
 this.stream_ops = {};
 this.rdev = rdev;
};

var readMode = 292 | 73;

var writeMode = 146;

Object.defineProperties(FSNode.prototype, {
 read: {
  get: function() {
   return (this.mode & readMode) === readMode;
  },
  set: function(val) {
   val ? this.mode |= readMode : this.mode &= ~readMode;
  }
 },
 write: {
  get: function() {
   return (this.mode & writeMode) === writeMode;
  },
  set: function(val) {
   val ? this.mode |= writeMode : this.mode &= ~writeMode;
  }
 },
 isFolder: {
  get: function() {
   return FS.isDir(this.mode);
  }
 },
 isDevice: {
  get: function() {
   return FS.isChrdev(this.mode);
  }
 }
});

FS.FSNode = FSNode;

FS.staticInit();

Module["FS_createPath"] = FS.createPath;

Module["FS_createDataFile"] = FS.createDataFile;

Module["FS_createPreloadedFile"] = FS.createPreloadedFile;

Module["FS_createLazyFile"] = FS.createLazyFile;

Module["FS_createDevice"] = FS.createDevice;

Module["FS_unlink"] = FS.unlink;

ERRNO_CODES = {
 "EPERM": 63,
 "ENOENT": 44,
 "ESRCH": 71,
 "EINTR": 27,
 "EIO": 29,
 "ENXIO": 60,
 "E2BIG": 1,
 "ENOEXEC": 45,
 "EBADF": 8,
 "ECHILD": 12,
 "EAGAIN": 6,
 "EWOULDBLOCK": 6,
 "ENOMEM": 48,
 "EACCES": 2,
 "EFAULT": 21,
 "ENOTBLK": 105,
 "EBUSY": 10,
 "EEXIST": 20,
 "EXDEV": 75,
 "ENODEV": 43,
 "ENOTDIR": 54,
 "EISDIR": 31,
 "EINVAL": 28,
 "ENFILE": 41,
 "EMFILE": 33,
 "ENOTTY": 59,
 "ETXTBSY": 74,
 "EFBIG": 22,
 "ENOSPC": 51,
 "ESPIPE": 70,
 "EROFS": 69,
 "EMLINK": 34,
 "EPIPE": 64,
 "EDOM": 18,
 "ERANGE": 68,
 "ENOMSG": 49,
 "EIDRM": 24,
 "ECHRNG": 106,
 "EL2NSYNC": 156,
 "EL3HLT": 107,
 "EL3RST": 108,
 "ELNRNG": 109,
 "EUNATCH": 110,
 "ENOCSI": 111,
 "EL2HLT": 112,
 "EDEADLK": 16,
 "ENOLCK": 46,
 "EBADE": 113,
 "EBADR": 114,
 "EXFULL": 115,
 "ENOANO": 104,
 "EBADRQC": 103,
 "EBADSLT": 102,
 "EDEADLOCK": 16,
 "EBFONT": 101,
 "ENOSTR": 100,
 "ENODATA": 116,
 "ETIME": 117,
 "ENOSR": 118,
 "ENONET": 119,
 "ENOPKG": 120,
 "EREMOTE": 121,
 "ENOLINK": 47,
 "EADV": 122,
 "ESRMNT": 123,
 "ECOMM": 124,
 "EPROTO": 65,
 "EMULTIHOP": 36,
 "EDOTDOT": 125,
 "EBADMSG": 9,
 "ENOTUNIQ": 126,
 "EBADFD": 127,
 "EREMCHG": 128,
 "ELIBACC": 129,
 "ELIBBAD": 130,
 "ELIBSCN": 131,
 "ELIBMAX": 132,
 "ELIBEXEC": 133,
 "ENOSYS": 52,
 "ENOTEMPTY": 55,
 "ENAMETOOLONG": 37,
 "ELOOP": 32,
 "EOPNOTSUPP": 138,
 "EPFNOSUPPORT": 139,
 "ECONNRESET": 15,
 "ENOBUFS": 42,
 "EAFNOSUPPORT": 5,
 "EPROTOTYPE": 67,
 "ENOTSOCK": 57,
 "ENOPROTOOPT": 50,
 "ESHUTDOWN": 140,
 "ECONNREFUSED": 14,
 "EADDRINUSE": 3,
 "ECONNABORTED": 13,
 "ENETUNREACH": 40,
 "ENETDOWN": 38,
 "ETIMEDOUT": 73,
 "EHOSTDOWN": 142,
 "EHOSTUNREACH": 23,
 "EINPROGRESS": 26,
 "EALREADY": 7,
 "EDESTADDRREQ": 17,
 "EMSGSIZE": 35,
 "EPROTONOSUPPORT": 66,
 "ESOCKTNOSUPPORT": 137,
 "EADDRNOTAVAIL": 4,
 "ENETRESET": 39,
 "EISCONN": 30,
 "ENOTCONN": 53,
 "ETOOMANYREFS": 141,
 "EUSERS": 136,
 "EDQUOT": 19,
 "ESTALE": 72,
 "ENOTSUP": 138,
 "ENOMEDIUM": 148,
 "EILSEQ": 25,
 "EOVERFLOW": 61,
 "ECANCELED": 11,
 "ENOTRECOVERABLE": 56,
 "EOWNERDEAD": 62,
 "ESTRPIPE": 135
};

embind_init_charCodes();

BindingError = Module["BindingError"] = extendError(Error, "BindingError");

InternalError = Module["InternalError"] = extendError(Error, "InternalError");

init_ClassHandle();

init_RegisteredPointer();

init_embind();

UnboundTypeError = Module["UnboundTypeError"] = extendError(Error, "UnboundTypeError");

init_emval();

var ASSERTIONS = true;

function intArrayFromString(stringy, dontAddNull, length) {
 var len = length > 0 ? length : lengthBytesUTF8(stringy) + 1;
 var u8array = new Array(len);
 var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length);
 if (dontAddNull) u8array.length = numBytesWritten;
 return u8array;
}

function intArrayToString(array) {
 var ret = [];
 for (var i = 0; i < array.length; i++) {
  var chr = array[i];
  if (chr > 255) {
   if (ASSERTIONS) {
    assert(false, "Character code " + chr + " (" + String.fromCharCode(chr) + ")  at offset " + i + " not in 0x00-0xFF.");
   }
   chr &= 255;
  }
  ret.push(String.fromCharCode(chr));
 }
 return ret.join("");
}

var decodeBase64 = typeof atob === "function" ? atob : function(input) {
 var keyStr = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=";
 var output = "";
 var chr1, chr2, chr3;
 var enc1, enc2, enc3, enc4;
 var i = 0;
 input = input.replace(/[^A-Za-z0-9\+\/\=]/g, "");
 do {
  enc1 = keyStr.indexOf(input.charAt(i++));
  enc2 = keyStr.indexOf(input.charAt(i++));
  enc3 = keyStr.indexOf(input.charAt(i++));
  enc4 = keyStr.indexOf(input.charAt(i++));
  chr1 = enc1 << 2 | enc2 >> 4;
  chr2 = (enc2 & 15) << 4 | enc3 >> 2;
  chr3 = (enc3 & 3) << 6 | enc4;
  output = output + String.fromCharCode(chr1);
  if (enc3 !== 64) {
   output = output + String.fromCharCode(chr2);
  }
  if (enc4 !== 64) {
   output = output + String.fromCharCode(chr3);
  }
 } while (i < input.length);
 return output;
};

function intArrayFromBase64(s) {
 try {
  var decoded = decodeBase64(s);
  var bytes = new Uint8Array(decoded.length);
  for (var i = 0; i < decoded.length; ++i) {
   bytes[i] = decoded.charCodeAt(i);
  }
  return bytes;
 } catch (_) {
  throw new Error("Converting base64 string to bytes failed.");
 }
}

function tryParseAsDataURI(filename) {
 if (!isDataURI(filename)) {
  return;
 }
 return intArrayFromBase64(filename.slice(dataURIPrefix.length));
}

var asmLibraryArg = {
 "__assert_fail": ___assert_fail,
 "__cxa_allocate_exception": ___cxa_allocate_exception,
 "__cxa_atexit": ___cxa_atexit,
 "__cxa_begin_catch": ___cxa_begin_catch,
 "__cxa_end_catch": ___cxa_end_catch,
 "__cxa_find_matching_catch_2": ___cxa_find_matching_catch_2,
 "__cxa_find_matching_catch_3": ___cxa_find_matching_catch_3,
 "__cxa_free_exception": ___cxa_free_exception,
 "__cxa_rethrow": ___cxa_rethrow,
 "__cxa_throw": ___cxa_throw,
 "__cxa_uncaught_exceptions": ___cxa_uncaught_exceptions,
 "__gmtime_r": ___gmtime_r,
 "__handle_stack_overflow": ___handle_stack_overflow,
 "__localtime_r": ___localtime_r,
 "__resumeException": ___resumeException,
 "__syscall__newselect": ___syscall__newselect,
 "__syscall_accept4": ___syscall_accept4,
 "__syscall_access": ___syscall_access,
 "__syscall_bind": ___syscall_bind,
 "__syscall_connect": ___syscall_connect,
 "__syscall_fcntl64": ___syscall_fcntl64,
 "__syscall_fstat64": ___syscall_fstat64,
 "__syscall_fstatat64": ___syscall_fstatat64,
 "__syscall_ftruncate64": ___syscall_ftruncate64,
 "__syscall_getcwd": ___syscall_getcwd,
 "__syscall_getdents64": ___syscall_getdents64,
 "__syscall_getsockopt": ___syscall_getsockopt,
 "__syscall_ioctl": ___syscall_ioctl,
 "__syscall_lstat64": ___syscall_lstat64,
 "__syscall_open": ___syscall_open,
 "__syscall_poll": ___syscall_poll,
 "__syscall_readlink": ___syscall_readlink,
 "__syscall_recvfrom": ___syscall_recvfrom,
 "__syscall_sendto": ___syscall_sendto,
 "__syscall_socket": ___syscall_socket,
 "__syscall_stat64": ___syscall_stat64,
 "_dlopen_js": __dlopen_js,
 "_dlsym_js": __dlsym_js,
 "_embind_register_bigint": __embind_register_bigint,
 "_embind_register_bool": __embind_register_bool,
 "_embind_register_class": __embind_register_class,
 "_embind_register_class_constructor": __embind_register_class_constructor,
 "_embind_register_class_function": __embind_register_class_function,
 "_embind_register_emval": __embind_register_emval,
 "_embind_register_enum": __embind_register_enum,
 "_embind_register_enum_value": __embind_register_enum_value,
 "_embind_register_float": __embind_register_float,
 "_embind_register_function": __embind_register_function,
 "_embind_register_integer": __embind_register_integer,
 "_embind_register_memory_view": __embind_register_memory_view,
 "_embind_register_std_string": __embind_register_std_string,
 "_embind_register_std_wstring": __embind_register_std_wstring,
 "_embind_register_void": __embind_register_void,
 "_emval_decref": __emval_decref,
 "_emval_incref": __emval_incref,
 "_emval_take_value": __emval_take_value,
 "abort": _abort,
 "alignfault": alignfault,
 "atexit": _atexit,
 "clock_gettime": _clock_gettime,
 "difftime": _difftime,
 "emscripten_get_now": _emscripten_get_now,
 "emscripten_resize_heap": _emscripten_resize_heap,
 "environ_get": _environ_get,
 "environ_sizes_get": _environ_sizes_get,
 "exit": _exit,
 "fd_close": _fd_close,
 "fd_pread": _fd_pread,
 "fd_pwrite": _fd_pwrite,
 "fd_read": _fd_read,
 "fd_seek": _fd_seek,
 "fd_write": _fd_write,
 "getTempRet0": _getTempRet0,
 "gethostbyname_r": _gethostbyname_r,
 "gettimeofday": _gettimeofday,
 "gmtime_r": _gmtime_r,
 "invoke_diii": invoke_diii,
 "invoke_fiii": invoke_fiii,
 "invoke_i": invoke_i,
 "invoke_ii": invoke_ii,
 "invoke_iii": invoke_iii,
 "invoke_iiii": invoke_iiii,
 "invoke_iiiii": invoke_iiiii,
 "invoke_iiiiii": invoke_iiiiii,
 "invoke_iiiiiii": invoke_iiiiiii,
 "invoke_iiiiiiii": invoke_iiiiiiii,
 "invoke_iiiiiiiiiii": invoke_iiiiiiiiiii,
 "invoke_iiiiiiiiiiii": invoke_iiiiiiiiiiii,
 "invoke_iiiiiiiiiiiii": invoke_iiiiiiiiiiiii,
 "invoke_iiiiij": invoke_iiiiij,
 "invoke_j": invoke_j,
 "invoke_ji": invoke_ji,
 "invoke_jiiii": invoke_jiiii,
 "invoke_v": invoke_v,
 "invoke_vi": invoke_vi,
 "invoke_vii": invoke_vii,
 "invoke_viid": invoke_viid,
 "invoke_viii": invoke_viii,
 "invoke_viiii": invoke_viiii,
 "invoke_viiiiiii": invoke_viiiiiii,
 "invoke_viiiiiiiiii": invoke_viiiiiiiiii,
 "invoke_viiiiiiiiiiiiiii": invoke_viiiiiiiiiiiiiii,
 "mktime": _mktime,
 "segfault": segfault,
 "strftime": _strftime,
 "strftime_l": _strftime_l,
 "time": _time,
 "timegm": _timegm,
 "tzset": _tzset
};

var asm = createWasm();

var ___wasm_call_ctors = Module["___wasm_call_ctors"] = createExportWrapper("__wasm_call_ctors");

var _malloc = Module["_malloc"] = createExportWrapper("malloc");

var _memcpy = Module["_memcpy"] = createExportWrapper("memcpy");

var ___errno_location = Module["___errno_location"] = createExportWrapper("__errno_location");

var _free = Module["_free"] = createExportWrapper("free");

var _htons = Module["_htons"] = createExportWrapper("htons");

var _ntohs = Module["_ntohs"] = createExportWrapper("ntohs");

var ___getTypeName = Module["___getTypeName"] = createExportWrapper("__getTypeName");

var ___embind_register_native_and_builtin_types = Module["___embind_register_native_and_builtin_types"] = createExportWrapper("__embind_register_native_and_builtin_types");

var _fflush = Module["_fflush"] = createExportWrapper("fflush");

var ___dl_seterr = Module["___dl_seterr"] = createExportWrapper("__dl_seterr");

var __get_tzname = Module["__get_tzname"] = createExportWrapper("_get_tzname");

var __get_daylight = Module["__get_daylight"] = createExportWrapper("_get_daylight");

var __get_timezone = Module["__get_timezone"] = createExportWrapper("_get_timezone");

var stackSave = Module["stackSave"] = createExportWrapper("stackSave");

var stackRestore = Module["stackRestore"] = createExportWrapper("stackRestore");

var stackAlloc = Module["stackAlloc"] = createExportWrapper("stackAlloc");

var _emscripten_stack_init = Module["_emscripten_stack_init"] = function() {
 return (_emscripten_stack_init = Module["_emscripten_stack_init"] = Module["asm"]["emscripten_stack_init"]).apply(null, arguments);
};

var _emscripten_stack_get_free = Module["_emscripten_stack_get_free"] = function() {
 return (_emscripten_stack_get_free = Module["_emscripten_stack_get_free"] = Module["asm"]["emscripten_stack_get_free"]).apply(null, arguments);
};

var _emscripten_stack_get_base = Module["_emscripten_stack_get_base"] = function() {
 return (_emscripten_stack_get_base = Module["_emscripten_stack_get_base"] = Module["asm"]["emscripten_stack_get_base"]).apply(null, arguments);
};

var _emscripten_stack_get_end = Module["_emscripten_stack_get_end"] = function() {
 return (_emscripten_stack_get_end = Module["_emscripten_stack_get_end"] = Module["asm"]["emscripten_stack_get_end"]).apply(null, arguments);
};

var _setThrew = Module["_setThrew"] = createExportWrapper("setThrew");

var ___cxa_demangle = Module["___cxa_demangle"] = createExportWrapper("__cxa_demangle");

var ___cxa_can_catch = Module["___cxa_can_catch"] = createExportWrapper("__cxa_can_catch");

var ___cxa_is_pointer_type = Module["___cxa_is_pointer_type"] = createExportWrapper("__cxa_is_pointer_type");

var _sbrk = Module["_sbrk"] = createExportWrapper("sbrk");

var _emscripten_get_sbrk_ptr = Module["_emscripten_get_sbrk_ptr"] = createExportWrapper("emscripten_get_sbrk_ptr");

var ___set_stack_limits = Module["___set_stack_limits"] = createExportWrapper("__set_stack_limits");

function invoke_iii(index, a1, a2) {
 var sp = stackSave();
 try {
  return getWasmTableEntry(index)(a1, a2);
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_viii(index, a1, a2, a3) {
 var sp = stackSave();
 try {
  getWasmTableEntry(index)(a1, a2, a3);
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_vii(index, a1, a2) {
 var sp = stackSave();
 try {
  getWasmTableEntry(index)(a1, a2);
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_ii(index, a1) {
 var sp = stackSave();
 try {
  return getWasmTableEntry(index)(a1);
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_iiii(index, a1, a2, a3) {
 var sp = stackSave();
 try {
  return getWasmTableEntry(index)(a1, a2, a3);
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_viiii(index, a1, a2, a3, a4) {
 var sp = stackSave();
 try {
  getWasmTableEntry(index)(a1, a2, a3, a4);
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_vi(index, a1) {
 var sp = stackSave();
 try {
  getWasmTableEntry(index)(a1);
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_j(index) {
 var sp = stackSave();
 try {
  return getWasmTableEntry(index)();
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_ji(index, a1) {
 var sp = stackSave();
 try {
  return getWasmTableEntry(index)(a1);
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_v(index) {
 var sp = stackSave();
 try {
  getWasmTableEntry(index)();
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_iiiiiii(index, a1, a2, a3, a4, a5, a6) {
 var sp = stackSave();
 try {
  return getWasmTableEntry(index)(a1, a2, a3, a4, a5, a6);
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_iiiiii(index, a1, a2, a3, a4, a5) {
 var sp = stackSave();
 try {
  return getWasmTableEntry(index)(a1, a2, a3, a4, a5);
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_iiiiij(index, a1, a2, a3, a4, a5) {
 var sp = stackSave();
 try {
  return getWasmTableEntry(index)(a1, a2, a3, a4, a5);
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_iiiii(index, a1, a2, a3, a4) {
 var sp = stackSave();
 try {
  return getWasmTableEntry(index)(a1, a2, a3, a4);
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_jiiii(index, a1, a2, a3, a4) {
 var sp = stackSave();
 try {
  return getWasmTableEntry(index)(a1, a2, a3, a4);
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_fiii(index, a1, a2, a3) {
 var sp = stackSave();
 try {
  return getWasmTableEntry(index)(a1, a2, a3);
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_diii(index, a1, a2, a3) {
 var sp = stackSave();
 try {
  return getWasmTableEntry(index)(a1, a2, a3);
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_viid(index, a1, a2, a3) {
 var sp = stackSave();
 try {
  getWasmTableEntry(index)(a1, a2, a3);
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_iiiiiiii(index, a1, a2, a3, a4, a5, a6, a7) {
 var sp = stackSave();
 try {
  return getWasmTableEntry(index)(a1, a2, a3, a4, a5, a6, a7);
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_iiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
 var sp = stackSave();
 try {
  return getWasmTableEntry(index)(a1, a2, a3, a4, a5, a6, a7, a8, a9, a10);
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_iiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12) {
 var sp = stackSave();
 try {
  return getWasmTableEntry(index)(a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12);
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_i(index) {
 var sp = stackSave();
 try {
  return getWasmTableEntry(index)();
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_viiiiiii(index, a1, a2, a3, a4, a5, a6, a7) {
 var sp = stackSave();
 try {
  getWasmTableEntry(index)(a1, a2, a3, a4, a5, a6, a7);
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_iiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) {
 var sp = stackSave();
 try {
  return getWasmTableEntry(index)(a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11);
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_viiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
 var sp = stackSave();
 try {
  getWasmTableEntry(index)(a1, a2, a3, a4, a5, a6, a7, a8, a9, a10);
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

function invoke_viiiiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15) {
 var sp = stackSave();
 try {
  getWasmTableEntry(index)(a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15);
 } catch (e) {
  stackRestore(sp);
  if (e !== e + 0 && e !== "longjmp") throw e;
  _setThrew(1, 0);
 }
}

if (!Object.getOwnPropertyDescriptor(Module, "intArrayFromString")) Module["intArrayFromString"] = function() {
 abort("'intArrayFromString' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "intArrayToString")) Module["intArrayToString"] = function() {
 abort("'intArrayToString' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "ccall")) Module["ccall"] = function() {
 abort("'ccall' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "cwrap")) Module["cwrap"] = function() {
 abort("'cwrap' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "setValue")) Module["setValue"] = function() {
 abort("'setValue' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "getValue")) Module["getValue"] = function() {
 abort("'getValue' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "allocate")) Module["allocate"] = function() {
 abort("'allocate' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "UTF8ArrayToString")) Module["UTF8ArrayToString"] = function() {
 abort("'UTF8ArrayToString' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "UTF8ToString")) Module["UTF8ToString"] = function() {
 abort("'UTF8ToString' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "stringToUTF8Array")) Module["stringToUTF8Array"] = function() {
 abort("'stringToUTF8Array' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "stringToUTF8")) Module["stringToUTF8"] = function() {
 abort("'stringToUTF8' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "lengthBytesUTF8")) Module["lengthBytesUTF8"] = function() {
 abort("'lengthBytesUTF8' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "stackTrace")) Module["stackTrace"] = function() {
 abort("'stackTrace' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "addOnPreRun")) Module["addOnPreRun"] = function() {
 abort("'addOnPreRun' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "addOnInit")) Module["addOnInit"] = function() {
 abort("'addOnInit' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "addOnPreMain")) Module["addOnPreMain"] = function() {
 abort("'addOnPreMain' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "addOnExit")) Module["addOnExit"] = function() {
 abort("'addOnExit' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "addOnPostRun")) Module["addOnPostRun"] = function() {
 abort("'addOnPostRun' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "writeStringToMemory")) Module["writeStringToMemory"] = function() {
 abort("'writeStringToMemory' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "writeArrayToMemory")) Module["writeArrayToMemory"] = function() {
 abort("'writeArrayToMemory' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "writeAsciiToMemory")) Module["writeAsciiToMemory"] = function() {
 abort("'writeAsciiToMemory' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

Module["addRunDependency"] = addRunDependency;

Module["removeRunDependency"] = removeRunDependency;

if (!Object.getOwnPropertyDescriptor(Module, "FS_createFolder")) Module["FS_createFolder"] = function() {
 abort("'FS_createFolder' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

Module["FS_createPath"] = FS.createPath;

Module["FS_createDataFile"] = FS.createDataFile;

Module["FS_createPreloadedFile"] = FS.createPreloadedFile;

Module["FS_createLazyFile"] = FS.createLazyFile;

if (!Object.getOwnPropertyDescriptor(Module, "FS_createLink")) Module["FS_createLink"] = function() {
 abort("'FS_createLink' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

Module["FS_createDevice"] = FS.createDevice;

Module["FS_unlink"] = FS.unlink;

if (!Object.getOwnPropertyDescriptor(Module, "getLEB")) Module["getLEB"] = function() {
 abort("'getLEB' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "getFunctionTables")) Module["getFunctionTables"] = function() {
 abort("'getFunctionTables' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "alignFunctionTables")) Module["alignFunctionTables"] = function() {
 abort("'alignFunctionTables' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "registerFunctions")) Module["registerFunctions"] = function() {
 abort("'registerFunctions' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "addFunction")) Module["addFunction"] = function() {
 abort("'addFunction' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "removeFunction")) Module["removeFunction"] = function() {
 abort("'removeFunction' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "getFuncWrapper")) Module["getFuncWrapper"] = function() {
 abort("'getFuncWrapper' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "prettyPrint")) Module["prettyPrint"] = function() {
 abort("'prettyPrint' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "dynCall")) Module["dynCall"] = function() {
 abort("'dynCall' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "getCompilerSetting")) Module["getCompilerSetting"] = function() {
 abort("'getCompilerSetting' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "print")) Module["print"] = function() {
 abort("'print' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "printErr")) Module["printErr"] = function() {
 abort("'printErr' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "getTempRet0")) Module["getTempRet0"] = function() {
 abort("'getTempRet0' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "setTempRet0")) Module["setTempRet0"] = function() {
 abort("'setTempRet0' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "callMain")) Module["callMain"] = function() {
 abort("'callMain' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "abort")) Module["abort"] = function() {
 abort("'abort' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "keepRuntimeAlive")) Module["keepRuntimeAlive"] = function() {
 abort("'keepRuntimeAlive' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "zeroMemory")) Module["zeroMemory"] = function() {
 abort("'zeroMemory' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "stringToNewUTF8")) Module["stringToNewUTF8"] = function() {
 abort("'stringToNewUTF8' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "setFileTime")) Module["setFileTime"] = function() {
 abort("'setFileTime' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "abortOnCannotGrowMemory")) Module["abortOnCannotGrowMemory"] = function() {
 abort("'abortOnCannotGrowMemory' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "emscripten_realloc_buffer")) Module["emscripten_realloc_buffer"] = function() {
 abort("'emscripten_realloc_buffer' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "ENV")) Module["ENV"] = function() {
 abort("'ENV' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "withStackSave")) Module["withStackSave"] = function() {
 abort("'withStackSave' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "ERRNO_CODES")) Module["ERRNO_CODES"] = function() {
 abort("'ERRNO_CODES' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "ERRNO_MESSAGES")) Module["ERRNO_MESSAGES"] = function() {
 abort("'ERRNO_MESSAGES' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "setErrNo")) Module["setErrNo"] = function() {
 abort("'setErrNo' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "inetPton4")) Module["inetPton4"] = function() {
 abort("'inetPton4' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "inetNtop4")) Module["inetNtop4"] = function() {
 abort("'inetNtop4' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "inetPton6")) Module["inetPton6"] = function() {
 abort("'inetPton6' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "inetNtop6")) Module["inetNtop6"] = function() {
 abort("'inetNtop6' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "readSockaddr")) Module["readSockaddr"] = function() {
 abort("'readSockaddr' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "writeSockaddr")) Module["writeSockaddr"] = function() {
 abort("'writeSockaddr' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "DNS")) Module["DNS"] = function() {
 abort("'DNS' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "getHostByName")) Module["getHostByName"] = function() {
 abort("'getHostByName' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "GAI_ERRNO_MESSAGES")) Module["GAI_ERRNO_MESSAGES"] = function() {
 abort("'GAI_ERRNO_MESSAGES' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "Protocols")) Module["Protocols"] = function() {
 abort("'Protocols' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "Sockets")) Module["Sockets"] = function() {
 abort("'Sockets' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "getRandomDevice")) Module["getRandomDevice"] = function() {
 abort("'getRandomDevice' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "traverseStack")) Module["traverseStack"] = function() {
 abort("'traverseStack' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "UNWIND_CACHE")) Module["UNWIND_CACHE"] = function() {
 abort("'UNWIND_CACHE' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "readAsmConstArgsArray")) Module["readAsmConstArgsArray"] = function() {
 abort("'readAsmConstArgsArray' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "readAsmConstArgs")) Module["readAsmConstArgs"] = function() {
 abort("'readAsmConstArgs' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "mainThreadEM_ASM")) Module["mainThreadEM_ASM"] = function() {
 abort("'mainThreadEM_ASM' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "jstoi_q")) Module["jstoi_q"] = function() {
 abort("'jstoi_q' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "jstoi_s")) Module["jstoi_s"] = function() {
 abort("'jstoi_s' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "getExecutableName")) Module["getExecutableName"] = function() {
 abort("'getExecutableName' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "listenOnce")) Module["listenOnce"] = function() {
 abort("'listenOnce' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "autoResumeAudioContext")) Module["autoResumeAudioContext"] = function() {
 abort("'autoResumeAudioContext' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "dynCall")) Module["dynCall"] = function() {
 abort("'dynCall' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "callRuntimeCallbacks")) Module["callRuntimeCallbacks"] = function() {
 abort("'callRuntimeCallbacks' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "setWasmTableEntry")) Module["setWasmTableEntry"] = function() {
 abort("'setWasmTableEntry' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "getWasmTableEntry")) Module["getWasmTableEntry"] = function() {
 abort("'getWasmTableEntry' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "handleException")) Module["handleException"] = function() {
 abort("'handleException' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "runtimeKeepalivePush")) Module["runtimeKeepalivePush"] = function() {
 abort("'runtimeKeepalivePush' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "runtimeKeepalivePop")) Module["runtimeKeepalivePop"] = function() {
 abort("'runtimeKeepalivePop' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "callUserCallback")) Module["callUserCallback"] = function() {
 abort("'callUserCallback' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "maybeExit")) Module["maybeExit"] = function() {
 abort("'maybeExit' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "safeSetTimeout")) Module["safeSetTimeout"] = function() {
 abort("'safeSetTimeout' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "asmjsMangle")) Module["asmjsMangle"] = function() {
 abort("'asmjsMangle' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "asyncLoad")) Module["asyncLoad"] = function() {
 abort("'asyncLoad' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "alignMemory")) Module["alignMemory"] = function() {
 abort("'alignMemory' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "mmapAlloc")) Module["mmapAlloc"] = function() {
 abort("'mmapAlloc' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "reallyNegative")) Module["reallyNegative"] = function() {
 abort("'reallyNegative' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "unSign")) Module["unSign"] = function() {
 abort("'unSign' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "reSign")) Module["reSign"] = function() {
 abort("'reSign' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "formatString")) Module["formatString"] = function() {
 abort("'formatString' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "PATH")) Module["PATH"] = function() {
 abort("'PATH' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "PATH_FS")) Module["PATH_FS"] = function() {
 abort("'PATH_FS' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "SYSCALLS")) Module["SYSCALLS"] = function() {
 abort("'SYSCALLS' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "syscallMmap2")) Module["syscallMmap2"] = function() {
 abort("'syscallMmap2' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "syscallMunmap")) Module["syscallMunmap"] = function() {
 abort("'syscallMunmap' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "getSocketFromFD")) Module["getSocketFromFD"] = function() {
 abort("'getSocketFromFD' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "getSocketAddress")) Module["getSocketAddress"] = function() {
 abort("'getSocketAddress' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "JSEvents")) Module["JSEvents"] = function() {
 abort("'JSEvents' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "registerKeyEventCallback")) Module["registerKeyEventCallback"] = function() {
 abort("'registerKeyEventCallback' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "specialHTMLTargets")) Module["specialHTMLTargets"] = function() {
 abort("'specialHTMLTargets' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "maybeCStringToJsString")) Module["maybeCStringToJsString"] = function() {
 abort("'maybeCStringToJsString' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "findEventTarget")) Module["findEventTarget"] = function() {
 abort("'findEventTarget' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "findCanvasEventTarget")) Module["findCanvasEventTarget"] = function() {
 abort("'findCanvasEventTarget' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "getBoundingClientRect")) Module["getBoundingClientRect"] = function() {
 abort("'getBoundingClientRect' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "fillMouseEventData")) Module["fillMouseEventData"] = function() {
 abort("'fillMouseEventData' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "registerMouseEventCallback")) Module["registerMouseEventCallback"] = function() {
 abort("'registerMouseEventCallback' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "registerWheelEventCallback")) Module["registerWheelEventCallback"] = function() {
 abort("'registerWheelEventCallback' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "registerUiEventCallback")) Module["registerUiEventCallback"] = function() {
 abort("'registerUiEventCallback' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "registerFocusEventCallback")) Module["registerFocusEventCallback"] = function() {
 abort("'registerFocusEventCallback' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "fillDeviceOrientationEventData")) Module["fillDeviceOrientationEventData"] = function() {
 abort("'fillDeviceOrientationEventData' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "registerDeviceOrientationEventCallback")) Module["registerDeviceOrientationEventCallback"] = function() {
 abort("'registerDeviceOrientationEventCallback' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "fillDeviceMotionEventData")) Module["fillDeviceMotionEventData"] = function() {
 abort("'fillDeviceMotionEventData' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "registerDeviceMotionEventCallback")) Module["registerDeviceMotionEventCallback"] = function() {
 abort("'registerDeviceMotionEventCallback' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "screenOrientation")) Module["screenOrientation"] = function() {
 abort("'screenOrientation' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "fillOrientationChangeEventData")) Module["fillOrientationChangeEventData"] = function() {
 abort("'fillOrientationChangeEventData' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "registerOrientationChangeEventCallback")) Module["registerOrientationChangeEventCallback"] = function() {
 abort("'registerOrientationChangeEventCallback' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "fillFullscreenChangeEventData")) Module["fillFullscreenChangeEventData"] = function() {
 abort("'fillFullscreenChangeEventData' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "registerFullscreenChangeEventCallback")) Module["registerFullscreenChangeEventCallback"] = function() {
 abort("'registerFullscreenChangeEventCallback' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "registerRestoreOldStyle")) Module["registerRestoreOldStyle"] = function() {
 abort("'registerRestoreOldStyle' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "hideEverythingExceptGivenElement")) Module["hideEverythingExceptGivenElement"] = function() {
 abort("'hideEverythingExceptGivenElement' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "restoreHiddenElements")) Module["restoreHiddenElements"] = function() {
 abort("'restoreHiddenElements' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "setLetterbox")) Module["setLetterbox"] = function() {
 abort("'setLetterbox' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "currentFullscreenStrategy")) Module["currentFullscreenStrategy"] = function() {
 abort("'currentFullscreenStrategy' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "restoreOldWindowedStyle")) Module["restoreOldWindowedStyle"] = function() {
 abort("'restoreOldWindowedStyle' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "softFullscreenResizeWebGLRenderTarget")) Module["softFullscreenResizeWebGLRenderTarget"] = function() {
 abort("'softFullscreenResizeWebGLRenderTarget' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "doRequestFullscreen")) Module["doRequestFullscreen"] = function() {
 abort("'doRequestFullscreen' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "fillPointerlockChangeEventData")) Module["fillPointerlockChangeEventData"] = function() {
 abort("'fillPointerlockChangeEventData' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "registerPointerlockChangeEventCallback")) Module["registerPointerlockChangeEventCallback"] = function() {
 abort("'registerPointerlockChangeEventCallback' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "registerPointerlockErrorEventCallback")) Module["registerPointerlockErrorEventCallback"] = function() {
 abort("'registerPointerlockErrorEventCallback' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "requestPointerLock")) Module["requestPointerLock"] = function() {
 abort("'requestPointerLock' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "fillVisibilityChangeEventData")) Module["fillVisibilityChangeEventData"] = function() {
 abort("'fillVisibilityChangeEventData' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "registerVisibilityChangeEventCallback")) Module["registerVisibilityChangeEventCallback"] = function() {
 abort("'registerVisibilityChangeEventCallback' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "registerTouchEventCallback")) Module["registerTouchEventCallback"] = function() {
 abort("'registerTouchEventCallback' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "fillGamepadEventData")) Module["fillGamepadEventData"] = function() {
 abort("'fillGamepadEventData' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "registerGamepadEventCallback")) Module["registerGamepadEventCallback"] = function() {
 abort("'registerGamepadEventCallback' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "registerBeforeUnloadEventCallback")) Module["registerBeforeUnloadEventCallback"] = function() {
 abort("'registerBeforeUnloadEventCallback' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "fillBatteryEventData")) Module["fillBatteryEventData"] = function() {
 abort("'fillBatteryEventData' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "battery")) Module["battery"] = function() {
 abort("'battery' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "registerBatteryEventCallback")) Module["registerBatteryEventCallback"] = function() {
 abort("'registerBatteryEventCallback' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "setCanvasElementSize")) Module["setCanvasElementSize"] = function() {
 abort("'setCanvasElementSize' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "getCanvasElementSize")) Module["getCanvasElementSize"] = function() {
 abort("'getCanvasElementSize' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "demangle")) Module["demangle"] = function() {
 abort("'demangle' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "demangleAll")) Module["demangleAll"] = function() {
 abort("'demangleAll' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "jsStackTrace")) Module["jsStackTrace"] = function() {
 abort("'jsStackTrace' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "stackTrace")) Module["stackTrace"] = function() {
 abort("'stackTrace' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "getEnvStrings")) Module["getEnvStrings"] = function() {
 abort("'getEnvStrings' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "checkWasiClock")) Module["checkWasiClock"] = function() {
 abort("'checkWasiClock' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "writeI53ToI64")) Module["writeI53ToI64"] = function() {
 abort("'writeI53ToI64' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "writeI53ToI64Clamped")) Module["writeI53ToI64Clamped"] = function() {
 abort("'writeI53ToI64Clamped' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "writeI53ToI64Signaling")) Module["writeI53ToI64Signaling"] = function() {
 abort("'writeI53ToI64Signaling' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "writeI53ToU64Clamped")) Module["writeI53ToU64Clamped"] = function() {
 abort("'writeI53ToU64Clamped' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "writeI53ToU64Signaling")) Module["writeI53ToU64Signaling"] = function() {
 abort("'writeI53ToU64Signaling' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "readI53FromI64")) Module["readI53FromI64"] = function() {
 abort("'readI53FromI64' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "readI53FromU64")) Module["readI53FromU64"] = function() {
 abort("'readI53FromU64' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "convertI32PairToI53")) Module["convertI32PairToI53"] = function() {
 abort("'convertI32PairToI53' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "convertU32PairToI53")) Module["convertU32PairToI53"] = function() {
 abort("'convertU32PairToI53' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "setImmediateWrapped")) Module["setImmediateWrapped"] = function() {
 abort("'setImmediateWrapped' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "clearImmediateWrapped")) Module["clearImmediateWrapped"] = function() {
 abort("'clearImmediateWrapped' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "polyfillSetImmediate")) Module["polyfillSetImmediate"] = function() {
 abort("'polyfillSetImmediate' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "uncaughtExceptionCount")) Module["uncaughtExceptionCount"] = function() {
 abort("'uncaughtExceptionCount' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "exceptionLast")) Module["exceptionLast"] = function() {
 abort("'exceptionLast' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "exceptionCaught")) Module["exceptionCaught"] = function() {
 abort("'exceptionCaught' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "ExceptionInfo")) Module["ExceptionInfo"] = function() {
 abort("'ExceptionInfo' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "CatchInfo")) Module["CatchInfo"] = function() {
 abort("'CatchInfo' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "exception_addRef")) Module["exception_addRef"] = function() {
 abort("'exception_addRef' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "exception_decRef")) Module["exception_decRef"] = function() {
 abort("'exception_decRef' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "Browser")) Module["Browser"] = function() {
 abort("'Browser' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "funcWrappers")) Module["funcWrappers"] = function() {
 abort("'funcWrappers' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "getFuncWrapper")) Module["getFuncWrapper"] = function() {
 abort("'getFuncWrapper' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "setMainLoop")) Module["setMainLoop"] = function() {
 abort("'setMainLoop' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "wget")) Module["wget"] = function() {
 abort("'wget' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

Module["FS"] = FS;

if (!Object.getOwnPropertyDescriptor(Module, "MEMFS")) Module["MEMFS"] = function() {
 abort("'MEMFS' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "TTY")) Module["TTY"] = function() {
 abort("'TTY' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "PIPEFS")) Module["PIPEFS"] = function() {
 abort("'PIPEFS' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "SOCKFS")) Module["SOCKFS"] = function() {
 abort("'SOCKFS' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "_setNetworkCallback")) Module["_setNetworkCallback"] = function() {
 abort("'_setNetworkCallback' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "tempFixedLengthArray")) Module["tempFixedLengthArray"] = function() {
 abort("'tempFixedLengthArray' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "miniTempWebGLFloatBuffers")) Module["miniTempWebGLFloatBuffers"] = function() {
 abort("'miniTempWebGLFloatBuffers' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "heapObjectForWebGLType")) Module["heapObjectForWebGLType"] = function() {
 abort("'heapObjectForWebGLType' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "heapAccessShiftForWebGLHeap")) Module["heapAccessShiftForWebGLHeap"] = function() {
 abort("'heapAccessShiftForWebGLHeap' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "GL")) Module["GL"] = function() {
 abort("'GL' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "emscriptenWebGLGet")) Module["emscriptenWebGLGet"] = function() {
 abort("'emscriptenWebGLGet' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "computeUnpackAlignedImageSize")) Module["computeUnpackAlignedImageSize"] = function() {
 abort("'computeUnpackAlignedImageSize' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "emscriptenWebGLGetTexPixelData")) Module["emscriptenWebGLGetTexPixelData"] = function() {
 abort("'emscriptenWebGLGetTexPixelData' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "emscriptenWebGLGetUniform")) Module["emscriptenWebGLGetUniform"] = function() {
 abort("'emscriptenWebGLGetUniform' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "webglGetUniformLocation")) Module["webglGetUniformLocation"] = function() {
 abort("'webglGetUniformLocation' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "webglPrepareUniformLocationsBeforeFirstUse")) Module["webglPrepareUniformLocationsBeforeFirstUse"] = function() {
 abort("'webglPrepareUniformLocationsBeforeFirstUse' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "webglGetLeftBracePos")) Module["webglGetLeftBracePos"] = function() {
 abort("'webglGetLeftBracePos' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "emscriptenWebGLGetVertexAttrib")) Module["emscriptenWebGLGetVertexAttrib"] = function() {
 abort("'emscriptenWebGLGetVertexAttrib' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "writeGLArray")) Module["writeGLArray"] = function() {
 abort("'writeGLArray' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "AL")) Module["AL"] = function() {
 abort("'AL' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "SDL_unicode")) Module["SDL_unicode"] = function() {
 abort("'SDL_unicode' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "SDL_ttfContext")) Module["SDL_ttfContext"] = function() {
 abort("'SDL_ttfContext' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "SDL_audio")) Module["SDL_audio"] = function() {
 abort("'SDL_audio' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "SDL")) Module["SDL"] = function() {
 abort("'SDL' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "SDL_gfx")) Module["SDL_gfx"] = function() {
 abort("'SDL_gfx' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "GLUT")) Module["GLUT"] = function() {
 abort("'GLUT' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "EGL")) Module["EGL"] = function() {
 abort("'EGL' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "GLFW_Window")) Module["GLFW_Window"] = function() {
 abort("'GLFW_Window' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "GLFW")) Module["GLFW"] = function() {
 abort("'GLFW' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "GLEW")) Module["GLEW"] = function() {
 abort("'GLEW' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "IDBStore")) Module["IDBStore"] = function() {
 abort("'IDBStore' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "runAndAbortIfError")) Module["runAndAbortIfError"] = function() {
 abort("'runAndAbortIfError' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "emval_handle_array")) Module["emval_handle_array"] = function() {
 abort("'emval_handle_array' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "emval_free_list")) Module["emval_free_list"] = function() {
 abort("'emval_free_list' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "emval_symbols")) Module["emval_symbols"] = function() {
 abort("'emval_symbols' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "init_emval")) Module["init_emval"] = function() {
 abort("'init_emval' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "count_emval_handles")) Module["count_emval_handles"] = function() {
 abort("'count_emval_handles' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "get_first_emval")) Module["get_first_emval"] = function() {
 abort("'get_first_emval' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "getStringOrSymbol")) Module["getStringOrSymbol"] = function() {
 abort("'getStringOrSymbol' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "Emval")) Module["Emval"] = function() {
 abort("'Emval' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "emval_newers")) Module["emval_newers"] = function() {
 abort("'emval_newers' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "craftEmvalAllocator")) Module["craftEmvalAllocator"] = function() {
 abort("'craftEmvalAllocator' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "emval_get_global")) Module["emval_get_global"] = function() {
 abort("'emval_get_global' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "emval_methodCallers")) Module["emval_methodCallers"] = function() {
 abort("'emval_methodCallers' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "emval_registeredMethods")) Module["emval_registeredMethods"] = function() {
 abort("'emval_registeredMethods' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "InternalError")) Module["InternalError"] = function() {
 abort("'InternalError' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "BindingError")) Module["BindingError"] = function() {
 abort("'BindingError' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "UnboundTypeError")) Module["UnboundTypeError"] = function() {
 abort("'UnboundTypeError' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "PureVirtualError")) Module["PureVirtualError"] = function() {
 abort("'PureVirtualError' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "init_embind")) Module["init_embind"] = function() {
 abort("'init_embind' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "throwInternalError")) Module["throwInternalError"] = function() {
 abort("'throwInternalError' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "throwBindingError")) Module["throwBindingError"] = function() {
 abort("'throwBindingError' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "throwUnboundTypeError")) Module["throwUnboundTypeError"] = function() {
 abort("'throwUnboundTypeError' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "ensureOverloadTable")) Module["ensureOverloadTable"] = function() {
 abort("'ensureOverloadTable' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "exposePublicSymbol")) Module["exposePublicSymbol"] = function() {
 abort("'exposePublicSymbol' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "replacePublicSymbol")) Module["replacePublicSymbol"] = function() {
 abort("'replacePublicSymbol' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "extendError")) Module["extendError"] = function() {
 abort("'extendError' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "createNamedFunction")) Module["createNamedFunction"] = function() {
 abort("'createNamedFunction' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "registeredInstances")) Module["registeredInstances"] = function() {
 abort("'registeredInstances' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "getBasestPointer")) Module["getBasestPointer"] = function() {
 abort("'getBasestPointer' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "registerInheritedInstance")) Module["registerInheritedInstance"] = function() {
 abort("'registerInheritedInstance' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "unregisterInheritedInstance")) Module["unregisterInheritedInstance"] = function() {
 abort("'unregisterInheritedInstance' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "getInheritedInstance")) Module["getInheritedInstance"] = function() {
 abort("'getInheritedInstance' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "getInheritedInstanceCount")) Module["getInheritedInstanceCount"] = function() {
 abort("'getInheritedInstanceCount' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "getLiveInheritedInstances")) Module["getLiveInheritedInstances"] = function() {
 abort("'getLiveInheritedInstances' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "registeredTypes")) Module["registeredTypes"] = function() {
 abort("'registeredTypes' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "awaitingDependencies")) Module["awaitingDependencies"] = function() {
 abort("'awaitingDependencies' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "typeDependencies")) Module["typeDependencies"] = function() {
 abort("'typeDependencies' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "registeredPointers")) Module["registeredPointers"] = function() {
 abort("'registeredPointers' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "registerType")) Module["registerType"] = function() {
 abort("'registerType' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "whenDependentTypesAreResolved")) Module["whenDependentTypesAreResolved"] = function() {
 abort("'whenDependentTypesAreResolved' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "embind_charCodes")) Module["embind_charCodes"] = function() {
 abort("'embind_charCodes' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "embind_init_charCodes")) Module["embind_init_charCodes"] = function() {
 abort("'embind_init_charCodes' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "readLatin1String")) Module["readLatin1String"] = function() {
 abort("'readLatin1String' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "getTypeName")) Module["getTypeName"] = function() {
 abort("'getTypeName' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "heap32VectorToArray")) Module["heap32VectorToArray"] = function() {
 abort("'heap32VectorToArray' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "requireRegisteredType")) Module["requireRegisteredType"] = function() {
 abort("'requireRegisteredType' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "getShiftFromSize")) Module["getShiftFromSize"] = function() {
 abort("'getShiftFromSize' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "integerReadValueFromPointer")) Module["integerReadValueFromPointer"] = function() {
 abort("'integerReadValueFromPointer' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "enumReadValueFromPointer")) Module["enumReadValueFromPointer"] = function() {
 abort("'enumReadValueFromPointer' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "floatReadValueFromPointer")) Module["floatReadValueFromPointer"] = function() {
 abort("'floatReadValueFromPointer' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "simpleReadValueFromPointer")) Module["simpleReadValueFromPointer"] = function() {
 abort("'simpleReadValueFromPointer' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "runDestructors")) Module["runDestructors"] = function() {
 abort("'runDestructors' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "new_")) Module["new_"] = function() {
 abort("'new_' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "craftInvokerFunction")) Module["craftInvokerFunction"] = function() {
 abort("'craftInvokerFunction' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "embind__requireFunction")) Module["embind__requireFunction"] = function() {
 abort("'embind__requireFunction' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "tupleRegistrations")) Module["tupleRegistrations"] = function() {
 abort("'tupleRegistrations' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "structRegistrations")) Module["structRegistrations"] = function() {
 abort("'structRegistrations' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "genericPointerToWireType")) Module["genericPointerToWireType"] = function() {
 abort("'genericPointerToWireType' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "constNoSmartPtrRawPointerToWireType")) Module["constNoSmartPtrRawPointerToWireType"] = function() {
 abort("'constNoSmartPtrRawPointerToWireType' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "nonConstNoSmartPtrRawPointerToWireType")) Module["nonConstNoSmartPtrRawPointerToWireType"] = function() {
 abort("'nonConstNoSmartPtrRawPointerToWireType' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "init_RegisteredPointer")) Module["init_RegisteredPointer"] = function() {
 abort("'init_RegisteredPointer' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "RegisteredPointer")) Module["RegisteredPointer"] = function() {
 abort("'RegisteredPointer' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "RegisteredPointer_getPointee")) Module["RegisteredPointer_getPointee"] = function() {
 abort("'RegisteredPointer_getPointee' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "RegisteredPointer_destructor")) Module["RegisteredPointer_destructor"] = function() {
 abort("'RegisteredPointer_destructor' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "RegisteredPointer_deleteObject")) Module["RegisteredPointer_deleteObject"] = function() {
 abort("'RegisteredPointer_deleteObject' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "RegisteredPointer_fromWireType")) Module["RegisteredPointer_fromWireType"] = function() {
 abort("'RegisteredPointer_fromWireType' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "runDestructor")) Module["runDestructor"] = function() {
 abort("'runDestructor' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "releaseClassHandle")) Module["releaseClassHandle"] = function() {
 abort("'releaseClassHandle' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "finalizationGroup")) Module["finalizationGroup"] = function() {
 abort("'finalizationGroup' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "detachFinalizer_deps")) Module["detachFinalizer_deps"] = function() {
 abort("'detachFinalizer_deps' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "detachFinalizer")) Module["detachFinalizer"] = function() {
 abort("'detachFinalizer' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "attachFinalizer")) Module["attachFinalizer"] = function() {
 abort("'attachFinalizer' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "makeClassHandle")) Module["makeClassHandle"] = function() {
 abort("'makeClassHandle' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "init_ClassHandle")) Module["init_ClassHandle"] = function() {
 abort("'init_ClassHandle' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "ClassHandle")) Module["ClassHandle"] = function() {
 abort("'ClassHandle' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "ClassHandle_isAliasOf")) Module["ClassHandle_isAliasOf"] = function() {
 abort("'ClassHandle_isAliasOf' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "throwInstanceAlreadyDeleted")) Module["throwInstanceAlreadyDeleted"] = function() {
 abort("'throwInstanceAlreadyDeleted' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "ClassHandle_clone")) Module["ClassHandle_clone"] = function() {
 abort("'ClassHandle_clone' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "ClassHandle_delete")) Module["ClassHandle_delete"] = function() {
 abort("'ClassHandle_delete' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "deletionQueue")) Module["deletionQueue"] = function() {
 abort("'deletionQueue' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "ClassHandle_isDeleted")) Module["ClassHandle_isDeleted"] = function() {
 abort("'ClassHandle_isDeleted' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "ClassHandle_deleteLater")) Module["ClassHandle_deleteLater"] = function() {
 abort("'ClassHandle_deleteLater' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "flushPendingDeletes")) Module["flushPendingDeletes"] = function() {
 abort("'flushPendingDeletes' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "delayFunction")) Module["delayFunction"] = function() {
 abort("'delayFunction' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "setDelayFunction")) Module["setDelayFunction"] = function() {
 abort("'setDelayFunction' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "RegisteredClass")) Module["RegisteredClass"] = function() {
 abort("'RegisteredClass' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "shallowCopyInternalPointer")) Module["shallowCopyInternalPointer"] = function() {
 abort("'shallowCopyInternalPointer' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "downcastPointer")) Module["downcastPointer"] = function() {
 abort("'downcastPointer' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "upcastPointer")) Module["upcastPointer"] = function() {
 abort("'upcastPointer' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "validateThis")) Module["validateThis"] = function() {
 abort("'validateThis' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "char_0")) Module["char_0"] = function() {
 abort("'char_0' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "char_9")) Module["char_9"] = function() {
 abort("'char_9' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "makeLegalFunctionName")) Module["makeLegalFunctionName"] = function() {
 abort("'makeLegalFunctionName' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "warnOnce")) Module["warnOnce"] = function() {
 abort("'warnOnce' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "stackSave")) Module["stackSave"] = function() {
 abort("'stackSave' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "stackRestore")) Module["stackRestore"] = function() {
 abort("'stackRestore' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "stackAlloc")) Module["stackAlloc"] = function() {
 abort("'stackAlloc' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "AsciiToString")) Module["AsciiToString"] = function() {
 abort("'AsciiToString' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "stringToAscii")) Module["stringToAscii"] = function() {
 abort("'stringToAscii' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "UTF16ToString")) Module["UTF16ToString"] = function() {
 abort("'UTF16ToString' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "stringToUTF16")) Module["stringToUTF16"] = function() {
 abort("'stringToUTF16' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "lengthBytesUTF16")) Module["lengthBytesUTF16"] = function() {
 abort("'lengthBytesUTF16' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "UTF32ToString")) Module["UTF32ToString"] = function() {
 abort("'UTF32ToString' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "stringToUTF32")) Module["stringToUTF32"] = function() {
 abort("'stringToUTF32' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "lengthBytesUTF32")) Module["lengthBytesUTF32"] = function() {
 abort("'lengthBytesUTF32' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "allocateUTF8")) Module["allocateUTF8"] = function() {
 abort("'allocateUTF8' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

if (!Object.getOwnPropertyDescriptor(Module, "allocateUTF8OnStack")) Module["allocateUTF8OnStack"] = function() {
 abort("'allocateUTF8OnStack' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
};

Module["writeStackCookie"] = writeStackCookie;

Module["checkStackCookie"] = checkStackCookie;

if (!Object.getOwnPropertyDescriptor(Module, "ALLOC_NORMAL")) Object.defineProperty(Module, "ALLOC_NORMAL", {
 configurable: true,
 get: function() {
  abort("'ALLOC_NORMAL' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
 }
});

if (!Object.getOwnPropertyDescriptor(Module, "ALLOC_STACK")) Object.defineProperty(Module, "ALLOC_STACK", {
 configurable: true,
 get: function() {
  abort("'ALLOC_STACK' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)");
 }
});

var calledRun;

function ExitStatus(status) {
 this.name = "ExitStatus";
 this.message = "Program terminated with exit(" + status + ")";
 this.status = status;
}

var calledMain = false;

dependenciesFulfilled = function runCaller() {
 if (!calledRun) run();
 if (!calledRun) dependenciesFulfilled = runCaller;
};

function stackCheckInit() {
 _emscripten_stack_init();
 writeStackCookie();
}

function run(args) {
 args = args || arguments_;
 if (runDependencies > 0) {
  return;
 }
 stackCheckInit();
 preRun();
 if (runDependencies > 0) {
  return;
 }
 function doRun() {
  if (calledRun) return;
  calledRun = true;
  Module["calledRun"] = true;
  if (ABORT) return;
  initRuntime();
  readyPromiseResolve(Module);
  if (Module["onRuntimeInitialized"]) Module["onRuntimeInitialized"]();
  assert(!Module["_main"], 'compiled without a main, but one is present. if you added it from JS, use Module["onRuntimeInitialized"]');
  postRun();
 }
 if (Module["setStatus"]) {
  Module["setStatus"]("Running...");
  setTimeout(function() {
   setTimeout(function() {
    Module["setStatus"]("");
   }, 1);
   doRun();
  }, 1);
 } else {
  doRun();
 }
 checkStackCookie();
}

Module["run"] = run;

function checkUnflushedContent() {
 var oldOut = out;
 var oldErr = err;
 var has = false;
 out = err = function(x) {
  has = true;
 };
 try {
  var flush = Module["_fflush"];
  if (flush) flush(0);
  [ "stdout", "stderr" ].forEach(function(name) {
   var info = FS.analyzePath("/dev/" + name);
   if (!info) return;
   var stream = info.object;
   var rdev = stream.rdev;
   var tty = TTY.ttys[rdev];
   if (tty && tty.output && tty.output.length) {
    has = true;
   }
  });
 } catch (e) {}
 out = oldOut;
 err = oldErr;
 if (has) {
  warnOnce("stdio streams had content in them that was not flushed. you should set EXIT_RUNTIME to 1 (see the FAQ), or make sure to emit a newline when you printf etc.");
 }
}

function exit(status, implicit) {
 EXITSTATUS = status;
 checkUnflushedContent();
 if (keepRuntimeAlive()) {
  if (!implicit) {
   var msg = "program exited (with status: " + status + "), but EXIT_RUNTIME is not set, so halting execution but not exiting the runtime or preventing further async execution (build with EXIT_RUNTIME=1, if you want a true shutdown)";
   readyPromiseReject(msg);
   err(msg);
  }
 } else {
  exitRuntime();
 }
 procExit(status);
}

function procExit(code) {
 EXITSTATUS = code;
 if (!keepRuntimeAlive()) {
  if (Module["onExit"]) Module["onExit"](code);
  ABORT = true;
 }
 quit_(code, new ExitStatus(code));
}

if (Module["preInit"]) {
 if (typeof Module["preInit"] == "function") Module["preInit"] = [ Module["preInit"] ];
 while (Module["preInit"].length > 0) {
  Module["preInit"].pop()();
 }
}

run();


  return FesapiModule.ready
}
);
})();
export default FesapiModule;